summaryrefslogtreecommitdiff
diff options
context:
space:
mode:
-rw-r--r--community-testing/balsa/PKGBUILD47
-rw-r--r--community-testing/balsa/balsa.install12
-rw-r--r--community-testing/balsa/gmime26.patch1372
-rw-r--r--community-testing/pinot/PKGBUILD50
-rw-r--r--community-testing/pinot/pinot.changelog2
-rw-r--r--community-testing/pinot/pinot.install15
-rw-r--r--community/linux-tools/PKGBUILD27
-rw-r--r--community/linux-tools/cpupower.conf28
-rw-r--r--community/linux-tools/cpupower.rc32
-rw-r--r--community/linux-tools/cpupower.service10
-rw-r--r--community/percona-server/PKGBUILD6
-rw-r--r--community/redis/PKGBUILD6
-rw-r--r--extra/gjs/PKGBUILD15
-rw-r--r--extra/libreoffice/PKGBUILD68
-rw-r--r--extra/qtwebkit/PKGBUILD14
-rw-r--r--extra/ristretto/PKGBUILD6
-rw-r--r--multilib-staging/binutils-multilib/PKGBUILD79
-rw-r--r--multilib-staging/binutils-multilib/binutils.install17
-rw-r--r--multilib-staging/chuck/PKGBUILD41
-rw-r--r--multilib-staging/gcc-multilib/PKGBUILD303
-rw-r--r--multilib-staging/gcc-multilib/gcc-ada.install20
-rw-r--r--multilib-staging/gcc-multilib/gcc-fortran.install16
-rw-r--r--multilib-staging/gcc-multilib/gcc-go.install20
-rw-r--r--multilib-staging/gcc-multilib/gcc-hash-style-both.patch122
-rw-r--r--multilib-staging/gcc-multilib/gcc-libs.install16
-rw-r--r--multilib-staging/gcc-multilib/gcc.install20
-rw-r--r--multilib-staging/gcc-multilib/gcc_pure64-multilib.patch24
-rw-r--r--multilib-staging/jack2-multilib/40-hpet-permissions.rules2
-rw-r--r--multilib-staging/jack2-multilib/99-audio.conf2
-rw-r--r--multilib-staging/jack2-multilib/PKGBUILD142
-rw-r--r--multilib-staging/lib32-gdk-pixbuf2/PKGBUILD45
-rw-r--r--multilib-staging/lib32-gdk-pixbuf2/gdk-pixbuf2.install11
-rw-r--r--multilib-staging/lib32-glib2/PKGBUILD40
-rw-r--r--multilib-staging/lib32-glibc/PKGBUILD176
-rw-r--r--multilib-staging/lib32-glibc/glibc-2.10-bz4781.patch42
-rw-r--r--multilib-staging/lib32-glibc/glibc-2.10-dont-build-timezone.patch13
-rw-r--r--multilib-staging/lib32-glibc/glibc-2.12.2-ignore-origin-of-privileged-program.patch26
-rw-r--r--multilib-staging/lib32-glibc/glibc-2.14-libdl-crash.patch132
-rw-r--r--multilib-staging/lib32-glibc/glibc-2.14-reexport-rpc-interface.patch26
-rw-r--r--multilib-staging/lib32-glibc/glibc-2.14-reinstall-nis-rpc-headers.patch28
-rw-r--r--multilib-staging/lib32-glibc/glibc-2.14-revert-4768ae77.patch37
-rw-r--r--multilib-staging/lib32-glibc/glibc-2.15-lddebug-scopes.patch27
-rw-r--r--multilib-staging/lib32-glibc/glibc-2.15-math64crash.patch184
-rw-r--r--multilib-staging/lib32-glibc/glibc-2.15-revert-c5a0802a.patch229
-rw-r--r--multilib-staging/lib32-glibc/glibc-__i686.patch13
-rw-r--r--multilib-staging/lib32-glibc/lib32-glibc.conf1
-rw-r--r--multilib-staging/lib32-gtk2/PKGBUILD57
-rw-r--r--multilib-staging/lib32-gtk2/gtk-modules-32.patch12
-rw-r--r--multilib-staging/lib32-gtk2/gtk2.install16
-rw-r--r--multilib-staging/lib32-gtk2/xid-collision-debug.patch15
-rw-r--r--multilib-staging/lib32-pango/PKGBUILD44
-rw-r--r--multilib-staging/lib32-pango/pango-modules-conffile.patch20
-rw-r--r--multilib-staging/lib32-pango/pango.install21
-rw-r--r--multilib-staging/libtool-multilib/PKGBUILD73
-rw-r--r--multilib-staging/libtool-multilib/libtool.install22
-rw-r--r--testing/gmime/PKGBUILD32
-rw-r--r--testing/grilo-plugins/PKGBUILD39
-rw-r--r--testing/mail-notification/PKGBUILD85
-rw-r--r--testing/mail-notification/dont-update-cache.patch22
-rw-r--r--testing/mail-notification/mail-notification-5.4-add-fallback-icon.patch16
-rw-r--r--testing/mail-notification/mail-notification-5.4-camel_headers.patch36
-rw-r--r--testing/mail-notification/mail-notification-5.4-evolution-3-0-support.patch122
-rw-r--r--testing/mail-notification/mail-notification-5.4-evolution-gtkhtml.patch12
-rw-r--r--testing/mail-notification/mail-notification-5.4-evolution.patch244
-rw-r--r--testing/mail-notification/mail-notification-5.4-gmime.patch63
-rw-r--r--testing/mail-notification/mail-notification-5.4-gtk3-support.patch1416
-rw-r--r--testing/mail-notification/mail-notification-5.4-icons.patch39
-rw-r--r--testing/mail-notification/mail-notification-5.4-kde-trayicon.patch72
-rw-r--r--testing/mail-notification/mail-notification-5.4-libx11.patch13
-rw-r--r--testing/mail-notification/mail-notification-5.4-popup-attach.patch45
-rw-r--r--testing/mail-notification/mail-notification-5.4-sasl_encode64.patch24
-rw-r--r--testing/mail-notification/mail-notification-5.4-weak.patch11
-rw-r--r--testing/mail-notification/mail-notification.install24
-rw-r--r--testing/mail-notification/remove-ubuntu-special-case.patch33
-rw-r--r--testing/systemd/0001-tmpfiles-fix-parsing-of-proc-net-unix-on-32Bit-machi.patch87
-rw-r--r--testing/systemd/0001-units-make-sure-syslog-socket-goes-away-early-during.patch26
-rw-r--r--testing/systemd/PKGBUILD21
-rw-r--r--testing/totem-plparser/PKGBUILD6
78 files changed, 6236 insertions, 96 deletions
diff --git a/community-testing/balsa/PKGBUILD b/community-testing/balsa/PKGBUILD
new file mode 100644
index 000000000..43eae5357
--- /dev/null
+++ b/community-testing/balsa/PKGBUILD
@@ -0,0 +1,47 @@
+# $Id: PKGBUILD 62015 2012-01-14 12:24:56Z ibiru $
+# Maintainer : Ionut Biru <ibiru@archlinux.org>
+# Maintainer: Brad Fanella <bradfanella@archlinux.us>
+# Contributor: Roman Kyrylych <roman@archlinux.org>
+
+pkgname=balsa
+pkgver=2.4.11
+pkgrel=1
+pkgdesc="An e-mail client for GNOME"
+arch=('i686' 'x86_64')
+license=('GPL')
+url='http://pawsa.fedorapeople.org/balsa/'
+depends=('gmime' 'libwebkit' 'libesmtp' 'libnotify' 'gpgme' 'gtksourceview2' 'gtkspell' 'gnome-icon-theme' 'desktop-file-utils')
+makedepends=('perlxml' 'gnome-doc-utils' 'intltool')
+install=balsa.install
+source=(http://pawsa.fedorapeople.org/${pkgname}/${pkgname}-${pkgver}.tar.bz2
+ gmime26.patch)
+md5sums=('915c622b6385aa4f83d5eee8f31ee8e8'
+ '108d33f533558a371189441edce7d7e6')
+
+build() {
+ cd "${srcdir}/${pkgname}-${pkgver}"
+
+ patch -Np1 -i "${srcdir}/gmime26.patch"
+ autoreconf -fi
+
+ ./configure --prefix=/usr \
+ --sysconfdir=/etc \
+ --localstatedir=/var \
+ --with-ssl \
+ --with-gpgme=gpgme-config \
+ --with-gss \
+ --with-ldap \
+ --with-gtksourceview \
+ --with-gtkspell \
+ --with-rubrica \
+ --with-sqlite \
+ --without-nm \
+ --without-gnome \
+ --with-html-widget=webkit
+ make
+}
+
+package() {
+ cd "${srcdir}/${pkgname}-${pkgver}"
+ make GTK_UPDATE_ICON_CACHE=/bin/true DESTDIR="${pkgdir}" install
+}
diff --git a/community-testing/balsa/balsa.install b/community-testing/balsa/balsa.install
new file mode 100644
index 000000000..1f167b5e9
--- /dev/null
+++ b/community-testing/balsa/balsa.install
@@ -0,0 +1,12 @@
+post_install() {
+ gtk-update-icon-cache -q -t -f /usr/share/icons/hicolor
+ update-desktop-database -q
+}
+
+post_upgrade() {
+ post_install $1
+}
+
+post_remove() {
+ post_install $1
+}
diff --git a/community-testing/balsa/gmime26.patch b/community-testing/balsa/gmime26.patch
new file mode 100644
index 000000000..fe4e6a9fa
--- /dev/null
+++ b/community-testing/balsa/gmime26.patch
@@ -0,0 +1,1372 @@
+From 393d0077495cb750ee47bab6ec44a60906a95179 Mon Sep 17 00:00:00 2001
+From: Peter Bloomfield <PeterBloomfield@bellsouth.net>
+Date: Mon, 28 Nov 2011 03:00:55 +0000
+Subject: Build with GMime 2.6.0
+
+ * configure.in: check for GMime >= 2.5.7
+ * libbalsa/gmime-application-pkcs7.c
+ (g_mime_application_pkcs7_sign), (g_mime_application_pkcs7_verify),
+ (g_mime_application_pkcs7_encrypt),
+ (g_mime_application_pkcs7_decrypt): build with GMime >= 2.5.7.
+ * libbalsa/gmime-application-pkcs7.h: ditto.
+ * libbalsa/gmime-gpgme-context.c (g_mime_gpgme_context_get_type),
+ (g_mime_gpgme_context_class_init), (g_mime_gpgme_context_finalize),
+ (g_mime_gpgme_digest_id): ditto.
+ * libbalsa/gmime-gpgme-context.h: ditto.
+ * libbalsa/gmime-part-rfc2440.c (g_mime_part_rfc2440_sign_encrypt),
+ (g_mime_part_rfc2440_verify), (g_mime_part_rfc2440_decrypt):
+ ditto.
+ * libbalsa/gmime-part-rfc2440.h: ditto.
+ * libbalsa/rfc3156.c (password_request_func),
+ (libbalsa_sign_mime_object), (libbalsa_encrypt_mime_object),
+ (libbalsa_body_check_signature), (libbalsa_body_decrypt): ditto.
+---
+diff --git a/ChangeLog b/ChangeLog
+index bd95e68..d5c62f5 100644
+--- a/ChangeLog
++++ b/ChangeLog
+@@ -1,3 +1,25 @@
++2011-11-27 Peter Bloomfield
++
++ Build with GMime 2.6.0
++
++ * configure.in: check for GMime >= 2.5.7
++ * libbalsa/gmime-application-pkcs7.c
++ (g_mime_application_pkcs7_sign), (g_mime_application_pkcs7_verify),
++ (g_mime_application_pkcs7_encrypt),
++ (g_mime_application_pkcs7_decrypt): build with GMime >= 2.5.7.
++ * libbalsa/gmime-application-pkcs7.h: ditto.
++ * libbalsa/gmime-gpgme-context.c (g_mime_gpgme_context_get_type),
++ (g_mime_gpgme_context_class_init), (g_mime_gpgme_context_finalize),
++ (g_mime_gpgme_digest_id): ditto.
++ * libbalsa/gmime-gpgme-context.h: ditto.
++ * libbalsa/gmime-part-rfc2440.c (g_mime_part_rfc2440_sign_encrypt),
++ (g_mime_part_rfc2440_verify), (g_mime_part_rfc2440_decrypt):
++ ditto.
++ * libbalsa/gmime-part-rfc2440.h: ditto.
++ * libbalsa/rfc3156.c (password_request_func),
++ (libbalsa_sign_mime_object), (libbalsa_encrypt_mime_object),
++ (libbalsa_body_check_signature), (libbalsa_body_decrypt): ditto.
++
+ 2011-11-22 Pawel Salek
+
+ * NEWS, configure.in: release balsa-2.4.11
+diff --git a/configure.in b/configure.in
+index 4a8320e..64d99f3 100644
+--- a/configure.in
++++ b/configure.in
+@@ -307,7 +307,12 @@ fi
+ case "$with_gmime" in
+ 2.4) ;;
+ 2.6) AC_DEFINE([HAVE_GMIME_2_6], [1],
+- [Defined to build with GMime version 2.5 or 2.6]) ;;
++ [Defined to build with GMime version 2.5 or 2.6])
++ if $PKG_CONFIG --atleast-version=2.5.7 gmime-2.6; then
++ AC_DEFINE([HAVE_GMIME_2_5_7], [1],
++ [Defined when GMime version is at least 2.5.7])
++ fi
++ ;;
+ *) AC_MSG_ERROR([unknown GMime version $with_gmime]) ;;
+ esac
+
+diff --git a/libbalsa/gmime-application-pkcs7.c b/libbalsa/gmime-application-pkcs7.c
+index 12f4f8f..63b8087 100644
+--- a/libbalsa/gmime-application-pkcs7.c
++++ b/libbalsa/gmime-application-pkcs7.c
+@@ -96,8 +96,14 @@ g_mime_application_pkcs7_sign (GMimePart *pkcs7, GMimeObject *content,
+ GMimeFilter *crlf_filter, *from_filter;
+
+ g_return_val_if_fail (GMIME_IS_PART (pkcs7), -1);
++#ifndef HAVE_GMIME_2_5_7
+ g_return_val_if_fail (GMIME_IS_CIPHER_CONTEXT (ctx), -1);
+ g_return_val_if_fail (ctx->sign_protocol != NULL, -1);
++#else /* HAVE_GMIME_2_5_7 */
++ g_return_val_if_fail (GMIME_IS_CRYPTO_CONTEXT (ctx), -1);
++ g_return_val_if_fail(g_mime_crypto_context_get_signature_protocol(ctx)
++ != NULL, -1);
++#endif /* HAVE_GMIME_2_5_7 */
+ g_return_val_if_fail (GMIME_IS_OBJECT (content), -1);
+
+ /* Prepare all the parts for signing... */
+@@ -127,7 +133,14 @@ g_mime_application_pkcs7_sign (GMimePart *pkcs7, GMimeObject *content,
+ sig_data_stream = g_mime_stream_mem_new ();
+
+ /* get the signed content */
+- if (g_mime_cipher_context_sign (ctx, userid, GMIME_CIPHER_HASH_DEFAULT, filtered_stream, sig_data_stream, err) == -1) {
++#ifndef HAVE_GMIME_2_5_7
++ if (g_mime_cipher_context_sign (ctx, userid, GMIME_CIPHER_HASH_DEFAULT, filtered_stream, sig_data_stream, err) == -1)
++#else /* HAVE_GMIME_2_5_7 */
++ if (g_mime_crypto_context_sign
++ (ctx, userid, GMIME_CIPHER_HASH_DEFAULT, filtered_stream,
++ sig_data_stream, err) == -1)
++#endif /* HAVE_GMIME_2_5_7 */
++ {
+ g_object_unref (filtered_stream);
+ g_object_unref (sig_data_stream);
+ g_object_unref (stream);
+@@ -168,9 +181,15 @@ g_mime_application_pkcs7_sign (GMimePart *pkcs7, GMimeObject *content,
+ * decrypting it again. In this case, validity is undefined.
+ */
+ GMimeObject *
++#ifndef HAVE_GMIME_2_5_7
+ g_mime_application_pkcs7_verify(GMimePart * pkcs7,
+ GMimeSignatureValidity ** validity,
+ GMimeCipherContext * ctx, GError ** err)
++#else /* HAVE_GMIME_2_5_7 */
++g_mime_application_pkcs7_verify(GMimePart * pkcs7,
++ GMimeSignatureList ** list,
++ GMimeCryptoContext * ctx, GError ** err)
++#endif /* HAVE_GMIME_2_5_7 */
+ {
+ GMimeObject *decrypted;
+ GMimeDataWrapper *wrapper;
+@@ -181,8 +200,14 @@ g_mime_application_pkcs7_verify(GMimePart * pkcs7,
+ const char *smime_type;
+
+ g_return_val_if_fail(GMIME_IS_PART(pkcs7), NULL);
++#ifndef HAVE_GMIME_2_5_7
+ g_return_val_if_fail(GMIME_IS_CIPHER_CONTEXT(ctx), NULL);
+ g_return_val_if_fail(ctx->encrypt_protocol != NULL, NULL);
++#else /* HAVE_GMIME_2_5_7 */
++ g_return_val_if_fail(GMIME_IS_CRYPTO_CONTEXT(ctx), NULL);
++ g_return_val_if_fail(g_mime_crypto_context_get_encryption_protocol(ctx)
++ != NULL, NULL);
++#endif /* HAVE_GMIME_2_5_7 */
+
+ /* some sanity checks */
+ smime_type =
+@@ -208,9 +233,16 @@ g_mime_application_pkcs7_verify(GMimePart * pkcs7,
+ g_object_unref(crlf_filter);
+
+ /* get the cleartext */
++#ifndef HAVE_GMIME_2_5_7
+ *validity = g_mime_cipher_context_verify(ctx, GMIME_CIPHER_HASH_DEFAULT,
+ ciphertext, filtered_stream, err);
+- if (!*validity) {
++ if (!*validity)
++#else /* HAVE_GMIME_2_5_7 */
++ *list = g_mime_crypto_context_verify(ctx, GMIME_CIPHER_ALGO_DEFAULT,
++ ciphertext, filtered_stream, err);
++ if (!*list)
++#endif /* HAVE_GMIME_2_5_7 */
++ {
+ g_object_unref(filtered_stream);
+ g_object_unref(ciphertext);
+ g_object_unref(stream);
+@@ -248,7 +280,12 @@ g_mime_application_pkcs7_verify(GMimePart * pkcs7,
+ */
+ int
+ g_mime_application_pkcs7_encrypt (GMimePart *pkcs7, GMimeObject *content,
++#ifndef HAVE_GMIME_2_5_7
+ GMimeCipherContext *ctx, GPtrArray *recipients,
++#else /* HAVE_GMIME_2_5_7 */
++ GMimeCryptoContext *ctx,
++ GPtrArray *recipients,
++#endif /* HAVE_GMIME_2_5_7 */
+ GError **err)
+ {
+ GMimeDataWrapper *wrapper;
+@@ -257,8 +294,14 @@ g_mime_application_pkcs7_encrypt (GMimePart *pkcs7, GMimeObject *content,
+ GMimeFilter *crlf_filter;
+
+ g_return_val_if_fail (GMIME_IS_PART (pkcs7), -1);
++#ifndef HAVE_GMIME_2_5_7
+ g_return_val_if_fail (GMIME_IS_CIPHER_CONTEXT (ctx), -1);
+ g_return_val_if_fail (ctx->encrypt_protocol != NULL, -1);
++#else /* HAVE_GMIME_2_5_7 */
++ g_return_val_if_fail (GMIME_IS_CRYPTO_CONTEXT (ctx), -1);
++ g_return_val_if_fail(g_mime_crypto_context_get_encryption_protocol(ctx)
++ != NULL, -1);
++#endif /* HAVE_GMIME_2_5_7 */
+ g_return_val_if_fail (GMIME_IS_OBJECT (content), -1);
+
+ /* get the cleartext */
+@@ -279,7 +322,15 @@ g_mime_application_pkcs7_encrypt (GMimePart *pkcs7, GMimeObject *content,
+
+ /* encrypt the content stream */
+ ciphertext = g_mime_stream_mem_new ();
+- if (g_mime_cipher_context_encrypt (ctx, FALSE, NULL, recipients, stream, ciphertext, err) == -1) {
++#ifndef HAVE_GMIME_2_5_7
++ if (g_mime_cipher_context_encrypt (ctx, FALSE, NULL, recipients, stream, ciphertext, err) == -1)
++#else /* HAVE_GMIME_2_5_7 */
++ if (g_mime_crypto_context_encrypt
++ (ctx, FALSE, NULL,
++ GMIME_CIPHER_ALGO_DEFAULT,
++ recipients, stream, ciphertext, err) == -1)
++#endif /* HAVE_GMIME_2_5_7 */
++ {
+ g_object_unref (ciphertext);
+ g_object_unref (stream);
+ return -1;
+@@ -313,8 +364,14 @@ g_mime_application_pkcs7_encrypt (GMimePart *pkcs7, GMimeObject *content,
+ * err with more information about the reason.
+ */
+ GMimeObject *
++#ifndef HAVE_GMIME_2_5_7
+ g_mime_application_pkcs7_decrypt (GMimePart *pkcs7, GMimeCipherContext *ctx,
+ GError **err)
++#else /* HAVE_GMIME_2_5_7 */
++g_mime_application_pkcs7_decrypt (GMimePart *pkcs7,
++ GMimeCryptoContext *ctx,
++ GError **err)
++#endif /* HAVE_GMIME_2_5_7 */
+ {
+ GMimeObject *decrypted;
+ GMimeDataWrapper *wrapper;
+@@ -325,8 +382,14 @@ g_mime_application_pkcs7_decrypt (GMimePart *pkcs7, GMimeCipherContext *ctx,
+ const char *smime_type;
+
+ g_return_val_if_fail(GMIME_IS_PART(pkcs7), NULL);
++#ifndef HAVE_GMIME_2_5_7
+ g_return_val_if_fail(GMIME_IS_CIPHER_CONTEXT(ctx), NULL);
+ g_return_val_if_fail(ctx->encrypt_protocol != NULL, NULL);
++#else /* HAVE_GMIME_2_5_7 */
++ g_return_val_if_fail(GMIME_IS_CRYPTO_CONTEXT(ctx), NULL);
++ g_return_val_if_fail(g_mime_crypto_context_get_encryption_protocol(ctx)
++ != NULL, NULL);
++#endif /* HAVE_GMIME_2_5_7 */
+
+ /* some sanity checks */
+ smime_type =
+@@ -353,7 +416,13 @@ g_mime_application_pkcs7_decrypt (GMimePart *pkcs7, GMimeCipherContext *ctx,
+ g_object_unref(crlf_filter);
+
+ /* get the cleartext */
+- if (g_mime_cipher_context_decrypt(ctx, ciphertext, filtered_stream, err) == NULL) {
++#ifndef HAVE_GMIME_2_5_7
++ if (g_mime_cipher_context_decrypt(ctx, ciphertext, filtered_stream, err) == NULL)
++#else /* HAVE_GMIME_2_5_7 */
++ if (g_mime_crypto_context_decrypt
++ (ctx, ciphertext, filtered_stream, err) == NULL)
++#endif /* HAVE_GMIME_2_5_7 */
++ {
+ g_object_unref(filtered_stream);
+ g_object_unref(ciphertext);
+ g_object_unref(stream);
+diff --git a/libbalsa/gmime-application-pkcs7.h b/libbalsa/gmime-application-pkcs7.h
+index 03fa401..6678ff5 100644
+--- a/libbalsa/gmime-application-pkcs7.h
++++ b/libbalsa/gmime-application-pkcs7.h
+@@ -28,7 +28,11 @@ extern "C" {
+ #endif /* __cplusplus */
+
+ #include <gmime/gmime-part.h>
++#ifndef HAVE_GMIME_2_5_7
+ #include <gmime/gmime-cipher-context.h>
++#else /* HAVE_GMIME_2_5_7 */
++#include <gmime/gmime-crypto-context.h>
++#endif /* HAVE_GMIME_2_5_7 */
+
+ #undef HAS_APPLICATION_PKCS7_MIME_SIGNED_SUPPORT
+
+@@ -39,21 +43,40 @@ extern "C" {
+ * Balsa always encodes S/MIME signed stuff as multipart/signed. */
+ int g_mime_application_pkcs7_sign(GMimePart * pkcs7,
+ GMimeObject * content,
++#ifndef HAVE_GMIME_2_5_7
+ GMimeCipherContext * ctx,
++#else /* HAVE_GMIME_2_5_7 */
++ GMimeCryptoContext * ctx,
++#endif /* HAVE_GMIME_2_5_7 */
+ const char *userid, GError ** err);
+ #endif
+
++#ifndef HAVE_GMIME_2_5_7
+ GMimeObject *g_mime_application_pkcs7_verify(GMimePart * pkcs7,
+ GMimeSignatureValidity ** validity,
+ GMimeCipherContext * ctx, GError ** err);
++#else /* HAVE_GMIME_2_5_7 */
++GMimeObject *g_mime_application_pkcs7_verify(GMimePart * pkcs7,
++ GMimeSignatureList ** validity,
++ GMimeCryptoContext * ctx, GError ** err);
++#endif /* HAVE_GMIME_2_5_7 */
+
+ int g_mime_application_pkcs7_encrypt(GMimePart * pkcs7,
+ GMimeObject * content,
++#ifndef HAVE_GMIME_2_5_7
+ GMimeCipherContext * ctx,
++#else /* HAVE_GMIME_2_5_7 */
++ GMimeCryptoContext * ctx,
++#endif /* HAVE_GMIME_2_5_7 */
+ GPtrArray * recipients, GError ** err);
+
++#ifndef HAVE_GMIME_2_5_7
+ GMimeObject *g_mime_application_pkcs7_decrypt(GMimePart * pkcs7,
+ GMimeCipherContext * ctx, GError ** err);
++#else /* HAVE_GMIME_2_5_7 */
++GMimeObject *g_mime_application_pkcs7_decrypt(GMimePart * pkcs7,
++ GMimeCryptoContext * ctx, GError ** err);
++#endif /* HAVE_GMIME_2_5_7 */
+
+ #ifdef __cplusplus
+ }
+diff --git a/libbalsa/gmime-gpgme-context.c b/libbalsa/gmime-gpgme-context.c
+index 24b140b..0c56f94 100644
+--- a/libbalsa/gmime-gpgme-context.c
++++ b/libbalsa/gmime-gpgme-context.c
+@@ -27,6 +27,9 @@
+ #include <unistd.h>
+ #include <glib.h>
+ #include <gmime/gmime.h>
++#ifdef HAVE_GMIME_2_5_7
++#include <gmime/gmime-certificate.h>
++#endif /* HAVE_GMIME_2_5_7 */
+ #include <gpgme.h>
+ #include <time.h>
+ #include <glib/gi18n.h>
+@@ -44,6 +47,7 @@ static gboolean g_mime_gpgme_context_check_protocol(GMimeGpgmeContextClass
+ protocol,
+ GError ** error);
+
++#ifndef HAVE_GMIME_2_5_7
+ static GMimeCipherHash g_mime_gpgme_hash_id(GMimeCipherContext * ctx,
+ const char *hash);
+
+@@ -70,6 +74,46 @@ static GMimeSignatureValidity *g_mime_gpgme_decrypt(GMimeCipherContext *
+ GMimeStream * istream,
+ GMimeStream * ostream,
+ GError ** err);
++#else /* HAVE_GMIME_2_5_7 */
++static GMimeDigestAlgo g_mime_gpgme_digest_id(GMimeCryptoContext * ctx,
++ const char *hash);
++
++static const char *g_mime_gpgme_digest_name(GMimeCryptoContext * ctx,
++ GMimeDigestAlgo hash);
++
++static const char
++ *g_mime_gpgme_get_signature_protocol(GMimeCryptoContext * context);
++static const char
++ *g_mime_gpgme_get_encryption_protocol(GMimeCryptoContext * context);
++static const char
++ *g_mime_gpgme_get_key_exchange_protocol(GMimeCryptoContext * context);
++
++static int g_mime_gpgme_sign(GMimeCryptoContext * ctx,
++ const char * userid,
++ GMimeDigestAlgo hash,
++ GMimeStream * istream,
++ GMimeStream * ostream,
++ GError ** err);
++
++static GMimeSignatureList *g_mime_gpgme_verify(GMimeCryptoContext * ctx,
++ GMimeDigestAlgo hash,
++ GMimeStream * istream,
++ GMimeStream * sigstream,
++ GError ** err);
++
++static int g_mime_gpgme_encrypt(GMimeCryptoContext * ctx,
++ gboolean sign,
++ const char *userid,
++ GMimeDigestAlgo digest,
++ GPtrArray * recipients,
++ GMimeStream * istream,
++ GMimeStream * ostream, GError ** err);
++
++static GMimeDecryptResult *g_mime_gpgme_decrypt(GMimeCryptoContext * ctx,
++ GMimeStream * istream,
++ GMimeStream * ostream,
++ GError ** err);
++#endif /* HAVE_GMIME_2_5_7 */
+
+
+ /* internal passphrase callback */
+@@ -102,7 +146,11 @@ static void g_set_error_from_gpgme(GError ** error, gpgme_error_t gpgme_err,
+ const gchar * message);
+
+
++#ifndef HAVE_GMIME_2_5_7
+ static GMimeCipherContextClass *parent_class = NULL;
++#else /* HAVE_GMIME_2_5_7 */
++static GMimeCryptoContextClass *parent_class = NULL;
++#endif /* HAVE_GMIME_2_5_7 */
+
+
+ GType
+@@ -124,8 +172,13 @@ g_mime_gpgme_context_get_type(void)
+ };
+
+ type =
++#ifndef HAVE_GMIME_2_5_7
+ g_type_register_static(GMIME_TYPE_CIPHER_CONTEXT,
+ "GMimeGpgmeContext", &info, 0);
++#else /* HAVE_GMIME_2_5_7 */
++ g_type_register_static(GMIME_TYPE_CRYPTO_CONTEXT,
++ "GMimeGpgmeContext", &info, 0);
++#endif /* HAVE_GMIME_2_5_7 */
+ }
+
+ return type;
+@@ -136,19 +189,39 @@ static void
+ g_mime_gpgme_context_class_init(GMimeGpgmeContextClass * klass)
+ {
+ GObjectClass *object_class = G_OBJECT_CLASS(klass);
++#ifndef HAVE_GMIME_2_5_7
+ GMimeCipherContextClass *cipher_class =
+ GMIME_CIPHER_CONTEXT_CLASS(klass);
++#else /* HAVE_GMIME_2_5_7 */
++ GMimeCryptoContextClass *crypto_class =
++ GMIME_CRYPTO_CONTEXT_CLASS(klass);
++#endif /* HAVE_GMIME_2_5_7 */
+
+ parent_class = g_type_class_ref(G_TYPE_OBJECT);
+
+ object_class->finalize = g_mime_gpgme_context_finalize;
+
++#ifndef HAVE_GMIME_2_5_7
+ cipher_class->hash_id = g_mime_gpgme_hash_id;
+ cipher_class->hash_name = g_mime_gpgme_hash_name;
+ cipher_class->sign = g_mime_gpgme_sign;
+ cipher_class->verify = g_mime_gpgme_verify;
+ cipher_class->encrypt = g_mime_gpgme_encrypt;
+ cipher_class->decrypt = g_mime_gpgme_decrypt;
++#else /* HAVE_GMIME_2_5_7 */
++ crypto_class->digest_id = g_mime_gpgme_digest_id;
++ crypto_class->digest_name = g_mime_gpgme_digest_name;
++ crypto_class->get_signature_protocol =
++ g_mime_gpgme_get_signature_protocol;
++ crypto_class->get_encryption_protocol =
++ g_mime_gpgme_get_encryption_protocol;
++ crypto_class->get_key_exchange_protocol =
++ g_mime_gpgme_get_key_exchange_protocol;
++ crypto_class->sign = g_mime_gpgme_sign;
++ crypto_class->verify = g_mime_gpgme_verify;
++ crypto_class->encrypt = g_mime_gpgme_encrypt;
++ crypto_class->decrypt = g_mime_gpgme_decrypt;
++#endif /* HAVE_GMIME_2_5_7 */
+
+ if (gpgme_engine_check_version(GPGME_PROTOCOL_OpenPGP) ==
+ GPG_ERR_NO_ERROR)
+@@ -190,7 +263,11 @@ g_mime_gpgme_context_finalize(GObject * object)
+ }
+
+ #if !defined(HAVE_GMIME_2_6)
++#ifndef HAVE_GMIME_2_5_7
+ g_object_unref(GMIME_CIPHER_CONTEXT(ctx)->session);
++#else /* HAVE_GMIME_2_5_7 */
++ g_object_unref(GMIME_CRYPTO_CONTEXT(ctx)->session);
++#endif /* HAVE_GMIME_2_5_7 */
+ #endif /* HAVE_GMIME_2_6 */
+
+ G_OBJECT_CLASS(parent_class)->finalize(object);
+@@ -200,15 +277,26 @@ g_mime_gpgme_context_finalize(GObject * object)
+ /*
+ * Convert a hash algorithm name to a number
+ */
++#ifndef HAVE_GMIME_2_5_7
+ static GMimeCipherHash
+ g_mime_gpgme_hash_id(GMimeCipherContext * ctx, const char *hash)
++#else /* HAVE_GMIME_2_5_7 */
++static GMimeDigestAlgo
++g_mime_gpgme_digest_id(GMimeCryptoContext * ctx, const char *hash)
++#endif /* HAVE_GMIME_2_5_7 */
+ {
++#ifndef HAVE_GMIME_2_5_7
+ if (hash == NULL)
+ return GMIME_CIPHER_HASH_DEFAULT;
++#else /* HAVE_GMIME_2_5_7 */
++ if (hash == NULL)
++ return GMIME_DIGEST_ALGO_DEFAULT;
++#endif /* HAVE_GMIME_2_5_7 */
+
+ if (!g_ascii_strcasecmp(hash, "pgp-"))
+ hash += 4;
+
++#ifndef HAVE_GMIME_2_5_7
+ if (!g_ascii_strcasecmp(hash, "md2"))
+ return GMIME_CIPHER_HASH_MD2;
+ else if (!g_ascii_strcasecmp(hash, "md5"))
+@@ -223,6 +311,22 @@ g_mime_gpgme_hash_id(GMimeCipherContext * ctx, const char *hash)
+ return GMIME_CIPHER_HASH_HAVAL5160;
+
+ return GMIME_CIPHER_HASH_DEFAULT;
++#else /* HAVE_GMIME_2_5_7 */
++ if (!g_ascii_strcasecmp(hash, "md2"))
++ return GMIME_DIGEST_ALGO_MD2;
++ else if (!g_ascii_strcasecmp(hash, "md5"))
++ return GMIME_DIGEST_ALGO_MD5;
++ else if (!g_ascii_strcasecmp(hash, "sha1"))
++ return GMIME_DIGEST_ALGO_SHA1;
++ else if (!g_ascii_strcasecmp(hash, "ripemd160"))
++ return GMIME_DIGEST_ALGO_RIPEMD160;
++ else if (!g_ascii_strcasecmp(hash, "tiger192"))
++ return GMIME_DIGEST_ALGO_TIGER192;
++ else if (!g_ascii_strcasecmp(hash, "haval-5-160"))
++ return GMIME_DIGEST_ALGO_HAVAL5160;
++
++ return GMIME_DIGEST_ALGO_DEFAULT;
++#endif /* HAVE_GMIME_2_5_7 */
+ }
+
+
+@@ -230,7 +334,11 @@ g_mime_gpgme_hash_id(GMimeCipherContext * ctx, const char *hash)
+ * Convert a hash algorithm number to a string
+ */
+ static const char *
++#ifndef HAVE_GMIME_2_5_7
+ g_mime_gpgme_hash_name(GMimeCipherContext * context, GMimeCipherHash hash)
++#else /* HAVE_GMIME_2_5_7 */
++g_mime_gpgme_digest_name(GMimeCryptoContext * context, GMimeDigestAlgo hash)
++#endif /* HAVE_GMIME_2_5_7 */
+ {
+ GMimeGpgmeContext *ctx = GMIME_GPGME_CONTEXT(context);
+ char *p;
+@@ -239,6 +347,7 @@ g_mime_gpgme_hash_name(GMimeCipherContext * context, GMimeCipherHash hash)
+ g_return_val_if_fail(ctx->gpgme_ctx, NULL);
+
+ /* note: this is only a subset of the hash algorithms gpg(me) supports */
++#ifndef HAVE_GMIME_2_5_7
+ switch (hash) {
+ case GMIME_CIPHER_HASH_MD2:
+ p = "pgp-md2";
+@@ -258,6 +367,27 @@ g_mime_gpgme_hash_name(GMimeCipherContext * context, GMimeCipherHash hash)
+ case GMIME_CIPHER_HASH_HAVAL5160:
+ p = "pgp-haval-5-160";
+ break;
++#else /* HAVE_GMIME_2_5_7 */
++ switch (hash) {
++ case GMIME_DIGEST_ALGO_MD2:
++ p = "pgp-md2";
++ break;
++ case GMIME_DIGEST_ALGO_MD5:
++ p = "pgp-md5";
++ break;
++ case GMIME_DIGEST_ALGO_SHA1:
++ p = "pgp-sha1";
++ break;
++ case GMIME_DIGEST_ALGO_RIPEMD160:
++ p = "pgp-ripemd160";
++ break;
++ case GMIME_DIGEST_ALGO_TIGER192:
++ p = "pgp-tiger192";
++ break;
++ case GMIME_DIGEST_ALGO_HAVAL5160:
++ p = "pgp-haval-5-160";
++ break;
++#endif /* HAVE_GMIME_2_5_7 */
+ default:
+ if (!(p = ctx->micalg))
+ return p;
+@@ -270,6 +400,29 @@ g_mime_gpgme_hash_name(GMimeCipherContext * context, GMimeCipherHash hash)
+ return p;
+ }
+
++#ifdef HAVE_GMIME_2_5_7
++static const char *
++g_mime_gpgme_get_signature_protocol(GMimeCryptoContext * context)
++{
++ GMimeGpgmeContext *ctx = GMIME_GPGME_CONTEXT(context);
++ return ctx->sign_protocol;
++}
++
++static const char *
++g_mime_gpgme_get_encryption_protocol(GMimeCryptoContext * context)
++{
++ GMimeGpgmeContext *ctx = GMIME_GPGME_CONTEXT(context);
++ return ctx->encrypt_protocol;
++}
++
++static const char *
++g_mime_gpgme_get_key_exchange_protocol(GMimeCryptoContext * context)
++{
++ GMimeGpgmeContext *ctx = GMIME_GPGME_CONTEXT(context);
++ return ctx->key_protocol;
++}
++
++#endif /* HAVE_GMIME_2_5_7 */
+
+ /*
+ * Wrapper to convert the passphrase returned from the gmime session to gpgme.
+@@ -279,7 +432,11 @@ g_mime_session_passphrase(void *HOOK, const char *UID_HINT,
+ const char *PASSPHRASE_INFO, int PREV_WAS_BAD,
+ int FD)
+ {
++#ifndef HAVE_GMIME_2_5_7
+ GMimeCipherContext *ctx = GMIME_CIPHER_CONTEXT(HOOK);
++#else /* HAVE_GMIME_2_5_7 */
++ GMimeCryptoContext *ctx = GMIME_CRYPTO_CONTEXT(HOOK);
++#endif /* HAVE_GMIME_2_5_7 */
+ #if defined(HAVE_GMIME_2_6)
+ GMimeStream *stream;
+ gboolean rc;
+@@ -366,9 +523,15 @@ cb_data_release(void *handle)
+ * arg, but set the value in the context.
+ */
+ static int
++#ifndef HAVE_GMIME_2_5_7
+ g_mime_gpgme_sign(GMimeCipherContext * context, const char *userid,
+ GMimeCipherHash hash, GMimeStream * istream,
+ GMimeStream * ostream, GError ** error)
++#else /* HAVE_GMIME_2_5_7 */
++g_mime_gpgme_sign(GMimeCryptoContext * context, const char *userid,
++ GMimeDigestAlgo hash, GMimeStream * istream,
++ GMimeStream * ostream, GError ** error)
++#endif /* HAVE_GMIME_2_5_7 */
+ {
+ GMimeGpgmeContext *ctx = (GMimeGpgmeContext *) context;
+ gpgme_sig_mode_t sig_mode;
+@@ -460,6 +623,7 @@ g_mime_gpgme_sign(GMimeCipherContext * context, const char *userid,
+ }
+
+
++#ifndef HAVE_GMIME_2_5_7
+ /*
+ * In standard mode, verify that sigstream contains a detached signature for
+ * istream. In single-part mode (RFC 2440, RFC 2633 application/pkcs7-mime),
+@@ -471,13 +635,33 @@ static GMimeSignatureValidity *
+ g_mime_gpgme_verify(GMimeCipherContext * context, GMimeCipherHash hash,
+ GMimeStream * istream, GMimeStream * sigstream,
+ GError ** error)
++#else /* HAVE_GMIME_2_5_7 */
++/*
++ * In standard mode, verify that sigstream contains a detached signature for
++ * istream. In single-part mode (RFC 2440, RFC 2633 application/pkcs7-mime),
++ * istream contains clearsigned data, and sigstream will be filled with the
++ * verified plaintext. The routine returns a GMimeSignatureList object.
++ * More information is saved in the context's signature object.
++ * On error error is set accordingly.
++ */
++static GMimeSignatureList *
++g_mime_gpgme_verify(GMimeCryptoContext * context, GMimeDigestAlgo hash,
++ GMimeStream * istream, GMimeStream * sigstream,
++ GError ** error)
++#endif /* HAVE_GMIME_2_5_7 */
+ {
+ GMimeGpgmeContext *ctx = (GMimeGpgmeContext *) context;
+ gpgme_ctx_t gpgme_ctx;
+ gpgme_protocol_t protocol;
+ gpgme_error_t err;
+ gpgme_data_t msg, sig;
++#ifndef HAVE_GMIME_2_5_7
+ GMimeSignatureValidity *validity;
++#else /* HAVE_GMIME_2_5_7 */
++ GMimeSignatureList *list;
++ GMimeSignature *signature;
++
++#endif /* HAVE_GMIME_2_5_7 */
+ struct gpgme_data_cbs cbs = {
+ (gpgme_data_read_cb_t) g_mime_gpgme_stream_rd, /* read method */
+ (gpgme_data_write_cb_t) g_mime_gpgme_stream_wr, /* write method */
+@@ -521,6 +705,7 @@ g_mime_gpgme_verify(GMimeCipherContext * context, GMimeCipherHash hash,
+ ctx->sig_state =
+ g_mime_gpgme_sigstat_new_from_gpgme_ctx(gpgme_ctx);
+
++#ifndef HAVE_GMIME_2_5_7
+ validity = g_mime_signature_validity_new();
+ if (ctx->sig_state) {
+ switch (ctx->sig_state->status)
+@@ -536,12 +721,44 @@ g_mime_gpgme_verify(GMimeCipherContext * context, GMimeCipherHash hash,
+ }
+ } else
+ g_mime_signature_validity_set_status(validity, GMIME_SIGNATURE_STATUS_UNKNOWN);
++#else /* HAVE_GMIME_2_5_7 */
++ list = g_mime_signature_list_new();
++ signature = g_mime_signature_new();
++ g_mime_signature_list_add(list, signature);
++
++ if (ctx->sig_state) {
++ switch (ctx->sig_state->status)
++ {
++ case GPG_ERR_NO_ERROR:
++ g_mime_signature_set_status(signature,
++ GMIME_SIGNATURE_STATUS_GOOD);
++ break;
++ case GPG_ERR_NOT_SIGNED:
++ g_mime_signature_set_status(signature,
++ GMIME_SIGNATURE_STATUS_ERROR);
++ g_mime_signature_set_errors(signature,
++ GMIME_SIGNATURE_ERROR_NONE);
++ break;
++ default:
++ g_mime_signature_set_status(signature,
++ GMIME_SIGNATURE_STATUS_BAD);
++ }
++ } else {
++ g_mime_signature_set_status(signature,
++ GMIME_SIGNATURE_STATUS_ERROR);
++ g_mime_signature_set_errors(signature, GMIME_SIGNATURE_ERROR_NONE);
++ }
++#endif /* HAVE_GMIME_2_5_7 */
+
+ /* release gmgme data buffers */
+ gpgme_data_release(msg);
+ gpgme_data_release(sig);
+
++#ifndef HAVE_GMIME_2_5_7
+ return validity;
++#else /* HAVE_GMIME_2_5_7 */
++ return list;
++#endif /* HAVE_GMIME_2_5_7 */
+ }
+
+
+@@ -549,10 +766,19 @@ g_mime_gpgme_verify(GMimeCipherContext * context, GMimeCipherHash hash,
+ * Encrypt istream to ostream for recipients. If sign is set, sign by userid.
+ */
+ static int
++#ifndef HAVE_GMIME_2_5_7
+ g_mime_gpgme_encrypt(GMimeCipherContext * context, gboolean sign,
+ const char *userid, GPtrArray * recipients,
+ GMimeStream * istream, GMimeStream * ostream,
+ GError ** error)
++#else /* HAVE_GMIME_2_5_7 */
++g_mime_gpgme_encrypt(GMimeCryptoContext * context, gboolean sign,
++ const char *userid,
++ GMimeDigestAlgo digest,
++ GPtrArray * recipients,
++ GMimeStream * istream, GMimeStream * ostream,
++ GError ** error)
++#endif /* HAVE_GMIME_2_5_7 */
+ {
+ GMimeGpgmeContext *ctx = (GMimeGpgmeContext *) context;
+ gpgme_ctx_t gpgme_ctx;
+@@ -653,9 +879,15 @@ g_mime_gpgme_encrypt(GMimeCipherContext * context, gboolean sign,
+ * Decrypt istream to ostream. In RFC 2440 mode, also try to check an included
+ * signature (if any).
+ */
++#ifndef HAVE_GMIME_2_5_7
+ static GMimeSignatureValidity *
+ g_mime_gpgme_decrypt(GMimeCipherContext * context, GMimeStream * istream,
+ GMimeStream * ostream, GError ** error)
++#else /* HAVE_GMIME_2_5_7 */
++static GMimeDecryptResult *
++g_mime_gpgme_decrypt(GMimeCryptoContext * context, GMimeStream * istream,
++ GMimeStream * ostream, GError ** error)
++#endif /* HAVE_GMIME_2_5_7 */
+ {
+ GMimeGpgmeContext *ctx = (GMimeGpgmeContext *) context;
+ gpgme_ctx_t gpgme_ctx;
+@@ -668,7 +900,13 @@ g_mime_gpgme_decrypt(GMimeCipherContext * context, GMimeStream * istream,
+ NULL, /* seek method */
+ cb_data_release /* release method */
+ };
++#ifndef HAVE_GMIME_2_5_7
+ GMimeSignatureValidity *validity;
++#else /* HAVE_GMIME_2_5_7 */
++ GMimeDecryptResult *result;
++ GMimeSignatureList *list;
++ GMimeSignature *signature;
++#endif /* HAVE_GMIME_2_5_7 */
+
+ /* some paranoia checks */
+ g_return_val_if_fail(ctx, NULL);
+@@ -716,6 +954,7 @@ g_mime_gpgme_decrypt(GMimeCipherContext * context, GMimeStream * istream,
+ /* try to get information about the signature (if any) */
+ ctx->sig_state = g_mime_gpgme_sigstat_new_from_gpgme_ctx(gpgme_ctx);
+
++#ifndef HAVE_GMIME_2_5_7
+ validity = g_mime_signature_validity_new();
+ if (ctx->sig_state) {
+ switch (ctx->sig_state->status)
+@@ -733,14 +972,57 @@ g_mime_gpgme_decrypt(GMimeCipherContext * context, GMimeStream * istream,
+ g_mime_signature_validity_set_status(validity, GMIME_SIGNATURE_STATUS_UNKNOWN);
+
+ return validity;
++#else /* HAVE_GMIME_2_5_7 */
++ list = g_mime_signature_list_new();
++ signature = g_mime_signature_new();
++ g_mime_signature_list_add(list, signature);
++ result = g_mime_decrypt_result_new();
++ g_mime_decrypt_result_set_signatures(result, list);
++
++ if (ctx->sig_state) {
++ switch (ctx->sig_state->status)
++ {
++ case GPG_ERR_NO_ERROR:
++ g_mime_signature_set_status(signature,
++ GMIME_SIGNATURE_STATUS_GOOD);
++ break;
++ case GPG_ERR_NOT_SIGNED:
++ g_mime_signature_set_status(signature,
++ GMIME_SIGNATURE_STATUS_ERROR);
++ g_mime_signature_set_errors(signature,
++ GMIME_SIGNATURE_ERROR_NONE);
++ break;
++ default:
++ g_mime_signature_set_status(signature,
++ GMIME_SIGNATURE_STATUS_BAD);
++ }
++ } else {
++ g_mime_signature_set_status(signature,
++ GMIME_SIGNATURE_STATUS_ERROR);
++ g_mime_signature_set_errors(signature, GMIME_SIGNATURE_ERROR_NONE);
++ }
++
++ return result;
++#endif /* HAVE_GMIME_2_5_7 */
+ }
+
+
++#ifndef HAVE_GMIME_2_5_7
+ /*
+ * Create a new gpgme cipher context with protocol. If anything fails, return
+ * NULL and set error.
+ */
++#else /* HAVE_GMIME_2_5_7 */
++/*
++ * Create a new gpgme crypto context with protocol. If anything fails, return
++ * NULL and set error.
++ */
++#endif /* HAVE_GMIME_2_5_7 */
++#ifndef HAVE_GMIME_2_5_7
+ GMimeCipherContext *
++#else /* HAVE_GMIME_2_5_7 */
++GMimeCryptoContext *
++#endif /* HAVE_GMIME_2_5_7 */
+ #if defined(HAVE_GMIME_2_6)
+ g_mime_gpgme_context_new(GMimePasswordRequestFunc request_passwd,
+ gpgme_protocol_t protocol, GError ** error)
+@@ -749,7 +1031,11 @@ g_mime_gpgme_context_new(GMimeSession * session,
+ gpgme_protocol_t protocol, GError ** error)
+ #endif /* HAVE_GMIME_2_6 */
+ {
++#ifndef HAVE_GMIME_2_5_7
+ GMimeCipherContext *cipher;
++#else /* HAVE_GMIME_2_5_7 */
++ GMimeCryptoContext *crypto;
++#endif /* HAVE_GMIME_2_5_7 */
+ GMimeGpgmeContext *ctx;
+ gpgme_error_t err;
+ gpgme_ctx_t gpgme_ctx;
+@@ -766,14 +1052,22 @@ g_mime_gpgme_context_new(GMimeSession * session,
+ return NULL;
+ }
+
++#ifndef HAVE_GMIME_2_5_7
+ /* create the cipher context */
++#else /* HAVE_GMIME_2_5_7 */
++ /* create the crypto context */
++#endif /* HAVE_GMIME_2_5_7 */
+ ctx = g_object_new(GMIME_TYPE_GPGME_CONTEXT, NULL, NULL);
+ if (!ctx) {
+ gpgme_release(gpgme_ctx);
+ return NULL;
+ } else
+ ctx->gpgme_ctx = gpgme_ctx;
++#ifndef HAVE_GMIME_2_5_7
+ cipher = (GMimeCipherContext *) ctx;
++#else /* HAVE_GMIME_2_5_7 */
++ crypto = (GMimeCryptoContext *) ctx;
++#endif /* HAVE_GMIME_2_5_7 */
+
+ /* check if the requested protocol is available */
+ if (!g_mime_gpgme_context_check_protocol
+@@ -785,23 +1079,47 @@ g_mime_gpgme_context_new(GMimeSession * session,
+
+ /* setup according to requested protocol */
+ #if defined(HAVE_GMIME_2_6)
++#ifndef HAVE_GMIME_2_5_7
+ cipher->request_passwd = request_passwd;
++#else /* HAVE_GMIME_2_5_7 */
++ crypto->request_passwd = request_passwd;
++#endif /* HAVE_GMIME_2_5_7 */
+ #else /* HAVE_GMIME_2_6 */
++#ifndef HAVE_GMIME_2_5_7
+ cipher->session = session;
++#else /* HAVE_GMIME_2_5_7 */
++ crypto->session = session;
++#endif /* HAVE_GMIME_2_5_7 */
+ g_object_ref(session);
+ #endif /* HAVE_GMIME_2_6 */
+ gpgme_set_protocol(gpgme_ctx, protocol);
+ if (protocol == GPGME_PROTOCOL_OpenPGP) {
++#ifndef HAVE_GMIME_2_5_7
+ cipher->sign_protocol = "application/pgp-signature";
+ cipher->encrypt_protocol = "application/pgp-encrypted";
+ cipher->key_protocol = NULL; /* FIXME */
++#else /* HAVE_GMIME_2_5_7 */
++ ctx->sign_protocol = "application/pgp-signature";
++ ctx->encrypt_protocol = "application/pgp-encrypted";
++ ctx->key_protocol = NULL; /* FIXME */
++#endif /* HAVE_GMIME_2_5_7 */
+ } else {
++#ifndef HAVE_GMIME_2_5_7
+ cipher->sign_protocol = "application/pkcs7-signature";
+ cipher->encrypt_protocol = "application/pkcs7-mime";
+ cipher->key_protocol = NULL; /* FIXME */
++#else /* HAVE_GMIME_2_5_7 */
++ ctx->sign_protocol = "application/pkcs7-signature";
++ ctx->encrypt_protocol = "application/pkcs7-mime";
++ ctx->key_protocol = NULL; /* FIXME */
++#endif /* HAVE_GMIME_2_5_7 */
+ }
+
++#ifndef HAVE_GMIME_2_5_7
+ return cipher;
++#else /* HAVE_GMIME_2_5_7 */
++ return crypto;
++#endif /* HAVE_GMIME_2_5_7 */
+ }
+
+
+diff --git a/libbalsa/gmime-gpgme-context.h b/libbalsa/gmime-gpgme-context.h
+index 585d927..19c5fae 100644
+--- a/libbalsa/gmime-gpgme-context.h
++++ b/libbalsa/gmime-gpgme-context.h
+@@ -63,7 +63,11 @@ typedef gboolean(*GMimeGpgmeKeyTrustCB) (const gchar * name,
+ GMimeGpgmeContext * ctx);
+
+ struct _GMimeGpgmeContext {
++#ifndef HAVE_GMIME_2_5_7
+ GMimeCipherContext parent_object;
++#else /* HAVE_GMIME_2_5_7 */
++ GMimeCryptoContext parent_object;
++#endif /* HAVE_GMIME_2_5_7 */
+
+ gpgme_ctx_t gpgme_ctx; /* gpgme context */
+ gboolean singlepart_mode; /* set context to single-part mode (RFC 2440, 2633) */
+@@ -73,11 +77,21 @@ struct _GMimeGpgmeContext {
+ GMimeGpgmeKeySelectCB key_select_cb; /* key selection callback */
+ GMimeGpgmeKeyTrustCB key_trust_cb; /* low trust key cb */
+ gpgme_passphrase_cb_t passphrase_cb; /* passphrase callback */
++#ifdef HAVE_GMIME_2_5_7
++
++ const gchar *sign_protocol;
++ const gchar *encrypt_protocol;
++ const gchar *key_protocol;
++#endif /* HAVE_GMIME_2_5_7 */
+ };
+
+
+ struct _GMimeGpgmeContextClass {
++#ifndef HAVE_GMIME_2_5_7
+ GMimeCipherContextClass parent_class;
++#else /* HAVE_GMIME_2_5_7 */
++ GMimeCryptoContextClass parent_class;
++#endif /* HAVE_GMIME_2_5_7 */
+
+ gboolean has_proto_openpgp;
+ gboolean has_proto_cms;
+@@ -86,10 +100,17 @@ struct _GMimeGpgmeContextClass {
+
+ GType g_mime_gpgme_context_get_type(void);
+ #if defined(HAVE_GMIME_2_6)
++#ifndef HAVE_GMIME_2_5_7
+ GMimeCipherContext *g_mime_gpgme_context_new(GMimePasswordRequestFunc
+ request_passwd,
+ gpgme_protocol_t protocol,
+ GError ** error);
++#else /* HAVE_GMIME_2_5_7 */
++GMimeCryptoContext *g_mime_gpgme_context_new(GMimePasswordRequestFunc
++ request_passwd,
++ gpgme_protocol_t protocol,
++ GError ** error);
++#endif /* HAVE_GMIME_2_5_7 */
+ #else /* HAVE_GMIME_2_6 */
+ GMimeCipherContext *g_mime_gpgme_context_new(GMimeSession * session,
+ gpgme_protocol_t protocol,
+diff --git a/libbalsa/gmime-part-rfc2440.c b/libbalsa/gmime-part-rfc2440.c
+index 795d2e1..e79c4cb 100644
+--- a/libbalsa/gmime-part-rfc2440.c
++++ b/libbalsa/gmime-part-rfc2440.c
+@@ -112,8 +112,13 @@ g_mime_part_rfc2440_sign_encrypt(GMimePart * part,
+
+ g_return_val_if_fail(GMIME_IS_PART(part), -1);
+ g_return_val_if_fail(GMIME_IS_GPGME_CONTEXT(ctx), -1);
++#ifndef HAVE_GMIME_2_5_7
+ g_return_val_if_fail(GMIME_CIPHER_CONTEXT(ctx)->sign_protocol != NULL,
+ -1);
++#else /* HAVE_GMIME_2_5_7 */
++ g_return_val_if_fail(g_mime_crypto_context_get_signature_protocol
++ (GMIME_CRYPTO_CONTEXT(ctx)) != NULL, -1);
++#endif /* HAVE_GMIME_2_5_7 */
+ g_return_val_if_fail(recipients != NULL || sign_userid != NULL, -1);
+
+ /* get the raw content */
+@@ -131,14 +136,27 @@ g_mime_part_rfc2440_sign_encrypt(GMimePart * part,
+ ctx->singlepart_mode = TRUE;
+ if (recipients == NULL)
+ result =
++#ifndef HAVE_GMIME_2_5_7
+ g_mime_cipher_context_sign(GMIME_CIPHER_CONTEXT(ctx), sign_userid,
+ GMIME_CIPHER_HASH_DEFAULT, stream,
+ cipherstream, err);
++#else /* HAVE_GMIME_2_5_7 */
++ g_mime_crypto_context_sign(GMIME_CRYPTO_CONTEXT(ctx), sign_userid,
++ GMIME_CIPHER_ALGO_DEFAULT, stream,
++ cipherstream, err);
++#endif /* HAVE_GMIME_2_5_7 */
+ else
+ result =
++#ifndef HAVE_GMIME_2_5_7
+ g_mime_cipher_context_encrypt(GMIME_CIPHER_CONTEXT(ctx),
+ sign_userid != NULL, sign_userid,
+ recipients, stream, cipherstream, err);
++#else /* HAVE_GMIME_2_5_7 */
++ g_mime_crypto_context_encrypt(GMIME_CRYPTO_CONTEXT(ctx),
++ sign_userid != NULL, sign_userid,
++ GMIME_CIPHER_ALGO_DEFAULT,
++ recipients, stream, cipherstream, err);
++#endif /* HAVE_GMIME_2_5_7 */
+ if (result == -1) {
+ g_object_unref(cipherstream);
+ return -1;
+@@ -202,18 +220,31 @@ g_mime_part_rfc2440_sign_encrypt(GMimePart * part,
+ * set on err to provide more information. Upon success, the content
+ * of part is replaced by the verified output of the crypto engine.
+ */
++#ifndef HAVE_GMIME_2_5_7
+ GMimeSignatureValidity *
++#else /* HAVE_GMIME_2_5_7 */
++GMimeSignatureList *
++#endif /* HAVE_GMIME_2_5_7 */
+ g_mime_part_rfc2440_verify(GMimePart * part,
+ GMimeGpgmeContext * ctx, GError ** err)
+ {
+ GMimeStream *stream, *plainstream;
+ GMimeDataWrapper * wrapper;
++#ifndef HAVE_GMIME_2_5_7
+ GMimeSignatureValidity *valid;
++#else /* HAVE_GMIME_2_5_7 */
++ GMimeSignatureList *list;
++#endif /* HAVE_GMIME_2_5_7 */
+
+ g_return_val_if_fail(GMIME_IS_PART(part), NULL);
+ g_return_val_if_fail(GMIME_IS_GPGME_CONTEXT(ctx), NULL);
++#ifndef HAVE_GMIME_2_5_7
+ g_return_val_if_fail(GMIME_CIPHER_CONTEXT(ctx)->sign_protocol != NULL,
+ NULL);
++#else /* HAVE_GMIME_2_5_7 */
++ g_return_val_if_fail(g_mime_crypto_context_get_signature_protocol
++ (GMIME_CRYPTO_CONTEXT(ctx)) != NULL, NULL);
++#endif /* HAVE_GMIME_2_5_7 */
+
+ /* get the raw content */
+ wrapper = g_mime_part_get_content_object(GMIME_PART(part));
+@@ -227,13 +258,25 @@ g_mime_part_rfc2440_verify(GMimePart * part,
+
+ /* verify the signature */
+ ctx->singlepart_mode = TRUE;
++#ifndef HAVE_GMIME_2_5_7
+ valid =
+ g_mime_cipher_context_verify(GMIME_CIPHER_CONTEXT(ctx),
+ GMIME_CIPHER_HASH_DEFAULT, stream,
+ plainstream, err);
++#else /* HAVE_GMIME_2_5_7 */
++ list =
++ g_mime_crypto_context_verify(GMIME_CRYPTO_CONTEXT(ctx),
++ GMIME_CIPHER_ALGO_DEFAULT, stream,
++ plainstream, err);
++#endif /* HAVE_GMIME_2_5_7 */
+
+ /* upon success, replace the signed content by the checked one */
+- if (valid) {
++#ifndef HAVE_GMIME_2_5_7
++ if (valid)
++#else /* HAVE_GMIME_2_5_7 */
++ if (list)
++#endif /* HAVE_GMIME_2_5_7 */
++ {
+ GMimeDataWrapper *wrapper = g_mime_data_wrapper_new();
+
+ g_mime_data_wrapper_set_stream(wrapper, plainstream);
+@@ -242,7 +285,11 @@ g_mime_part_rfc2440_verify(GMimePart * part,
+ }
+ g_object_unref(plainstream);
+
++#ifndef HAVE_GMIME_2_5_7
+ return valid;
++#else /* HAVE_GMIME_2_5_7 */
++ return list;
++#endif /* HAVE_GMIME_2_5_7 */
+ }
+
+
+@@ -255,19 +302,32 @@ g_mime_part_rfc2440_verify(GMimePart * part,
+ * verified and the result is placed in ctx by the underlying gpgme
+ * context.
+ */
++#ifndef HAVE_GMIME_2_5_7
+ GMimeSignatureValidity *
++#else /* HAVE_GMIME_2_5_7 */
++GMimeDecryptResult *
++#endif /* HAVE_GMIME_2_5_7 */
+ g_mime_part_rfc2440_decrypt(GMimePart * part,
+ GMimeGpgmeContext * ctx, GError ** err)
+ {
+ GMimeStream *stream, *plainstream;
+ GMimeDataWrapper * wrapper;
++#ifndef HAVE_GMIME_2_5_7
+ GMimeSignatureValidity *result;
++#else /* HAVE_GMIME_2_5_7 */
++ GMimeDecryptResult *result;
++#endif /* HAVE_GMIME_2_5_7 */
+ gchar *headbuf = g_malloc0(1024);
+
+ g_return_val_if_fail(GMIME_IS_PART(part), NULL);
+ g_return_val_if_fail(GMIME_IS_GPGME_CONTEXT(ctx), NULL);
++#ifndef HAVE_GMIME_2_5_7
+ g_return_val_if_fail(GMIME_CIPHER_CONTEXT(ctx)->encrypt_protocol !=
+ NULL, NULL);
++#else /* HAVE_GMIME_2_5_7 */
++ g_return_val_if_fail(g_mime_crypto_context_get_encryption_protocol
++ (GMIME_CRYPTO_CONTEXT(ctx)) != NULL, NULL);
++#endif /* HAVE_GMIME_2_5_7 */
+
+ /* get the raw content */
+ wrapper = g_mime_part_get_content_object(part);
+@@ -284,8 +344,13 @@ g_mime_part_rfc2440_decrypt(GMimePart * part,
+
+ /* decrypt and (if possible) verify the input */
+ result =
++#ifndef HAVE_GMIME_2_5_7
+ g_mime_cipher_context_decrypt(GMIME_CIPHER_CONTEXT(ctx), stream,
+ plainstream, err);
++#else /* HAVE_GMIME_2_5_7 */
++ g_mime_crypto_context_decrypt(GMIME_CRYPTO_CONTEXT(ctx), stream,
++ plainstream, err);
++#endif /* HAVE_GMIME_2_5_7 */
+
+ if (result != NULL) {
+ GMimeStream *filter_stream;
+diff --git a/libbalsa/gmime-part-rfc2440.h b/libbalsa/gmime-part-rfc2440.h
+index 48be5a4..cc1901a 100644
+--- a/libbalsa/gmime-part-rfc2440.h
++++ b/libbalsa/gmime-part-rfc2440.h
+@@ -53,12 +53,21 @@ int g_mime_part_rfc2440_sign_encrypt(GMimePart * part,
+ GPtrArray * recipients,
+ const char *sign_userid,
+ GError ** err);
++#ifndef HAVE_GMIME_2_5_7
+ GMimeSignatureValidity *g_mime_part_rfc2440_verify(GMimePart * part,
+ GMimeGpgmeContext * ctx,
+ GError ** err);
+ GMimeSignatureValidity *g_mime_part_rfc2440_decrypt(GMimePart * part,
+ GMimeGpgmeContext *
+ ctx, GError ** err);
++#else /* HAVE_GMIME_2_5_7 */
++GMimeSignatureList *g_mime_part_rfc2440_verify(GMimePart * part,
++ GMimeGpgmeContext * ctx,
++ GError ** err);
++GMimeDecryptResult *g_mime_part_rfc2440_decrypt(GMimePart * part,
++ GMimeGpgmeContext * ctx,
++ GError ** err);
++#endif /* HAVE_GMIME_2_5_7 */
+
+ #ifdef __cplusplus
+ }
+diff --git a/libbalsa/rfc3156.c b/libbalsa/rfc3156.c
+index a56e12c..df4a2e1 100644
+--- a/libbalsa/rfc3156.c
++++ b/libbalsa/rfc3156.c
+@@ -268,9 +268,15 @@ libbalsa_message_body_protection(LibBalsaMessageBody * body)
+
+ #if defined(HAVE_GMIME_2_6)
+ static gboolean
++#ifndef HAVE_GMIME_2_5_7
+ password_request_func(GMimeCipherContext * ctx, const char *user_id,
+ const char *prompt_ctx, gboolean reprompt,
+ GMimeStream * response, GError ** err)
++#else /* HAVE_GMIME_2_5_7 */
++password_request_func(GMimeCryptoContext * ctx, const char *user_id,
++ const char *prompt_ctx, gboolean reprompt,
++ GMimeStream * response, GError ** err)
++#endif /* HAVE_GMIME_2_5_7 */
+ {
+ gint fd;
+ gchar *name_used;
+@@ -366,9 +372,16 @@ libbalsa_sign_mime_object(GMimeObject ** content, const gchar * rfc822_for,
+ return FALSE;
+ }
+
++#ifndef HAVE_GMIME_2_5_7
+ if (g_mime_multipart_signed_sign
+ (mps, *content, GMIME_CIPHER_CONTEXT(ctx), rfc822_for,
+- GMIME_CIPHER_HASH_DEFAULT, error) != 0) {
++ GMIME_CIPHER_HASH_DEFAULT, error) != 0)
++#else /* HAVE_GMIME_2_5_7 */
++ if (g_mime_multipart_signed_sign
++ (mps, *content, GMIME_CRYPTO_CONTEXT(ctx), rfc822_for,
++ GMIME_DIGEST_ALGO_DEFAULT, error) != 0)
++#endif /* HAVE_GMIME_2_5_7 */
++ {
+ g_object_unref(mps);
+ g_object_unref(ctx);
+ #if !defined(HAVE_GMIME_2_6)
+@@ -458,10 +471,18 @@ libbalsa_encrypt_mime_object(GMimeObject ** content, GList * rfc822_for,
+
+ encrypted_obj = GMIME_OBJECT(mpe);
+ result =
++#ifndef HAVE_GMIME_2_5_7
+ g_mime_multipart_encrypted_encrypt(mpe, *content,
+ GMIME_CIPHER_CONTEXT(ctx),
+ FALSE, NULL,
+ recipients, error);
++#else /* HAVE_GMIME_2_5_7 */
++ g_mime_multipart_encrypted_encrypt(mpe, *content,
++ GMIME_CRYPTO_CONTEXT(ctx),
++ FALSE, NULL,
++ GMIME_DIGEST_ALGO_DEFAULT,
++ recipients, error);
++#endif /* HAVE_GMIME_2_5_7 */
+ }
+ #ifdef HAVE_SMIME
+ else {
+@@ -471,9 +492,15 @@ libbalsa_encrypt_mime_object(GMimeObject ** content, GList * rfc822_for,
+ encrypted_obj = GMIME_OBJECT(pkcs7);
+ ctx->singlepart_mode = TRUE;
+ result =
++#ifndef HAVE_GMIME_2_5_7
+ g_mime_application_pkcs7_encrypt(pkcs7, *content,
+ GMIME_CIPHER_CONTEXT(ctx),
+ recipients, error);
++#else /* HAVE_GMIME_2_5_7 */
++ g_mime_application_pkcs7_encrypt(pkcs7, *content,
++ GMIME_CRYPTO_CONTEXT(ctx),
++ recipients, error);
++#endif /* HAVE_GMIME_2_5_7 */
+ }
+ #endif
+
+@@ -565,8 +592,14 @@ libbalsa_body_check_signature(LibBalsaMessageBody * body,
+ #if !defined(HAVE_GMIME_2_6)
+ GMimeSession *session;
+ #endif /* HAVE_GMIME_2_6 */
+- GMimeCipherContext *ctx;
++#ifndef HAVE_GMIME_2_5_7
++ GMimeCipherContext *g_mime_ctx;
+ GMimeSignatureValidity *valid;
++#else /* HAVE_GMIME_2_5_7 */
++ GMimeCryptoContext *g_mime_ctx;
++ GMimeSignatureList *valid;
++#endif /* HAVE_GMIME_2_5_7 */
++ GMimeGpgmeContext *ctx;
+ GError *error = NULL;
+
+ /* paranoia checks */
+@@ -592,12 +625,12 @@ libbalsa_body_check_signature(LibBalsaMessageBody * body,
+ /* try to create GMimeGpgMEContext */
+ #if !defined(HAVE_GMIME_2_6)
+ session = g_object_new(g_mime_session_get_type(), NULL, NULL);
+- ctx = g_mime_gpgme_context_new(session, protocol, &error);
++ g_mime_ctx = g_mime_gpgme_context_new(session, protocol, &error);
+ #else /* HAVE_GMIME_2_6 */
+- ctx =
++ g_mime_ctx =
+ g_mime_gpgme_context_new(password_request_func, protocol, &error);
+ #endif /* HAVE_GMIME_2_6 */
+- if (ctx == NULL) {
++ if (g_mime_ctx == NULL) {
+ if (error) {
+ libbalsa_information(LIBBALSA_INFORMATION_ERROR, "%s: %s",
+ _("creating a gpgme context failed"),
+@@ -613,6 +646,7 @@ libbalsa_body_check_signature(LibBalsaMessageBody * body,
+ body->parts->next->sig_info->status = GPGME_SIG_STAT_ERROR;
+ return FALSE;
+ }
++ ctx = GMIME_GPGME_CONTEXT(g_mime_ctx);
+
+ /* S/MIME uses the protocol application/pkcs7-signature, but some ancient
+ mailers, not yet knowing RFC 2633, use application/x-pkcs7-signature,
+@@ -622,14 +656,19 @@ libbalsa_body_check_signature(LibBalsaMessageBody * body,
+ g_mime_object_get_content_type_parameter(GMIME_OBJECT (body->mime_part),
+ "protocol");
+ if (!g_ascii_strcasecmp(cms_protocol, "application/x-pkcs7-signature"))
++#ifndef HAVE_GMIME_2_5_7
++ g_mime_ctx->sign_protocol = cms_protocol;
++#else /* HAVE_GMIME_2_5_7 */
+ ctx->sign_protocol = cms_protocol;
++#endif /* HAVE_GMIME_2_5_7 */
+ }
+
+ /* verify the signature */
+
+ libbalsa_mailbox_lock_store(body->message->mailbox);
+ valid = g_mime_multipart_signed_verify(GMIME_MULTIPART_SIGNED
+- (body->mime_part), ctx, &error);
++ (body->mime_part), g_mime_ctx,
++ &error);
+ libbalsa_mailbox_unlock_store(body->message->mailbox);
+
+ if (valid == NULL) {
+@@ -642,12 +681,16 @@ libbalsa_body_check_signature(LibBalsaMessageBody * body,
+ libbalsa_information(LIBBALSA_INFORMATION_ERROR,
+ _("signature verification failed"));
+ }
+- if (GMIME_GPGME_CONTEXT(ctx)->sig_state) {
+- body->parts->next->sig_info = GMIME_GPGME_CONTEXT(ctx)->sig_state;
++ if (ctx->sig_state) {
++ body->parts->next->sig_info = ctx->sig_state;
+ g_object_ref(G_OBJECT(body->parts->next->sig_info));
+ }
++#ifndef HAVE_GMIME_2_5_7
+ g_mime_signature_validity_free(valid);
+- g_object_unref(ctx);
++#else /* HAVE_GMIME_2_5_7 */
++ g_object_unref(valid);
++#endif /* HAVE_GMIME_2_5_7 */
++ g_object_unref(g_mime_ctx);
+ #if !defined(HAVE_GMIME_2_6)
+ g_object_unref(session);
+ #endif /* HAVE_GMIME_2_6 */
+@@ -747,14 +790,26 @@ libbalsa_body_decrypt(LibBalsaMessageBody * body,
+ libbalsa_mailbox_lock_store(body->message->mailbox);
+ if (protocol == GPGME_PROTOCOL_OpenPGP)
+ mime_obj =
++#ifndef HAVE_GMIME_2_5_7
+ g_mime_multipart_encrypted_decrypt(GMIME_MULTIPART_ENCRYPTED(body->mime_part),
+ GMIME_CIPHER_CONTEXT(ctx),
+ &error);
++#else /* HAVE_GMIME_2_5_7 */
++ g_mime_multipart_encrypted_decrypt(GMIME_MULTIPART_ENCRYPTED(body->mime_part),
++ GMIME_CRYPTO_CONTEXT(ctx),
++ NULL,
++ &error);
++#endif /* HAVE_GMIME_2_5_7 */
+ #ifdef HAVE_SMIME
+ else if (smime_signed) {
++#ifndef HAVE_GMIME_2_5_7
+ GMimeSignatureValidity *valid;
++#else /* HAVE_GMIME_2_5_7 */
++ GMimeSignatureList *valid;
++#endif /* HAVE_GMIME_2_5_7 */
+
+ ctx->singlepart_mode = TRUE;
++#ifndef HAVE_GMIME_2_5_7
+ mime_obj =
+ g_mime_application_pkcs7_verify(GMIME_PART(body->mime_part),
+ &valid,
+@@ -766,6 +821,19 @@ libbalsa_body_decrypt(LibBalsaMessageBody * body,
+ g_mime_application_pkcs7_decrypt(GMIME_PART(body->mime_part),
+ GMIME_CIPHER_CONTEXT(ctx),
+ &error);
++#else /* HAVE_GMIME_2_5_7 */
++ mime_obj =
++ g_mime_application_pkcs7_verify(GMIME_PART(body->mime_part),
++ &valid,
++ GMIME_CRYPTO_CONTEXT(ctx),
++ &error);
++ g_object_unref(valid);
++ } else
++ mime_obj =
++ g_mime_application_pkcs7_decrypt(GMIME_PART(body->mime_part),
++ GMIME_CRYPTO_CONTEXT(ctx),
++ &error);
++#endif /* HAVE_GMIME_2_5_7 */
+ #endif
+ libbalsa_mailbox_unlock_store(body->message->mailbox);
+
+@@ -906,7 +974,11 @@ libbalsa_rfc2440_verify(GMimePart * part, GMimeGpgmeSigstat ** sig_info)
+ GMimeSession *session;
+ #endif /* HAVE_GMIME_2_6 */
+ GMimeGpgmeContext *ctx;
++#ifndef HAVE_GMIME_2_5_7
+ GMimeSignatureValidity *valid;
++#else /* HAVE_GMIME_2_5_7 */
++ GMimeSignatureList *valid;
++#endif /* HAVE_GMIME_2_5_7 */
+ GError *error = NULL;
+ gpgme_error_t retval;
+
+@@ -978,7 +1050,11 @@ libbalsa_rfc2440_verify(GMimePart * part, GMimeGpgmeSigstat ** sig_info)
+ }
+
+ /* clean up */
++#ifndef HAVE_GMIME_2_5_7
+ g_mime_signature_validity_free(valid);
++#else /* HAVE_GMIME_2_5_7 */
++ g_object_unref(valid);
++#endif /* HAVE_GMIME_2_5_7 */
+ retval = ctx->sig_state->status;
+ g_object_unref(ctx);
+ #if !defined(HAVE_GMIME_2_6)
+--
+cgit v0.9.0.2
diff --git a/community-testing/pinot/PKGBUILD b/community-testing/pinot/PKGBUILD
new file mode 100644
index 000000000..8dd7c740a
--- /dev/null
+++ b/community-testing/pinot/PKGBUILD
@@ -0,0 +1,50 @@
+# $Id: PKGBUILD 62017 2012-01-14 12:25:05Z ibiru $
+# Maintainer: Jaroslav Lichtblau <dragonlord@aur.archlinux.org>
+# Contributor: Alexander Fehr <pizzapunk gmail com>
+# Contributor: William Rea <sillywilly@gmail.com>
+# Contributor: Daniel J Griffiths <ghost1227@archlinux.us>
+
+pkgname=pinot
+pkgver=0.98
+pkgrel=2
+pkgdesc='Personal search and metasearch tool'
+arch=('i686' 'x86_64')
+url='http://pinot.berlios.de/'
+license=('GPL')
+depends=('gtkmm' 'xapian-core' 'libtextcat' 'sqlite3' 'libxml++' 'curl'
+ 'gmime' 'dbus-glib' 'shared-mime-info' 'libexif' 'taglib'
+ 'hicolor-icon-theme' 'cairo' 'exiv2')
+makedepends=('boost' 'desktop-file-utils')
+optdepends=('unzip: ZIP files extraction'
+ 'poppler: PDF to text conversion'
+ 'catdvi: DVI to text conversion'
+ 'djvulibre: DjVu text extraction'
+ 'unrtf: RTF to HTML conversion'
+ 'antiword: MS Word to text conversion'
+ 'catdoc: XLS and PPT to text conversion'
+ 'deskbar-applet: Pinot Deskbar-Applet module')
+options=('!emptydirs')
+install=$pkgname.install
+changelog=$pkgname.changelog
+source=(http://download.berlios.de/$pkgname/$pkgname-$pkgver.tar.gz)
+sha256sums=('8a89a73a48344074aa8f4534ce68fd18e3d84553645cef864c137ab21d8d341c')
+
+build() {
+ cd ${srcdir}/$pkgname-$pkgver
+ sed -i 's|/usr/share/libtextcat/|/usr/share/libtextcat/LM/|' textcat_conf.txt
+ sed -i -e "s|.*russian$|/usr/share/libtextcat/LM/russian-iso8859_5.lm russian-iso8859_5\n\
+/usr/share/libtextcat/LM/russian-koi8_r.lm russian-koi8_r\n\
+/usr/share/libtextcat/LM/russian-windows1251.lm russian-windows1251|" textcat_conf.txt
+
+ ./configure --prefix=/usr --sysconfdir=/etc --libexecdir=/usr/lib
+ make
+}
+
+package() {
+ cd ${srcdir}/$pkgname-$pkgver
+
+ make DESTDIR=${pkgdir} install
+
+ # Remove Deskbar-Applet handler
+ rm -rf ${pkgdir}/usr/lib/deskbar-applet/handlers
+}
diff --git a/community-testing/pinot/pinot.changelog b/community-testing/pinot/pinot.changelog
new file mode 100644
index 000000000..7d899cdb0
--- /dev/null
+++ b/community-testing/pinot/pinot.changelog
@@ -0,0 +1,2 @@
+2011-12-18 Jaroslav Lichtblau <dragonlord@aur.archlinux.org>
+ * pinot 0.98-1
diff --git a/community-testing/pinot/pinot.install b/community-testing/pinot/pinot.install
new file mode 100644
index 000000000..55ab40426
--- /dev/null
+++ b/community-testing/pinot/pinot.install
@@ -0,0 +1,15 @@
+post_install() {
+ gtk-update-icon-cache -q -t -f usr/share/icons/hicolor
+ echo "Starting with 0.63, the service is auto-started. "
+ echo "The file that enables this is located at "
+ echo "/etc/xdg/autostart/pinot-dbus-daemon.desktop"
+ echo "Delete this file if you don't want the auto-start."
+}
+
+post_upgrade() {
+ gtk-update-icon-cache -q -t -f usr/share/icons/hicolor
+}
+
+post_remove() {
+ gtk-update-icon-cache -q -t -f usr/share/icons/hicolor
+}
diff --git a/community/linux-tools/PKGBUILD b/community/linux-tools/PKGBUILD
index 345d8f9ad..026c0aa1d 100644
--- a/community/linux-tools/PKGBUILD
+++ b/community/linux-tools/PKGBUILD
@@ -1,12 +1,12 @@
-# $Id: PKGBUILD 61664 2012-01-06 00:12:09Z seblu $
-# Maintainer: Sebastien Luttringer <seblu+arch@seblu.net>
+# $Id: PKGBUILD 62053 2012-01-15 02:27:29Z seblu $
+# Maintainer: Sébastien Luttringer <seblu@aur.archlinux.org>
pkgbase=linux-tools
pkgname=('perf' 'cpupower')
pkgver=3.2
-kernver=${pkgver}
+kernver=${pkgver}.1
[[ ${kernver##*rc} != $kernver ]] && testing='testing'
-pkgrel=1
+pkgrel=2
license=('GPL2')
arch=('i686' 'x86_64')
url='http://www.kernel.org'
@@ -16,16 +16,18 @@ makedepends=('asciidoc' 'xmlto')
makedepends+=('python2' 'libnewt' 'elfutils' 'pciutils')
source=("http://ftp.kernel.org/pub/linux/kernel/v3.0/$testing/linux-$kernver.tar.xz"
'cpupower.rc'
- 'cpupower.conf')
-md5sums=('364066fa18767ec0ae5f4e4abcf9dc51'
- 'd8b119eff7dc1a2d655eb71a47fa6215'
- '218fd36a7957d3170ed8bd1a0be1f62f')
+ 'cpupower.conf'
+ 'cpupower.service')
+md5sums=('cd2f8b7752c85c337af809391f4afb94'
+ '26af384ca282bc0dc38ff65acc7bb4b9'
+ '857ccdd0598511e3bf4b63522754dc48'
+ '20870541e88109d2f153be3c58a277f1')
build() {
msg2 'Build perf'
cd linux-$kernver/tools/perf
- make PYTHON=python2 DESTDIR="${pkgdir}/usr" perfexecdir="lib/$pkgname" PERF_VERSION=$pkgver-$pkgrel \
- all man
+ make PYTHON=python2 DESTDIR="${pkgdir}/usr" perfexecdir="lib/$pkgname" \
+ PERF_VERSION=$pkgver-$pkgrel all man
msg2 'Build cpupower'
# we cannot use --as-needed
@@ -39,8 +41,8 @@ package_perf() {
depends=('python2' 'libnewt' 'elfutils')
cd linux-${kernver}/tools/perf
- make PYTHON=python2 DESTDIR="${pkgdir}/usr" perfexecdir="lib/$pkgname" PERF_VERSION=$pkgver \
- install install-man
+ make PYTHON=python2 DESTDIR="${pkgdir}/usr" perfexecdir="lib/$pkgname" \
+ PERF_VERSION=$pkgver install install-man
}
package_cpupower() {
@@ -52,6 +54,7 @@ package_cpupower() {
# install rc.d script
install -D -m 755 cpupower.rc "$pkgdir/etc/rc.d/cpupower"
install -D -m 644 cpupower.conf "$pkgdir/etc/conf.d/cpupower"
+ install -D -m 644 cpupower.service "$pkgdir/lib/systemd/system/cpupower.service"
cd linux-$kernver/tools/power/cpupower
make \
diff --git a/community/linux-tools/cpupower.conf b/community/linux-tools/cpupower.conf
index 0f56836b1..ee8602953 100644
--- a/community/linux-tools/cpupower.conf
+++ b/community/linux-tools/cpupower.conf
@@ -1,14 +1,28 @@
-# valid governors:
-# ondemand, performance, powersave,
-# conservative, userspace
-#governor="ondemand"
+# Define CPUs governor
+# valid governors: ondemand, performance, powersave, conservative, userspace.
+#governor='ondemand'
-# limit frequency range (optional)
-# valid suffixes: Hz, kHz (default), MHz, GHz, THz
+# Limit frequency range
+# Valid suffixes: Hz, kHz (default), MHz, GHz, THz
#min_freq="2.25GHz"
#max_freq="3GHz"
-# use freq to set up the exact cpu frequency using it with userspace governor
+# Specific frequency to be set.
+# Requires userspace governor to be available and loaded.
#freq=
+# Utilizes cores in one processor package/socket first before processes are
+# scheduled to other processor packages/sockets.
+# See man (1) CPUPOWER-SET for additional details.
+#mc_scheduler=
+
+# Utilizes thread siblings of one processor core first before processes are
+# scheduled to other cores. See man (1) CPUPOWER-SET for additional details.
+#smp_scheduler=
+
+# Sets a register on supported Intel processore which allows software to convey
+# its policy for the relative importance of performance versus energy savings to
+# the processor. See man (1) CPUPOWER-SET for additional details.
+#perf_bias=
+
# vim:set ts=2 sw=2 ft=sh et:
diff --git a/community/linux-tools/cpupower.rc b/community/linux-tools/cpupower.rc
index 812637b61..9b0bcddb7 100644
--- a/community/linux-tools/cpupower.rc
+++ b/community/linux-tools/cpupower.rc
@@ -8,19 +8,29 @@
case "$1" in
start|restart)
stat_busy "Setting cpupower rules"
+ declare -i fail=0
- declare params=''
- if [[ "$governor" ]]; then
- params="-g $governor "
- params+="${min_freq:+-d $min_freq} "
- params+="${max_freq:+-u $max_freq} "
- params+="${freq:+-f $freq} "
- cpupower frequency-set $params >/dev/null || { stat_fail; exit 1; }
- stat_done
- else
- stat_append ': Invalid configuration'
- stat_fail
+ # frequency-set options
+ declare -a params=()
+ params+=(${governor:+-g $governor})
+ params+=(${min_freq:+-d $min_freq})
+ params+=(${max_freq:+-u $max_freq})
+ params+=(${freq:+-f $freq})
+ if ((${#params[@]} > 0)); then
+ cpupower frequency-set "${params[@]}" >/dev/null || fail=1
fi
+
+ # set options
+ declare -a params=()
+ params+=(${mc_scheduler:+-m $mc_scheduler})
+ params+=(${smp_scheduler:+-s $smp_scheduler})
+ params+=(${perf_bias:+-b $perf_bias})
+ if ((${#params[@]} > 0)); then
+ cpupower set "${params[@]}" >/dev/null || fail=1
+ fi
+
+ # print failure if any
+ (($fail > 0)) && stat_fail && exit 1 || stat_done
;;
*)
echo "usage: $0 {start|restart}"
diff --git a/community/linux-tools/cpupower.service b/community/linux-tools/cpupower.service
new file mode 100644
index 000000000..f77cfdc97
--- /dev/null
+++ b/community/linux-tools/cpupower.service
@@ -0,0 +1,10 @@
+[Unit]
+Description=Apply cpupower configuration
+
+[Service]
+Type=oneshot
+ExecStart=/etc/rc.d/cpupower start
+RemainAfterExit=yes
+
+[Install]
+WantedBy=multi-user.target
diff --git a/community/percona-server/PKGBUILD b/community/percona-server/PKGBUILD
index 4a03ded15..3eea37da6 100644
--- a/community/percona-server/PKGBUILD
+++ b/community/percona-server/PKGBUILD
@@ -1,7 +1,7 @@
# Maintainer: Massimiliano Torromeo <massimiliano.torromeo@gmail.com>
pkgname=percona-server
-pkgver=5.5.18_rel23.0
+pkgver=5.5.19_rel24.0
pkgrel=1
pkgdesc="A backwards-compatible drop-in replacement for MySQL that provides improved performance, diagnostics and instrumentation, and manageability of the server"
arch=('i686' 'x86_64')
@@ -17,7 +17,7 @@ url="http://www.percona.com/software/percona-server/"
options=('!libtool' 'emptydirs')
backup=('etc/mysql/my.cnf')
install=percona.install
-source=("http://www.percona.com/redir/downloads/Percona-Server-${pkgver%.*_*}/Percona-Server-${pkgver/_rel/-}/Percona-Server-${pkgver/_/-}.tar.gz"
+source=("http://www.percona.com/downloads/Percona-Server-${pkgver%.*_*}/Percona-Server-${pkgver/_rel/-}/source/Percona-Server-${pkgver/_/-}.tar.gz"
'mysqld'
'my.cnf')
@@ -98,6 +98,6 @@ package() {
install -dm700 "${pkgdir}"/var/lib/mysql
}
-md5sums=('17b266f5c10d01838522188f313a1ead'
+md5sums=('eb8c21bbb8179e0a4709d51c037e682c'
'243864805611764a7e5883c1dba7afd8'
'1c949c0dbea5206af0db14942d9927b6')
diff --git a/community/redis/PKGBUILD b/community/redis/PKGBUILD
index 44788d319..1d6f2f102 100644
--- a/community/redis/PKGBUILD
+++ b/community/redis/PKGBUILD
@@ -1,10 +1,10 @@
-# $Id: PKGBUILD 61232 2011-12-25 17:05:47Z spupykin $
+# $Id: PKGBUILD 62009 2012-01-14 09:42:42Z spupykin $
# Maintainer: Sergej Pupykin <pupykin.s+arch@gmail.com>
# Maintainer: Jan-Erik Rediger <badboy at archlinux dot us>
# Contributor: nofxx <x@<nick>.com>
pkgname=redis
-pkgver=2.4.5
+pkgver=2.4.6
pkgrel=1
pkgdesc="Advanced key-value store"
arch=('i686' 'x86_64')
@@ -18,7 +18,7 @@ backup=("etc/redis.conf"
source=("http://redis.googlecode.com/files/${pkgname}-${pkgver}.tar.gz"
"redis.d"
"redis.logrotate")
-md5sums=('babeb1a1d05281b5e00ca0a519cfc3f9'
+md5sums=('41d394074bcde762872ecb5506f35aee'
'9726d06d0a0c60cb5d55a31b3dc1e55d'
'9e2d75b7a9dc421122d673fe520ef17f')
diff --git a/extra/gjs/PKGBUILD b/extra/gjs/PKGBUILD
index 37ba73ba9..b7dc6877c 100644
--- a/extra/gjs/PKGBUILD
+++ b/extra/gjs/PKGBUILD
@@ -1,7 +1,8 @@
-# $Id: PKGBUILD 139275 2011-10-01 18:57:14Z ibiru $
+# $Id: PKGBUILD 146616 2012-01-14 12:13:58Z ibiru $
# Maintainer: Ionut Biru <ibiru@archlinux.org>
+
pkgname=gjs
-pkgver=1.30.0
+pkgver=1.30.1
pkgrel=1
pkgdesc="Javascript Bindings for GNOME"
arch=('i686' 'x86_64')
@@ -9,17 +10,17 @@ url="http://live.gnome.org/Gjs"
license=('GPL')
depends=('cairo' 'dbus-glib' 'gobject-introspection' 'js')
options=('!libtool')
-source=(http://download.gnome.org/sources/${pkgname}/1.30/${pkgname}-${pkgver}.tar.xz)
-sha256sums=('ffe01980dd183abd96b2cc861d2e86ef12751d0a1af86daa4c491b82c74ac7b9')
+source=(http://download.gnome.org/sources/$pkgname/${pkgver%.*}/$pkgname-$pkgver.tar.xz)
+sha256sums=('f5db07ddf70458a33a5d0bdf83f84070fc234237ecb0d49a8676e67b52119a05')
build() {
- cd "${srcdir}/${pkgname}-${pkgver}"
+ cd "$srcdir/$pkgname-$pkgver"
sed -i 's|python|python2|' scripts/make-tests
./configure --prefix=/usr --disable-static
make
}
package() {
- cd "${srcdir}/${pkgname}-${pkgver}"
- make DESTDIR="${pkgdir}" install
+ cd "$srcdir/$pkgname-$pkgver"
+ make DESTDIR="$pkgdir" install
}
diff --git a/extra/libreoffice/PKGBUILD b/extra/libreoffice/PKGBUILD
index 125c5eb13..53a37e5c8 100644
--- a/extra/libreoffice/PKGBUILD
+++ b/extra/libreoffice/PKGBUILD
@@ -1,4 +1,4 @@
-# $Id: PKGBUILD 146473 2012-01-11 15:22:18Z stephane $
+# $Id: PKGBUILD 146608 2012-01-14 08:15:18Z andyrtr $
# Maintainer: AndyRTR <andyrtr@archlinux.org>
pkgbase="libreoffice"
@@ -35,9 +35,9 @@ pkgname=('libreoffice-common'
'libreoffice-extension-validator'
'libreoffice-extension-watch-window'
'libreoffice-extension-wiki-publisher')
-_LOver=3.4.4.2
-pkgver=3.4.4
-pkgrel=5
+_LOver=3.4.5.2
+pkgver=3.4.5
+pkgrel=1
arch=('i686' 'x86_64')
#_LO_tree="3.4"
_OFFICEUPD="340"
@@ -61,8 +61,11 @@ makedepends=( # makedepends
_mirror="http://download.documentfoundation.org/libreoffice/src/${pkgver}"
#_mirror="http://dev-builds.libreoffice.org/pre-releases/src"
+#_mirror="http://dev-builds.libreoffice.org/pre-releases-3-4/src"
_additional_source_url="http://hg.services.openoffice.org/binaries"
+_additional_source_url="http://dev-www.libreoffice.org/src"
source=(${_mirror}/${pkgbase}-{artwork,base,bootstrap,calc,components,extensions,extras,filters,help,impress,libs-core,libs-extern,libs-extern-sys,libs-gui,postprocess,sdk,testing,ure,writer}-${_LOver}.tar.bz2 #,translations
+ ${_additional_source_url}/f02578f5218f217a9f20e9c30e119c6a-boost_1_44_0.tar.bz2
${_additional_source_url}/1f24ab1d39f4a51faf22244c94a6203f-xmlsec1-1.2.14.tar.gz
${_additional_source_url}/35c94d2df8893241173de1d16b6034c0-swingExSrc.zip
${_additional_source_url}/798b2ffdc8bcfe7bca2cf92b62caf685-rhino1_5R5.zip
@@ -102,11 +105,9 @@ source=(${_mirror}/${pkgbase}-{artwork,base,bootstrap,calc,components,extensions
buildfix_boost.diff
buildfix_ct2n.diff
vbahelper.visibility.patch
- scp2-more-reasonable-file-access-rights.diff
- oracle-recognition.diff::http://cgit.freedesktop.org/libreoffice/core/patch/?id=549e54fb2f8113502743c443d6deadfe648dede1
- RemovetheoslSecuritygetHomeDircheck.diff::http://cgit.freedesktop.org/libreoffice/ure/patch/?id=bc9b86940a707e9e2e1076f2954f38075398b5d7
- gcc462_buildfix.diff)
+ scp2-more-reasonable-file-access-rights.diff)
noextract=(185d60944ea767075d27247c3162b3bc-unowinreg.dll
+ f02578f5218f217a9f20e9c30e119c6a-boost_1_44_0.tar.bz2
0ff7d225d087793c8c2c680d77aac3e7-mdds_0.5.3.tar.bz2
ada24d37d8d638b3d8a9985e80bc2978-source-9.0.0.7-bj.zip
798b2ffdc8bcfe7bca2cf92b62caf685-rhino1_5R5.zip
@@ -142,25 +143,26 @@ noextract=(185d60944ea767075d27247c3162b3bc-unowinreg.dll
dbaafd21de055e582d92d7d32fe9da13-gdocs_2.3.1.oxt
b7b2d0e04e142f26dd96119c80757d1f-oooblogger_0.1.oxt
90401bca927835b6fbae4a707ed187c8-nlpsolver-0.9.tar.bz2)
-md5sums=('be8b13f83045f0a53b69fe76d6d72e9c'
- 'db423cbb1cee416b718138044a5de930'
- '31944d2139d6d81ef1131bd513530621'
- 'f447fd4ffe54aab9561c6caa262754b3'
- '97fe698737a35c8803712d4e08007620'
- 'acff44d97a5106d9b53c747dabeb0800'
- '620d43a0b9f36388f423e030513864ef'
- '4c5b1ed870363eca2602f0cb42a8415a'
- '702c6ca31525d7d2c2ded86c77b0bd2e'
- 'ac9b3acf78f43c1395d0e2dedc860f30'
- 'd8d2c41cb86bc8ba2a07e001a5317abb'
- '4d4af2fc06dbe33ec2307df812f7abe1'
- '1398a566eb76598bf3005e187fc2386c'
- 'dd962d2d57f88b9e07e665adad3cabbc'
- 'fff0fc9cd16ef1eb2b2ed5d0a6e77f95'
- 'e54d41d39e63d04ac4a88ce79e37af98'
- 'dbc71403040f447683bf55d1f0be3cad'
- '69ce5b72f44b008d0e78767c5b1dbf39'
- '34a2e8ae6b81a042966740263c53e135'
+md5sums=('a75d7d4ebefb4c9a4bb256acf866fa81'
+ 'c1e2dabdf4cfcd5957779014a7f9787e'
+ '79c9c7fc208e7f56af09f284f261a7da'
+ 'c83a8a374d3d5cc83c6ac3b5ff613e46'
+ 'fa64799ebad8cbd2c160ac2f87bd5599'
+ 'b24fba57aa4185934e86a0a8db4a3433'
+ '4f98020088ab9b597fc21b617121bd47'
+ '3c3be7c5f923339c90b0d1d6ecad0243'
+ '3a0bb4bb096b7488533ed2ee466a2bc9'
+ 'f2b180aa1eff3884b4ca81c048f1e327'
+ 'a9af488ef92ad4442eafba874249c529'
+ 'db6a67c96a9090bc5e21b64e202a984e'
+ 'e00187ae0840e1f6a00fa3290cacf0d1'
+ '20fbf6cffd2b06e90a52105b75a57828'
+ '4af055f590732ec19a2534b2278ac49c'
+ 'c84693796d2b1d9c8269425b1fa53aef'
+ 'd4926dc27b6884656feec6753f4fdf22'
+ '770678ca19cca0f7985c1c82b2dccf48'
+ '97a1e3de430b124faf35bf334248ad53'
+ 'f02578f5218f217a9f20e9c30e119c6a'
'1f24ab1d39f4a51faf22244c94a6203f'
'35c94d2df8893241173de1d16b6034c0'
'798b2ffdc8bcfe7bca2cf92b62caf685'
@@ -200,10 +202,7 @@ md5sums=('be8b13f83045f0a53b69fe76d6d72e9c'
'bc228237108cab7745897a9f466b6d39'
'eee273f501ff45dc5f1365e78c6d57c0'
'43b145db28e6c0d73578ae6fd35e510d'
- '37638431e7e40baf2e47966ebb9bc0e9'
- '3c6c62e77c30649a3dfe73512947cc9a'
- 'eb35d4c715e0dfc23bbc706996033829'
- '10600d04ee81014bc9b5cc04e615d799')
+ '37638431e7e40baf2e47966ebb9bc0e9')
build() {
@@ -233,10 +232,6 @@ build() {
patch -Np1 -i ${srcdir}/buildfix_ct2n.diff
patch -Np0 -i ${srcdir}/vbahelper.visibility.patch
patch -Np0 -i ${srcdir}/scp2-more-reasonable-file-access-rights.diff
- patch -Np1 -i ${srcdir}/oracle-recognition.diff
- patch -Np1 -i ${srcdir}/RemovetheoslSecuritygetHomeDircheck.diff
- # https://www.libreoffice.org/bugzilla/show_bug.cgi?id=43139
- patch -Np1 -i ${srcdir}/gcc462_buildfix.diff
# unset C(XX)FLAGS
# http://www.openoffice.org/issues/show_bug.cgi?id=103205
@@ -290,7 +285,6 @@ build() {
--enable-lockdown\
--enable-opengl \
--enable-odk\
- --enable-opengl\
--enable-ext-barcode \
--enable-ext-diagram \
--enable-ext-google-docs \
@@ -333,7 +327,7 @@ build() {
--with-external-libtextcat-data \
--with-openldap\
--with-ant-home="/usr/share/java/apache-ant"\
- --with-system-boost\
+ --without-system-boost\
--with-system-cairo\
--with-system-libs\
--with-system-mozilla\
diff --git a/extra/qtwebkit/PKGBUILD b/extra/qtwebkit/PKGBUILD
index 84a006909..c0c13dd98 100644
--- a/extra/qtwebkit/PKGBUILD
+++ b/extra/qtwebkit/PKGBUILD
@@ -1,9 +1,9 @@
-# $Id: PKGBUILD 145469 2011-12-22 22:02:51Z andrea $
+# $Id: PKGBUILD 146627 2012-01-14 15:25:15Z andrea $
# Maintainer: Andrea Scarpino <andrea@archlinux.org>
pkgname=qtwebkit
pkgver=2.2.1
-pkgrel=1
+pkgrel=2
arch=('i686' 'x86_64')
url='http://trac.webkit.org/wiki/QtWebKit'
pkgdesc='An open source web browser engine (Qt port)'
@@ -13,8 +13,10 @@ makedepends=('python2' 'mesa' 'chrpath')
conflicts=('qt<4.8')
#source=("http://get.qt.nokia.com/${pkgname}/QtWebKit-${pkgver}.tar.gz"
source=("ftp://ftp.archlinux.org/other/${pkgname}/QtWebKit-${pkgver}.tar.gz"
+ "ftp://ftp.archlinux.org/other/${pkgname}/qwebview-4.8.0.tar.bz2"
'python2-path.patch')
sha1sums=('283fc116882157df0474af496be73bb9b34cb001'
+ '0e44b27a0f71aceb91a89a2c28ab6331126518d9'
'b0ef3d5596171e3900a685df9bcfac3068ad6330')
build() {
@@ -28,6 +30,11 @@ build() {
--makeargs="${MAKEFLAGS}" \
--release \
--3d-canvas
+
+ # Build the QWebView plugin (FS#27914)
+ cd "${srcdir}"/QtWebKit-${pkgver}/qwebview-4.8.0/plugins/qwebview
+ qmake
+ make
}
package() {
@@ -36,4 +43,7 @@ package() {
# Fix RPATH
chrpath -r /usr/lib/ "${pkgdir}"/usr/lib/qt/imports/QtWebKit/libqmlwebkitplugin.so
+
+ cd "${srcdir}"/QtWebKit-${pkgver}/qwebview-4.8.0/plugins/qwebview
+ make INSTALL_ROOT="${pkgdir}" install
}
diff --git a/extra/ristretto/PKGBUILD b/extra/ristretto/PKGBUILD
index 7bd21048b..3c45bbd56 100644
--- a/extra/ristretto/PKGBUILD
+++ b/extra/ristretto/PKGBUILD
@@ -1,10 +1,10 @@
-# $Id: PKGBUILD 144969 2011-12-12 17:23:28Z andrea $
+# $Id: PKGBUILD 146610 2012-01-14 08:51:04Z eric $
# Maintainer:
# Contributor: AndyRTR <andyrtr@archlinux.org>
# Contributor: Ronald van Haren <ronald.archlinux.org>
pkgname=ristretto
-pkgver=0.3.0
+pkgver=0.3.1
pkgrel=1
pkgdesc="A fast and lightweight picture-viewer for Xfce"
arch=('i686' 'x86_64')
@@ -15,7 +15,7 @@ makedepends=('intltool')
groups=('xfce4-goodies')
install=ristretto.install
source=("http://archive.xfce.org/src/apps/$pkgname/${pkgver%.*}/$pkgname-$pkgver.tar.bz2")
-sha1sums=('c7034ad543bea3c1b99a2336dcee9d5ba480b2bb')
+sha1sums=('1a0c4a5f0edf6594d14c7e24fb41a6127c4c1774')
build() {
cd "${srcdir}/$pkgname-$pkgver"
diff --git a/multilib-staging/binutils-multilib/PKGBUILD b/multilib-staging/binutils-multilib/PKGBUILD
new file mode 100644
index 000000000..4b8a09454
--- /dev/null
+++ b/multilib-staging/binutils-multilib/PKGBUILD
@@ -0,0 +1,79 @@
+# $Id: PKGBUILD 62031 2012-01-14 21:44:56Z heftig $
+# Maintainer: Jan "heftig" Steffens <jan.steffens@gmail.com>
+# Contributor: Allan McRae <allan@archlinux.org>
+
+# toolchain build order: linux-api-headers->glibc->binutils->gcc->binutils->glibc
+
+pkgname=binutils-multilib
+pkgver=2.22
+pkgrel=4.1
+_date=20111227
+pkgdesc="A set of programs to assemble and manipulate binary and object files for multilib"
+arch=('x86_64')
+url="http://www.gnu.org/software/binutils/"
+license=('GPL')
+groups=('multilib-devel')
+provides=("binutils=$pkgver-$pkgrel")
+conflicts=('binutils')
+depends=('glibc>=2.14' 'zlib')
+makedepends=('dejagnu' 'gcc-multilib') # Make sure we compile this with gcc-multilib
+options=('!libtool' '!distcc' '!ccache')
+install=binutils.install
+source=(http://mirrors.kernel.org/archlinux/other/binutils/binutils-${pkgver}_${_date}.tar.bz2)
+md5sums=('c2377089c15bb1a1bfaeca8d0e59dd4d')
+
+build() {
+ cd ${srcdir}
+ mkdir binutils-build && cd binutils-build
+
+ ${srcdir}/binutils/configure --prefix=/usr \
+ --enable-ld=default --enable-gold \
+ --enable-plugins --enable-threads \
+ --enable-shared \
+ --enable-64-bit-bfd --enable-multilib
+
+ # check the host environment and makes sure all the necessary tools are available
+ make configure-host
+
+ make tooldir=${pkgdir}/usr
+
+ # Rebuild libiberty.a with -fPIC
+ cp -a libiberty libiberty-pic
+ make -C libiberty-pic clean
+ make CFLAGS="$CFLAGS -fPIC" -C libiberty-pic
+
+ # Rebuild libbfd.a with -fPIC
+ # hidden visability prevent 3rd party shared libraries exporting bfd non-stable API
+ cp -a bfd bfd-pic
+ make -C bfd-pic clean
+ make CFLAGS="$CFLAGS -fPIC -fvisibility=hidden" -C bfd-pic
+}
+
+check() {
+ cd ${srcdir}/binutils-build
+
+ # do not abort on errors - manually check log files
+ make -k -j1 check || true
+}
+
+package() {
+ cd ${srcdir}/binutils-build
+ make prefix=${pkgdir}/usr tooldir=${pkgdir}/usr install
+
+ # Add some useful headers
+ install -m644 ${srcdir}/binutils/include/libiberty.h ${pkgdir}/usr/include
+ install -m644 ${srcdir}/binutils/include/demangle.h ${pkgdir}/usr/include
+
+ # install libraries rebuilt with -fPIC
+ install -m644 libiberty-pic/libiberty.a ${pkgdir}/usr/lib
+ install -m644 bfd-pic/libbfd.a ${pkgdir}/usr/lib
+
+ # Remove Windows/Novell specific man pages
+ rm -f ${pkgdir}/usr/share/man/man1/{dlltool,nlmconv,windres,windmc}*
+
+ # Remove these symlinks, they are not ABI stable.
+ # Programs should compile static to the .a file.
+ rm -f ${pkgdir}/usr/lib/lib{bfd,opcodes}.so
+ echo "INPUT ( /usr/lib/libbfd.a -liberty -lz )" >${pkgdir}/usr/lib/libbfd.so
+ echo "INPUT ( /usr/lib/libopcodes.a -lbfd )" >${pkgdir}/usr/lib/libopcodes.so
+}
diff --git a/multilib-staging/binutils-multilib/binutils.install b/multilib-staging/binutils-multilib/binutils.install
new file mode 100644
index 000000000..8bf9f3a47
--- /dev/null
+++ b/multilib-staging/binutils-multilib/binutils.install
@@ -0,0 +1,17 @@
+infodir=usr/share/info
+filelist=(as.info bfd.info binutils.info configure.info gprof.info ld.info standards.info)
+
+post_upgrade() {
+ [ -x usr/bin/install-info ] || return 0
+ for file in ${filelist[@]}; do
+ install-info $infodir/$file.gz $infodir/dir 2> /dev/null
+ done
+}
+
+pre_remove() {
+ [ -x usr/bin/install-info ] || return 0
+ for file in ${filelist[@]}; do
+ install-info --delete $infodir/$file.gz $infodir/dir 2> /dev/null
+ done
+}
+
diff --git a/multilib-staging/chuck/PKGBUILD b/multilib-staging/chuck/PKGBUILD
new file mode 100644
index 000000000..333d7f73d
--- /dev/null
+++ b/multilib-staging/chuck/PKGBUILD
@@ -0,0 +1,41 @@
+# $Id: PKGBUILD 62037 2012-01-14 23:38:40Z heftig $
+# Maintainer: Brad Fanella <bradfanella@archlinux.us>
+# Contributor: SpepS <dreamspepser at yahoo dot it>
+# Contributor: Jeff Mickey <jeff@archlinux.org>
+# Contributor: tardo <tardo@nagi-fanboi.net>
+
+pkgname=chuck
+pkgver=1.2.1.3
+pkgrel=5.1
+pkgdesc="Concurrent, on-the-fly audio programming language."
+arch=('i686' 'x86_64')
+url="http://chuck.cs.princeton.edu/"
+license=('GPL')
+depends=('gcc-libs' 'libsndfile' 'alsa-lib')
+makedepends=('bison' 'flex')
+source=(http://chuck.cs.princeton.edu/release/files/$pkgname-$pkgver.tgz)
+md5sums=('ac8459b4067c2491fbdeb61d122a5985')
+
+if [[ $CARCH == x86_64 ]]; then
+ depends=('lib32-gcc-libs' 'lib32-libsndfile' 'lib32-alsa-lib')
+ makedepends+=('gcc-multilib')
+fi
+
+build() {
+ if [[ $CARCH == x86_64 ]]; then
+ export CC='gcc -m32'
+ export CXX='g++ -m32'
+ export PKG_CONFIG_PATH=/usr/lib32/pkgconfig
+ fi
+
+ cd $srcdir/$pkgname-$pkgver/src
+ CFLAGS="$CFLAGS -fno-strict-aliasing"
+
+ # This can be linux-alsa linux-jack linux-oss osx win32
+ make linux-alsa
+}
+
+package() {
+ cd $srcdir/$pkgname-$pkgver/src
+ install -D -m 755 chuck $pkgdir/usr/bin/chuck
+}
diff --git a/multilib-staging/gcc-multilib/PKGBUILD b/multilib-staging/gcc-multilib/PKGBUILD
new file mode 100644
index 000000000..7fed692d9
--- /dev/null
+++ b/multilib-staging/gcc-multilib/PKGBUILD
@@ -0,0 +1,303 @@
+# $Id: PKGBUILD 62033 2012-01-14 22:04:04Z heftig $
+# Maintainer: Jan "heftig" Steffens <jan.steffens@gmail.com>
+# Contributor: Allan McRae <allan@archlinux.org>
+
+# toolchain build order: linux-api-headers->glibc->binutils->gcc->binutils->glibc
+# NOTE: libtool requires rebuilt with each new gcc version
+
+pkgbase='gcc-multilib'
+pkgname=('gcc-multilib' 'gcc-libs-multilib' 'lib32-gcc-libs' 'gcc-fortran-multilib' 'gcc-objc-multilib' 'gcc-ada-multilib' 'gcc-go-multilib')
+pkgver=4.6.2
+pkgrel=5.1
+_snapshot=4.6-20111223
+_libstdcppmanver=20111215
+pkgdesc="The GNU Compiler Collection for multilib"
+arch=('x86_64')
+license=('GPL' 'LGPL' 'FDL' 'custom')
+url="http://gcc.gnu.org"
+makedepends=('binutils-multilib>=2.22' 'libmpc' 'cloog' 'ppl' 'gcc-ada-multilib'
+ 'lib32-glibc>=2.14')
+checkdepends=('dejagnu')
+options=('!libtool' '!emptydirs')
+source=(#ftp://gcc.gnu.org/pub/gcc/releases/gcc-${pkgver}/gcc-${pkgver}.tar.bz2
+ ftp://gcc.gnu.org/pub/gcc/snapshots/${_snapshot}/gcc-${_snapshot}.tar.bz2
+ ftp://gcc.gnu.org/pub/gcc/libstdc++/doxygen/libstdc++-man.${_libstdcppmanver}.tar.bz2
+ gcc_pure64-multilib.patch
+ gcc-hash-style-both.patch)
+md5sums=('4755b9f6ac0abecbaa2097ed9738406a'
+ '450772ce32daed97d7383199f8797f33'
+ '7da5b7ab75b3c29993f953b18bc38579'
+ '4df25b623799b148a0703eaeec8fdf3f')
+
+if [ -n "${_snapshot}" ]; then
+ _basedir="${srcdir}/gcc-${_snapshot}"
+else
+ _basedir="${srcdir}/gcc-${pkgver}"
+fi
+
+build() {
+ cd ${_basedir}
+
+ # Do not install libiberty
+ sed -i 's/install_to_$(INSTALL_DEST) //' libiberty/Makefile.in
+
+ # Do not run fixincludes
+ sed -i 's@\./fixinc\.sh@-c true@' gcc/Makefile.in
+
+ patch -Np1 -i ${srcdir}/gcc_pure64-multilib.patch
+ patch -Np0 -i ${srcdir}/gcc-hash-style-both.patch
+
+ echo ${pkgver} > gcc/BASE-VER
+
+ cd ${srcdir}
+ mkdir gcc-build && cd gcc-build
+
+ ${_basedir}/configure --prefix=/usr \
+ --libdir=/usr/lib --libexecdir=/usr/lib \
+ --mandir=/usr/share/man --infodir=/usr/share/info \
+ --with-bugurl=https://bugs.archlinux.org/ \
+ --enable-languages=c,c++,ada,fortran,go,lto,objc,obj-c++ \
+ --enable-shared --enable-threads=posix \
+ --with-system-zlib --enable-__cxa_atexit \
+ --disable-libunwind-exceptions --enable-clocale=gnu \
+ --enable-gnu-unique-object --enable-linker-build-id \
+ --with-ppl --enable-cloog-backend=isl \
+ --enable-lto --enable-gold --enable-ld=default \
+ --enable-plugin --with-plugin-ld=ld.gold \
+ --enable-multilib --disable-libssp --disable-libstdcxx-pch \
+ --enable-checking=release --with-fpmath=sse
+ make
+}
+
+check() {
+ cd gcc-build
+
+ # increase stack size to prevent test failures
+ # http://gcc.gnu.org/bugzilla/show_bug.cgi?id=31827
+ ulimit -s 32768
+
+ # do not abort on error as some are "expected"
+ make -k check || true
+ ${_basedir}/contrib/test_summary
+}
+
+package_gcc-libs-multilib()
+{
+ pkgdesc="Runtime libraries shipped by GCC for multilib"
+ depends=('glibc>=2.14' "lib32-gcc-libs=$pkgver-$pkgrel")
+ provides=("gcc-libs=$pkgver-$pkgrel")
+ conflicts=('gcc-libs')
+ install=gcc-libs.install
+
+ cd gcc-build
+ make -j1 -C $CHOST/libgcc DESTDIR=${pkgdir} install-shared
+ for lib in libmudflap libgomp libstdc++-v3/src; do
+ make -j1 -C $CHOST/$lib DESTDIR=${pkgdir} install-toolexeclibLTLIBRARIES
+ done
+ make -j1 -C $CHOST/libstdc++-v3/po DESTDIR=${pkgdir} install
+ make -j1 -C $CHOST/libgomp DESTDIR=${pkgdir} install-info
+
+ make -j1 DESTDIR=${pkgdir} install-target-libquadmath
+ make -j1 DESTDIR=${pkgdir} install-target-libgfortran
+ make -j1 DESTDIR=${pkgdir} install-target-libobjc
+
+ # remove unnecessary files installed by install-target-{libquadmath,libgfortran,libobjc}
+ rm -rf ${pkgdir}/usr/lib/{gcc/,libgfortran.spec}
+
+ # remove stuff in lib32-gcc-libs
+ rm -rf ${pkgdir}/usr/lib32
+
+ # remove static libraries
+ find ${pkgdir} -name *.a -delete
+
+ # Install Runtime Library Exception
+ install -Dm644 ${_basedir}/COPYING.RUNTIME \
+ ${pkgdir}/usr/share/licenses/gcc-libs-multilib/RUNTIME.LIBRARY.EXCEPTION
+}
+
+package_lib32-gcc-libs()
+{
+ pkgdesc="Runtime libraries shipped by GCC (32-bit)"
+ depends=('lib32-glibc>=2.14' "gcc-libs>=$pkgver")
+
+ cd gcc-build
+ make -j1 -C $CHOST/32/libgcc DESTDIR=${pkgdir} install-shared
+ for lib in libmudflap libgomp libstdc++-v3/src; do
+ make -j1 -C $CHOST/32/$lib DESTDIR=${pkgdir} install-toolexeclibLTLIBRARIES
+ done
+
+ make -j1 DESTDIR=${pkgdir} install-target-libquadmath
+ make -j1 DESTDIR=${pkgdir} install-target-libgfortran
+ make -j1 DESTDIR=${pkgdir} install-target-libobjc
+
+ # remove unnecessary files installed by install-target-{libquadmath,libgfortran,libobjc}
+ rm ${pkgdir}/usr/lib32/libgfortran.spec
+
+ # remove stuff in gcc-libs-multilib
+ rm -rf ${pkgdir}/usr/lib
+ rm -rf ${pkgdir}/usr/share/info
+
+ # remove static libraries
+ find ${pkgdir} -name *.a -delete
+
+ # Install Runtime Library Exception
+ install -Dm644 ${_basedir}/COPYING.RUNTIME \
+ ${pkgdir}/usr/share/licenses/lib32-gcc-libs/RUNTIME.LIBRARY.EXCEPTION
+}
+
+package_gcc-multilib()
+{
+ pkgdesc="The GNU Compiler Collection - C and C++ frontends for multilib"
+ depends=("gcc-libs-multilib=$pkgver-$pkgrel" 'binutils-multilib>=2.22' 'libmpc' 'cloog' 'ppl')
+ groups=('multilib-devel')
+ provides=("gcc=$pkgver-$pkgrel")
+ conflicts=('gcc')
+ install=gcc.install
+
+ cd gcc-build
+
+ # unfortunately it is much, much easier to install the lot and clean-up the mess...
+ make -j1 DESTDIR=${pkgdir} install
+ rm $pkgdir/usr/bin/{{$CHOST-,}gfortran,{$CHOST-,}gccgo,gnat*}
+ rm $pkgdir/usr/lib{,32}/*.so*
+ rm $pkgdir/usr/lib{,32}/lib{ffi,gfortran,go{,begin},objc,quadmath}.a
+ rm $pkgdir/usr/lib{,32}/libgfortran.spec
+ rm -r $pkgdir/usr/lib/gcc/$CHOST/${pkgver}/{{,32/}ada{include,lib},finclude,include/objc}
+ rm $pkgdir/usr/lib/gcc/$CHOST/${pkgver}/include/{ffi{,target}.h,quadmath{,_weak}.h}
+ rm $pkgdir/usr/lib/gcc/$CHOST/${pkgver}/{cc1obj{,plus},f951,gnat1,go1,{,32/}libgfortranbegin.a}
+ rm -r $pkgdir/usr/lib{,32}/go
+ rm $pkgdir/usr/share/info/{gccgo,gfortran,gnat*,libgomp,libquadmath}.info
+ rm $pkgdir/usr/share/locale/{de,fr}/LC_MESSAGES/libstdc++.mo
+ rm $pkgdir/usr/share/man/man1/{gccgo,gfortran}.1
+ rm $pkgdir/usr/share/man/man3/ffi*
+
+ # many packages require these symlinks
+ install -dm755 ${pkgdir}/lib
+ ln -sf /usr/bin/cpp ${pkgdir}/lib/cpp
+ ln -sf gcc ${pkgdir}/usr/bin/cc
+ ln -sf g++ ${pkgdir}/usr/bin/c++
+
+ # install gengtype for plugin support
+ install -m755 gcc/build/gengtype $pkgdir/usr/lib/gcc/$CHOST/${pkgver}/
+ install -m644 gcc/gtype.state $pkgdir/usr/lib/gcc/$CHOST/${pkgver}/
+
+ # POSIX conformance launcher scripts for c89 and c99
+ cat > $pkgdir/usr/bin/c89 <<"EOF"
+#!/bin/sh
+fl="-std=c89"
+for opt; do
+ case "$opt" in
+ -ansi|-std=c89|-std=iso9899:1990) fl="";;
+ -std=*) echo "`basename $0` called with non ANSI/ISO C option $opt" >&2
+ exit 1;;
+ esac
+done
+exec gcc $fl ${1+"$@"}
+EOF
+
+ cat > $pkgdir/usr/bin/c99 <<"EOF"
+#!/bin/sh
+fl="-std=c99"
+for opt; do
+ case "$opt" in
+ -std=c99|-std=iso9899:1999) fl="";;
+ -std=*) echo "`basename $0` called with non ISO C99 option $opt" >&2
+ exit 1;;
+ esac
+done
+exec gcc $fl ${1+"$@"}
+EOF
+
+ chmod 755 $pkgdir/usr/bin/c{8,9}9
+
+ # install the libstdc++ man pages
+ install -dm755 ${pkgdir}/usr/share/man/man3
+ install -m644 ${srcdir}/man3/* ${pkgdir}/usr/share/man/man3/
+
+ # Install Runtime Library Exception
+ install -Dm644 ${_basedir}/COPYING.RUNTIME \
+ ${pkgdir}/usr/share/licenses/gcc-multilib/RUNTIME.LIBRARY.EXCEPTION
+}
+
+package_gcc-fortran-multilib()
+{
+ pkgdesc="Fortran front-end for GCC for multilib"
+ depends=("gcc-multilib=$pkgver-$pkgrel")
+ provides=("gcc-fortran=$pkgver-$pkgrel")
+ conflicts=('gcc-fortran')
+ install=gcc-fortran.install
+
+ cd gcc-build
+ make -j1 DESTDIR=${pkgdir} install-target-libquadmath
+ make -j1 DESTDIR=$pkgdir install-target-libgfortran
+ make -j1 -C $CHOST/libgomp DESTDIR=$pkgdir install-nodist_fincludeHEADERS
+ make -j1 -C gcc DESTDIR=$pkgdir fortran.install-{common,man,info}
+ install -Dm755 gcc/f951 $pkgdir/usr/lib/gcc/$CHOST/$pkgver/f951
+
+ # remove libraries included in gcc-libs
+ rm ${pkgdir}/usr/lib{,32}/lib{gfortran,quadmath}.so*
+ rm ${pkgdir}/usr/share/info/libquadmath.info
+
+ # Install Runtime Library Exception
+ install -Dm644 ${_basedir}/COPYING.RUNTIME \
+ ${pkgdir}/usr/share/licenses/gcc-fortran-multilib/RUNTIME.LIBRARY.EXCEPTION
+}
+
+package_gcc-objc-multilib()
+{
+ pkgdesc="Objective-C front-end for GCC for multilib"
+ depends=("gcc-multilib=$pkgver-$pkgrel")
+ provides=("gcc-objc=$pkgver-$pkgrel")
+ conflicts=('gcc-objc')
+
+ cd gcc-build
+ make -j1 DESTDIR=$pkgdir install-target-libobjc
+ install -dm755 $pkgdir/usr/lib/gcc/$CHOST/$pkgver/
+ install -m755 gcc/cc1obj{,plus} $pkgdir/usr/lib/gcc/$CHOST/$pkgver/
+
+ # remove libraries included in gcc-libs
+ rm ${pkgdir}/usr/lib{,32}/libobjc.so*
+
+ # Install Runtime Library Exception
+ install -Dm644 ${_basedir}/COPYING.RUNTIME \
+ ${pkgdir}/usr/share/licenses/gcc-objc-multilib/RUNTIME.LIBRARY.EXCEPTION
+}
+
+package_gcc-ada-multilib()
+{
+ pkgdesc="Ada front-end for GCC (GNAT) for multilib"
+ depends=("gcc-multilib=$pkgver-$pkgrel")
+ provides=("gcc-ada=$pkgver-$pkgrel")
+ conflicts=('gcc-ada')
+ install=gcc-ada.install
+
+ cd gcc-build/gcc
+ make -j1 DESTDIR=$pkgdir ada.install-{common,info}
+ install -m755 gnat1 $pkgdir/usr/lib/gcc/$CHOST/$pkgver
+
+ cd ../$CHOST/32/libada
+ make -j1 DESTDIR=${pkgdir} INSTALL="install" \
+ INSTALL_DATA="install -m644" install-gnatlib
+
+ # Install Runtime Library Exception
+ install -Dm644 ${_basedir}/COPYING.RUNTIME \
+ ${pkgdir}/usr/share/licenses/gcc-ada-multilib/RUNTIME.LIBRARY.EXCEPTION
+}
+
+package_gcc-go-multilib()
+{
+ pkgdesc="Go front-end for GCC for multilib"
+ depends=("gcc-multilib=$pkgver-$pkgrel")
+ provides=("gcc-go=$pkgver-$pkgrel")
+ conflicts=('gcc-go')
+ install=gcc-go.install
+
+ cd gcc-build
+ make -j1 DESTDIR=$pkgdir install-target-libgo
+ make -j1 -C gcc DESTDIR=$pkgdir go.install-{common,man,info}
+ install -Dm755 gcc/go1 $pkgdir/usr/lib/gcc/$CHOST/$pkgver/go1
+
+ # Install Runtime Library Exception
+ install -Dm644 ${_basedir}/COPYING.RUNTIME \
+ ${pkgdir}/usr/share/licenses/gcc-go/RUNTIME.LIBRARY.EXCEPTION
+}
diff --git a/multilib-staging/gcc-multilib/gcc-ada.install b/multilib-staging/gcc-multilib/gcc-ada.install
new file mode 100644
index 000000000..df0553a4f
--- /dev/null
+++ b/multilib-staging/gcc-multilib/gcc-ada.install
@@ -0,0 +1,20 @@
+infodir=usr/share/info
+filelist=(gnat-style.info gnat_rm.info gnat_ugn.info)
+
+post_install() {
+ [ -x usr/bin/install-info ] || return 0
+ for file in ${filelist[@]}; do
+ install-info $infodir/$file.gz $infodir/dir 2> /dev/null
+ done
+}
+
+post_upgrade() {
+ post_install $1
+}
+
+pre_remove() {
+ [ -x usr/bin/install-info ] || return 0
+ for file in ${filelist[@]}; do
+ install-info --delete $infodir/$file.gz $infodir/dir 2> /dev/null
+ done
+}
diff --git a/multilib-staging/gcc-multilib/gcc-fortran.install b/multilib-staging/gcc-multilib/gcc-fortran.install
new file mode 100644
index 000000000..b15d89a97
--- /dev/null
+++ b/multilib-staging/gcc-multilib/gcc-fortran.install
@@ -0,0 +1,16 @@
+infodir=usr/share/info
+file="gfortran.info"
+
+post_install() {
+ [ -x usr/bin/install-info ] || return 0
+ install-info $infodir/$file.gz $infodir/dir 2> /dev/null
+}
+
+post_upgrade() {
+ post_install $1
+}
+
+pre_remove() {
+ [ -x usr/bin/install-info ] || return 0
+ install-info --delete $infodir/$file.gz $infodir/dir 2> /dev/null
+}
diff --git a/multilib-staging/gcc-multilib/gcc-go.install b/multilib-staging/gcc-multilib/gcc-go.install
new file mode 100644
index 000000000..7dc50dee5
--- /dev/null
+++ b/multilib-staging/gcc-multilib/gcc-go.install
@@ -0,0 +1,20 @@
+infodir=usr/share/info
+filelist=(gccgo.info)
+
+post_install() {
+ [ -x usr/bin/install-info ] || return 0
+ for file in ${filelist[@]}; do
+ install-info $infodir/$file.gz $infodir/dir 2> /dev/null
+ done
+}
+
+post_upgrade() {
+ post_install $1
+}
+
+pre_remove() {
+ [ -x usr/bin/install-info ] || return 0
+ for file in ${filelist[@]}; do
+ install-info --delete $infodir/$file.gz $infodir/dir 2> /dev/null
+ done
+}
diff --git a/multilib-staging/gcc-multilib/gcc-hash-style-both.patch b/multilib-staging/gcc-multilib/gcc-hash-style-both.patch
new file mode 100644
index 000000000..8b59f4535
--- /dev/null
+++ b/multilib-staging/gcc-multilib/gcc-hash-style-both.patch
@@ -0,0 +1,122 @@
+--- gcc/config/alpha/linux-elf.h.orig 2010-12-09 23:27:07.000000000 +1000
++++ gcc/config/alpha/linux-elf.h 2011-03-11 10:01:47.770000457 +1000
+@@ -41,7 +41,7 @@
+
+ #define ELF_DYNAMIC_LINKER LINUX_DYNAMIC_LINKER
+
+-#define LINK_SPEC "-m elf64alpha %{G*} %{relax:-relax} \
++#define LINK_SPEC "-m elf64alpha --hash-style=both %{G*} %{relax:-relax} \
+ %{O*:-O3} %{!O*:-O1} \
+ %{shared:-shared} \
+ %{!shared: \
+--- gcc/config/i386/linux64.h.orig 2011-03-03 08:35:36.000000000 +1000
++++ gcc/config/i386/linux64.h 2011-03-11 10:01:47.770000457 +1000
+@@ -78,7 +78,7 @@
+ %{!mno-sse2avx:%{mavx:-msse2avx}} %{msse2avx:%{!mavx:-msse2avx}}"
+
+ #undef LINK_SPEC
+-#define LINK_SPEC "%{" SPEC_64 ":-m elf_x86_64} %{" SPEC_32 ":-m elf_i386} \
++#define LINK_SPEC "%{" SPEC_64 ":-m elf_x86_64} %{" SPEC_32 ":-m elf_i386} --hash-style=both \
+ %{shared:-shared} \
+ %{!shared: \
+ %{!static: \
+--- gcc/config/i386/linux.h.orig 2011-01-15 04:45:06.000000000 +1000
++++ gcc/config/i386/linux.h 2011-03-11 10:01:47.770000457 +1000
+@@ -104,7 +104,7 @@
+ { "dynamic_linker", LINUX_DYNAMIC_LINKER }
+
+ #undef LINK_SPEC
+-#define LINK_SPEC "-m %(link_emulation) %{shared:-shared} \
++#define LINK_SPEC "-m %(link_emulation) --hash-style=both %{shared:-shared} \
+ %{!shared: \
+ %{!static: \
+ %{rdynamic:-export-dynamic} \
+--- gcc/config/ia64/linux.h.orig 2010-12-09 23:27:07.000000000 +1000
++++ gcc/config/ia64/linux.h 2011-03-11 10:01:47.770000457 +1000
+@@ -64,7 +64,7 @@
+ #define GLIBC_DYNAMIC_LINKER "/lib/ld-linux-ia64.so.2"
+
+ #undef LINK_SPEC
+-#define LINK_SPEC "\
++#define LINK_SPEC "--hash-style=both \
+ %{shared:-shared} \
+ %{!shared: \
+ %{!static: \
+--- gcc/config/rs6000/linux64.h.orig 2011-02-11 03:30:10.000000000 +1000
++++ gcc/config/rs6000/linux64.h 2011-03-11 10:03:34.280000457 +1000
+@@ -389,11 +389,11 @@
+ CHOOSE_DYNAMIC_LINKER (GLIBC_DYNAMIC_LINKER64, UCLIBC_DYNAMIC_LINKER64)
+
+
+-#define LINK_OS_LINUX_SPEC32 "-m elf32ppclinux %{!shared: %{!static: \
++#define LINK_OS_LINUX_SPEC32 "-m elf32ppclinux --hash-style=both %{!shared: %{!static: \
+ %{rdynamic:-export-dynamic} \
+ -dynamic-linker " LINUX_DYNAMIC_LINKER32 "}}"
+
+-#define LINK_OS_LINUX_SPEC64 "-m elf64ppc %{!shared: %{!static: \
++#define LINK_OS_LINUX_SPEC64 "-m elf64ppc --hash-style=both %{!shared: %{!static: \
+ %{rdynamic:-export-dynamic} \
+ -dynamic-linker " LINUX_DYNAMIC_LINKER64 "}}"
+
+--- gcc/config/rs6000/sysv4.h.orig 2011-01-28 04:36:03.000000000 +1000
++++ gcc/config/rs6000/sysv4.h 2011-03-11 10:01:47.773333792 +1000
+@@ -830,7 +830,7 @@
+ #define LINUX_DYNAMIC_LINKER \
+ CHOOSE_DYNAMIC_LINKER (GLIBC_DYNAMIC_LINKER, UCLIBC_DYNAMIC_LINKER)
+
+-#define LINK_OS_LINUX_SPEC "-m elf32ppclinux %{!shared: %{!static: \
++#define LINK_OS_LINUX_SPEC "-m elf32ppclinux --hash-style=both %{!shared: %{!static: \
+ %{rdynamic:-export-dynamic} \
+ -dynamic-linker " LINUX_DYNAMIC_LINKER "}}"
+
+--- gcc/config/s390/linux.h.orig 2010-12-09 23:27:07.000000000 +1000
++++ gcc/config/s390/linux.h 2011-03-11 10:01:47.770000457 +1000
+@@ -77,7 +77,7 @@
+
+ #undef LINK_SPEC
+ #define LINK_SPEC \
+- "%{m31:-m elf_s390}%{m64:-m elf64_s390} \
++ "%{m31:-m elf_s390}%{m64:-m elf64_s390} --hash-style=both \
+ %{shared:-shared} \
+ %{!shared: \
+ %{static:-static} \
+--- gcc/config/sparc/linux64.h.orig 2011-02-17 23:57:21.000000000 +1000
++++ gcc/config/sparc/linux64.h 2011-03-11 10:01:47.770000457 +1000
+@@ -113,7 +113,7 @@
+ { "link_arch_default", LINK_ARCH_DEFAULT_SPEC }, \
+ { "link_arch", LINK_ARCH_SPEC },
+
+-#define LINK_ARCH32_SPEC "-m elf32_sparc -Y P,%R/usr/lib %{shared:-shared} \
++#define LINK_ARCH32_SPEC "-m elf32_sparc --hash-style=both -Y P,%R/usr/lib %{shared:-shared} \
+ %{!shared: \
+ %{!static: \
+ %{rdynamic:-export-dynamic} \
+@@ -121,7 +121,7 @@
+ %{static:-static}} \
+ "
+
+-#define LINK_ARCH64_SPEC "-m elf64_sparc -Y P,%R/usr/lib64 %{shared:-shared} \
++#define LINK_ARCH64_SPEC "-m elf64_sparc --hash-style=both -Y P,%R/usr/lib64 %{shared:-shared} \
+ %{!shared: \
+ %{!static: \
+ %{rdynamic:-export-dynamic} \
+@@ -193,7 +193,7 @@
+ #else /* !SPARC_BI_ARCH */
+
+ #undef LINK_SPEC
+-#define LINK_SPEC "-m elf64_sparc -Y P,%R/usr/lib64 %{shared:-shared} \
++#define LINK_SPEC "-m elf64_sparc --hash-style=both -Y P,%R/usr/lib64 %{shared:-shared} \
+ %{!shared: \
+ %{!static: \
+ %{rdynamic:-export-dynamic} \
+--- gcc/config/sparc/linux.h.orig 2011-01-27 06:30:12.000000000 +1000
++++ gcc/config/sparc/linux.h 2011-03-11 10:01:47.770000457 +1000
+@@ -74,7 +74,7 @@
+ #define GLIBC_DYNAMIC_LINKER "/lib/ld-linux.so.2"
+
+ #undef LINK_SPEC
+-#define LINK_SPEC "-m elf32_sparc -Y P,/usr/lib %{shared:-shared} \
++#define LINK_SPEC "-m elf32_sparc --hash-style=both -Y P,/usr/lib %{shared:-shared} \
+ %{!mno-relax:%{!r:-relax}} \
+ %{!shared: \
+ %{!static: \
diff --git a/multilib-staging/gcc-multilib/gcc-libs.install b/multilib-staging/gcc-multilib/gcc-libs.install
new file mode 100644
index 000000000..23553b8f0
--- /dev/null
+++ b/multilib-staging/gcc-multilib/gcc-libs.install
@@ -0,0 +1,16 @@
+infodir=usr/share/info
+filelist=(libgomp.info libquadmath.info)
+
+post_upgrade() {
+ [ -x usr/bin/install-info ] || return 0
+ for file in ${filelist[@]}; do
+ install-info $infodir/$file.gz $infodir/dir 2> /dev/null
+ done
+}
+
+pre_remove() {
+ [ -x usr/bin/install-info ] || return 0
+ for file in ${filelist[@]}; do
+ install-info --delete $infodir/$file.gz $infodir/dir 2> /dev/null
+ done
+}
diff --git a/multilib-staging/gcc-multilib/gcc.install b/multilib-staging/gcc-multilib/gcc.install
new file mode 100644
index 000000000..3407a5e1f
--- /dev/null
+++ b/multilib-staging/gcc-multilib/gcc.install
@@ -0,0 +1,20 @@
+infodir=usr/share/info
+filelist=(cpp.info cppinternals.info gcc.info gccinstall.info gccint.info)
+
+post_install() {
+ [ -x usr/bin/install-info ] || return 0
+ for file in ${filelist[@]}; do
+ install-info $infodir/$file.gz $infodir/dir 2> /dev/null
+ done
+}
+
+post_upgrade() {
+ post_install $1
+}
+
+pre_remove() {
+ [ -x usr/bin/install-info ] || return 0
+ for file in ${filelist[@]}; do
+ install-info --delete $infodir/$file.gz $infodir/dir 2> /dev/null
+ done
+}
diff --git a/multilib-staging/gcc-multilib/gcc_pure64-multilib.patch b/multilib-staging/gcc-multilib/gcc_pure64-multilib.patch
new file mode 100644
index 000000000..73df6b873
--- /dev/null
+++ b/multilib-staging/gcc-multilib/gcc_pure64-multilib.patch
@@ -0,0 +1,24 @@
+diff -u -r gcc-4.6-20111223/gcc/config/i386/linux64.h gcc-4.6-20111223-pure64/gcc/config/i386/linux64.h
+--- gcc-4.6-20111223/gcc/config/i386/linux64.h 2011-09-08 11:12:35.000000000 +0200
++++ gcc-4.6-20111223-pure64/gcc/config/i386/linux64.h 2012-01-14 19:52:33.688573352 +0100
+@@ -63,7 +63,7 @@
+ done. */
+
+ #define GLIBC_DYNAMIC_LINKER32 "/lib/ld-linux.so.2"
+-#define GLIBC_DYNAMIC_LINKER64 "/lib64/ld-linux-x86-64.so.2"
++#define GLIBC_DYNAMIC_LINKER64 "/lib/ld-linux-x86-64.so.2"
+
+ #if TARGET_64BIT_DEFAULT
+ #define SPEC_32 "m32"
+diff -u -r gcc-4.6-20111223/gcc/config/i386/t-linux64 gcc-4.6-20111223-pure64/gcc/config/i386/t-linux64
+--- gcc-4.6-20111223/gcc/config/i386/t-linux64 2009-04-21 21:03:23.000000000 +0200
++++ gcc-4.6-20111223-pure64/gcc/config/i386/t-linux64 2012-01-14 19:50:27.346242617 +0100
+@@ -25,7 +25,7 @@
+
+ MULTILIB_OPTIONS = m64/m32
+ MULTILIB_DIRNAMES = 64 32
+-MULTILIB_OSDIRNAMES = ../lib64 $(if $(wildcard $(shell echo $(SYSTEM_HEADER_DIR))/../../usr/lib32),../lib32,../lib)
++MULTILIB_OSDIRNAMES = ../lib ../lib32
+
+ LIBGCC = stmp-multilib
+ INSTALL_LIBGCC = install-multilib
diff --git a/multilib-staging/jack2-multilib/40-hpet-permissions.rules b/multilib-staging/jack2-multilib/40-hpet-permissions.rules
new file mode 100644
index 000000000..7af3780f9
--- /dev/null
+++ b/multilib-staging/jack2-multilib/40-hpet-permissions.rules
@@ -0,0 +1,2 @@
+KERNEL=="rtc0", GROUP="audio"
+KERNEL=="hpet", GROUP="audio"
diff --git a/multilib-staging/jack2-multilib/99-audio.conf b/multilib-staging/jack2-multilib/99-audio.conf
new file mode 100644
index 000000000..eb76ef920
--- /dev/null
+++ b/multilib-staging/jack2-multilib/99-audio.conf
@@ -0,0 +1,2 @@
+@audio - rtprio 99
+@audio - memlock unlimited
diff --git a/multilib-staging/jack2-multilib/PKGBUILD b/multilib-staging/jack2-multilib/PKGBUILD
new file mode 100644
index 000000000..9c7e0fd6f
--- /dev/null
+++ b/multilib-staging/jack2-multilib/PKGBUILD
@@ -0,0 +1,142 @@
+# $Id: PKGBUILD 52694 2011-07-27 17:23:48Z schiv $
+# Maintainer: Ray Rashif <schiv@archlinux.org>
+# Contributor: SpepS <dreamspepser at yahoo dot it>
+
+# This one is in response to a need for an equivalent to lib32-jack for
+# jack2. A lib32-jack2 would require much patching and invading the pure
+# jack2 package, and what's more, the buildsystem provides a flag just to
+# build a hybrid jack2 in full. As such, we have opted to provide multilib
+# users with a replacement package instead of the usual lib32 add-on.
+#
+# See http://mailman.archlinux.org/pipermail/arch-multilib/2011-December/000251.html
+
+pkgbase=jack2-multilib
+pkgname=('jack2-multilib' 'jack2-dbus-multilib')
+#pkgname= # single build (overrides split)
+_tarname=jack
+pkgver=1.9.7
+pkgrel=2
+arch=('x86_64')
+url="http://jackaudio.org/"
+backup=(etc/security/limits.d/99-audio.conf)
+license=('GPL')
+makedepends=('python2' 'libffado' 'libsamplerate' 'celt'
+ 'doxygen' 'gcc-multilib' 'lib32-dbus-core')
+source=("http://www.grame.fr/~letz/$_tarname-$pkgver.tar.bz2"
+ '99-audio.conf'
+ '40-hpet-permissions.rules')
+md5sums=('9759670feecbd43eeccf1c0f743ec199'
+ 'ae65b7c9ebe0fff6c918ba9d97ae342d'
+ '471aad533ff56c5d3cbbf65ce32cadef')
+
+_pyfix() {
+ sed -i 's:bin/env python:bin/env python2:' \
+ "$pkgdir/usr/bin/jack_control"
+}
+
+_wafconf() {
+ python2 waf configure --prefix=/usr \
+ --alsa \
+ --firewire \
+ --mixed \
+ --doxygen $@
+}
+
+_isbuild() {
+ printf "%s\n" ${pkgname[@]} | grep -qx $1
+}
+
+_mklinks() {
+ ln -s /usr/lib32/libjack.so.0.1.0 "$pkgdir/usr/lib32/libjack.so.0"
+ ln -s /usr/lib32/libjack.so.0 "$pkgdir/usr/lib32/libjack.so"
+}
+
+build() {
+ cd "$srcdir"
+
+ # fix doxygen building
+ sed -i 's:build/default/html:html:' $_tarname-$pkgver/wscript
+
+ # we may do 2 different builds
+ cp -r $_tarname-$pkgver $_tarname-dbus-$pkgver
+
+ # mixed dbus/classic build
+ if _isbuild jack2-multilib; then
+ cd $_tarname-$pkgver
+ msg2 "Running Mixed D-Bus/Classic build"
+ _wafconf --classic --dbus
+ python2 waf build $MAKEFLAGS
+ cd ..
+ fi
+
+ # dbus-ONLY build
+ if _isbuild jack2-dbus-multilib; then
+ cd $_tarname-dbus-$pkgver
+ msg2 "Running D-Bus-only build"
+ _wafconf --dbus
+ python2 waf build $MAKEFLAGS
+ cd ..
+ fi
+}
+
+package_jack2-multilib() {
+ ! _isbuild jack2-multilib && return 0
+
+ pkgdesc="The next-generation JACK with SMP support & mixed mode"
+ depends=('libsamplerate' 'gcc-libs-multilib')
+ optdepends=('libffado: FireWire support'
+ 'celt: NetJACK2 driver'
+ 'lib32-dbus-core: jackdbus'
+ 'python2: jack_control')
+ conflicts=('jack' 'jack2' 'lib32-jack')
+ provides=('jack' 'jack2' 'lib32-jack' 'jackmp'
+ 'jackdmp' 'jackdbus' 'lib32-jack2')
+
+ cd "$srcdir/$_tarname-$pkgver"
+
+ python2 waf install --destdir="$pkgdir"
+
+ # fix for major python transition
+ _pyfix
+
+ # configure realtime access/scheduling
+ # see https://bugs.archlinux.org/task/26343
+ install -Dm644 "$srcdir/99-audio.conf" \
+ "$pkgdir/etc/security/limits.d/99-audio.conf"
+
+ install -Dm644 "$srcdir/40-hpet-permissions.rules" \
+ "$pkgdir/lib/udev/rules.d/40-hpet-permissions.rules"
+
+ # should be done by upstream
+ # see http://trac.jackaudio.org/ticket/200
+ _mklinks
+}
+
+package_jack2-dbus-multilib() {
+ ! _isbuild jack2-dbus-multilib && return 0
+
+ pkgdesc="The next-generation JACK with SMP support & mixed mode (for D-BUS interaction only)"
+ depends=('libsamplerate' 'lib32-dbus-core')
+ optdepends=('libffado: FireWire support'
+ 'celt: NetJACK2 driver'
+ 'python2: jack_control')
+ conflicts=('jack' 'jack2' 'lib32-jack' 'jack2-multilib')
+ provides=('jack' 'jack2' 'lib32-jack' 'jack2-multilib'
+ 'jackmp' 'jackdmp' 'jackdbus' 'lib32-jack2')
+
+ cd "$srcdir/$_tarname-dbus-$pkgver"
+
+ python2 waf install --destdir="$pkgdir"
+
+ _pyfix
+
+ install -Dm644 "$srcdir/99-audio.conf" \
+ "$pkgdir/etc/security/limits.d/99-audio.conf"
+
+ install -Dm644 "$srcdir/40-hpet-permissions.rules" \
+ "$pkgdir/lib/udev/rules.d/40-hpet-permissions.rules"
+
+ _mklinks
+}
+
+# vim:set ts=2 sw=2 et:
diff --git a/multilib-staging/lib32-gdk-pixbuf2/PKGBUILD b/multilib-staging/lib32-gdk-pixbuf2/PKGBUILD
new file mode 100644
index 000000000..eef9aca26
--- /dev/null
+++ b/multilib-staging/lib32-gdk-pixbuf2/PKGBUILD
@@ -0,0 +1,45 @@
+# $Id: PKGBUILD 91063 2010-09-21 19:21:24Z ibiru $
+# Maintainer: Ionut Biru <ibiru@archlinux.org>
+_pkgbasename=gdk-pixbuf2
+pkgname=lib32-$_pkgbasename
+pkgver=2.24.1
+pkgrel=1
+pkgdesc="An image loading library (32-bit)"
+arch=('x86_64')
+url="http://www.gtk.org/"
+license=('GPL2')
+depends=(lib32-glib2 lib32-libpng lib32-libtiff lib32-libjpeg lib32-libx11
+ $_pkgbasename)
+makedepends=(gcc-multilib)
+options=('!libtool' '!docs')
+install=gdk-pixbuf2.install
+source=(http://download.gnome.org/sources/gdk-pixbuf/2.24/gdk-pixbuf-${pkgver}.tar.xz)
+sha256sums=('da7a3f00db360913716368e19e336402755cafa93769f3cfa28a969303e4bee1')
+
+build() {
+ export CC="gcc -m32"
+ export CXX="g++ -m32"
+ export PKG_CONFIG_PATH="/usr/lib32/pkgconfig"
+
+ cd "${srcdir}/gdk-pixbuf-${pkgver}"
+
+ ./configure --prefix=/usr --libdir=/usr/lib32 \
+ --without-libjasper \
+ --with-x11 \
+ --with-included-loaders=png
+ make
+}
+
+package() {
+ cd "${srcdir}/gdk-pixbuf-${pkgver}"
+
+ make DESTDIR="${pkgdir}" install
+ rm -rf "${pkgdir}"/etc
+ rm -rf "${pkgdir}"/usr/{include,share}
+
+ cd "${pkgdir}"/usr/bin
+ mv gdk-pixbuf-query-loaders gdk-pixbuf-query-loaders-32
+ rm gdk-pixbuf-csource
+}
+
+# vim:set ts=2 sw=2 et:
diff --git a/multilib-staging/lib32-gdk-pixbuf2/gdk-pixbuf2.install b/multilib-staging/lib32-gdk-pixbuf2/gdk-pixbuf2.install
new file mode 100644
index 000000000..92d58ef04
--- /dev/null
+++ b/multilib-staging/lib32-gdk-pixbuf2/gdk-pixbuf2.install
@@ -0,0 +1,11 @@
+post_install() {
+ usr/bin/gdk-pixbuf-query-loaders-32 --update-cache
+}
+
+post_upgrade() {
+ post_install
+}
+
+pre_remove() {
+ rm -f usr/lib32/gdk-pixbuf-2.0/2.10.0/loaders/loaders.cache
+}
diff --git a/multilib-staging/lib32-glib2/PKGBUILD b/multilib-staging/lib32-glib2/PKGBUILD
new file mode 100644
index 000000000..a1a1f36f3
--- /dev/null
+++ b/multilib-staging/lib32-glib2/PKGBUILD
@@ -0,0 +1,40 @@
+# $Id: PKGBUILD 62040 2012-01-14 23:44:48Z heftig $
+# Maintainer: Ionut Biru <ibiru@archlinux.org>
+# Contributor: Pierre Schmitz <pierre@archlinux.de>
+# Contributor: Mikko Seppälä <t-r-a-y@mbnet.fi>
+
+_pkgbasename=glib2
+pkgname=lib32-$_pkgbasename
+pkgver=2.30.2
+pkgrel=2
+pkgdesc="Common C routines used by GTK+ 2.4 and other libs (32-bit)"
+url="http://www.gtk.org/"
+arch=('x86_64')
+license=('LGPL')
+depends=('lib32-pcre' 'lib32-zlib' 'lib32-dbus-core' lib32-libffi $_pkgbasename)
+makedepends=('gcc-multilib' python2)
+options=('!libtool' '!docs')
+source=(http://ftp.gnome.org/pub/GNOME/sources/glib/2.30/glib-${pkgver}.tar.xz)
+sha256sums=('f0e91e6333321ddb48fa12b5c66f56c3d5f05325748c66dd2e9016c278ff8e82')
+
+build() {
+ export CC="gcc -m32"
+ export CXX="g++ -m32"
+ export PKG_CONFIG_PATH="/usr/lib32/pkgconfig"
+
+ cd "${srcdir}/glib-${pkgver}"
+ PYTHON=/usr/bin/python2 ./configure --prefix=/usr --sysconfdir=/etc --libdir=/usr/lib32 \
+ --enable-static --enable-shared --with-pcre=system --disable-fam
+ make
+}
+
+package() {
+ cd "${srcdir}/glib-${pkgver}"
+ make DESTDIR="${pkgdir}" install
+ rm -rf "${pkgdir}"/{etc,usr/{share,include}}
+
+ cd "${pkgdir}"/usr/bin
+ mv gio-querymodules gio-querymodules-32
+ rm -f gdbus glib* gobject-query gsettings gtester*
+ rm -rf "$pkgdir"/usr/{bin/gdbus-codegen,lib32/gdbus-2.0}
+}
diff --git a/multilib-staging/lib32-glibc/PKGBUILD b/multilib-staging/lib32-glibc/PKGBUILD
new file mode 100644
index 000000000..ed4d6efa8
--- /dev/null
+++ b/multilib-staging/lib32-glibc/PKGBUILD
@@ -0,0 +1,176 @@
+# $Id: PKGBUILD 62030 2012-01-14 21:43:25Z heftig $
+# Maintainer: Jan "heftig" Steffens <jan.steffens@gmail.com>
+# Contributor: Jan de Groot <jgc@archlinux.org>
+# Contributor: Allan McRae <allan@archlinux.org>
+
+# toolchain build order: linux-api-headers->glibc->binutils->gcc->binutils->glibc
+# NOTE: valgrind requires rebuilt with each major glibc version
+
+_pkgbasename=glibc
+pkgname=lib32-$_pkgbasename
+pkgver=2.15
+pkgrel=3.1
+_glibcdate=20111227
+pkgdesc="GNU C Library for multilib"
+arch=('x86_64')
+url="http://www.gnu.org/software/libc"
+license=('GPL' 'LGPL')
+depends=("glibc>=$pkgver")
+makedepends=('gcc-multilib>=4.6')
+options=('!strip' '!emptydirs')
+source=(ftp://ftp.archlinux.org/other/glibc/${_pkgbasename}-${pkgver}_${_glibcdate}.tar.xz
+ glibc-2.10-dont-build-timezone.patch
+ glibc-2.10-bz4781.patch
+ glibc-__i686.patch
+ glibc-2.12.2-ignore-origin-of-privileged-program.patch
+ glibc-2.14-libdl-crash.patch
+ glibc-2.14-revert-4768ae77.patch
+ glibc-2.14-reexport-rpc-interface.patch
+ glibc-2.14-reinstall-nis-rpc-headers.patch
+ glibc-2.15-lddebug-scopes.patch
+ glibc-2.15-revert-c5a0802a.patch
+ glibc-2.15-math64crash.patch
+ lib32-glibc.conf)
+md5sums=('6ffdf5832192b92f98bdd125317c0dfc'
+ '4dadb9203b69a3210d53514bb46f41c3'
+ '0c5540efc51c0b93996c51b57a8540ae'
+ '40cd342e21f71f5e49e32622b25acc52'
+ 'b042647ea7d6f22ad319e12e796bd13e'
+ '6970bcfeb3bf88913436d5112d16f588'
+ '7da8c554a3b591c7401d7023b1928afc'
+ 'c5de2a946215d647c8af5432ec4b0da0'
+ '55febbb72139ac7b65757df085024b83'
+ '3c219ddfb619b6df903cac4cc42c611d'
+ '7ae3e426251ae33e73dbad71f9c91378'
+ 'dc7550e659ddd685bd78a930d15a01f2'
+ '6e052f1cb693d5d3203f50f9d4e8c33b')
+
+build() {
+ cd ${srcdir}/glibc
+
+ # timezone data is in separate package (tzdata)
+ patch -Np1 -i ${srcdir}/glibc-2.10-dont-build-timezone.patch
+
+ # http://sources.redhat.com/bugzilla/show_bug.cgi?id=4781
+ patch -Np1 -i ${srcdir}/glibc-2.10-bz4781.patch
+
+ # http://sources.redhat.com/bugzilla/show_bug.cgi?id=411
+ # http://sourceware.org/ml/libc-alpha/2009-07/msg00072.html
+ patch -Np1 -i ${srcdir}/glibc-__i686.patch
+
+ # http://www.exploit-db.com/exploits/15274/
+ # http://sourceware.org/git/?p=glibc.git;a=patch;h=d14e6b09 (only fedora branch...)
+ patch -Np1 -i ${srcdir}/glibc-2.12.2-ignore-origin-of-privileged-program.patch
+
+ # http://sourceware.org/git/?p=glibc.git;a=commitdiff;h=675155e9 (only fedora branch...)
+ # http://sourceware.org/ml/libc-alpha/2011-06/msg00006.html
+ patch -Np1 -i ${srcdir}/glibc-2.14-libdl-crash.patch
+
+ # Revert commit causing issues with crappy DNS servers...
+ # Will be removed when workaround becomes annoying to maintain - USE A BETTER DNS SERVER!
+ # Note that both these patches appear not to fix the issue completely:
+ # http://sourceware.org/bugzilla/show_bug.cgi?id=13013
+ # http://sourceware.org/git/?p=glibc.git;a=commitdiff;h=032c0ee3 (only fedora branch...)
+ patch -Np1 -i ${srcdir}/glibc-2.14-revert-4768ae77.patch
+
+ # re-export RPC interface until libtirpc is ready as a replacement
+ # http://sourceware.org/git/?p=glibc.git;a=commitdiff;h=acee4873 (only fedora branch...)
+ patch -Np1 -i ${srcdir}/glibc-2.14-reexport-rpc-interface.patch
+ # http://sourceware.org/git/?p=glibc.git;a=commitdiff;h=bdd816a3 (only fedora branch...)
+ patch -Np1 -i ${srcdir}/glibc-2.14-reinstall-nis-rpc-headers.patch
+
+ # propriety nvidia crash - https://bugzilla.redhat.com/show_bug.cgi?id=737223
+ # http://sourceware.org/git/?p=glibc.git;a=commitdiff;h=0c95ab64 (only fedora branch...)
+ patch -Np1 -i ${srcdir}/glibc-2.15-lddebug-scopes.patch
+
+ # revert commit c5a0802a - causes various hangs
+ # https://bugzilla.redhat.com/show_bug.cgi?id=769421
+ patch -Np1 -i ${srcdir}/glibc-2.15-revert-c5a0802a.patch
+
+ # revert optimized math routines that can cause crashes (FS#27736, FS#27743)
+ # obviously not a real fix...
+ patch -Np1 -i ${srcdir}/glibc-2.15-math64crash.patch
+
+ cd ${srcdir}
+ mkdir glibc-build
+ cd glibc-build
+
+ export CC="gcc -m32"
+
+ # Hack to fix NPTL issues with Xen, only required on 32bit platforms
+ export CFLAGS="${CFLAGS} -mno-tls-direct-seg-refs"
+
+ echo "slibdir=/usr/lib32" >> configparms
+
+ # remove hardening options from CFLAGS for building libraries
+ CFLAGS=${CFLAGS/-fstack-protector/}
+ CFLAGS=${CFLAGS/-D_FORTIFY_SOURCE=2/}
+
+ ${srcdir}/glibc/configure --prefix=/usr \
+ --libdir=/usr/lib32 --libexecdir=/usr/lib32 \
+ --with-headers=/usr/include \
+ --enable-add-ons=nptl,libidn \
+ --enable-kernel=2.6.27 \
+ --with-tls --with-__thread \
+ --enable-bind-now --without-gd \
+ --without-cvs --disable-profile \
+ --enable-multi-arch i686-unknown-linux-gnu
+
+ # build libraries with hardening disabled
+ echo "build-programs=no" >> configparms
+ make
+
+ # re-enable hardening for programs
+ sed -i "s#=no#=yes#" configparms
+ echo "CC += -fstack-protector -D_FORTIFY_SOURCE=2" >> configparms
+ echo "CXX += -fstack-protector -D_FORTIFY_SOURCE=2" >> configparms
+ make
+
+ # remove harding in preparation to run test-suite
+ sed -i '2,4d' configparms
+}
+
+check() {
+ cd ${srcdir}/glibc-build
+
+ # some errors are expected - manually check log files
+ make -k check || true
+}
+
+package() {
+ cd ${srcdir}/glibc-build
+ make install_root=${pkgdir} install
+
+ rm -rf ${pkgdir}/{etc,sbin,usr/{bin,sbin,share},var}
+
+ # We need one 32 bit specific header file
+ find ${pkgdir}/usr/include -type f -not -name stubs-32.h -delete
+
+ # Do not strip the following files for improved debugging support
+ # ("improved" as in not breaking gdb and valgrind...):
+ # ld-${pkgver}.so
+ # libc-${pkgver}.so
+ # libpthread-${pkgver}.so
+ # libthread_db-1.0.so
+
+ cd $pkgdir
+ strip $STRIP_BINARIES usr/lib32/getconf/*
+
+ strip $STRIP_STATIC usr/lib32/*.a
+
+ strip $STRIP_SHARED usr/lib32/{libanl,libBrokenLocale,libcidn,libcrypt}-${pkgver}.so \
+ usr/lib32/libnss_{compat,db,dns,files,hesiod,nis,nisplus}-${pkgver}.so \
+ usr/lib32/{libdl,libm,libnsl,libresolv,librt,libutil}-${pkgver}.so \
+ usr/lib32/{libmemusage,libpcprofile,libSegFault}.so \
+ usr/lib32/{pt_chown,{audit,gconv}/*.so}
+
+ # Dynamic linker
+ mkdir ${pkgdir}/lib
+ ln -s ../usr/lib32/ld-linux.so.2 ${pkgdir}/lib/
+
+ # Add lib32 paths to the default library search path
+ install -Dm644 "$srcdir/lib32-glibc.conf" "$pkgdir/etc/ld.so.conf.d/lib32-glibc.conf"
+
+ # Symlink /usr/lib32/locale to /usr/lib/locale
+ ln -s ../lib/locale "$pkgdir/usr/lib32/locale"
+}
diff --git a/multilib-staging/lib32-glibc/glibc-2.10-bz4781.patch b/multilib-staging/lib32-glibc/glibc-2.10-bz4781.patch
new file mode 100644
index 000000000..cf1a97a18
--- /dev/null
+++ b/multilib-staging/lib32-glibc/glibc-2.10-bz4781.patch
@@ -0,0 +1,42 @@
+diff -Naur glibc-old/sysdeps/unix/sysv/linux/i386/clone.S glibc/sysdeps/unix/sysv/linux/i386/clone.S
+--- glibc-old/sysdeps/unix/sysv/linux/i386/clone.S 2009-05-09 13:35:30.000000000 +1000
++++ glibc/sysdeps/unix/sysv/linux/i386/clone.S 2009-05-23 13:27:46.000000000 +1000
+@@ -120,9 +120,6 @@
+ ret
+
+ L(thread_start):
+- cfi_startproc;
+- /* Clearing frame pointer is insufficient, use CFI. */
+- cfi_undefined (eip);
+ /* Note: %esi is zero. */
+ movl %esi,%ebp /* terminate the stack frame */
+ #ifdef RESET_PID
+@@ -155,7 +152,6 @@
+ jmp L(haspid)
+ .previous
+ #endif
+- cfi_endproc;
+
+ cfi_startproc
+ PSEUDO_END (BP_SYM (__clone))
+diff -Naur glibc-old/sysdeps/unix/sysv/linux/x86_64/clone.S glibc/sysdeps/unix/sysv/linux/x86_64/clone.S
+--- glibc-old/sysdeps/unix/sysv/linux/x86_64/clone.S 2009-05-09 13:35:30.000000000 +1000
++++ glibc/sysdeps/unix/sysv/linux/x86_64/clone.S 2009-05-23 13:27:46.000000000 +1000
+@@ -89,9 +89,6 @@
+ ret
+
+ L(thread_start):
+- cfi_startproc;
+- /* Clearing frame pointer is insufficient, use CFI. */
+- cfi_undefined (rip);
+ /* Clear the frame pointer. The ABI suggests this be done, to mark
+ the outermost frame obviously. */
+ xorl %ebp, %ebp
+@@ -116,7 +113,6 @@
+ /* Call exit with return value from function call. */
+ movq %rax, %rdi
+ call HIDDEN_JUMPTARGET (_exit)
+- cfi_endproc;
+
+ cfi_startproc;
+ PSEUDO_END (BP_SYM (__clone))
diff --git a/multilib-staging/lib32-glibc/glibc-2.10-dont-build-timezone.patch b/multilib-staging/lib32-glibc/glibc-2.10-dont-build-timezone.patch
new file mode 100644
index 000000000..d3abeff17
--- /dev/null
+++ b/multilib-staging/lib32-glibc/glibc-2.10-dont-build-timezone.patch
@@ -0,0 +1,13 @@
+timezone data has been split into the package sys-libs/timezone-data
+
+--- glibc-2.4/Makeconfig
++++ glibc-2.4/Makeconfig
+@@ -931,7 +931,7 @@
+ stdlib stdio-common libio malloc string wcsmbs time dirent \
+ grp pwd posix io termios resource misc socket sysvipc gmon \
+ gnulib iconv iconvdata wctype manual shadow gshadow po argp \
+- crypt nss localedata timezone rt conform debug \
++ crypt nss localedata rt conform debug \
+ $(add-on-subdirs) $(dlfcn) $(binfmt-subdir)
+
+ ifndef avoid-generated
diff --git a/multilib-staging/lib32-glibc/glibc-2.12.2-ignore-origin-of-privileged-program.patch b/multilib-staging/lib32-glibc/glibc-2.12.2-ignore-origin-of-privileged-program.patch
new file mode 100644
index 000000000..ce089b49c
--- /dev/null
+++ b/multilib-staging/lib32-glibc/glibc-2.12.2-ignore-origin-of-privileged-program.patch
@@ -0,0 +1,26 @@
+From d14e6b09d60d52cc12f0396c3106b14e1bd0fe8f Mon Sep 17 00:00:00 2001
+From: Andreas Schwab <schwab@redhat.com>
+Date: Thu, 9 Dec 2010 15:00:59 +0100
+Subject: [PATCH 1/1] Ignore origin of privileged program
+
+---
+ ChangeLog | 5 +++++
+ elf/dl-object.c | 3 +++
+ 2 files changed, 8 insertions(+), 0 deletions(-)
+
+diff --git a/elf/dl-object.c b/elf/dl-object.c
+index 22a1635..7674d49 100644
+--- a/elf/dl-object.c
++++ b/elf/dl-object.c
+@@ -214,6 +214,9 @@ _dl_new_object (char *realname, const char *libname, int type,
+ out:
+ new->l_origin = origin;
+ }
++ else if (INTUSE(__libc_enable_secure) && type == lt_executable)
++ /* The origin of a privileged program cannot be trusted. */
++ new->l_origin = (char *) -1;
+
+ return new;
+ }
+--
+1.7.2
diff --git a/multilib-staging/lib32-glibc/glibc-2.14-libdl-crash.patch b/multilib-staging/lib32-glibc/glibc-2.14-libdl-crash.patch
new file mode 100644
index 000000000..6c9d2718e
--- /dev/null
+++ b/multilib-staging/lib32-glibc/glibc-2.14-libdl-crash.patch
@@ -0,0 +1,132 @@
+diff --git a/elf/dl-close.c b/elf/dl-close.c
+index 73b2a2f..9bd91e3 100644
+--- a/elf/dl-close.c
++++ b/elf/dl-close.c
+@@ -1,5 +1,5 @@
+ /* Close a shared object opened by `_dl_open'.
+- Copyright (C) 1996-2007, 2009, 2010, 2011 Free Software Foundation, Inc.
++ Copyright (C) 1996-2007, 2009, 2010 Free Software Foundation, Inc.
+ This file is part of the GNU C Library.
+
+ The GNU C Library is free software; you can redistribute it and/or
+@@ -119,17 +119,8 @@ _dl_close_worker (struct link_map *map)
+ if (map->l_direct_opencount > 0 || map->l_type != lt_loaded
+ || dl_close_state != not_pending)
+ {
+- if (map->l_direct_opencount == 0)
+- {
+- if (map->l_type == lt_loaded)
+- dl_close_state = rerun;
+- else if (map->l_type == lt_library)
+- {
+- struct link_map **oldp = map->l_initfini;
+- map->l_initfini = map->l_orig_initfini;
+- _dl_scope_free (oldp);
+- }
+- }
++ if (map->l_direct_opencount == 0 && map->l_type == lt_loaded)
++ dl_close_state = rerun;
+
+ /* There are still references to this object. Do nothing more. */
+ if (__builtin_expect (GLRO(dl_debug_mask) & DL_DEBUG_FILES, 0))
+diff --git a/elf/dl-deps.c b/elf/dl-deps.c
+index 9e30594..3890d00 100644
+--- a/elf/dl-deps.c
++++ b/elf/dl-deps.c
+@@ -478,6 +478,7 @@ _dl_map_object_deps (struct link_map *map,
+ nneeded * sizeof needed[0]);
+ atomic_write_barrier ();
+ l->l_initfini = l_initfini;
++ l->l_free_initfini = 1;
+ }
+
+ /* If we have no auxiliary objects just go on to the next map. */
+@@ -681,6 +682,7 @@ Filters not supported with LD_TRACE_PRELINKING"));
+ l_initfini[nlist] = NULL;
+ atomic_write_barrier ();
+ map->l_initfini = l_initfini;
++ map->l_free_initfini = 1;
+ if (l_reldeps != NULL)
+ {
+ atomic_write_barrier ();
+@@ -689,5 +691,5 @@ Filters not supported with LD_TRACE_PRELINKING"));
+ _dl_scope_free (old_l_reldeps);
+ }
+ if (old_l_initfini != NULL)
+- map->l_orig_initfini = old_l_initfini;
++ _dl_scope_free (old_l_initfini);
+
+diff --git a/elf/dl-libc.c b/elf/dl-libc.c
+index 7be9483..a13fce3 100644
+--- a/elf/dl-libc.c
++++ b/elf/dl-libc.c
+@@ -265,13 +265,13 @@ libc_freeres_fn (free_mem)
+
+ for (Lmid_t ns = 0; ns < GL(dl_nns); ++ns)
+ {
+- /* Remove all additional names added to the objects. */
+ for (l = GL(dl_ns)[ns]._ns_loaded; l != NULL; l = l->l_next)
+ {
+ struct libname_list *lnp = l->l_libname->next;
+
+ l->l_libname->next = NULL;
+
++ /* Remove all additional names added to the objects. */
+ while (lnp != NULL)
+ {
+ struct libname_list *old = lnp;
+@@ -279,6 +279,10 @@ libc_freeres_fn (free_mem)
+ if (! old->dont_free)
+ free (old);
+ }
++
++ /* Free the initfini dependency list. */
++ if (l->l_free_initfini)
++ free (l->l_initfini);
+ }
+
+ if (__builtin_expect (GL(dl_ns)[ns]._ns_global_scope_alloc, 0) != 0
+diff --git a/elf/rtld.c b/elf/rtld.c
+index 4a9109e..617e30e 100644
+--- a/elf/rtld.c
++++ b/elf/rtld.c
+@@ -2251,6 +2251,7 @@ ERROR: ld.so: object '%s' cannot be loaded as audit interface: %s; ignored.\n",
+ lnp->dont_free = 1;
+ lnp = lnp->next;
+ }
++ l->l_free_initfini = 0;
+
+ if (l != &GL(dl_rtld_map))
+ _dl_relocate_object (l, l->l_scope, GLRO(dl_lazy) ? RTLD_LAZY : 0,
+diff --git a/include/link.h b/include/link.h
+index e877104..051b99a 100644
+--- a/include/link.h
++++ b/include/link.h
+@@ -1,6 +1,6 @@
+ /* Data structure for communication from the run-time dynamic linker for
+ loaded ELF shared objects.
+- Copyright (C) 1995-2006, 2007, 2009, 2010, 2011 Free Software Foundation, Inc.
++ Copyright (C) 1995-2006, 2007, 2009, 2010 Free Software Foundation, Inc.
+ This file is part of the GNU C Library.
+
+ The GNU C Library is free software; you can redistribute it and/or
+@@ -192,6 +192,9 @@ struct link_map
+ during LD_TRACE_PRELINKING=1
+ contains any DT_SYMBOLIC
+ libraries. */
++ unsigned int l_free_initfini:1; /* Nonzero if l_initfini can be
++ freed, ie. not allocated with
++ the dummy malloc in ld.so. */
+
+ /* Collected information about own RPATH directories. */
+ struct r_search_path_struct l_rpath_dirs;
+@@ -240,9 +243,6 @@ struct link_map
+
+ /* List of object in order of the init and fini calls. */
+ struct link_map **l_initfini;
+- /* The init and fini list generated at startup, saved when the
+- object is also loaded dynamically. */
+- struct link_map **l_orig_initfini;
+
+ /* List of the dependencies introduced through symbol binding. */
+ struct link_map_reldeps
diff --git a/multilib-staging/lib32-glibc/glibc-2.14-reexport-rpc-interface.patch b/multilib-staging/lib32-glibc/glibc-2.14-reexport-rpc-interface.patch
new file mode 100644
index 000000000..e2beea881
--- /dev/null
+++ b/multilib-staging/lib32-glibc/glibc-2.14-reexport-rpc-interface.patch
@@ -0,0 +1,26 @@
+diff --git a/include/libc-symbols.h b/include/libc-symbols.h
+index 67e1ca2..5e7cca5 100644
+--- a/include/libc-symbols.h
++++ b/include/libc-symbols.h
+@@ -635,7 +635,7 @@ for linking")
+ # define libc_hidden_proto(name, attrs...) hidden_proto (name, ##attrs)
+ # define libc_hidden_def(name) hidden_def (name)
+ # define libc_hidden_weak(name) hidden_weak (name)
+-# define libc_hidden_nolink(name, version) hidden_nolink (name, libc, version)
++# define libc_hidden_nolink(name, version) hidden_def (name)
+ # define libc_hidden_ver(local, name) hidden_ver (local, name)
+ # define libc_hidden_data_def(name) hidden_data_def (name)
+ # define libc_hidden_data_weak(name) hidden_data_weak (name)
+diff --git a/sunrpc/Makefile b/sunrpc/Makefile
+index 5134ce9..40c73d1 100644
+--- a/sunrpc/Makefile
++++ b/sunrpc/Makefile
+@@ -53,7 +53,7 @@ headers-in-tirpc = $(addprefix rpc/,auth.h auth_unix.h clnt.h pmap_clnt.h \
+ des_crypt.h)
+ headers-not-in-tirpc = $(addprefix rpc/,key_prot.h rpc_des.h) \
+ $(rpcsvc:%=rpcsvc/%) rpcsvc/bootparam.h
+-headers = rpc/netdb.h
++headers = rpc/netdb.h $(headers-in-tirpc) $(headers-not-in-tirpc)
+ install-others = $(inst_sysconfdir)/rpc
+ generated = $(rpcsvc:%.x=rpcsvc/%.h) $(rpcsvc:%.x=x%.c) $(rpcsvc:%.x=x%.stmp) \
+ $(rpcsvc:%.x=rpcsvc/%.stmp) rpcgen
diff --git a/multilib-staging/lib32-glibc/glibc-2.14-reinstall-nis-rpc-headers.patch b/multilib-staging/lib32-glibc/glibc-2.14-reinstall-nis-rpc-headers.patch
new file mode 100644
index 000000000..eb0fd822d
--- /dev/null
+++ b/multilib-staging/lib32-glibc/glibc-2.14-reinstall-nis-rpc-headers.patch
@@ -0,0 +1,28 @@
+From bdd816a366c4e5bba5de7157d948e0c0737fb4fb Mon Sep 17 00:00:00 2001
+From: Andreas Schwab <schwab@redhat.com>
+Date: Tue, 17 May 2011 17:42:30 +0200
+Subject: [PATCH] Reinstall NIS RPC headers
+
+---
+ nis/Makefile | 4 ++--
+ 1 files changed, 2 insertions(+), 2 deletions(-)
+
+diff --git a/nis/Makefile b/nis/Makefile
+index b5c9609..d2934d9 100644
+--- a/nis/Makefile
++++ b/nis/Makefile
+@@ -23,9 +23,9 @@ subdir := nis
+
+ aux := nis_hash
+
++headers := $(wildcard rpcsvc/*.[hx])
+ distribute := nss-nis.h nss-nisplus.h nis_intern.h Banner \
+- nisplus-parser.h nis_xdr.h nss \
+- $(wildcard rpcsvc/*.[hx])
++ nisplus-parser.h nis_xdr.h nss
+
+ # These are the databases available for the nis (and perhaps later nisplus)
+ # service. This must be a superset of the services in nss.
+--
+1.7.5.4
+
diff --git a/multilib-staging/lib32-glibc/glibc-2.14-revert-4768ae77.patch b/multilib-staging/lib32-glibc/glibc-2.14-revert-4768ae77.patch
new file mode 100644
index 000000000..11f087cb7
--- /dev/null
+++ b/multilib-staging/lib32-glibc/glibc-2.14-revert-4768ae77.patch
@@ -0,0 +1,37 @@
+diff -Naur glibc-orig//resolv/res_send.c glibc/resolv/res_send.c
+--- glibc-orig//resolv/res_send.c 2011-06-10 18:59:03.041436996 +1000
++++ glibc/resolv/res_send.c 2011-06-10 19:08:09.379309323 +1000
+@@ -549,7 +549,7 @@
+ ns, ansp, ansp2, nansp2, resplen2);
+ if (n < 0)
+ return (-1);
+- if (n == 0 && (buf2 == NULL || *resplen2 == 0))
++ if (n == 0)
+ goto next_ns;
+ } else {
+ /* Use datagrams. */
+@@ -559,7 +559,7 @@
+ ansp2, nansp2, resplen2);
+ if (n < 0)
+ return (-1);
+- if (n == 0 && (buf2 == NULL || *resplen2 == 0))
++ if (n == 0)
+ goto next_ns;
+ if (v_circuit)
+ // XXX Check whether both requests failed or
+@@ -1275,14 +1275,10 @@
+ (*thisresplenp > *thisanssizp)
+ ? *thisanssizp : *thisresplenp);
+
+- if (recvresp1 || (buf2 != NULL && recvresp2)) {
+- *resplen2 = 0;
++ if (recvresp1 || (buf2 != NULL && recvresp2))
+ return resplen;
+- }
+ if (buf2 != NULL)
+ {
+- /* No data from the first reply. */
+- resplen = 0;
+ /* We are waiting for a possible second reply. */
+ if (hp->id == anhp->id)
+ recvresp1 = 1;
diff --git a/multilib-staging/lib32-glibc/glibc-2.15-lddebug-scopes.patch b/multilib-staging/lib32-glibc/glibc-2.15-lddebug-scopes.patch
new file mode 100644
index 000000000..808cf8d7c
--- /dev/null
+++ b/multilib-staging/lib32-glibc/glibc-2.15-lddebug-scopes.patch
@@ -0,0 +1,27 @@
+From 0c95ab64cb4ec0d22bb222647d9d20c7b4903e38 Mon Sep 17 00:00:00 2001
+From: Andreas Schwab <schwab@redhat.com>
+Date: Fri, 7 Oct 2011 09:31:27 +0200
+Subject: [PATCH] Horrible workaround for horribly broken software
+
+---
+ elf/rtld.c | 4 +++-
+ 1 files changed, 3 insertions(+), 1 deletions(-)
+
+diff --git a/elf/rtld.c b/elf/rtld.c
+index 978c609..8422b9f 100644
+--- a/elf/rtld.c
++++ b/elf/rtld.c
+@@ -1393,7 +1393,9 @@ of this helper program; chances are you did not intend to run this program.\n\
+ char *copy = malloc (len);
+ if (copy == NULL)
+ _dl_fatal_printf ("out of memory\n");
+- l->l_libname->name = l->l_name = memcpy (copy, dsoname, len);
++ l->l_libname->name = memcpy (copy, dsoname, len);
++ if (GLRO(dl_debug_mask))
++ l->l_name = copy;
+ }
+
+ /* Add the vDSO to the object list. */
+--
+1.7.3.4
+
diff --git a/multilib-staging/lib32-glibc/glibc-2.15-math64crash.patch b/multilib-staging/lib32-glibc/glibc-2.15-math64crash.patch
new file mode 100644
index 000000000..d315bf266
--- /dev/null
+++ b/multilib-staging/lib32-glibc/glibc-2.15-math64crash.patch
@@ -0,0 +1,184 @@
+diff --git a/sysdeps/x86_64/fpu/multiarch/Makefile b/sysdeps/x86_64/fpu/multiarch/Makefile
+index be68903..a032da8 100644
+--- a/sysdeps/x86_64/fpu/multiarch/Makefile
++++ b/sysdeps/x86_64/fpu/multiarch/Makefile
+@@ -1,5 +1,5 @@
+ ifeq ($(subdir),math)
+-libm-sysdep_routines += s_floor-c s_ceil-c s_floorf-c s_ceilf-c \
++libm-sysdep_routines += s_floorf-c s_ceilf-c \
+ s_rint-c s_rintf-c s_nearbyint-c s_nearbyintf-c
+
+ ifeq ($(have-mfma4),yes)
+diff --git a/sysdeps/x86_64/fpu/multiarch/s_ceil-c.c b/sysdeps/x86_64/fpu/multiarch/s_ceil-c.c
+deleted file mode 100644
+index 6a5ea3f..0000000
+--- a/sysdeps/x86_64/fpu/multiarch/s_ceil-c.c
++++ /dev/null
+@@ -1,2 +0,0 @@
+-#define __ceil __ceil_c
+-#include <sysdeps/ieee754/dbl-64/wordsize-64/s_ceil.c>
+diff --git a/sysdeps/x86_64/fpu/multiarch/s_ceil.S b/sysdeps/x86_64/fpu/multiarch/s_ceil.S
+deleted file mode 100644
+index d0f8da3..0000000
+--- a/sysdeps/x86_64/fpu/multiarch/s_ceil.S
++++ /dev/null
+@@ -1,40 +0,0 @@
+-/* Copyright (C) 2011 Free Software Foundation, Inc.
+- This file is part of the GNU C Library.
+- Contributed by Ulrich Drepper <drepper@gmail.come>, 2011.
+-
+- The GNU C Library is free software; you can redistribute it and/or
+- modify it under the terms of the GNU Lesser General Public
+- License as published by the Free Software Foundation; either
+- version 2.1 of the License, or (at your option) any later version.
+-
+- The GNU C Library is distributed in the hope that it will be useful,
+- but WITHOUT ANY WARRANTY; without even the implied warranty of
+- MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+- Lesser General Public License for more details.
+-
+- You should have received a copy of the GNU Lesser General Public
+- License along with the GNU C Library; if not, write to the Free
+- Software Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA
+- 02111-1307 USA. */
+-
+-#include <machine/asm.h>
+-#include <init-arch.h>
+-
+-
+-ENTRY(__ceil)
+- .type __ceil, @gnu_indirect_function
+- call __get_cpu_features@plt
+- movq %rax, %rdx
+- leaq __ceil_sse41(%rip), %rax
+- testl $bit_SSE4_1, CPUID_OFFSET+index_SSE4_1(%rdx)
+- jnz 2f
+- leaq __ceil_c(%rip), %rax
+-2: ret
+-END(__ceil)
+-weak_alias (__ceil, ceil)
+-
+-
+-ENTRY(__ceil_sse41)
+- roundsd $2, %xmm0, %xmm0
+- ret
+-END(__ceil_sse41)
+diff --git a/sysdeps/x86_64/fpu/multiarch/s_floor-c.c b/sysdeps/x86_64/fpu/multiarch/s_floor-c.c
+deleted file mode 100644
+index 68733b6..0000000
+--- a/sysdeps/x86_64/fpu/multiarch/s_floor-c.c
++++ /dev/null
+@@ -1,3 +0,0 @@
+-#undef __floor
+-#define __floor __floor_c
+-#include <sysdeps/ieee754/dbl-64/wordsize-64/s_floor.c>
+diff --git a/sysdeps/x86_64/fpu/multiarch/s_floor.S b/sysdeps/x86_64/fpu/multiarch/s_floor.S
+deleted file mode 100644
+index 514ea95..0000000
+--- a/sysdeps/x86_64/fpu/multiarch/s_floor.S
++++ /dev/null
+@@ -1,40 +0,0 @@
+-/* Copyright (C) 2011 Free Software Foundation, Inc.
+- This file is part of the GNU C Library.
+- Contributed by Ulrich Drepper <drepper@gmail.come>, 2011.
+-
+- The GNU C Library is free software; you can redistribute it and/or
+- modify it under the terms of the GNU Lesser General Public
+- License as published by the Free Software Foundation; either
+- version 2.1 of the License, or (at your option) any later version.
+-
+- The GNU C Library is distributed in the hope that it will be useful,
+- but WITHOUT ANY WARRANTY; without even the implied warranty of
+- MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+- Lesser General Public License for more details.
+-
+- You should have received a copy of the GNU Lesser General Public
+- License along with the GNU C Library; if not, write to the Free
+- Software Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA
+- 02111-1307 USA. */
+-
+-#include <machine/asm.h>
+-#include <init-arch.h>
+-
+-
+-ENTRY(__floor)
+- .type __floor, @gnu_indirect_function
+- call __get_cpu_features@plt
+- movq %rax, %rdx
+- leaq __floor_sse41(%rip), %rax
+- testl $bit_SSE4_1, CPUID_OFFSET+index_SSE4_1(%rdx)
+- jnz 2f
+- leaq __floor_c(%rip), %rax
+-2: ret
+-END(__floor)
+-weak_alias (__floor, floor)
+-
+-
+-ENTRY(__floor_sse41)
+- roundsd $1, %xmm0, %xmm0
+- ret
+-END(__floor_sse41)
+diff --git a/sysdeps/x86_64/fpu/multiarch/s_sin.c b/sysdeps/x86_64/fpu/multiarch/s_sin.c
+deleted file mode 100644
+index 1ba9dbc..0000000
+--- a/sysdeps/x86_64/fpu/multiarch/s_sin.c
++++ /dev/null
+@@ -1,31 +0,0 @@
+-#if defined HAVE_FMA4_SUPPORT || defined HAVE_AVX_SUPPORT
+-# include <init-arch.h>
+-# include <math.h>
+-# undef NAN
+-
+-extern double __cos_sse2 (double);
+-extern double __sin_sse2 (double);
+-extern double __cos_avx (double);
+-extern double __sin_avx (double);
+-# ifdef HAVE_FMA4_SUPPORT
+-extern double __cos_fma4 (double);
+-extern double __sin_fma4 (double);
+-# else
+-# undef HAS_FMA4
+-# define HAS_FMA4 0
+-# define __cos_fma4 ((void *) 0)
+-# define __sin_fma4 ((void *) 0)
+-# endif
+-
+-libm_ifunc (__cos, HAS_FMA4 ? __cos_fma4 : HAS_AVX ? __cos_avx : __cos_sse2);
+-weak_alias (__cos, cos)
+-
+-libm_ifunc (__sin, HAS_FMA4 ? __sin_fma4 : HAS_AVX ? __sin_avx : __sin_sse2);
+-weak_alias (__sin, sin)
+-
+-# define __cos __cos_sse2
+-# define __sin __sin_sse2
+-#endif
+-
+-
+-#include <sysdeps/ieee754/dbl-64/s_sin.c>
+diff --git a/sysdeps/x86_64/fpu/multiarch/s_tan.c b/sysdeps/x86_64/fpu/multiarch/s_tan.c
+deleted file mode 100644
+index 8f6601e..0000000
+--- a/sysdeps/x86_64/fpu/multiarch/s_tan.c
++++ /dev/null
+@@ -1,21 +0,0 @@
+-#if defined HAVE_FMA4_SUPPORT || defined HAVE_AVX_SUPPORT
+-# include <init-arch.h>
+-# include <math.h>
+-
+-extern double __tan_sse2 (double);
+-extern double __tan_avx (double);
+-# ifdef HAVE_FMA4_SUPPORT
+-extern double __tan_fma4 (double);
+-# else
+-# undef HAS_FMA4
+-# define HAS_FMA4 0
+-# define __tan_fma4 ((void *) 0)
+-# endif
+-
+-libm_ifunc (tan, HAS_FMA4 ? __tan_fma4 : HAS_AVX ? __tan_avx : __tan_sse2);
+-
+-# define tan __tan_sse2
+-#endif
+-
+-
+-#include <sysdeps/ieee754/dbl-64/s_tan.c>
diff --git a/multilib-staging/lib32-glibc/glibc-2.15-revert-c5a0802a.patch b/multilib-staging/lib32-glibc/glibc-2.15-revert-c5a0802a.patch
new file mode 100644
index 000000000..f532b95e8
--- /dev/null
+++ b/multilib-staging/lib32-glibc/glibc-2.15-revert-c5a0802a.patch
@@ -0,0 +1,229 @@
+diff -rup a/nptl/sysdeps/unix/sysv/linux/i386/i486/pthread_cond_wait.S b/nptl/sysdeps/unix/sysv/linux/i386/i486/pthread_cond_wait.S
+--- a/nptl/sysdeps/unix/sysv/linux/i386/i486/pthread_cond_wait.S 2011-12-22 18:04:12.937212834 +0000
++++ b/nptl/sysdeps/unix/sysv/linux/i386/i486/pthread_cond_wait.S 2011-12-22 18:04:42.104222278 +0000
+@@ -137,7 +137,6 @@ __pthread_cond_wait:
+ cmpl $PI_BIT, %eax
+ jne 18f
+
+-90:
+ movl $(FUTEX_WAIT_REQUEUE_PI|FUTEX_PRIVATE_FLAG), %ecx
+ movl %ebp, %edx
+ xorl %esi, %esi
+@@ -151,9 +150,6 @@ __pthread_cond_wait:
+ sete 16(%esp)
+ je 19f
+
+- cmpl $-EAGAIN, %eax
+- je 91f
+-
+ /* Normal and PI futexes dont mix. Use normal futex functions only
+ if the kernel does not support the PI futex functions. */
+ cmpl $-ENOSYS, %eax
+@@ -398,78 +394,6 @@ __pthread_cond_wait:
+ #endif
+ call __lll_unlock_wake
+ jmp 11b
+-
+-91:
+-.LcleanupSTART2:
+- /* FUTEX_WAIT_REQUEUE_PI returned EAGAIN. We need to
+- call it again. */
+-
+- /* Get internal lock. */
+- movl $1, %edx
+- xorl %eax, %eax
+- LOCK
+-#if cond_lock == 0
+- cmpxchgl %edx, (%ebx)
+-#else
+- cmpxchgl %edx, cond_lock(%ebx)
+-#endif
+- jz 92f
+-
+-#if cond_lock == 0
+- movl %ebx, %edx
+-#else
+- leal cond_lock(%ebx), %edx
+-#endif
+-#if (LLL_SHARED-LLL_PRIVATE) > 255
+- xorl %ecx, %ecx
+-#endif
+- cmpl $-1, dep_mutex(%ebx)
+- setne %cl
+- subl $1, %ecx
+- andl $(LLL_SHARED-LLL_PRIVATE), %ecx
+-#if LLL_PRIVATE != 0
+- addl $LLL_PRIVATE, %ecx
+-#endif
+- call __lll_lock_wait
+-
+-92:
+- /* Increment the cond_futex value again, so it can be used as a new
+- expected value. */
+- addl $1, cond_futex(%ebx)
+- movl cond_futex(%ebx), %ebp
+-
+- /* Unlock. */
+- LOCK
+-#if cond_lock == 0
+- subl $1, (%ebx)
+-#else
+- subl $1, cond_lock(%ebx)
+-#endif
+- je 93f
+-#if cond_lock == 0
+- movl %ebx, %eax
+-#else
+- leal cond_lock(%ebx), %eax
+-#endif
+-#if (LLL_SHARED-LLL_PRIVATE) > 255
+- xorl %ecx, %ecx
+-#endif
+- cmpl $-1, dep_mutex(%ebx)
+- setne %cl
+- subl $1, %ecx
+- andl $(LLL_SHARED-LLL_PRIVATE), %ecx
+-#if LLL_PRIVATE != 0
+- addl $LLL_PRIVATE, %ecx
+-#endif
+- call __lll_unlock_wake
+-
+-93:
+- /* Set the rest of SYS_futex args for FUTEX_WAIT_REQUEUE_PI. */
+- xorl %ecx, %ecx
+- movl dep_mutex(%ebx), %edi
+- jmp 90b
+-.LcleanupEND2:
+-
+ .size __pthread_cond_wait, .-__pthread_cond_wait
+ versioned_symbol (libpthread, __pthread_cond_wait, pthread_cond_wait,
+ GLIBC_2_3_2)
+@@ -642,10 +566,6 @@ __condvar_w_cleanup:
+ .long .LcleanupEND-.Lsub_cond_futex
+ .long __condvar_w_cleanup-.LSTARTCODE
+ .uleb128 0
+- .long .LcleanupSTART2-.LSTARTCODE
+- .long .LcleanupEND2-.LcleanupSTART2
+- .long __condvar_w_cleanup-.LSTARTCODE
+- .uleb128 0
+ .long .LcallUR-.LSTARTCODE
+ .long .LENDCODE-.LcallUR
+ .long 0
+Only in b/nptl/sysdeps/unix/sysv/linux/i386/i486: pthread_cond_wait.S.orig
+diff -rup a/nptl/sysdeps/unix/sysv/linux/x86_64/pthread_cond_wait.S b/nptl/sysdeps/unix/sysv/linux/x86_64/pthread_cond_wait.S
+--- a/nptl/sysdeps/unix/sysv/linux/x86_64/pthread_cond_wait.S 2011-12-22 18:04:12.941212837 +0000
++++ b/nptl/sysdeps/unix/sysv/linux/x86_64/pthread_cond_wait.S 2011-12-22 18:05:05.155229737 +0000
+@@ -23,7 +23,6 @@
+ #include <lowlevelcond.h>
+ #include <tcb-offsets.h>
+ #include <pthread-pi-defines.h>
+-#include <pthread-errnos.h>
+
+ #include <kernel-features.h>
+
+@@ -137,14 +136,11 @@ __pthread_cond_wait:
+ cmpl $PI_BIT, %eax
+ jne 61f
+
+-90:
+ movl $(FUTEX_WAIT_REQUEUE_PI|FUTEX_PRIVATE_FLAG), %esi
+ movl $SYS_futex, %eax
+ syscall
+
+ movl $1, %r8d
+- cmpq $-EAGAIN, %rax
+- je 91f
+ #ifdef __ASSUME_REQUEUE_PI
+ jmp 62f
+ #else
+@@ -331,70 +327,6 @@ __pthread_cond_wait:
+
+ 13: movq %r10, %rax
+ jmp 14b
+-
+-91:
+-.LcleanupSTART2:
+- /* FUTEX_WAIT_REQUEUE_PI returned EAGAIN. We need to
+- call it again. */
+- movq 8(%rsp), %rdi
+-
+- /* Get internal lock. */
+- movl $1, %esi
+- xorl %eax, %eax
+- LOCK
+-#if cond_lock == 0
+- cmpxchgl %esi, (%rdi)
+-#else
+- cmpxchgl %esi, cond_lock(%rdi)
+-#endif
+- jz 92f
+-
+-#if cond_lock != 0
+- addq $cond_lock, %rdi
+-#endif
+- cmpq $-1, dep_mutex-cond_lock(%rdi)
+- movl $LLL_PRIVATE, %eax
+- movl $LLL_SHARED, %esi
+- cmovne %eax, %esi
+- callq __lll_lock_wait
+-#if cond_lock != 0
+- subq $cond_lock, %rdi
+-#endif
+-92:
+- /* Increment the cond_futex value again, so it can be used as a new
+- expected value. */
+- incl cond_futex(%rdi)
+- movl cond_futex(%rdi), %edx
+-
+- /* Release internal lock. */
+- LOCK
+-#if cond_lock == 0
+- decl (%rdi)
+-#else
+- decl cond_lock(%rdi)
+-#endif
+- jz 93f
+-
+-#if cond_lock != 0
+- addq $cond_lock, %rdi
+-#endif
+- cmpq $-1, dep_mutex-cond_lock(%rdi)
+- movl $LLL_PRIVATE, %eax
+- movl $LLL_SHARED, %esi
+- cmovne %eax, %esi
+- /* The call preserves %rdx. */
+- callq __lll_unlock_wake
+-#if cond_lock != 0
+- subq $cond_lock, %rdi
+-#endif
+-93:
+- /* Set the rest of SYS_futex args for FUTEX_WAIT_REQUEUE_PI. */
+- xorq %r10, %r10
+- movq dep_mutex(%rdi), %r8
+- leaq cond_futex(%rdi), %rdi
+- jmp 90b
+-.LcleanupEND2:
+-
+ .size __pthread_cond_wait, .-__pthread_cond_wait
+ versioned_symbol (libpthread, __pthread_cond_wait, pthread_cond_wait,
+ GLIBC_2_3_2)
+@@ -547,15 +479,11 @@ __condvar_cleanup1:
+ .uleb128 .LcleanupSTART-.LSTARTCODE
+ .uleb128 .LcleanupEND-.LcleanupSTART
+ .uleb128 __condvar_cleanup1-.LSTARTCODE
+- .uleb128 0
+- .uleb128 .LcleanupSTART2-.LSTARTCODE
+- .uleb128 .LcleanupEND2-.LcleanupSTART2
+- .uleb128 __condvar_cleanup1-.LSTARTCODE
+- .uleb128 0
++ .uleb128 0
+ .uleb128 .LcallUR-.LSTARTCODE
+ .uleb128 .LENDCODE-.LcallUR
+ .uleb128 0
+- .uleb128 0
++ .uleb128 0
+ .Lcstend:
+
+
+Only in b/nptl/sysdeps/unix/sysv/linux/x86_64: pthread_cond_wait.S.orig
+Only in b/nptl/sysdeps/unix/sysv/linux/x86_64: pthread_cond_wait.S.rej
diff --git a/multilib-staging/lib32-glibc/glibc-__i686.patch b/multilib-staging/lib32-glibc/glibc-__i686.patch
new file mode 100644
index 000000000..28d5dd424
--- /dev/null
+++ b/multilib-staging/lib32-glibc/glibc-__i686.patch
@@ -0,0 +1,13 @@
+diff -Naur glibc-old//sysdeps/i386/Makefile glibc//sysdeps/i386/Makefile
+--- glibc-old//sysdeps/i386/Makefile 2010-03-18 11:52:30.000000000 +1000
++++ glibc//sysdeps/i386/Makefile 2010-04-16 15:05:50.000000000 +1000
+@@ -1,6 +1,7 @@
+ # The mpn functions need a #define for asm syntax flavor.
+-# Every i386 port in use uses gas syntax (I think).
+-asm-CPPFLAGS += -DGAS_SYNTAX
++# Every i386 port in use uses gas syntax (I think). Don't replace
++# __i686 in __i686.get_pc_thunk.bx.
++asm-CPPFLAGS += -DGAS_SYNTAX -U __i686
+
+ # The i386 `long double' is a distinct type we support.
+ long-double-fcts = yes
diff --git a/multilib-staging/lib32-glibc/lib32-glibc.conf b/multilib-staging/lib32-glibc/lib32-glibc.conf
new file mode 100644
index 000000000..9b08c3f43
--- /dev/null
+++ b/multilib-staging/lib32-glibc/lib32-glibc.conf
@@ -0,0 +1 @@
+/usr/lib32
diff --git a/multilib-staging/lib32-gtk2/PKGBUILD b/multilib-staging/lib32-gtk2/PKGBUILD
new file mode 100644
index 000000000..b9c9036ca
--- /dev/null
+++ b/multilib-staging/lib32-gtk2/PKGBUILD
@@ -0,0 +1,57 @@
+# $Id: PKGBUILD 62043 2012-01-14 23:45:58Z bluewind $
+# Maintainer: Ionut Biru <ibiru@archlinux.org
+# Contributor: Pierre Schmitz <pierre@archlinux.de>
+# Contributor: Mikko Seppälä <t-r-a-y@mbnet.fi>
+
+_pkgbasename=gtk2
+pkgname=lib32-$_pkgbasename
+pkgver=2.24.8
+pkgrel=2
+pkgdesc="The GTK+ Toolkit (v2) (32-bit)"
+arch=('x86_64')
+url="http://www.gtk.org/"
+install=gtk2.install
+depends=(lib32-{'atk>=1.30.0','pango>=1.28.0','cairo>=1.10.0','gdk-pixbuf2>=2.22.1'}
+ lib32-lib{'cups>=1.4.4',xcursor,'xrandr>=1.3','xi>=1.3',xinerama,xcomposite,xdamage}
+ $_pkgbasename)
+makedepends=('pkgconfig' 'gcc-multilib')
+options=('!libtool' '!docs')
+license=('LGPL')
+source=(http://ftp.gnome.org/pub/gnome/sources/gtk+/2.24/gtk+-${pkgver}.tar.xz
+ xid-collision-debug.patch
+ gtk-modules-32.patch)
+sha256sums=('8a3b29f667933cf52eea2db7b066723edbc80443ca9c75b7cd7cbe8c8b90b93c'
+ 'd758bb93e59df15a4ea7732cf984d1c3c19dff67c94b957575efea132b8fe558'
+ '2effb13404442ae266d4c663347e88cd1ca19e9a83b452da1743bac16af9c7b0')
+
+build() {
+ export CC="gcc -m32"
+ export CXX="g++ -m32"
+ export PKG_CONFIG_PATH="/usr/lib32/pkgconfig"
+
+ cd "${srcdir}/gtk+-${pkgver}"
+ patch -Np1 -i "${srcdir}/xid-collision-debug.patch"
+ patch -p1 -i ${srcdir}/gtk-modules-32.patch
+
+ CXX=/bin/false ./configure --prefix=/usr \
+ --sysconfdir=/etc \
+ --localstatedir=/var \
+ --libdir=/usr/lib32 \
+ --with-xinput=yes
+
+ #https://bugzilla.gnome.org/show_bug.cgi?id=655517
+ sed -i -e 's/ -shared / -Wl,-O1,--as-needed\0/g' libtool
+
+ make
+}
+
+package() {
+ cd "${srcdir}/gtk+-${pkgver}"
+ make DESTDIR="${pkgdir}" install
+ rm -rf "${pkgdir}"/etc
+ rm -rf "${pkgdir}"/usr/{include,share}
+
+ cd "${pkgdir}"/usr/bin
+ mv gtk-query-immodules-2.0 gtk-query-immodules-2.0-32
+ rm -f gtk-builder-convert gtk-demo gtk-update-icon-cache
+}
diff --git a/multilib-staging/lib32-gtk2/gtk-modules-32.patch b/multilib-staging/lib32-gtk2/gtk-modules-32.patch
new file mode 100644
index 000000000..a2530c3bf
--- /dev/null
+++ b/multilib-staging/lib32-gtk2/gtk-modules-32.patch
@@ -0,0 +1,12 @@
+diff -ur gtk+-2.20.1/gtk/gtkrc.c gtk+-2.20.1-32/gtk/gtkrc.c
+--- gtk+-2.20.1/gtk/gtkrc.c 2010-05-03 01:28:21.000000000 +0200
++++ gtk+-2.20.1-32/gtk/gtkrc.c 2010-08-26 07:22:42.316920033 +0200
+@@ -450,7 +450,7 @@
+ if (im_module_file)
+ result = g_strdup (im_module_file);
+ else
+- result = g_build_filename (GTK_SYSCONFDIR, "gtk-2.0", "gtk.immodules", NULL);
++ result = g_build_filename (GTK_SYSCONFDIR, "gtk-2.0", "gtk.immodules-32", NULL);
+ }
+
+ return result;
diff --git a/multilib-staging/lib32-gtk2/gtk2.install b/multilib-staging/lib32-gtk2/gtk2.install
new file mode 100644
index 000000000..49f86f550
--- /dev/null
+++ b/multilib-staging/lib32-gtk2/gtk2.install
@@ -0,0 +1,16 @@
+post_install() {
+ GTK_PATH=/usr/lib32/gtk-2.0 usr/bin/gtk-query-immodules-2.0-32 > etc/gtk-2.0/gtk.immodules-32
+}
+
+pre_upgrade() {
+ pre_remove
+}
+
+post_upgrade() {
+ post_install
+}
+
+pre_remove() {
+ rm -f etc/gtk-2.0/gtk.immodules-32 &>/dev/null
+ rm -f etc/gtk-2.0/gdk-pixbuf.loaders-32 &>/dev/null
+}
diff --git a/multilib-staging/lib32-gtk2/xid-collision-debug.patch b/multilib-staging/lib32-gtk2/xid-collision-debug.patch
new file mode 100644
index 000000000..d61238c3b
--- /dev/null
+++ b/multilib-staging/lib32-gtk2/xid-collision-debug.patch
@@ -0,0 +1,15 @@
+--- gtk+-2.18.3/gdk/x11/gdkxid.c 2009-06-19 04:59:18.000000000 +0200
++++ gtk+-2.18.3/gdk/x11/gdkxid.c.new 2009-07-22 11:30:12.000000000 +0200
+@@ -56,10 +56,10 @@
+ if (!display_x11->xid_ht)
+ display_x11->xid_ht = g_hash_table_new ((GHashFunc) gdk_xid_hash,
+ (GEqualFunc) gdk_xid_equal);
+-
++/*
+ if (g_hash_table_lookup (display_x11->xid_ht, xid))
+ g_warning ("XID collision, trouble ahead");
+-
++*/
+ g_hash_table_insert (display_x11->xid_ht, xid, data);
+ }
+
diff --git a/multilib-staging/lib32-pango/PKGBUILD b/multilib-staging/lib32-pango/PKGBUILD
new file mode 100644
index 000000000..aa0488509
--- /dev/null
+++ b/multilib-staging/lib32-pango/PKGBUILD
@@ -0,0 +1,44 @@
+# $Id: PKGBUILD 62049 2012-01-14 23:53:37Z heftig $
+# Contributor: Pierre Schmitz <pierre@archlinux.de>
+# Contributor: Mikko Seppälä <t-r-a-y@mbnet.fi>
+# Maintainer: Biru Ionut <ionut@archlinux.ro>
+_pkgbasename=pango
+pkgname=lib32-$_pkgbasename
+pkgver=1.29.4
+pkgrel=2
+pkgdesc="A library for layout and rendering of text (32-bit)"
+arch=('x86_64')
+license=('LGPL')
+depends=('lib32-glib2>=2.25.15' 'lib32-cairo>=1.10.0' 'lib32-libxft>=2.1.14'
+ 'lib32-freetype2>=2.4.2' $_pkgbasename)
+makedepends=("gcc-multilib")
+options=('!libtool' '!emptydirs')
+install=pango.install
+source=(http://ftp.gnome.org/pub/gnome/sources/${_pkgbasename}/1.29/${_pkgbasename}-${pkgver}.tar.xz
+ pango-modules-conffile.patch)
+url="http://www.pango.org/"
+sha256sums=('7ae8d1953e6098a2706df58c1f84555c06ace7006bb34c0e54ab9acd98c1127f'
+ '4a178b60dd420ae53baeabbecfaaeca4070a4b777b2b3f36d137cd70b5a270c3')
+
+build() {
+ export CC="gcc -m32"
+ export CXX="g++ -m32"
+ export PKG_CONFIG_PATH="/usr/lib32/pkgconfig"
+
+ cd "${srcdir}/${_pkgbasename}-${pkgver}"
+ patch -p0 < ${srcdir}/pango-modules-conffile.patch
+ # No libthai support yet
+ ./configure --prefix=/usr --libdir=/usr/lib32 --sysconfdir=/etc \
+ --localstatedir=/var --with-included-modules=basic-fc \
+ --with-dynamic-modules=arabic-fc,arabic-lang,basic-fc,basic-win32,basic-x,basic-atsui,hangul-fc,hebrew-fc,indic-fc,indic-lang,khmer-fc,syriac-fc,tibetan-fc \
+ --disable-introspection
+ make
+}
+
+package() {
+ cd "${srcdir}/${_pkgbasename}-${pkgver}"
+ make DESTDIR="${pkgdir}" install
+ rm -rf "$pkgdir"/etc
+ rm -rf "$pkgdir"/usr/{bin/pango-view,share,include}
+ mv "$pkgdir"/usr/bin/pango-querymodules "$pkgdir"/usr/bin/pango-querymodules-32
+}
diff --git a/multilib-staging/lib32-pango/pango-modules-conffile.patch b/multilib-staging/lib32-pango/pango-modules-conffile.patch
new file mode 100644
index 000000000..a959cf1c8
--- /dev/null
+++ b/multilib-staging/lib32-pango/pango-modules-conffile.patch
@@ -0,0 +1,20 @@
+--- pango/modules.c.orig 2010-08-26 06:45:49.329259966 +0200
++++ pango/modules.c 2010-08-26 06:46:13.786685177 +0200
+@@ -529,7 +529,7 @@
+
+ if (!file_str)
+ file_str = g_build_filename (pango_get_sysconf_subdirectory (),
+- "pango.modules",
++ "pango.modules-32",
+ NULL);
+
+ files = pango_split_file_list (file_str);
+@@ -640,7 +640,7 @@
+ if (!no_module_warning)
+ {
+ gchar *filename = g_build_filename (pango_get_sysconf_subdirectory (),
+- "pango.modules",
++ "pango.modules-32",
+ NULL);
+ g_critical ("No modules found:\n"
+ "No builtin or dynamically loaded modules were found.\n"
diff --git a/multilib-staging/lib32-pango/pango.install b/multilib-staging/lib32-pango/pango.install
new file mode 100644
index 000000000..173b6820f
--- /dev/null
+++ b/multilib-staging/lib32-pango/pango.install
@@ -0,0 +1,21 @@
+# arg 1: the new package version
+post_install() {
+ # we need to ldconfig first, in case xfree86's libs aren't
+ # in ld.so.cache yet
+ sbin/ldconfig -r .
+ usr/bin/pango-querymodules-32 >etc/pango/pango.modules-32
+}
+
+# arg 1: the new package version
+# arg 2: the old package version
+post_upgrade() {
+ if [ -f etc/pango/pango.modules-32 ]; then
+ rm etc/pango/pango.modules-32
+ fi
+ post_install $1
+}
+
+# arg 1: the old package version
+pre_remove() {
+ rm etc/pango/pango.modules-32
+}
diff --git a/multilib-staging/libtool-multilib/PKGBUILD b/multilib-staging/libtool-multilib/PKGBUILD
new file mode 100644
index 000000000..abdc50ebc
--- /dev/null
+++ b/multilib-staging/libtool-multilib/PKGBUILD
@@ -0,0 +1,73 @@
+# $Id: PKGBUILD 62034 2012-01-14 22:04:47Z heftig $
+# Maintainer: Jan "heftig" Steffens <jan.steffens@gmail.com>
+# Contributor: Allan McRae <allan@archlinux.org>
+# Contributor: judd <jvinet@zeroflux.org>
+
+# NOTE: requires rebuild with each new gcc version
+
+pkgbase=libtool-multilib
+pkgname=(libtool-multilib lib32-libltdl)
+pkgver=2.4.2
+pkgrel=2.1
+pkgdesc="A generic library support script for multilib"
+arch=('x86_64')
+url="http://www.gnu.org/software/libtool"
+license=('GPL')
+_gccver=4.6.2
+makedepends=("gcc-multilib=$_gccver")
+options=('!libtool')
+source=(ftp://ftp.gnu.org/pub/gnu/libtool/libtool-${pkgver}.tar.xz{,.sig})
+md5sums=('2ec8997e0c07249eb4cbd072417d70fe'
+ '1e6ba57420c82c663c85e745d11c7eed')
+
+build() {
+ cd "$srcdir"
+
+ rm -rf libtool-64 libtool-32
+ mv libtool-$pkgver libtool-64
+ cp -a libtool-64 libtool-32
+
+ msg2 "Building libtool-64..."
+ cd "$srcdir/libtool-64"
+ ./configure --prefix=/usr
+ make
+
+ msg2 "Building libtool-32..."
+ export CC="gcc -m32"
+ export CXX="g++ -m32"
+
+ cd "$srcdir/libtool-32"
+ ./configure --prefix=/usr --libdir=/usr/lib32
+ make
+}
+
+check() {
+ cd "$srcdir/libtool-64"
+ make check
+ cd "$srcdir/libtool-32"
+ make check
+}
+
+package_libtool-multilib() {
+ depends=('sh' "libltdl=$pkgver" 'tar' "gcc-multilib=$_gccver" "lib32-libltdl=$pkgver")
+ groups=('multilib-devel')
+ install=libtool.install
+ provides=("libtool=$pkgver-$pkgrel")
+ conflicts=(libtool)
+
+ cd "$srcdir/libtool-64"
+ make DESTDIR=${pkgdir} install-binSCRIPTS install-man install-info \
+ install-data-local
+ rm -rf ${pkgdir}/usr/share/libtool/libltdl/
+}
+
+package_lib32-libltdl() {
+ pkgdesc="A system independent dlopen wrapper for GNU libtool (32-bit)"
+ depends=(lib32-glibc libltdl)
+ replaces=(lib32-libtool)
+ provides=("lib32-libtool=$pkgver-$pkgrel")
+ conflicts=(lib32-libtool)
+
+ cd "$srcdir/libtool-32"
+ make DESTDIR="$pkgdir" install-libLTLIBRARIES
+}
diff --git a/multilib-staging/libtool-multilib/libtool.install b/multilib-staging/libtool-multilib/libtool.install
new file mode 100644
index 000000000..424c8cb88
--- /dev/null
+++ b/multilib-staging/libtool-multilib/libtool.install
@@ -0,0 +1,22 @@
+infodir=/usr/share/info
+filelist=(libtool.info libtool.info-1 libtool.info-2)
+
+post_install() {
+ [ -x usr/bin/install-info ] || return 0
+ for file in ${filelist[@]}; do
+ install-info $infodir/$file.gz $infodir/dir 2> /dev/null
+ done
+}
+
+post_upgrade() {
+ post_install $1
+}
+
+pre_remove() {
+ [ -x usr/bin/install-info ] || return 0
+ for file in ${filelist[@]}; do
+ install-info --delete $infodir/$file.gz $infodir/dir 2> /dev/null
+ done
+}
+
+# vim:set ts=2 sw=2 et:
diff --git a/testing/gmime/PKGBUILD b/testing/gmime/PKGBUILD
new file mode 100644
index 000000000..0cd358ce6
--- /dev/null
+++ b/testing/gmime/PKGBUILD
@@ -0,0 +1,32 @@
+# $Id: PKGBUILD 146618 2012-01-14 12:24:08Z ibiru $
+# Maintainer: Jan de Groot <jgc@archlinux.org>
+# Contributor: Ben <ben@benmazer.net>
+
+pkgname=gmime
+pkgver=2.6.4
+pkgrel=1
+pkgdesc="Core mime parsing library"
+arch=('i686' 'x86_64')
+license=('GPL')
+url="http://spruce.sourceforge.net/gmime/"
+depends=('glib2' 'gpgme' 'zlib')
+makedepends=('gtk-sharp-2')
+options=('!libtool')
+source=(http://ftp.gnome.org/pub/GNOME/sources/$pkgname/${pkgver%.*}/$pkgname-$pkgver.tar.xz)
+sha256sums=('2e85076c223fe8bf1392a7c1affa4454cb3bb6dec83016ad6e3230c65533f163')
+
+build() {
+ # get rid of that .wapi errors in fakeroot
+ export MONO_SHARED_DIR="$srcdir/weird"
+ mkdir -p "$MONO_SHARED_DIR"
+
+ cd "$srcdir/$pkgname-$pkgver"
+
+ ./configure --prefix=/usr --disable-static
+ make
+}
+
+package() {
+ cd "$srcdir/$pkgname-$pkgver"
+ make DESTDIR="$pkgdir" install
+}
diff --git a/testing/grilo-plugins/PKGBUILD b/testing/grilo-plugins/PKGBUILD
new file mode 100644
index 000000000..ddf708f84
--- /dev/null
+++ b/testing/grilo-plugins/PKGBUILD
@@ -0,0 +1,39 @@
+# $Id: PKGBUILD 146620 2012-01-14 12:24:10Z ibiru $
+# Maintainer: Jan "heftig" Steffens <jan.steffens@gmail.com>
+
+pkgname=grilo-plugins
+pkgver=0.1.18
+pkgrel=2
+pkgdesc="Plugins for Grilo"
+url="http://www.gnome.org"
+arch=('i686' 'x86_64')
+license=('LGPL')
+depends=('grilo')
+makedepends=('gupnp-av' 'libgdata' 'libquvi' 'sqlite3' 'gmime' 'libgcrypt'
+ 'rest' 'libtracker-sparql')
+optdepends=('gupnp-av: uPnP plugin'
+ 'libgdata: Youtube plugin'
+ 'libquvi: Youtube plugin'
+ 'sqlite3: Podcasts plugin'
+ 'gmime: Podcasts plugin'
+ 'sqlite3: Bookmarks plugin'
+ 'sqlite3: Metadata store plugin'
+ 'libgcrypt: Vimeo plugin'
+ 'rest: Blip.tv plugin'
+ 'libtracker-sparql: Tracker plugin')
+options=('!libtool' '!emptydirs')
+source=(http://ftp.gnome.org/pub/gnome/sources/${pkgname}/${pkgver%.*}/${pkgname}-${pkgver}.tar.xz)
+sha256sums=('7e382f402119f4f270380627a2f49b30a6c43a47ecd645bf5ffe4e0cd99a1c79')
+
+build() {
+ cd "${srcdir}/${pkgname}-${pkgver}"
+
+ ./configure --prefix=/usr --sysconfdir=/etc --disable-static \
+ --enable-shoutcast
+ make
+}
+
+package() {
+ cd "${srcdir}/${pkgname}-${pkgver}"
+ make DESTDIR="${pkgdir}" install
+}
diff --git a/testing/mail-notification/PKGBUILD b/testing/mail-notification/PKGBUILD
new file mode 100644
index 000000000..1ed5fa7f0
--- /dev/null
+++ b/testing/mail-notification/PKGBUILD
@@ -0,0 +1,85 @@
+# $Id: PKGBUILD 146622 2012-01-14 12:24:17Z ibiru $
+# Maintainer: Roman Kyrylych <roman@archlinux.org>
+
+pkgname=mail-notification
+pkgver=5.4
+pkgrel=10
+pkgdesc="Tray icon application that informs you if you have new mail"
+arch=('i686' 'x86_64')
+url="http://www.nongnu.org/mailnotify/"
+license=('GPL3' 'FDL')
+depends=('gmime' 'libnotify' 'gnome-keyring' 'hicolor-icon-theme' 'notification-daemon' 'libgnome')
+makedepends=('gob2' 'intltool' 'evolution' 'gnome-doc-utils' 'gtk2')
+options=('!libtool' '!emptydirs')
+install=mail-notification.install
+source=(http://savannah.nongnu.org/download/mailnotify-orig/${pkgname}-${pkgver}.tar.bz2
+ dont-update-cache.patch
+ remove-ubuntu-special-case.patch
+ mail-notification-5.4-evolution.patch
+ mail-notification-5.4-sasl_encode64.patch
+ mail-notification-5.4-evolution-gtkhtml.patch
+ mail-notification-5.4-camel_headers.patch
+ mail-notification-5.4-icons.patch
+ mail-notification-5.4-weak.patch
+ mail-notification-5.4-popup-attach.patch
+ mail-notification-5.4-kde-trayicon.patch
+ mail-notification-5.4-evolution-3-0-support.patch
+ mail-notification-5.4-gtk3-support.patch
+ mail-notification-5.4-add-fallback-icon.patch
+ mail-notification-5.4-gmime.patch
+ mail-notification-5.4-libx11.patch)
+md5sums=('c8dc33a61251acb5474e56eab6b18f43'
+ '6007bc30e789dab0a8282038e0335eb9'
+ '9cadd61bbd9c324b2916ec980231e0f2'
+ 'aa6f80820899f904c25988772f70ade9'
+ '125513ed059f62469377eb0ab794dbed'
+ 'c595a3962ab13a65be24a941e28faa9c'
+ 'f79939f593b2e8659e302df72c2b54b1'
+ '244b7ef2aec7656e8df390be87c10e2b'
+ '31bde95dfd39449959d8b3316f91429c'
+ 'cdead6a88d1779f69a5f40dc75d5cb84'
+ 'c7991b831834724eddc1c6802c3e06a6'
+ 'b370b1085ebb2814bd5d345a6d2b45ea'
+ '1ba948759110787dd57097cff157b75a'
+ '09df61b4dc29c676ac81ff9054e840ac'
+ '0944695e9b9b30f39028f85c83c6a7e2'
+ 'c3f643ef16aab3b4fe9ff5b333bff41a')
+
+build() {
+ cd "${srcdir}/${pkgname}-${pkgver}"
+
+ patch -Np0 -i "${srcdir}/dont-update-cache.patch"
+ patch -Np0 -i "${srcdir}/remove-ubuntu-special-case.patch"
+ patch -Np1 -i "${srcdir}/mail-notification-5.4-evolution.patch"
+ patch -Np1 -i "${srcdir}/mail-notification-5.4-sasl_encode64.patch"
+ patch -Np1 -i "${srcdir}/mail-notification-5.4-evolution-gtkhtml.patch"
+ patch -Np1 -i "${srcdir}/mail-notification-5.4-camel_headers.patch"
+ patch -Np1 -i "${srcdir}/mail-notification-5.4-icons.patch"
+ patch -Np1 -i "${srcdir}/mail-notification-5.4-weak.patch"
+ patch -Np1 -i "${srcdir}/mail-notification-5.4-popup-attach.patch"
+ patch -Np1 -i "${srcdir}/mail-notification-5.4-kde-trayicon.patch"
+ patch -Np0 -i "${srcdir}/mail-notification-5.4-evolution-3-0-support.patch"
+ patch -Np0 -i "${srcdir}/mail-notification-5.4-gtk3-support.patch"
+ patch -Np0 -i "${srcdir}/mail-notification-5.4-add-fallback-icon.patch"
+ patch -Np1 -i "${srcdir}/mail-notification-5.4-gmime.patch"
+ patch -Np1 -i "${srcdir}/mail-notification-5.4-libx11.patch"
+
+ gtk-builder-convert ui/mailbox-properties-dialog.glade ui/mailbox-properties-dialog.ui
+ gtk-builder-convert ui/properties-dialog.glade ui/properties-dialog.ui
+
+ ./jb configure prefix=/usr sysconfdir=/etc \
+ localstatedir=/var destdir="${pkgdir}" \
+ gconf-schemas-dir=/etc/gconf/schemas install-gconf-schemas=no \
+ cflags="${CFLAGS}" cppflags="${CXXFLAGS}" ldflags="${LDFLAGS}" \
+ library-mode=0755
+ ./jb build
+ GCONF_DISABLE_MAKEFILE_SCHEMA_INSTALL=1 ./jb install
+
+ rm -f "${pkgdir}/usr/share/mail-notification/"*.glade
+ install -m644 ui/mailbox-properties-dialog.ui "${pkgdir}/usr/share/mail-notification/"
+ install -m644 ui/properties-dialog.ui "${pkgdir}/usr/share/mail-notification/"
+
+ install -m755 -d "${pkgdir}/usr/share/gconf/schemas"
+ gconf-merge-schema ${pkgdir}/usr/share/gconf/schemas/${pkgname}.schemas --domain mail-notification ${pkgdir}/etc/gconf/schemas/*.schemas
+ rm -f ${pkgdir}/etc/gconf/schemas/*.schemas
+}
diff --git a/testing/mail-notification/dont-update-cache.patch b/testing/mail-notification/dont-update-cache.patch
new file mode 100644
index 000000000..81216835e
--- /dev/null
+++ b/testing/mail-notification/dont-update-cache.patch
@@ -0,0 +1,22 @@
+--- jbsrc/jb.c.~1~ 2008-03-20 16:53:02.000000000 +0100
++++ jbsrc/jb.c 2008-03-26 20:51:45.641363619 +0100
+@@ -327,7 +327,6 @@
+ jb_package_add_resources (void)
+ {
+ JBGroup *group;
+- JBRule *rule;
+ JBObject *object;
+
+ if (jb_variable_get_bool("compile-warnings"))
+@@ -362,11 +361,6 @@
+ if (jb_variable_get_bool("hotmail"))
+ jb_group_add_data_file(group, "hotmail.png", "$pkgdatadir");
+
+- rule = jb_rule_new();
+- jb_rule_set_install_message(rule, "updating the GTK+ icon cache");
+- jb_rule_add_install_command(rule, "-gtk-update-icon-cache -f -t $datadir/icons/hicolor");
+- jb_group_add_resource(group, JB_GROUP_RESOURCE(rule));
+-
+ jb_group_add(group);
+
+ /*** data ******************************************************************/
diff --git a/testing/mail-notification/mail-notification-5.4-add-fallback-icon.patch b/testing/mail-notification/mail-notification-5.4-add-fallback-icon.patch
new file mode 100644
index 000000000..41c28e870
--- /dev/null
+++ b/testing/mail-notification/mail-notification-5.4-add-fallback-icon.patch
@@ -0,0 +1,16 @@
+--- src/mn-stock.c.orig 2011-02-17 17:42:39.886767087 +0100
++++ src/mn-stock.c 2011-02-17 17:49:37.415541177 +0100
+@@ -86,6 +86,13 @@
+ gtk_icon_source_set_icon_name(icon_source, icons[i].icon_name);
+ gtk_icon_set_add_source(icon_set, icon_source);
+ gtk_icon_source_free(icon_source);
++
++ /* Add a fallback icon */
++ icon_source = gtk_icon_source_new();
++ gtk_icon_source_set_icon_name(icon_source, "mail-notification");
++ gtk_icon_source_set_state_wildcarded(icon_source, TRUE);
++ gtk_icon_set_add_source(icon_set, icon_source);
++ gtk_icon_source_free(icon_source);
+ }
+ else if (icons[i].source_stock_id)
+ {
diff --git a/testing/mail-notification/mail-notification-5.4-camel_headers.patch b/testing/mail-notification/mail-notification-5.4-camel_headers.patch
new file mode 100644
index 000000000..861e3d215
--- /dev/null
+++ b/testing/mail-notification/mail-notification-5.4-camel_headers.patch
@@ -0,0 +1,36 @@
+diff -Nrbu mail-notification-5.4/build/src/mn-evolution-message.c mail-notification-5.4-OK/build/src/mn-evolution-message.c
+--- mail-notification-5.4/build/src/mn-evolution-message.c 2008-05-22 19:47:51.000000000 +0400
++++ mail-notification-5.4-OK/build/src/mn-evolution-message.c 2010-05-04 18:13:31.000000000 +0400
+@@ -25,7 +25,7 @@
+ #line 24 "src/mn-evolution-message.gob"
+
+ #include <glib/gi18n.h>
+-#include <camel/camel-folder-summary.h>
++#include <camel/camel.h>
+ #include "mn-evolution-mailbox.h"
+ #include "mn-message-private.h"
+ #include "mn-evolution-client.h"
+diff -Nrbu mail-notification-5.4/build/src/mn-evolution-server.c mail-notification-5.4-OK/build/src/mn-evolution-server.c
+--- mail-notification-5.4/build/src/mn-evolution-server.c 2010-05-04 18:12:56.000000000 +0400
++++ mail-notification-5.4-OK/build/src/mn-evolution-server.c 2010-05-04 18:13:39.000000000 +0400
+@@ -28,7 +28,7 @@
+ #include <libintl.h>
+ #include <gobject/gvaluecollector.h>
+ #include <libedataserver/eds-version.h>
+-#include <camel/camel-folder.h>
++#include <camel/camel.h>
+ #if EDS_CHECK_VERSION(2,29,0)
+ #include <shell/e-shell.h>
+ #include <mail/e-mail-browser.h>
+diff -Nrbu mail-notification-5.4/src/mn-evolution-plugin.c mail-notification-5.4-OK/src/mn-evolution-plugin.c
+--- mail-notification-5.4/src/mn-evolution-plugin.c 2010-05-04 18:12:56.000000000 +0400
++++ mail-notification-5.4-OK/src/mn-evolution-plugin.c 2010-05-04 18:13:20.000000000 +0400
+@@ -24,7 +24,7 @@
+ #include <dbus/dbus.h>
+ #include <dbus/dbus-glib-lowlevel.h>
+ #include <dbus/dbus-glib-bindings.h>
+-#include <camel/camel-folder.h>
++#include <camel/camel.h>
+ #include <mail/em-event.h>
+ #include <mail/mail-tools.h>
+ #include "mn-evolution.h"
diff --git a/testing/mail-notification/mail-notification-5.4-evolution-3-0-support.patch b/testing/mail-notification/mail-notification-5.4-evolution-3-0-support.patch
new file mode 100644
index 000000000..51938b5fa
--- /dev/null
+++ b/testing/mail-notification/mail-notification-5.4-evolution-3-0-support.patch
@@ -0,0 +1,122 @@
+--- jbsrc/lib/src/extras/jb-evolution-plugin.c.evolution30 2011-02-02 00:09:33.945696868 +0100
++++ jbsrc/lib/src/extras/jb-evolution-plugin.c 2011-02-02 00:28:09.096275028 +0100
+@@ -41,7 +41,7 @@
+ if (! minversion)
+ minversion = "2.12";
+
+- packages = g_strdup_printf("evolution-plugin >= %s libgtkhtml-3.15 gtkhtml-editor-3.14", minversion);
++ packages = g_strdup_printf("evolution-plugin-3.0 >= %s libgtkhtml-4.0 gtkhtml-editor-4.0", minversion);
+ result = jb_check_packages("Evolution", "evolution-plugin", packages);
+ g_free(packages);
+
+@@ -53,7 +53,7 @@
+ char *plugindir;
+
+ jb_message_checking("for the Evolution plugin directory");
+- plugindir = jb_get_package_variable("evolution-plugin", "plugindir");
++ plugindir = jb_get_package_variable("evolution-plugin-3.0", "plugindir");
+ jb_message_result_string(plugindir ? plugindir : "not found");
+
+ if (! plugindir)
+--- src/mn-evolution-plugin.c.orig 2011-02-09 00:07:37.422002566 +0100
++++ src/mn-evolution-plugin.c 2011-02-09 00:12:43.652678682 +0100
+@@ -25,6 +25,7 @@
+ #include <dbus/dbus-glib-lowlevel.h>
+ #include <dbus/dbus-glib-bindings.h>
+ #include <camel/camel.h>
++#include <libedataserver/eds-version.h>
+ #include <mail/em-event.h>
+ #include <mail/mail-tools.h>
+ #include "mn-evolution.h"
+@@ -240,7 +241,11 @@
+ EMEventTargetFolder *folder)
+ {
+ if (evo_server)
++#if EDS_CHECK_VERSION(3,1,0)
++ mn_evolution_server_folder_changed(evo_server, e_mail_folder_uri_build(folder->store, folder->folder_name));
++#else
+ mn_evolution_server_folder_changed(evo_server, folder->uri);
++#endif
+ }
+
+ void
+@@ -249,10 +250,16 @@
+ {
+ if (evo_server)
+ {
+- char *url;
++#if EDS_CHECK_VERSION(2,91,0)
++ const char *url = camel_folder_get_uri(message->folder);
++#else
++ char *url = mail_tools_folder_to_url(message->folder);
++#endif
+
+- url = mail_tools_folder_to_url(message->folder);
+ mn_evolution_server_message_reading(evo_server, url);
++
++#if !EDS_CHECK_VERSION(2,91,0)
+ g_free(url);
++#endif
+ }
+ }
+--- build/src/mn-evolution-server.c.orig 2011-02-09 00:17:38.850944227 +0100
++++ build/src/mn-evolution-server.c 2011-02-09 22:21:54.155346478 +0100
+@@ -496,11 +496,15 @@
+
+ if (! folder)
+ {
+- folder = mail_tool_uri_to_folder(uri, 0,
+ #if EDS_CHECK_VERSION(2,91,0)
+- NULL,
++ static EMailSession * session = NULL;
++ if (!session)
++ session = e_mail_session_new();
++
++ folder = e_mail_session_uri_to_folder_sync(session, uri, 0, NULL, NULL);
++#else
++ folder = mail_tool_uri_to_folder(uri, 0, NULL);
+ #endif
+- NULL);
+ if (folder)
+ self_cache_folder(uri, folder);
+ else
+@@ -677,7 +681,12 @@
+ folder = self_lookup_folder(folder_uri, err);
+ if (folder)
+ {
++#if EDS_CHECK_VERSION(3,1,0)
++ *ret = g_strdup(camel_folder_get_display_name(folder));
++#else
+ *ret = g_strdup(camel_folder_get_name(folder));
++#endif
++
+ #if EDS_CHECK_VERSION(2,31,0)
+ g_object_unref(folder);
+ #else
+@@ -725,8 +734,12 @@
+ shell = e_shell_get_default ();
+ shell_backend = e_shell_get_backend_by_name (shell, "mail");
+
+- browser = e_mail_browser_new (shell_backend);
++ browser = e_mail_browser_new (E_MAIL_BACKEND(shell_backend));
++#if EDS_CHECK_VERSION(3,1,0)
++ e_mail_reader_set_folder (E_MAIL_READER (browser), folder);
++#else
+ e_mail_reader_set_folder (E_MAIL_READER (browser), folder, folder_uri);
++#endif
+ e_mail_reader_set_message (E_MAIL_READER (browser), message_uid);
+ gtk_widget_show (browser);
+ #else
+--- build/src/mn-evolution-folder-tree-server.c.orig 2011-06-17 22:01:49.226886994 +0200
++++ build/src/mn-evolution-folder-tree-server.c 2011-06-18 00:34:23.046889847 +0200
+@@ -444,7 +444,9 @@
+ {
+ #line 61 "src/mn-evolution-folder-tree-server.gob"
+
+-#if EDS_CHECK_VERSION(2,91,0)
++#if EDS_CHECK_VERSION(3,1,0)
++ selfp->tree = em_folder_tree_new(NULL, NULL);
++#elif EDS_CHECK_VERSION(2,91,0)
+ selfp->session = e_mail_session_new();
+ selfp->tree = em_folder_tree_new(selfp->session);
+ #elif EDS_CHECK_VERSION(2,29,0)
diff --git a/testing/mail-notification/mail-notification-5.4-evolution-gtkhtml.patch b/testing/mail-notification/mail-notification-5.4-evolution-gtkhtml.patch
new file mode 100644
index 000000000..283ef36d6
--- /dev/null
+++ b/testing/mail-notification/mail-notification-5.4-evolution-gtkhtml.patch
@@ -0,0 +1,12 @@
+diff -Nrbu mail-notification-5.4/jbsrc/lib/src/extras/jb-evolution-plugin.c mail-notification-5.4-OK/jbsrc/lib/src/extras/jb-evolution-plugin.c
+--- mail-notification-5.4/jbsrc/lib/src/extras/jb-evolution-plugin.c 2008-04-27 18:47:43.000000000 +0400
++++ mail-notification-5.4-OK/jbsrc/lib/src/extras/jb-evolution-plugin.c 2009-08-21 19:48:22.000000000 +0400
+@@ -41,7 +41,7 @@
+ if (! minversion)
+ minversion = "2.12";
+
+- packages = g_strdup_printf("evolution-plugin >= %s", minversion);
++ packages = g_strdup_printf("evolution-plugin >= %s libgtkhtml-3.15 gtkhtml-editor-3.14", minversion);
+ result = jb_check_packages("Evolution", "evolution-plugin", packages);
+ g_free(packages);
+
diff --git a/testing/mail-notification/mail-notification-5.4-evolution.patch b/testing/mail-notification/mail-notification-5.4-evolution.patch
new file mode 100644
index 000000000..87514c22d
--- /dev/null
+++ b/testing/mail-notification/mail-notification-5.4-evolution.patch
@@ -0,0 +1,244 @@
+diff -Nrbu mail-notification-5.4/build/src/mn-evolution-folder-tree-server.c mail-notification-5.4-OK/build/src/mn-evolution-folder-tree-server.c
+--- mail-notification-5.4/build/src/mn-evolution-folder-tree-server.c 2008-05-22 19:47:48.000000000 +0400
++++ mail-notification-5.4-OK/build/src/mn-evolution-folder-tree-server.c 2010-10-12 16:50:15.000000000 +0400
+@@ -25,7 +25,10 @@
+ #line 24 "src/mn-evolution-folder-tree-server.gob"
+
+ #include <dbus/dbus.h>
++#include <libedataserver/eds-version.h>
++#if !EDS_CHECK_VERSION(2,29,0)
+ #include <mail/mail-component.h>
++#endif
+ #include <mail/em-folder-tree.h>
+ #include "mn-evolution-plugin.h"
+ #include "mn-evolution.h"
+@@ -441,10 +444,17 @@
+ {
+ #line 61 "src/mn-evolution-folder-tree-server.gob"
+
++#if EDS_CHECK_VERSION(2,91,0)
++ selfp->session = e_mail_session_new();
++ selfp->tree = em_folder_tree_new(selfp->session);
++#elif EDS_CHECK_VERSION(2,29,0)
++ selfp->tree = em_folder_tree_new();
++#else
+ EMFolderTreeModel *model;
+
+ model = mail_component_peek_tree_model(mail_component_peek());
+ selfp->tree = em_folder_tree_new_with_model(model);
++#endif
+
+ selfp->plug = gtk_plug_new((GdkNativeWindow) selfp->id);
+ gtk_container_add(GTK_CONTAINER(selfp->plug), selfp->tree);
+@@ -469,6 +479,10 @@
+ {
+ #line 80 "src/mn-evolution-folder-tree-server.gob"
+
++#if EDS_CHECK_VERSION(2,91,0)
++ g_object_unref(selfp->session);
++ selfp->session = NULL;
++#endif
+ g_signal_handlers_disconnect_by_func(selfp->plug, self_plug_destroy_h, self);
+ }}
+ #line 475 "mn-evolution-folder-tree-server.c"
+diff -Nrbu mail-notification-5.4/build/src/mn-evolution-server.c mail-notification-5.4-OK/build/src/mn-evolution-server.c
+--- mail-notification-5.4/build/src/mn-evolution-server.c 2008-05-22 19:47:48.000000000 +0400
++++ mail-notification-5.4-OK/build/src/mn-evolution-server.c 2010-10-12 16:50:40.000000000 +0400
+@@ -27,12 +27,22 @@
+ #include <stdio.h>
+ #include <libintl.h>
+ #include <gobject/gvaluecollector.h>
++#include <libedataserver/eds-version.h>
+ #include <camel/camel-folder.h>
++#if EDS_CHECK_VERSION(2,29,0)
++#include <shell/e-shell.h>
++#include <mail/e-mail-browser.h>
++#else
+ #include <mail/em-folder-view.h>
+ #include <mail/em-format.h>
+ #include <mail/em-message-browser.h>
++#endif
+ #include <mail/em-utils.h>
++#if EDS_CHECK_VERSION(2,91,0)
++#include <mail/e-mail-session.h>
++#else
+ #include <mail/mail-session.h>
++#endif
+ #include <mail/mail-tools.h>
+ #include "mn-evolution.h"
+ #include "mn-evolution-folder-tree-server.h"
+@@ -391,10 +397,18 @@
+ info = g_new0(FolderInfo, 1);
+ info->uri = g_strdup(uri);
+ info->folder = folder;
++#if EDS_CHECK_VERSION(2,31,0)
++ g_object_ref(folder);
++#else
+ camel_object_ref(folder);
++#endif
+
+ /* uncache the folder when it is deleted */
++#if EDS_CHECK_VERSION(2,31,0)
++ g_signal_connect(folder, "deleted", G_CALLBACK(self_folder_deleted_cb), info);
++#else
+ camel_object_hook_event(folder, "deleted", self_folder_deleted_cb, info);
++#endif
+
+ g_hash_table_replace(folders, info->uri, info);
+ }}
+@@ -413,8 +427,13 @@
+ {
+ #line 105 "src/mn-evolution-server.gob"
+
++#if EDS_CHECK_VERSION(2,31,0)
++ g_signal_handlers_disconnect_by_func(info->folder, self_folder_deleted_cb, info);
++ g_object_unref(info->folder);
++#else
+ camel_object_unhook_event(info->folder, "deleted", self_folder_deleted_cb, info);
+ camel_object_unref(info->folder);
++#endif
+ g_free(info->uri);
+ g_free(info);
+ }}
+@@ -461,7 +480,11 @@
+ if (info)
+ {
+ folder = info->folder;
++#if EDS_CHECK_VERSION(2,31,0)
++ g_object_ref(folder);
++#else
+ camel_object_ref(folder);
++#endif
+ }
+ }
+ else
+@@ -469,7 +492,11 @@
+
+ if (! folder)
+ {
+- folder = mail_tool_uri_to_folder(uri, 0, NULL);
++ folder = mail_tool_uri_to_folder(uri, 0,
++#if EDS_CHECK_VERSION(2,91,0)
++ NULL,
++#endif
++ NULL);
+ if (folder)
+ self_cache_folder(uri, folder);
+ else
+@@ -595,14 +622,23 @@
+
+ for (i = 0; i < summary->len; i++)
+ {
++#if EDS_CHECK_VERSION(2,23,5)
++ char *uid = summary->pdata[i];
++ CamelMessageInfo *info = camel_folder_get_message_info(folder, uid);
++#else
+ CamelMessageInfo *info = summary->pdata[i];
++#endif
+
+ if ((camel_message_info_flags(info) & CAMEL_MESSAGE_SEEN) == 0)
+ g_ptr_array_add(*ret, self_camel_message_info_to_dbus_struct(info));
+ }
+
+ camel_folder_free_summary(folder, summary);
++#if EDS_CHECK_VERSION(2,31,0)
++ g_object_unref(folder);
++#else
+ camel_object_unref(folder);
++#endif
+ }
+
+ GDK_THREADS_LEAVE();
+@@ -638,7 +674,11 @@
+ if (folder)
+ {
+ *ret = g_strdup(camel_folder_get_name(folder));
++#if EDS_CHECK_VERSION(2,31,0)
++ g_object_unref(folder);
++#else
+ camel_object_unref(folder);
++#endif
+ }
+
+ GDK_THREADS_LEAVE();
+@@ -673,6 +713,19 @@
+ folder = self_lookup_folder(folder_uri, err);
+ if (folder)
+ {
++#if EDS_CHECK_VERSION(2,29,0)
++ EShell *shell;
++ EShellBackend *shell_backend;
++ GtkWidget *browser;
++
++ shell = e_shell_get_default ();
++ shell_backend = e_shell_get_backend_by_name (shell, "mail");
++
++ browser = e_mail_browser_new (shell_backend);
++ e_mail_reader_set_folder (E_MAIL_READER (browser), folder, folder_uri);
++ e_mail_reader_set_message (E_MAIL_READER (browser), message_uid);
++ gtk_widget_show (browser);
++#else
+ GtkWidget *browser;
+
+ /* modelled after Evolution's handleuri_got_folder() */
+@@ -683,8 +736,13 @@
+ em_folder_view_set_folder((EMFolderView *) browser, folder, folder_uri);
+ em_folder_view_set_message((EMFolderView *) browser, message_uid, FALSE);
+ gtk_widget_show(((EMMessageBrowser *) browser)->window);
++#endif
+
++#if EDS_CHECK_VERSION(2,31,0)
++ g_object_unref(folder);
++#else
+ camel_object_unref(folder);
++#endif
+ }
+
+ GDK_THREADS_LEAVE();
+@@ -721,7 +779,11 @@
+ if (folder)
+ {
+ status = camel_folder_set_message_flags(folder, message_uid, flags, flags);
++#if EDS_CHECK_VERSION(2,31,0)
++ g_object_unref(folder);
++#else
+ camel_object_unref(folder);
++#endif
+
+ if (! status)
+ g_set_error(err,
+diff -Nrbu mail-notification-5.4/src/mn-evolution-plugin.c mail-notification-5.4-OK/src/mn-evolution-plugin.c
+--- mail-notification-5.4/src/mn-evolution-plugin.c 2008-05-22 19:45:35.000000000 +0400
++++ mail-notification-5.4-OK/src/mn-evolution-plugin.c 2010-10-12 16:50:15.000000000 +0400
+@@ -204,7 +204,7 @@
+ }
+
+ int
+-e_plugin_lib_enable (EPluginLib *ep, int enable)
++e_plugin_lib_enable (EPlugin *ep, int enable)
+ {
+ static gboolean enabled = FALSE;
+ GError *err = NULL;
+--- mail-notification-5.4/build/src/mn-evolution-folder-tree-server-private.h.orig 2010-11-13 13:55:01.571934066 +0100
++++ mail-notification-5.4/build/src/mn-evolution-folder-tree-server-private.h 2010-11-13 13:56:07.019487418 +0100
+@@ -4,6 +4,10 @@
+ #define __MN_EVOLUTION_FOLDER_TREE_SERVER_PRIVATE_H__
+
+ #include "mn-evolution-folder-tree-server.h"
++#include <libedataserver/eds-version.h>
++#if EDS_CHECK_VERSION(2,91,0)
++#include <mail/e-mail-session.h>
++#endif
+
+ #ifdef __cplusplus
+ extern "C" {
+@@ -23,6 +23,9 @@
+ #line 41 "src/mn-evolution-folder-tree-server.gob"
+ GtkWidget * tree;
+ #line 26 "mn-evolution-folder-tree-server-private.h"
++#if EDS_CHECK_VERSION(2,91,0)
++ EMailSession * session;
++#endif
+ };
+
+ #ifdef __cplusplus
diff --git a/testing/mail-notification/mail-notification-5.4-gmime.patch b/testing/mail-notification/mail-notification-5.4-gmime.patch
new file mode 100644
index 000000000..5f516a46b
--- /dev/null
+++ b/testing/mail-notification/mail-notification-5.4-gmime.patch
@@ -0,0 +1,63 @@
+diff -Nrbu mail-notification-5.4/build/src/mn-base-mbox-mailbox-backend.c mail-notification-5.4-OK/build/src/mn-base-mbox-mailbox-backend.c
+--- mail-notification-5.4/build/src/mn-base-mbox-mailbox-backend.c 2008-12-23 14:48:49.000000000 +0300
++++ mail-notification-5.4-OK/build/src/mn-base-mbox-mailbox-backend.c 2008-12-23 14:48:28.000000000 +0300
+@@ -265,7 +265,7 @@
+ mime_message = g_mime_parser_construct_message(parser);
+ if (mime_message)
+ {
+- if (g_mime_message_get_header(mime_message, "X-Mozilla-Status"))
++ if (g_mime_object_get_header(mime_message, "X-Mozilla-Status"))
+ {
+ #if WITH_MOZILLA
+ type = MN_TYPE_MOZILLA_MAILBOX_BACKEND;
+diff -Nrbu mail-notification-5.4/build/src/mn-mozilla-mailbox-backend.c mail-notification-5.4-OK/build/src/mn-mozilla-mailbox-backend.c
+--- mail-notification-5.4/build/src/mn-mozilla-mailbox-backend.c 2008-12-23 14:48:49.000000000 +0300
++++ mail-notification-5.4-OK/build/src/mn-mozilla-mailbox-backend.c 2008-12-23 14:46:47.000000000 +0300
+@@ -167,7 +167,7 @@
+
+ const char *header;
+
+- header = g_mime_message_get_header(mime_message, header_name);
++ header = g_mime_object_get_header(mime_message, header_name);
+ if (header && mn_str_ishex(header))
+ return strtol(header, NULL, 16);
+ else
+diff -Nrbu mail-notification-5.4/jbsrc/jb.c mail-notification-5.4-OK/jbsrc/jb.c
+--- mail-notification-5.4/jbsrc/jb.c 2008-05-22 19:47:04.000000000 +0400
++++ mail-notification-5.4-OK/jbsrc/jb.c 2008-12-23 14:43:09.000000000 +0300
+@@ -166,7 +166,7 @@
+ jb_require_packages("GNOME", "gnome", "glib-2.0 >= 2.14 gthread-2.0 gconf-2.0 >= 2.4.0 gtk+-2.0 >= 2.12 libgnomeui-2.0 >= 2.14.0 gnome-vfs-2.0 libglade-2.0 libxml-2.0 libnotify >= 0.4.1");
+ jb_require_packages("D-Bus", "dbus", "dbus-glib-1");
+
+- jb_check_packages_for_options("GMime", "gmime", "gmime-2.0 >= 2.2.7",
++ jb_check_packages_for_options("GMime", "gmime", "gmime-2.6",
+ "hotmail",
+ "imap",
+ "maildir",
+diff -Nrbu mail-notification-5.4/src/mn-message-mime.c mail-notification-5.4-OK/src/mn-message-mime.c
+--- mail-notification-5.4/src/mn-message-mime.c 2008-05-22 19:45:35.000000000 +0400
++++ mail-notification-5.4-OK/src/mn-message-mime.c 2008-12-23 14:46:35.000000000 +0300
+@@ -33,12 +33,12 @@
+ g_return_val_if_fail(GMIME_IS_MESSAGE(mime_message), FALSE);
+
+ /* SpamAssassin */
+- spam = g_mime_message_get_header(mime_message, "X-Spam-Status");
++ spam = g_mime_object_get_header(mime_message, "X-Spam-Status");
+ if (spam && mn_ascii_str_case_has_prefix(spam, "yes"))
+ return TRUE;
+
+ /* bogofilter */
+- spam = g_mime_message_get_header(mime_message, "X-Bogosity");
++ spam = g_mime_object_get_header(mime_message, "X-Bogosity");
+ if (spam && mn_ascii_str_case_has_prefix(spam, "yes"))
+ return TRUE;
+
+@@ -89,7 +89,7 @@
+ {
+ const char *status;
+
+- status = g_mime_message_get_header(mime_message, "Status");
++ status = g_mime_object_get_header(mime_message, "Status");
+ if (status && strchr(status, 'R'))
+ return NULL; /* the message was read */
+ else if (status && strchr(status, 'O'))
diff --git a/testing/mail-notification/mail-notification-5.4-gtk3-support.patch b/testing/mail-notification/mail-notification-5.4-gtk3-support.patch
new file mode 100644
index 000000000..6a29f8622
--- /dev/null
+++ b/testing/mail-notification/mail-notification-5.4-gtk3-support.patch
@@ -0,0 +1,1416 @@
+--- build/src/mn-dialog.c.orig 2011-02-02 23:08:09.816659245 +0100
++++ build/src/mn-dialog.c 2011-02-02 23:09:16.988113774 +0100
+@@ -106,8 +106,7 @@
+ #line 27 "src/mn-dialog.gob"
+
+ gtk_container_set_border_width(GTK_CONTAINER(self), 5);
+- gtk_dialog_set_has_separator(GTK_DIALOG(self), FALSE);
+- gtk_box_set_spacing(GTK_BOX(GTK_DIALOG(self)->vbox), 2);
++ gtk_box_set_spacing(GTK_BOX(gtk_dialog_get_content_area(GTK_DIALOG(self))), 2);
+
+ #line 113 "mn-dialog.c"
+ }
+--- jbsrc/jb.c.orig 2011-02-02 23:40:33.567924712 +0100
++++ jbsrc/jb.c 2011-02-02 23:39:39.680803618 +0100
+@@ -163,7 +163,7 @@
+ {
+ jb_check_glibc();
+
+- jb_require_packages("GNOME", "gnome", "glib-2.0 >= 2.14 gthread-2.0 gconf-2.0 >= 2.4.0 gtk+-2.0 >= 2.12 libgnomeui-2.0 >= 2.14.0 gnome-vfs-2.0 libglade-2.0 libxml-2.0 libnotify >= 0.4.1");
++ jb_require_packages("GNOME", "gnome", "glib-2.0 >= 2.14 gthread-2.0 gconf-2.0 >= 2.4.0 gtk+-3.0 libgnome-2.0 >= 2.14.0 gnome-vfs-2.0 libxml-2.0 libnotify >= 0.4.1");
+ jb_require_packages("D-Bus", "dbus", "dbus-glib-1");
+
+ jb_check_packages_for_options("GMime", "gmime", "gmime-2.6",
+--- build/src/mn-file-chooser-button.c.orig 2011-02-02 23:38:01.503049512 +0100
++++ build/src/mn-file-chooser-button.c 2011-02-02 23:38:16.988222034 +0100
+@@ -358,7 +358,7 @@
+ g_signal_connect(selfp->dialog, "response", G_CALLBACK(self_response_h), self);
+ }
+
+- if (! GTK_WIDGET_VISIBLE(selfp->dialog))
++ if (! gtk_widget_get_visible(selfp->dialog))
+ {
+ GtkWindow *parent;
+
+--- build/src/mn-sound-player.c.orig 2011-02-02 23:55:02.436500397 +0100
++++ build/src/mn-sound-player.c 2011-02-02 23:55:09.125141055 +0100
+@@ -27,7 +27,7 @@
+ #include <sys/types.h>
+ #include <signal.h>
+ #include <glib/gi18n.h>
+-#include <gnome.h>
++#include <libgnome/libgnome.h>
+ #include "mn-conf.h"
+ #include "mn-locked-callback.h"
+ #include "mn-util.h"
+--- build/src/mn-file-chooser-button.c.orig 2011-02-02 23:55:21.857457045 +0100
++++ build/src/mn-file-chooser-button.c 2011-02-02 23:55:30.422996901 +0100
+@@ -25,7 +25,7 @@
+ #line 39 "src/mn-file-chooser-button.gob"
+
+ #include <glib/gi18n.h>
+-#include <gnome.h>
++#include <libgnome/libgnome.h>
+ #include "mn-util.h"
+
+ #line 32 "mn-file-chooser-button.c"
+--- build/src/mn-message.c.orig 2011-02-02 23:55:41.160420099 +0100
++++ build/src/mn-message.c 2011-02-02 23:55:47.755065850 +0100
+@@ -26,7 +26,7 @@
+
+ #include <errno.h>
+ #include <glib/gi18n.h>
+-#include <gnome.h>
++#include <libgnome/libgnome.h>
+ #include <libgnomevfs/gnome-vfs.h>
+ #include "mn-conf.h"
+ #include "mn-util.h"
+--- build/src/mn-file-chooser-button.c.orig 2011-02-03 00:15:16.178407712 +0100
++++ build/src/mn-file-chooser-button.c 2011-02-03 00:18:17.865681563 +0100
+@@ -463,6 +463,7 @@
+
+ GDK_THREADS_ENTER();
+
++#if 0
+ if (results)
+ {
+ GnomeVFSGetFileInfoResult *result = results->data;
+@@ -494,6 +495,7 @@
+ }
+ }
+ }
++#endif
+
+ selfp->async_handle = NULL;
+ g_object_unref(self);
+--- build/src/mn-evolution-folder-tree-server.c.orig 2011-02-07 20:17:09.574274620 +0100
++++ build/src/mn-evolution-folder-tree-server.c 2011-02-07 20:23:25.196053994 +0100
+@@ -25,6 +25,7 @@
+ #line 24 "src/mn-evolution-folder-tree-server.gob"
+
+ #include <dbus/dbus.h>
++#include <gtk/gtkx.h>
+ #include <libedataserver/eds-version.h>
+ #if !EDS_CHECK_VERSION(2,29,0)
+ #include <mail/mail-component.h>
+@@ -71,7 +72,7 @@
+ static void mn_evolution_folder_tree_server_finalize (MNEvolutionFolderTreeServer * self);
+ #line 70 "mn-evolution-folder-tree-server.c"
+ #line 84 "src/mn-evolution-folder-tree-server.gob"
+-static void mn_evolution_folder_tree_server_plug_destroy_h (GtkObject * object, gpointer user_data);
++static void mn_evolution_folder_tree_server_plug_destroy_h (GtkWidget * object, gpointer user_data);
+ #line 73 "mn-evolution-folder-tree-server.c"
+ #line 104 "src/mn-evolution-folder-tree-server.gob"
+ static void mn_evolution_folder_tree_server_selected_h (EMFolderTree * tree, const char * full_name, const char * uri, guint32 flags, gpointer user_data);
+@@ -456,7 +457,7 @@
+ selfp->tree = em_folder_tree_new_with_model(model);
+ #endif
+
+- selfp->plug = gtk_plug_new((GdkNativeWindow) selfp->id);
++ selfp->plug = gtk_plug_new((Window) selfp->id);
+ gtk_container_add(GTK_CONTAINER(selfp->plug), selfp->tree);
+ gtk_widget_show_all(selfp->plug);
+
+@@ -490,7 +491,7 @@
+
+ #line 84 "src/mn-evolution-folder-tree-server.gob"
+ static void
+-mn_evolution_folder_tree_server_plug_destroy_h (GtkObject * object, gpointer user_data)
++mn_evolution_folder_tree_server_plug_destroy_h (GtkWidget * object, gpointer user_data)
+ {
+ #line 482 "mn-evolution-folder-tree-server.c"
+ #define __GOB_FUNCTION__ "MN:Evolution:Folder:Tree:Server::plug_destroy_h"
+--- src/eggtrayicon.h.orig 2011-02-07 20:25:26.352057350 +0100
++++ src/eggtrayicon.h 2011-02-07 20:27:54.495032920 +0100
+@@ -23,10 +23,9 @@
+ #ifndef __EGG_TRAY_ICON_H__
+ #define __EGG_TRAY_ICON_H__
+
+-#include <gtk/gtkplug.h>
+-#ifdef GDK_WINDOWING_X11
++#include <gtk/gtk.h>
++#include <gtk/gtkx.h>
+ #include <gdk/gdkx.h>
+-#endif
+
+ G_BEGIN_DECLS
+
+--- build/src/mn-mail-icon.c.orig 2011-02-07 20:24:58.971663075 +0100
++++ build/src/mn-mail-icon.c 2011-02-07 20:30:33.714401306 +0100
+@@ -833,11 +833,13 @@
+ #line 239 "src/mn-mail-icon.gob"
+
+ GtkWidget *widget = user_data;
++ GtkAllocation allocation;
+
+- gdk_window_get_origin(widget->window, x, y);
++ gdk_window_get_origin(gtk_widget_get_window(widget), x, y);
++ gtk_widget_get_allocation(widget, &allocation);
+
+- *x += widget->allocation.x;
+- *y += widget->allocation.y;
++ *x += allocation.x;
++ *y += allocation.y;
+
+ if (*y > gdk_screen_get_height(gtk_widget_get_screen(widget)) / 2)
+ {
+@@ -847,7 +849,7 @@
+ *y -= req.height;
+ }
+ else
+- *y += widget->allocation.height;
++ *y += allocation.height;
+
+ *push_in = TRUE;
+ }}
+--- build/src/mn-mail-icon-widget.c.orig 2011-02-07 20:31:19.475816763 +0100
++++ build/src/mn-mail-icon-widget.c 2011-02-07 21:53:48.858814715 +0100
+@@ -64,9 +64,13 @@
+ #line 65 "mn-mail-icon-widget.c"
+ #line 110 "src/mn-mail-icon-widget.gob"
+ static void ___7_mn_mail_icon_widget_size_request (GtkWidget * widget, GtkRequisition * requisition);
++static void
++mn_mail_icon_widget_get_preferred_width(GtkWidget *widget, gint *minimal_width, gint *natural_width);
++static void
++mn_mail_icon_widget_get_preferred_height(GtkWidget *widget, gint *minimal_height, gint *natural_height);
+ #line 68 "mn-mail-icon-widget.c"
+ #line 132 "src/mn-mail-icon-widget.gob"
+-static gboolean ___8_mn_mail_icon_widget_expose_event (GtkWidget * widget, GdkEventExpose * event);
++static gboolean ___8_mn_mail_icon_widget_draw (GtkWidget * widget, cairo_t *cr);
+ #line 71 "mn-mail-icon-widget.c"
+ #line 244 "src/mn-mail-icon-widget.gob"
+ static GdkPixbuf * mn_mail_icon_widget_render_icon (MNMailIconWidget * self);
+@@ -187,9 +191,10 @@
+ parent_class = g_type_class_ref (GTK_TYPE_WIDGET);
+
+ #line 110 "src/mn-mail-icon-widget.gob"
+- gtk_widget_class->size_request = ___7_mn_mail_icon_widget_size_request;
++ gtk_widget_class->get_preferred_width = mn_mail_icon_widget_get_preferred_width;
++ gtk_widget_class->get_preferred_height = mn_mail_icon_widget_get_preferred_height;
+ #line 132 "src/mn-mail-icon-widget.gob"
+- gtk_widget_class->expose_event = ___8_mn_mail_icon_widget_expose_event;
++ gtk_widget_class->draw = ___8_mn_mail_icon_widget_draw;
+ #line 194 "mn-mail-icon-widget.c"
+ g_object_class->dispose = ___dispose;
+ g_object_class->finalize = ___finalize;
+@@ -234,7 +239,7 @@
+ {
+ #line 93 "src/mn-mail-icon-widget.gob"
+
+- GTK_WIDGET_SET_FLAGS(self, GTK_NO_WINDOW);
++ gtk_widget_set_has_window(GTK_WIDGET(self), FALSE);
+
+ gtk_widget_set_name(GTK_WIDGET(self), "mn-mail-icon");
+
+@@ -457,9 +462,28 @@
+ #undef __GOB_FUNCTION__
+ #undef PARENT_HANDLER
+
++static void
++mn_mail_icon_widget_get_preferred_width(GtkWidget *widget, gint *minimal_width, gint *natural_width)
++{
++ GtkRequisition requisition;
++
++ ___7_mn_mail_icon_widget_size_request (widget, &requisition);
++ *minimal_width = *natural_width = requisition.width;
++}
++
++static void
++mn_mail_icon_widget_get_preferred_height(GtkWidget *widget, gint *minimal_height, gint *natural_height)
++{
++ GtkRequisition requisition;
++
++ ___7_mn_mail_icon_widget_size_request (widget, &requisition);
++
++ *minimal_height = *natural_height = requisition.height;
++}
++
+ #line 132 "src/mn-mail-icon-widget.gob"
+ static gboolean
+-___8_mn_mail_icon_widget_expose_event (GtkWidget * widget G_GNUC_UNUSED, GdkEventExpose * event)
++___8_mn_mail_icon_widget_draw (GtkWidget * widget G_GNUC_UNUSED, cairo_t *cr)
+ #line 464 "mn-mail-icon-widget.c"
+ #define PARENT_HANDLER(___widget,___event) \
+ ((GTK_WIDGET_CLASS(parent_class)->expose_event)? \
+@@ -472,7 +496,7 @@
+
+ Self *self = SELF(widget);
+
+- if (! GTK_WIDGET_DRAWABLE(widget) || ! selfp->stock_id)
++ if (! gtk_widget_is_drawable(widget) || ! selfp->stock_id)
+ return FALSE;
+
+ if (selfp->is_on)
+@@ -480,23 +504,34 @@
+ int x;
+ int y;
+ GdkRectangle image_area;
++ GtkAllocation allocation;
++ GtkRequisition requisition;
+
+ /* note: widget->requisition is the pixbuf size, see size_request() */
+
+- x = floor(widget->allocation.x + ((widget->allocation.width - widget->requisition.width) * ICON_XALIGN));
+- y = floor(widget->allocation.y + ((widget->allocation.height - widget->requisition.height) * ICON_YALIGN));
++ gtk_widget_get_allocation(widget, &allocation);
++ gtk_widget_get_requisition(widget, &requisition);
++
++ x = floor(allocation.x + ((allocation.width - requisition.width) * ICON_XALIGN));
++ y = floor(allocation.y + ((allocation.height - requisition.height) * ICON_YALIGN));
+
+ image_area.x = x;
+ image_area.y = y;
+- image_area.width = widget->requisition.width;
+- image_area.height = widget->requisition.height;
++ image_area.width = requisition.width;
++ image_area.height = requisition.height;
+
++#if 0
+ if (gdk_rectangle_intersect(&event->area, &image_area, &image_area))
++#endif
+ {
+ GdkPixbuf *pixbuf;
+
+ pixbuf = self_render_icon(self);
++ gdk_cairo_set_source_pixbuf(cr, pixbuf, image_area.x, image_area.y);
++ cairo_move_to(cr, image_area.x - x, image_area.y - y);
++ cairo_paint(cr);
+
++#if 0
+ gdk_draw_pixbuf(widget->window,
+ NULL,
+ pixbuf,
+@@ -509,6 +544,7 @@
+ GDK_RGB_DITHER_NORMAL,
+ 0,
+ 0);
++#endif
+
+ g_object_unref(pixbuf);
+ }
+@@ -523,13 +559,16 @@
+ int box_y;
+ int box_width;
+ int box_height;
++ GtkAllocation allocation;
++
++ gtk_widget_get_allocation(widget, &allocation);
+
+ if (! selfp->count_layout)
+ {
+ const char *size;
+ char *markup;
+
+- if (widget->allocation.height < 32)
++ if (allocation.height < 32)
+ size = "small";
+ else
+ size = "medium";
+@@ -546,17 +585,16 @@
+ box_width = count_rect.width + COUNT_BOX_XPAD * 2;
+ box_height = count_rect.height + COUNT_BOX_YPAD * 2;
+
+- box_x = widget->allocation.x + widget->allocation.width - box_width - COUNT_BOX_XMARGIN;
+- box_y = widget->allocation.y + widget->allocation.height - box_height - COUNT_BOX_YMARGIN;
++ box_x = allocation.x + allocation.width - box_width - COUNT_BOX_XMARGIN;
++ box_y = allocation.y + allocation.height - box_height - COUNT_BOX_YMARGIN;
+
+ count_x = box_x - count_rect.x + COUNT_BOX_XPAD;
+ count_y = box_y - count_rect.y + COUNT_BOX_YPAD;
+
+- gtk_paint_box(widget->style,
+- widget->window,
+- GTK_WIDGET_STATE(widget),
++ gtk_paint_box(gtk_widget_get_style(widget),
++ cr,
++ gtk_widget_get_state_flags(widget),
+ GTK_SHADOW_OUT,
+- &event->area,
+ widget,
+ NULL,
+ box_x,
+@@ -564,11 +602,10 @@
+ box_width,
+ box_height);
+
+- gtk_paint_layout(widget->style,
+- widget->window,
+- GTK_WIDGET_STATE(widget),
++ gtk_paint_layout(gtk_widget_get_style(widget),
++ cr,
++ gtk_widget_get_state_flags(widget),
+ FALSE,
+- &event->area,
+ widget,
+ NULL,
+ count_x,
+--- build/src/mn-mailbox-properties-dialog.c.orig 2011-02-07 21:57:31.257251776 +0100
++++ build/src/mn-mailbox-properties-dialog.c 2011-02-07 21:56:56.989854854 +0100
+@@ -456,7 +456,7 @@
+ MNMailboxProperties *properties;
+
+ mn_container_create_interface(GTK_CONTAINER(self),
+- PKGDATADIR G_DIR_SEPARATOR_S "mailbox-properties-dialog.glade",
++ PKGDATADIR G_DIR_SEPARATOR_S "mailbox-properties-dialog.ui",
+ "notebook",
+ "mn_mailbox_properties_dialog_",
+ "notebook", &self->notebook,
+@@ -1290,7 +1290,7 @@
+ {
+ #line 686 "src/mn-mailbox-properties-dialog.gob"
+
+- if (GTK_WIDGET_IS_SENSITIVE(GTK_WINDOW(self)->default_widget))
++ if (gtk_widget_is_sensitive(gtk_window_get_default_widget(GTK_WINDOW(self))))
+ gtk_window_activate_default(GTK_WINDOW(self));
+ else
+ {
+@@ -1313,9 +1313,9 @@
+ if (elem->data == entry)
+ break;
+
+- if (GTK_WIDGET_MAPPED(elem->data)
+- && GTK_WIDGET_VISIBLE(elem->data)
+- && GTK_WIDGET_SENSITIVE(elem->data))
++ if (gtk_widget_get_mapped(elem->data)
++ && gtk_widget_get_visible(elem->data)
++ && gtk_widget_get_sensitive(elem->data))
+ next = elem->data;
+ }
+ while (! next);
+--- build/src/mn-mailbox-view.c.orig 2011-02-07 22:18:49.962462920 +0100
++++ build/src/mn-mailbox-view.c 2011-02-07 23:01:39.990363248 +0100
+@@ -412,23 +412,23 @@
+ binding_set = gtk_binding_set_by_class(class);
+
+ /* Delete removes a row */
+- gtk_binding_entry_add_signal(binding_set, GDK_Delete, 0, "activate-remove", 0);
+- gtk_binding_entry_add_signal(binding_set, GDK_KP_Delete, 0, "activate-remove", 0);
++ gtk_binding_entry_add_signal(binding_set, GDK_KEY_Delete, 0, "activate-remove", 0);
++ gtk_binding_entry_add_signal(binding_set, GDK_KEY_KP_Delete, 0, "activate-remove", 0);
+
+ /* HIG 2.0 cut/copy/paste shortcuts */
+- gtk_binding_entry_add_signal(binding_set, GDK_x, GDK_CONTROL_MASK, "activate-cut", 0);
+- gtk_binding_entry_add_signal(binding_set, GDK_c, GDK_CONTROL_MASK, "activate-copy", 0);
+- gtk_binding_entry_add_signal(binding_set, GDK_v, GDK_CONTROL_MASK, "activate-paste", 0);
++ gtk_binding_entry_add_signal(binding_set, GDK_KEY_x, GDK_CONTROL_MASK, "activate-cut", 0);
++ gtk_binding_entry_add_signal(binding_set, GDK_KEY_c, GDK_CONTROL_MASK, "activate-copy", 0);
++ gtk_binding_entry_add_signal(binding_set, GDK_KEY_v, GDK_CONTROL_MASK, "activate-paste", 0);
+
+ /* cut/copy/paste shortcuts taken from gtkentry.c */
+- gtk_binding_entry_add_signal(binding_set, GDK_Delete, GDK_SHIFT_MASK, "activate-cut", 0);
+- gtk_binding_entry_add_signal(binding_set, GDK_Insert, GDK_CONTROL_MASK, "activate-copy", 0);
+- gtk_binding_entry_add_signal(binding_set, GDK_Insert, GDK_SHIFT_MASK, "activate-paste", 0);
++ gtk_binding_entry_add_signal(binding_set, GDK_KEY_Delete, GDK_SHIFT_MASK, "activate-cut", 0);
++ gtk_binding_entry_add_signal(binding_set, GDK_KEY_Insert, GDK_CONTROL_MASK, "activate-copy", 0);
++ gtk_binding_entry_add_signal(binding_set, GDK_KEY_Insert, GDK_SHIFT_MASK, "activate-paste", 0);
+
+ /* HIG 2.0 properties */
+- gtk_binding_entry_add_signal(binding_set, GDK_Return, GDK_MOD1_MASK, "activate-properties", 0);
+- gtk_binding_entry_add_signal(binding_set, GDK_ISO_Enter, GDK_MOD1_MASK, "activate-properties", 0);
+- gtk_binding_entry_add_signal(binding_set, GDK_KP_Enter, GDK_MOD1_MASK, "activate-properties", 0);
++ gtk_binding_entry_add_signal(binding_set, GDK_KEY_Return, GDK_MOD1_MASK, "activate-properties", 0);
++ gtk_binding_entry_add_signal(binding_set, GDK_KEY_ISO_Enter, GDK_MOD1_MASK, "activate-properties", 0);
++ gtk_binding_entry_add_signal(binding_set, GDK_KEY_KP_Enter, GDK_MOD1_MASK, "activate-properties", 0);
+
+ #line 434 "mn-mailbox-view.c"
+ }
+@@ -934,14 +934,13 @@
+ #line 183 "src/mn-mailbox-view.gob"
+
+ GtkSelectionData *data;
+-
+ data = gtk_clipboard_wait_for_contents(global_clipboard, clipboard_info[TARGET_MAILBOXES].atom);
+ if (data)
+ {
+ GSList *configurations;
+ GSList *l;
+
+- memcpy(&configurations, data->data, data->length);
++ memcpy(&configurations, gtk_selection_data_get_data(data), gtk_selection_data_get_length(data));
+
+ MN_LIST_FOREACH(l, configurations)
+ {
+@@ -962,14 +961,14 @@
+ data = gtk_clipboard_wait_for_contents(global_clipboard, clipboard_info[TARGET_GNOME_COPIED_FILES].atom);
+ if (data)
+ {
+- if (data->format == 8 && data->length > 0)
++ if (gtk_selection_data_get_format(data) == 8 && gtk_selection_data_get_length(data) > 0)
+ {
+ char *gnome_copied_files;
+ gboolean status;
+ MNGnomeCopiedFilesType type;
+ GSList *uri_list;
+
+- gnome_copied_files = g_strndup(data->data, data->length);
++ gnome_copied_files = g_strndup(gtk_selection_data_get_data(data), gtk_selection_data_get_length(data));
+ status = mn_parse_gnome_copied_files(gnome_copied_files, &type, &uri_list);
+ g_free(gnome_copied_files);
+
+--- build/src/mn-shell.c.orig 2011-02-07 23:02:17.852293679 +0100
++++ build/src/mn-shell.c 2011-02-07 23:04:39.223548403 +0100
+@@ -158,7 +158,7 @@
+ static void mn_shell_icon_activate_about_h (MNMailIcon * icon, gpointer user_data);
+ #line 160 "mn-shell.c"
+ #line 499 "src/mn-shell.gob"
+-static void mn_shell_icon_destroy_h (GtkObject * object, gpointer user_data);
++static void mn_shell_icon_destroy_h (GtkWidget * object, gpointer user_data);
+ #line 163 "mn-shell.c"
+ #line 508 "src/mn-shell.gob"
+ static void mn_shell_update_sensitivity (MNShell * self);
+@@ -1006,7 +1006,7 @@
+
+ #line 499 "src/mn-shell.gob"
+ static void
+-mn_shell_icon_destroy_h (GtkObject * object, gpointer user_data)
++mn_shell_icon_destroy_h (GtkWidget * object, gpointer user_data)
+ {
+ #line 1004 "mn-shell.c"
+ #define __GOB_FUNCTION__ "MN:Shell::icon_destroy_h"
+--- build/src/mn-text-table.c.orig 2011-02-07 23:05:08.799927792 +0100
++++ build/src/mn-text-table.c 2011-02-07 23:18:06.480056895 +0100
+@@ -69,9 +69,11 @@
+ #line 70 "mn-text-table.c"
+ #line 104 "src/mn-text-table.gob"
+ static void ___4_mn_text_table_size_request (GtkWidget * widget, GtkRequisition * requisition);
++static void mn_text_table_get_preferred_width (GtkWidget * widget, gint * minimal_width, gint * natural_width);
++static void mn_text_table_get_preferred_height (GtkWidget * widget, gint * minimal_height, gint * natural_height);
+ #line 73 "mn-text-table.c"
+ #line 115 "src/mn-text-table.gob"
+-static gboolean ___5_mn_text_table_expose_event (GtkWidget * widget, GdkEventExpose * event);
++static gboolean ___5_mn_text_table_draw (GtkWidget * widget, cairo_t *cr);
+ #line 76 "mn-text-table.c"
+ #line 165 "src/mn-text-table.gob"
+ static void mn_text_table_set_dirty (MNTextTable * self);
+@@ -188,9 +190,10 @@
+ parent_class = g_type_class_ref (GTK_TYPE_WIDGET);
+
+ #line 104 "src/mn-text-table.gob"
+- gtk_widget_class->size_request = ___4_mn_text_table_size_request;
++ gtk_widget_class->get_preferred_width = mn_text_table_get_preferred_width;
++ gtk_widget_class->get_preferred_height = mn_text_table_get_preferred_height;
+ #line 115 "src/mn-text-table.gob"
+- gtk_widget_class->expose_event = ___5_mn_text_table_expose_event;
++ gtk_widget_class->draw = ___5_mn_text_table_draw;
+ #line 257 "src/mn-text-table.gob"
+ c->clear = ___real_mn_text_table_clear;
+ #line 197 "mn-text-table.c"
+@@ -216,7 +219,7 @@
+ {
+ #line 80 "src/mn-text-table.gob"
+
+- GTK_WIDGET_SET_FLAGS(self, GTK_NO_WINDOW);
++ gtk_widget_set_has_window(GTK_WIDGET(self), FALSE);
+
+ g_object_connect(self,
+ "swapped-signal::style-set", self_context_changed, self,
+@@ -290,9 +293,29 @@
+ #undef __GOB_FUNCTION__
+ #undef PARENT_HANDLER
+
++static void
++mn_text_table_get_preferred_width (GtkWidget * widget, gint * minimal_width, gint * natural_width)
++{
++ GtkRequisition requisition;
++
++ ___4_mn_text_table_size_request (widget, &requisition);
++
++ *minimal_width = *natural_width = requisition.width;
++}
++
++static void
++mn_text_table_get_preferred_height (GtkWidget * widget, gint * minimal_height, gint * natural_height)
++{
++ GtkRequisition requisition;
++
++ ___4_mn_text_table_size_request (widget, &requisition);
++
++ *minimal_height = *natural_height = requisition.height;
++}
++
+ #line 115 "src/mn-text-table.gob"
+ static gboolean
+-___5_mn_text_table_expose_event (GtkWidget * widget G_GNUC_UNUSED, GdkEventExpose * event)
++___5_mn_text_table_draw (GtkWidget * widget G_GNUC_UNUSED, cairo_t *cr)
+ #line 297 "mn-text-table.c"
+ #define PARENT_HANDLER(___widget,___event) \
+ ((GTK_WIDGET_CLASS(parent_class)->expose_event)? \
+@@ -304,10 +327,14 @@
+ #line 117 "src/mn-text-table.gob"
+
+ Self *self = SELF(widget);
++ GtkAllocation allocation;
+ int i;
+- int y = widget->allocation.y;
++ int y;
++
++ gtk_widget_get_allocation(widget, &allocation);
++ y = 0;
+
+- if (! GTK_WIDGET_DRAWABLE(widget))
++ if (! gtk_widget_is_drawable(widget))
+ return FALSE;
+
+ self_relayout(self);
+@@ -316,7 +343,7 @@
+ {
+ Row *row = g_ptr_array_index(selfp->rows, i);
+ int j;
+- int x = widget->allocation.x;
++ int x = 0;
+ int column = 0;
+
+ MN_ARRAY_FOREACH(j, row->cells)
+@@ -324,11 +351,10 @@
+ MNTextTableCell *cell = g_ptr_array_index(row->cells, j);
+
+ if (cell->layout)
+- gtk_paint_layout(widget->style,
+- widget->window,
+- GTK_WIDGET_STATE(widget),
++ gtk_paint_layout(gtk_widget_get_style(widget),
++ cr,
++ gtk_widget_get_state_flags(widget),
+ FALSE,
+- &event->area,
+ widget,
+ NULL,
+ x,
+--- build/src/mn-tooltips.c.orig 2011-02-07 23:19:05.903761972 +0100
++++ build/src/mn-tooltips.c 2011-02-07 23:41:19.368621912 +0100
+@@ -104,7 +104,7 @@
+ static void mn_tooltips_set_tip_widget_real (MNTooltips * self, GtkWidget * widget, GtkWidget * tip_widget, int border_width);
+ #line 106 "mn-tooltips.c"
+ #line 287 "src/mn-tooltips.gob"
+-static gboolean mn_tooltips_paint_window (MNTooltips * self);
++static gboolean mn_tooltips_paint_window (MNTooltips * self, cairo_t *cr);
+ #line 109 "mn-tooltips.c"
+ #line 308 "src/mn-tooltips.gob"
+ static void mn_tooltips_draw_tips (MNTooltips * self);
+@@ -422,7 +422,13 @@
+
+ if (! selfp->window)
+ {
++ GtkStyleContext *ctx;
++
+ selfp->window = gtk_window_new(GTK_WINDOW_POPUP);
++
++ ctx = gtk_widget_get_style_context(GTK_WIDGET(selfp->window));
++ gtk_style_context_add_class(ctx, "tooltip");
++
+ self_update_screen(self, TRUE);
+ gtk_widget_set_app_paintable(selfp->window, TRUE);
+ gtk_window_set_resizable(GTK_WINDOW(selfp->window), FALSE);
+@@ -430,7 +430,7 @@
+ gtk_container_set_border_width(GTK_CONTAINER(selfp->window), selfp->border_width);
+
+ g_signal_connect_swapped(selfp->window,
+- "expose-event",
++ "draw",
+ G_CALLBACK(self_paint_window),
+ self);
+
+@@ -490,7 +490,7 @@
+
+ if (selfp->active_data
+ && selfp->active_data->widget == widget
+- && GTK_WIDGET_DRAWABLE(selfp->active_data->widget))
++ && gtk_widget_is_drawable(selfp->active_data->widget))
+ {
+ if (data->tip_widget)
+ g_object_unref(data->tip_widget);
+@@ -594,7 +594,7 @@
+
+ #line 287 "src/mn-tooltips.gob"
+ static gboolean
+-mn_tooltips_paint_window (MNTooltips * self)
++mn_tooltips_paint_window (MNTooltips * self, cairo_t *cr)
+ {
+ #line 600 "mn-tooltips.c"
+ #define __GOB_FUNCTION__ "MN:Tooltips::paint_window"
+@@ -608,18 +608,13 @@
+
+ GtkRequisition req;
+
+- gtk_widget_size_request(selfp->window, &req);
+- gtk_paint_flat_box(selfp->window->style,
+- selfp->window->window,
+- GTK_STATE_NORMAL,
+- GTK_SHADOW_OUT,
+- NULL,
+- selfp->window,
+- "tooltip",
+- 0,
+- 0,
+- req.width,
+- req.height);
++ gtk_widget_size_request(GTK_WIDGET(selfp->window), &req);
++ gtk_render_background(gtk_widget_get_style_context(GTK_WIDGET(selfp->window)),
++ cr,
++ 0,
++ 0,
++ req.width,
++ req.height);
+
+ return FALSE;
+ }}
+@@ -651,10 +650,11 @@
+ gint monitor_num, px, py;
+ GdkRectangle monitor;
+ int screen_width;
++ GtkAllocation allocation;
+
+ if (! selfp->window)
+ self_force_window(self);
+- else if (GTK_WIDGET_VISIBLE(selfp->window))
++ else if (gtk_widget_get_visible(selfp->window))
+ g_get_current_time(&selfp->last_popdown);
+
+ gtk_widget_ensure_style(selfp->window);
+@@ -670,7 +670,7 @@
+
+ data = selfp->active_data;
+
+- child = GTK_BIN(selfp->window)->child;
++ child = gtk_bin_get_child(GTK_BIN(selfp->window));
+ if (child)
+ gtk_container_remove(GTK_CONTAINER(selfp->window), child);
+
+@@ -684,14 +684,16 @@
+ w = requisition.width;
+ h = requisition.height;
+
+- gdk_window_get_origin(widget->window, &x, &y);
+- if (GTK_WIDGET_NO_WINDOW(widget))
++ gtk_widget_get_allocation(selfp->window, &allocation);
++
++ gdk_window_get_origin(gtk_widget_get_window(widget), &x, &y);
++ if (! gtk_widget_get_has_window(widget))
+ {
+- x += widget->allocation.x;
+- y += widget->allocation.y;
++ x += allocation.x;
++ y += allocation.y;
+ }
+
+- x += widget->allocation.width / 2;
++ x += allocation.width / 2;
+
+ if (! keyboard_mode)
+ gdk_window_get_pointer(gdk_screen_get_root_window(screen), &x, NULL, NULL);
+@@ -712,11 +714,11 @@
+ else if (x < monitor.x)
+ x = monitor.x;
+
+- if ((y + h + widget->allocation.height + 4) > monitor.y + monitor.height
++ if ((y + h + allocation.height + 4) > monitor.y + monitor.height
+ && (y - 4) > monitor.y)
+ y = y - h - 4;
+ else
+- y = y + widget->allocation.height + 4;
++ y = y + allocation.height + 4;
+
+ /*
+ * The following block is not part of GTK+ and has been added to
+@@ -760,7 +762,7 @@
+
+ Self *self = SELF(data);
+
+- if (selfp->active_data && GTK_WIDGET_DRAWABLE(selfp->active_data->widget))
++ if (selfp->active_data && gtk_widget_is_drawable(selfp->active_data->widget))
+ self_draw_tips(self);
+
+ selfp->timeout_id = 0;
+@@ -785,7 +787,7 @@
+
+ if (selfp->window)
+ {
+- if (GTK_WIDGET_VISIBLE(selfp->window))
++ if (gtk_widget_get_visible(selfp->window))
+ g_get_current_time(&selfp->last_popdown);
+ gtk_widget_hide(selfp->window);
+ }
+@@ -802,7 +804,7 @@
+ {
+ TooltipsData *data = l->data;
+
+- if (data->widget == widget && GTK_WIDGET_DRAWABLE(widget))
++ if (data->widget == widget && gtk_widget_is_drawable(widget))
+ {
+ selfp->active_data = data;
+ break;
+@@ -937,7 +939,7 @@
+
+ if (GTK_IS_WINDOW(toplevel))
+ {
+- GtkWidget *focus = GTK_WINDOW(toplevel)->focus_widget;
++ GtkWidget *focus = gtk_window_get_focus(GTK_WINDOW(toplevel));
+
+ g_object_set_data(G_OBJECT(toplevel), TOOLTIPS_KEYBOARD_MODE, GINT_TO_POINTER(TRUE));
+
+@@ -966,7 +968,7 @@
+
+ if (GTK_IS_WINDOW(toplevel))
+ {
+- GtkWidget *focus = GTK_WINDOW(toplevel)->focus_widget;
++ GtkWidget *focus = gtk_window_get_focus(GTK_WINDOW(toplevel));
+
+ if (focus)
+ self_hide_tip(focus);
+@@ -1057,24 +1059,24 @@
+ break;
+
+ case GDK_ENTER_NOTIFY:
+- if (! (GTK_IS_MENU_ITEM(widget) && GTK_MENU_ITEM(widget)->submenu))
++ if (! (GTK_IS_MENU_ITEM(widget) && gtk_menu_item_get_submenu(GTK_MENU_ITEM(widget))))
+ self_start_delay(self, widget);
+ break;
+
+ case GDK_LEAVE_NOTIFY:
+ self_set_active_widget(self, NULL);
+- selfp->use_sticky_delay = selfp->window && GTK_WIDGET_VISIBLE(selfp->window);
++ selfp->use_sticky_delay = selfp->window && gtk_widget_get_visible(selfp->window);
+ break;
+
+ case GDK_MOTION_NOTIFY:
+ /* Handle menu items specially ... pend popup for each motion
+ * on other widgets, we ignore motion.
+ */
+- if (GTK_IS_MENU_ITEM(widget) && ! GTK_MENU_ITEM(widget)->submenu)
++ if (GTK_IS_MENU_ITEM(widget) && ! gtk_menu_item_get_submenu(GTK_MENU_ITEM(widget)))
+ {
+ /* Completely evil hack to make sure we get the LEAVE_NOTIFY
+ */
+- GTK_PRIVATE_SET_FLAG(widget, GTK_LEAVE_PENDING);
++ //GTK_PRIVATE_SET_FLAG(widget, GTK_LEAVE_PENDING);
+ self_set_active_widget(self, NULL);
+ self_start_delay(self, widget);
+ break;
+--- src/nautilus-cell-renderer-pixbuf-emblem.c.orig 2011-02-08 00:16:43.847831409 +0100
++++ src/nautilus-cell-renderer-pixbuf-emblem.c 2011-02-08 00:32:59.128682767 +0100
+@@ -39,17 +39,16 @@
+ GtkWidget *widget);
+ static void nautilus_cell_renderer_pixbuf_emblem_get_size (GtkCellRenderer *cell,
+ GtkWidget *widget,
+- GdkRectangle *rectangle,
++ const GdkRectangle *rectangle,
+ gint *x_offset,
+ gint *y_offset,
+ gint *width,
+ gint *height);
+ static void nautilus_cell_renderer_pixbuf_emblem_render (GtkCellRenderer *cell,
+- GdkWindow *window,
++ cairo_t *cr,
+ GtkWidget *widget,
+- GdkRectangle *background_area,
+- GdkRectangle *cell_area,
+- GdkRectangle *expose_area,
++ const GdkRectangle *background_area,
++ const GdkRectangle *cell_area,
+ GtkCellRendererState flags);
+
+ enum {
+@@ -356,7 +355,7 @@
+ static void
+ nautilus_cell_renderer_pixbuf_emblem_get_size (GtkCellRenderer *cell,
+ GtkWidget *widget,
+- GdkRectangle *cell_area,
++ const GdkRectangle *cell_area,
+ gint *x_offset,
+ gint *y_offset,
+ gint *width,
+@@ -368,6 +367,10 @@
+ gint pixbuf_height = 0;
+ gint calc_width;
+ gint calc_height;
++ int xpad;
++ int ypad;
++ gfloat xalign;
++ gfloat yalign;
+
+ if (!cellpixbuf->pixbuf && cellinfo->stock_id)
+ nautilus_cell_renderer_pixbuf_emblem_create_stock_pixbuf (cellpixbuf, widget);
+@@ -385,8 +388,11 @@
+ pixbuf_height = MAX (pixbuf_height, gdk_pixbuf_get_height (cellpixbuf->pixbuf_expander_closed));
+ }
+
+- calc_width = (gint) cell->xpad * 2 + pixbuf_width;
+- calc_height = (gint) cell->ypad * 2 + pixbuf_height;
++ gtk_cell_renderer_get_padding(cell, &xpad, &ypad);
++ gtk_cell_renderer_get_alignment(cell, &xalign, &yalign);
++
++ calc_width = (gint) xpad * 2 + pixbuf_width;
++ calc_height = (gint) ypad * 2 + pixbuf_height;
+
+ if (x_offset) *x_offset = 0;
+ if (y_offset) *y_offset = 0;
+@@ -394,14 +400,14 @@
+ if (cell_area && pixbuf_width > 0 && pixbuf_height > 0) {
+ if (x_offset) {
+ *x_offset = (((gtk_widget_get_direction (widget) == GTK_TEXT_DIR_RTL) ?
+- 1.0 - cell->xalign : cell->xalign) *
+- (cell_area->width - calc_width - 2 * cell->xpad));
+- *x_offset = MAX (*x_offset, 0) + cell->xpad;
++ 1.0 - xalign : xalign) *
++ (cell_area->width - calc_width - 2 * xpad));
++ *x_offset = MAX (*x_offset, 0) + xpad;
+ }
+ if (y_offset) {
+- *y_offset = (cell->yalign *
+- (cell_area->height - calc_height - 2 * cell->ypad));
+- *y_offset = MAX (*y_offset, 0) + cell->ypad;
++ *y_offset = (yalign *
++ (cell_area->height - calc_height - 2 * ypad));
++ *y_offset = MAX (*y_offset, 0) + ypad;
+ }
+ }
+
+@@ -414,11 +420,10 @@
+
+ static void
+ nautilus_cell_renderer_pixbuf_emblem_render (GtkCellRenderer *cell,
+- GdkWindow *window,
++ cairo_t *cr,
+ GtkWidget *widget,
+- GdkRectangle *background_area,
+- GdkRectangle *cell_area,
+- GdkRectangle *expose_area,
++ const GdkRectangle *background_area,
++ const GdkRectangle *cell_area,
+ GtkCellRendererState flags)
+
+ {
+@@ -429,13 +434,19 @@
+ GdkRectangle pix_emblem_rect;
+ GdkRectangle draw_rect;
+ gboolean stock_pixbuf = FALSE;
++ gboolean is_expander = FALSE;
++ gboolean is_expanded = FALSE;
++ int xpad;
++ int ypad;
++
++ g_object_get(cell, "is-expander", &is_expander, "is-expanded", &is_expanded, NULL);
+
+ pixbuf = cellpixbuf->pixbuf;
+- if (cell->is_expander) {
+- if (cell->is_expanded &&
++ if (is_expander) {
++ if (is_expanded &&
+ cellpixbuf->pixbuf_expander_open != NULL) {
+ pixbuf = cellpixbuf->pixbuf_expander_open;
+- } else if (!cell->is_expanded &&
++ } else if (!is_expanded &&
+ cellpixbuf->pixbuf_expander_closed != NULL) {
+ pixbuf = cellpixbuf->pixbuf_expander_closed;
+ }
+@@ -456,15 +467,20 @@
+ if (stock_pixbuf)
+ pixbuf = cellpixbuf->pixbuf;
+
++ gtk_cell_renderer_get_padding(cell, &xpad, &ypad);
++
+ pix_rect.x += cell_area->x;
+ pix_rect.y += cell_area->y;
+- pix_rect.width -= cell->xpad * 2;
+- pix_rect.height -= cell->ypad * 2;
++ pix_rect.width -= xpad * 2;
++ pix_rect.height -= ypad * 2;
+
++ if (gdk_rectangle_intersect (cell_area, &pix_rect, &draw_rect)) {
++#if 0
+ if (gdk_rectangle_intersect (cell_area, &pix_rect, &draw_rect) &&
+ gdk_rectangle_intersect (expose_area, &draw_rect, &draw_rect)) {
++
+ gdk_draw_pixbuf (window,
+- widget->style->black_gc,
++ gtk_widget_get_style(widget)->black_gc,
+ pixbuf,
+ /* pixbuf 0, 0 is at pix_rect.x, pix_rect.y */
+ draw_rect.x - pix_rect.x,
+@@ -475,6 +491,11 @@
+ draw_rect.height,
+ GDK_RGB_DITHER_NORMAL,
+ 0, 0);
++#endif
++
++ cairo_move_to (cr, draw_rect.x - pix_rect.x, draw_rect.y - pix_rect.y);
++ gdk_cairo_set_source_pixbuf (cr, pixbuf, draw_rect.x, draw_rect.y);
++ cairo_paint (cr);
+ }
+
+ if (cellpixbuf->pixbuf_emblem) {
+@@ -482,8 +503,11 @@
+ pix_emblem_rect.height = gdk_pixbuf_get_height (cellpixbuf->pixbuf_emblem);
+ pix_emblem_rect.x = pix_rect.x;
+ pix_emblem_rect.y = pix_rect.y + pix_rect.height - pix_emblem_rect.height;
++ if (gdk_rectangle_intersect (cell_area, &pix_emblem_rect, &draw_rect)) {
++#if 0
+ if (gdk_rectangle_intersect (cell_area, &pix_emblem_rect, &draw_rect) &&
+ gdk_rectangle_intersect (expose_area, &draw_rect, &draw_rect)) {
++
+ gdk_draw_pixbuf (window,
+ widget->style->black_gc,
+ cellpixbuf->pixbuf_emblem,
+@@ -496,6 +520,11 @@
+ draw_rect.height,
+ GDK_RGB_DITHER_NORMAL,
+ 0, 0);
++#endif
++
++ cairo_move_to (cr, draw_rect.x - pix_emblem_rect.x, draw_rect.y - pix_emblem_rect.y);
++ gdk_cairo_set_source_pixbuf (cr, cellpixbuf->pixbuf_emblem, draw_rect.x, draw_rect.y);
++ cairo_paint (cr);
+ }
+ }
+ }
+--- src/nautilus-cell-renderer-pixbuf-emblem.h.orig 2011-02-07 22:18:12.336471764 +0100
++++ src/nautilus-cell-renderer-pixbuf-emblem.h 2011-02-08 00:20:30.461758697 +0100
+@@ -25,18 +25,18 @@
+ #ifndef NAUTILUS_CELL_RENDERER_PIXBUF_EMBLEM_H
+ #define NAUTILUS_CELL_RENDERER_PIXBUF_EMBLEM_H
+
+-#include <gtk/gtkcellrenderer.h>
++#include <gtk/gtk.h>
+
+ #define NAUTILUS_TYPE_CELL_RENDERER_PIXBUF_EMBLEM \
+ (nautilus_cell_renderer_pixbuf_emblem_get_type ())
+ #define NAUTILUS_CELL_RENDERER_PIXBUF_EMBLEM(obj) \
+- (GTK_CHECK_CAST ((obj), NAUTILUS_TYPE_CELL_RENDERER_PIXBUF_EMBLEM, NautilusCellRendererPixbufEmblem))
++ (G_TYPE_CHECK_INSTANCE_CAST ((obj), NAUTILUS_TYPE_CELL_RENDERER_PIXBUF_EMBLEM, NautilusCellRendererPixbufEmblem))
+ #define NAUTILUS_CELL_RENDERER_PIXBUF_EMBLEM_CLASS(klass) \
+- (GTK_CHECK_CLASS_CAST ((klass), NAUTILUS_TYPE_CELL_RENDERER_PIXBUF_EMBLEM, NautilusCellRendererPixbufEmblemClass))
++ (G_TYPE_CHECK_CLASS_CAST ((klass), NAUTILUS_TYPE_CELL_RENDERER_PIXBUF_EMBLEM, NautilusCellRendererPixbufEmblemClass))
+ #define NAUTILUS_IS_CELL_RENDERER_PIXBUF_EMBLEM(obj) \
+- (GTK_CHECK_TYPE ((obj), NAUTILUS_TYPE_CELL_RENDERER_PIXBUF_EMBLEM))
++ (G_TYPE_CHECK_INSTANCE_TYPE ((obj), NAUTILUS_TYPE_CELL_RENDERER_PIXBUF_EMBLEM))
+ #define NAUTILUS_IS_CELL_RENDERER_PIXBUF_EMBLEM_CLASS(klass) \
+- (GTK_CHECK_CLASS_TYPE ((klass), NAUTILUS_TYPE_CELL_RENDERER_PIXBUF_EMBLEM))
++ (G_TYPE_CHECK_CLASS_TYPE ((klass), NAUTILUS_TYPE_CELL_RENDERER_PIXBUF_EMBLEM))
+
+ typedef struct _NautilusCellRendererPixbufEmblem NautilusCellRendererPixbufEmblem;
+ typedef struct _NautilusCellRendererPixbufEmblemClass NautilusCellRendererPixbufEmblemClass;
+--- build/src/mn-authenticated-mailbox.c.orig 2011-02-08 00:34:16.332610802 +0100
++++ build/src/mn-authenticated-mailbox.c 2011-02-08 00:36:23.706936717 +0100
+@@ -25,7 +25,7 @@
+ #line 29 "src/mn-authenticated-mailbox.gob"
+
+ #include <glib/gi18n.h>
+-#include <gnome.h>
++#include <libgnome/libgnome.h>
+ #include "mn-mailbox-private.h"
+ #include "mn-shell.h"
+ #include "mn-util.h"
+@@ -859,6 +859,7 @@
+
+ /* keep the title in sync with gnome-authentication-manager */
+
++#if 0
+ /* translators: header capitalization */
+ selfp->auth_dialog = gnome_password_dialog_new(_("Authentication Required"),
+ message,
+@@ -891,6 +892,9 @@
+ gtk_widget_destroy(selfp->auth_dialog);
+
+ return ok;
++#else
++ return FALSE;
++#endif
+ }}
+ #line 896 "mn-authenticated-mailbox.c"
+ #undef __GOB_FUNCTION__
+--- build/src/mn-about-dialog.c.orig 2011-02-08 22:20:54.469841262 +0100
++++ build/src/mn-about-dialog.c 2011-02-08 22:21:13.309839037 +0100
+@@ -111,9 +111,11 @@
+ {
+ #line 32 "src/mn-about-dialog.gob"
+
++#if 0
+ gtk_about_dialog_set_email_hook(self_activate_link_cb, "mailto:", NULL);
+ gtk_about_dialog_set_url_hook(self_activate_link_cb, NULL, NULL);
+-
++#endif
++
+ #line 118 "mn-about-dialog.c"
+ }
+ }
+--- build/src/mn-autodetect-mailbox-properties.c.orig 2011-02-08 22:21:58.639427345 +0100
++++ build/src/mn-autodetect-mailbox-properties.c 2011-02-08 22:22:43.564035901 +0100
+@@ -355,10 +355,9 @@
+
+ toplevel = gtk_widget_get_toplevel(GTK_WIDGET(button));
+ /* translators: header capitalization */
+- selfp->chooser = gtk_file_chooser_dialog_new_with_backend(_("Select a File or Folder"),
++ selfp->chooser = gtk_file_chooser_dialog_new(_("Select a File or Folder"),
+ GTK_WINDOW(toplevel),
+ GTK_FILE_CHOOSER_ACTION_OPEN,
+- "gnome-vfs",
+ GTK_STOCK_CANCEL, GTK_RESPONSE_CANCEL,
+ GTK_STOCK_OPEN, 1,
+ NULL);
+--- build/src/mn-pi-mailbox-properties.c.orig 2011-02-08 22:30:08.051375715 +0100
++++ build/src/mn-pi-mailbox-properties.c 2011-02-08 22:30:21.398665261 +0100
+@@ -415,7 +415,7 @@
+ int i;
+
+ for (i = 0; i < MN_PI_MAILBOX_N_CONNECTION_TYPES; i++)
+- gtk_widget_set_sensitive(self->port_spin[i], GTK_WIDGET_SENSITIVE(self->conn_radio[i]) && gtk_toggle_button_get_active(GTK_TOGGLE_BUTTON(self->conn_radio[i])));
++ gtk_widget_set_sensitive(self->port_spin[i], gtk_widget_get_sensitive(self->conn_radio[i]) && gtk_toggle_button_get_active(GTK_TOGGLE_BUTTON(self->conn_radio[i])));
+
+ g_object_notify(G_OBJECT(self), "complete");
+ }}
+--- src/eggtrayicon.c.orig 2011-02-07 23:42:30.405791829 +0100
++++ src/eggtrayicon.c 2011-02-08 23:06:16.092968325 +0100
+@@ -25,7 +25,7 @@
+
+ #include "eggtrayicon.h"
+
+-#include <gdkconfig.h>
++#include <gdk/gdk.h>
+ #if defined (GDK_WINDOWING_X11)
+ #include <gdk/gdkx.h>
+ #include <X11/Xatom.h>
+@@ -258,7 +258,7 @@
+ {
+ GdkWindow *gdkwin;
+
+- gdkwin = gdk_window_lookup_for_display (gtk_widget_get_display (widget),
++ gdkwin = gdk_x11_window_lookup_for_display (gtk_widget_get_display (widget),
+ icon->manager_window);
+
+ gdk_window_remove_filter (gdkwin, egg_tray_icon_manager_filter, icon);
+@@ -290,7 +290,7 @@
+ ev.window = window;
+ ev.message_type = icon->system_tray_opcode_atom;
+ ev.format = 32;
+- ev.data.l[0] = gdk_x11_get_server_time (GTK_WIDGET (icon)->window);
++ ev.data.l[0] = gdk_x11_get_server_time (gtk_widget_get_window(GTK_WIDGET (icon)));
+ ev.data.l[1] = message;
+ ev.data.l[2] = data1;
+ ev.data.l[3] = data2;
+@@ -342,12 +342,12 @@
+ {
+ GdkWindow *gdkwin;
+
+- gdkwin = gdk_window_lookup_for_display (gtk_widget_get_display (GTK_WIDGET (icon)),
++ gdkwin = gdk_x11_window_lookup_for_display (gtk_widget_get_display (GTK_WIDGET (icon)),
+ icon->manager_window);
+
+ gdk_window_add_filter (gdkwin, egg_tray_icon_manager_filter, icon);
+
+- if (dock_if_realized && GTK_WIDGET_REALIZED (icon))
++ if (dock_if_realized && gtk_widget_get_realized (GTK_WIDGET(icon)))
+ egg_tray_icon_send_dock_request (icon);
+
+ egg_tray_icon_get_orientation_property (icon);
+@@ -355,10 +355,16 @@
+ }
+
+ static gboolean
+-transparent_expose_event (GtkWidget *widget, GdkEventExpose *event, gpointer user_data)
++transparent_draw (GtkWidget *widget, cairo_t *cr, gpointer user_data)
+ {
+- gdk_window_clear_area (widget->window, event->area.x, event->area.y,
++#if 0
++ gdk_window_clear_area (gtk_widget_get_window(widget), event->area.x, event->area.y,
+ event->area.width, event->area.height);
++#endif
++ cairo_set_operator (cr, CAIRO_OPERATOR_CLEAR);
++ //gdk_cairo_region (cr, event->region);
++ cairo_fill (cr);
++
+ return FALSE;
+ }
+
+@@ -366,20 +372,20 @@
+ make_transparent_again (GtkWidget *widget, GtkStyle *previous_style,
+ gpointer user_data)
+ {
+- gdk_window_set_back_pixmap (widget->window, NULL, TRUE);
++ //gdk_window_set_back_pixmap (gtk_widget_get_window(widget), NULL, TRUE);
+ }
+
+ static void
+ make_transparent (GtkWidget *widget, gpointer user_data)
+ {
+- if (GTK_WIDGET_NO_WINDOW (widget) || GTK_WIDGET_APP_PAINTABLE (widget))
++ if (! gtk_widget_get_has_window (widget) || gtk_widget_get_app_paintable (widget))
+ return;
+
+ gtk_widget_set_app_paintable (widget, TRUE);
+ gtk_widget_set_double_buffered (widget, FALSE);
+- gdk_window_set_back_pixmap (widget->window, NULL, TRUE);
+- g_signal_connect (widget, "expose_event",
+- G_CALLBACK (transparent_expose_event), NULL);
++ //gdk_window_set_back_pixmap (gtk_widget_get_window(widget), NULL, TRUE);
++ g_signal_connect (widget, "draw",
++ G_CALLBACK (transparent_draw), NULL);
+ g_signal_connect_after (widget, "style_set",
+ G_CALLBACK (make_transparent_again), NULL);
+ }
+@@ -391,7 +397,7 @@
+
+ g_return_if_fail (icon->manager_window != None);
+
+- gdkwin = gdk_window_lookup_for_display (gtk_widget_get_display (GTK_WIDGET (icon)),
++ gdkwin = gdk_x11_window_lookup_for_display (gtk_widget_get_display (GTK_WIDGET (icon)),
+ icon->manager_window);
+
+ gdk_window_remove_filter (gdkwin, egg_tray_icon_manager_filter, icon);
+--- build/src/mn-properties-dialog.c.orig 2011-02-08 23:37:12.605200174 +0100
++++ build/src/mn-properties-dialog.c 2011-02-08 23:37:18.601881191 +0100
+@@ -183,7 +183,7 @@
+ GtkTreeSelection *selection;
+
+ mn_container_create_interface(GTK_CONTAINER(self),
+- PKGDATADIR G_DIR_SEPARATOR_S "properties-dialog.glade",
++ PKGDATADIR G_DIR_SEPARATOR_S "properties-dialog.ui",
+ "main_vbox",
+ "mn_properties_dialog_",
+ "notebook", &selfp->notebook,
+--- src/mn-util.c.orig 2011-02-08 00:01:25.167207512 +0100
++++ src/mn-util.c 2011-02-09 00:01:35.718285446 +0100
+@@ -26,8 +26,7 @@
+ #include <gmodule.h>
+ #include <glib/gi18n.h>
+ #include <gobject/gvaluecollector.h>
+-#include <gnome.h>
+-#include <glade/glade.h>
++#include <libgnome/libgnome.h>
+ #include "mn-util.h"
+ #include "mn-mailboxes.h"
+ #include "mn-shell.h"
+@@ -303,49 +302,55 @@
+ return pixbuf;
+ }
+
+-static GladeXML *
++static GtkBuilder *
+ mn_glade_xml_new (const char *filename, const char *root, const char *domain)
+ {
+- GladeXML *xml;
++ GtkBuilder *builder;
++ GError *err = NULL;
+
+ g_return_val_if_fail(filename != NULL, NULL);
+
+- xml = glade_xml_new(filename, root, domain);
+- if (! xml)
+- mn_show_fatal_error_dialog(NULL, "Unable to load interface \"%s\".", filename);
++ builder = gtk_builder_new();
++ gtk_builder_set_translation_domain(builder, domain);
++ if (! gtk_builder_add_from_file(builder, filename, &err)) {
++ mn_show_fatal_error_dialog(NULL, "Unable to load interface \"%s\": %s.", filename, err->message);
++ g_error_free(err);
++ g_object_unref(builder);
++ return NULL;
++ }
+
+- return xml;
++ return builder;
+ }
+
+ static GtkWidget *
+-mn_glade_xml_get_widget (GladeXML *xml, const char *widget_name)
++mn_glade_xml_get_widget (GtkBuilder *builder, const char *widget_name)
+ {
+ GtkWidget *widget;
+
+- g_return_val_if_fail(GLADE_IS_XML(xml), NULL);
++ g_return_val_if_fail(GTK_IS_BUILDER(builder), NULL);
+ g_return_val_if_fail(widget_name != NULL, NULL);
+
+- widget = glade_xml_get_widget(xml, widget_name);
++ widget = GTK_WIDGET(gtk_builder_get_object(builder, widget_name));
+ if (! widget)
+- mn_show_fatal_error_dialog(NULL, "Widget \"%s\" not found in interface \"%s\".", widget_name, xml->filename);
++ mn_show_fatal_error_dialog(NULL, "Widget \"%s\" not found in interface.", widget_name);
+
+ return widget;
+ }
+
+ static void
+-create_interface_connect_cb (const char *handler_name,
++create_interface_connect_cb (GtkBuilder *builder,
+ GObject *object,
+ const char *signal_name,
+- const char *signal_data,
++ const char *handler_name,
+ GObject *connect_object,
+- gboolean after,
++ GConnectFlags flags,
+ gpointer user_data)
+ {
+ static GModule *module = NULL;
+ ContainerCreateInterfaceConnectInfo *info = user_data;
+ char *cb_name;
+ GCallback cb;
+- GConnectFlags flags;
++ GConnectFlags cflags;
+
+ if (! module)
+ {
+@@ -359,11 +364,9 @@
+ mn_show_fatal_error_dialog(NULL, "Signal handler \"%s\" not found.", cb_name);
+ g_free(cb_name);
+
+- flags = G_CONNECT_SWAPPED;
+- if (after)
+- flags |= G_CONNECT_AFTER;
++ cflags = G_CONNECT_SWAPPED;
+
+- g_signal_connect_data(object, signal_name, cb, info->container, NULL, flags);
++ g_signal_connect_data(object, signal_name, cb, info->container, NULL, cflags);
+ }
+
+ void
+@@ -373,7 +376,7 @@
+ const char *callback_prefix,
+ ...)
+ {
+- GladeXML *xml;
++ GtkBuilder *xml;
+ GtkWidget *child;
+ ContainerCreateInterfaceConnectInfo info;
+ va_list args;
+@@ -387,14 +390,16 @@
+ xml = mn_glade_xml_new(filename, child_name, NULL);
+ child = mn_glade_xml_get_widget(xml, child_name);
+
+- if (GTK_IS_DIALOG(container))
+- gtk_box_pack_start(GTK_BOX(GTK_DIALOG(container)->vbox), child, TRUE, TRUE, 0);
+- else
++ if (GTK_IS_DIALOG(container)) {
++ gtk_widget_unparent(child);
++ gtk_box_pack_start(GTK_BOX(gtk_dialog_get_content_area(GTK_DIALOG(container))), child, TRUE, TRUE, 0);
++ } else {
+ gtk_container_add(container, child);
++ }
+
+ info.container = container;
+ info.callback_prefix = callback_prefix;
+- glade_xml_signal_autoconnect_full(xml, create_interface_connect_cb, &info);
++ gtk_builder_connect_signals_full(xml, create_interface_connect_cb, &info);
+
+ va_start(args, callback_prefix);
+
+@@ -422,7 +427,7 @@
+
+ toplevel = gtk_widget_get_toplevel(widget);
+
+- return GTK_WIDGET_TOPLEVEL(toplevel) ? GTK_WINDOW(toplevel) : NULL;
++ return gtk_widget_get_toplevel(toplevel) ? GTK_WINDOW(toplevel) : NULL;
+ }
+
+ static void
+@@ -493,9 +498,11 @@
+ gpointer user_data)
+ {
+ GtkAdjustment *adjustment;
++ GtkAllocation allocation;
+
++ gtk_widget_get_allocation(widget, &allocation);
+ adjustment = gtk_scrolled_window_get_vadjustment(GTK_SCROLLED_WINDOW(widget));
+- gtk_adjustment_set_value(adjustment, (double) y / (widget->allocation.height - 2) * (adjustment->upper - adjustment->page_size));
++ gtk_adjustment_set_value(adjustment, (double) y / (allocation.height - 2) * (gtk_adjustment_get_upper(adjustment) - gtk_adjustment_get_page_size(adjustment)));
+
+ return TRUE; /* we're forcibly in a drop zone */
+ }
+@@ -562,7 +569,7 @@
+ MNMailbox *mailbox;
+
+ /* text/x-moz-url is encoded in UCS-2 but in format 8: broken */
+- if (selection_data->format != 8 || selection_data->length <= 0 || (selection_data->length % 2) != 0)
++ if (gtk_selection_data_get_format(selection_data) != 8 || gtk_selection_data_get_length(selection_data) <= 0 || (gtk_selection_data_get_length(selection_data) % 2) != 0)
+ {
+ mn_show_error_dialog(mn_widget_get_parent_window(widget),
+ _("A drag and drop error has occurred"),
+@@ -570,8 +577,8 @@
+ return;
+ }
+
+- char_data = (const guint16 *) selection_data->data;
+- char_len = selection_data->length / 2;
++ char_data = (const guint16 *) gtk_selection_data_get_data(selection_data);
++ char_len = gtk_selection_data_get_length(selection_data) / 2;
+
+ url = g_string_new(NULL);
+ for (i = 0; i < char_len && char_data[i] != '\n'; i++)
+@@ -1322,7 +1329,7 @@
+ }
+
+ static void
+-dialog_run_nonmodal_destroy_h (GtkObject *object, gpointer user_data)
++dialog_run_nonmodal_destroy_h (GtkWidget *object, gpointer user_data)
+ {
+ RunNonmodalInfo *info = user_data;
+
+@@ -1375,7 +1382,7 @@
+
+ g_object_ref(dialog);
+
+- if (! GTK_WIDGET_VISIBLE(dialog))
++ if (! gtk_widget_get_visible(dialog))
+ gtk_widget_show(GTK_WIDGET(dialog));
+
+ g_object_connect(dialog,
+--- src/mn-main.c.gtk3 2008-05-22 17:45:35.000000000 +0200
++++ src/mn-main.c 2011-02-08 23:32:33.800030659 +0100
+@@ -21,7 +21,7 @@
+ #include <stdlib.h>
+ #include <signal.h>
+ #include <glib/gi18n.h>
+-#include <gnome.h>
++#include <libgnome/libgnome.h>
+ #include <libgnomevfs/gnome-vfs.h>
+ #include <libnotify/notify.h>
+ #include <dbus/dbus-glib-lowlevel.h>
+@@ -452,7 +452,7 @@
+
+ gnome_program_init(PACKAGE,
+ VERSION,
+- LIBGNOMEUI_MODULE,
++ LIBGNOME_MODULE,
+ argc,
+ argv,
+ GNOME_PARAM_HUMAN_READABLE_NAME, _("Mail Notification"),
+@@ -460,6 +460,8 @@
+ GNOME_PARAM_GOPTION_CONTEXT, option_context,
+ NULL);
+
++ gtk_init(&argc, &argv);
++
+ if (arg_version)
+ {
+ print_version();
+@@ -497,7 +499,9 @@
+ if (! gnome_vfs_init())
+ mn_show_fatal_error_dialog(NULL, _("Unable to initialize the GnomeVFS library."));
+
++#if 0
+ gnome_authentication_manager_init();
++#endif
+
+ /* must be called before init_gmime() */
+ mn_conf_init();
+--- src/mn-conf.c.gtk3 2008-05-22 17:45:35.000000000 +0200
++++ src/mn-conf.c 2011-02-07 20:07:01.630580132 +0100
+@@ -23,7 +23,7 @@
+ #include <errno.h>
+ #include <stdarg.h>
+ #include <glib/gi18n.h>
+-#include <gnome.h>
++#include <libgnome/libgnome.h>
+ #include "mn-util.h"
+ #include "mn-conf.h"
+ #include "mn-shell.h"
+--- data/mail-notification.desktop.in.orig 2011-07-08 13:46:52.327548264 +0200
++++ data/mail-notification.desktop.in 2011-07-08 13:47:00.732704467 +0200
+@@ -5,7 +5,7 @@
+ _Comment=Get notified when new mail arrives
+ Type=Application
+ Categories=GNOME;GTK;Network;Email;
+-Exec=mail-notification --sm-disable
++Exec=mail-notification
+ Terminal=false
+ StartupNotify=true
+ X-GNOME-DocPath=mail-notification/mail-notification.xml
diff --git a/testing/mail-notification/mail-notification-5.4-icons.patch b/testing/mail-notification/mail-notification-5.4-icons.patch
new file mode 100644
index 000000000..48d54742a
--- /dev/null
+++ b/testing/mail-notification/mail-notification-5.4-icons.patch
@@ -0,0 +1,39 @@
+diff -Nrbu mail-notification-5.4/src/mn-stock.c mail-notification-5.4-OK/src/mn-stock.c
+--- mail-notification-5.4/src/mn-stock.c 2008-05-22 19:45:35.000000000 +0400
++++ mail-notification-5.4-OK/src/mn-stock.c 2010-05-24 19:36:03.000000000 +0400
+@@ -32,11 +32,11 @@
+ const char *icon_name;
+ const char *source_stock_id;
+ } icons[] = {
+- { MN_STOCK_MAIL, NULL, "stock_mail" },
+- { MN_STOCK_NO_MAIL, NULL, "stock_inbox" },
+- { MN_STOCK_LOCAL, NULL, "stock_folder" },
+- { MN_STOCK_REMOTE, NULL, "stock_internet" },
+- { MN_STOCK_UNKNOWN, NULL, "stock_unknown" },
++ { MN_STOCK_MAIL, NULL, "mail-message-new" },
++ { MN_STOCK_NO_MAIL, NULL, "mail-notification" },
++ { MN_STOCK_LOCAL, NULL, "folder" },
++ { MN_STOCK_REMOTE, NULL, "applications-internet" },
++ { MN_STOCK_UNKNOWN, NULL, "dialog-question" },
+ { MN_STOCK_ERROR, NULL, NULL, GTK_STOCK_DIALOG_ERROR },
+ #if WITH_GMAIL
+ { MN_STOCK_GMAIL, PKGDATADIR G_DIR_SEPARATOR_S "gmail.png" },
+@@ -48,14 +48,14 @@
+ { MN_STOCK_HOTMAIL, PKGDATADIR G_DIR_SEPARATOR_S "hotmail.png" },
+ #endif
+ #if WITH_MBOX || WITH_MOZILLA || WITH_MH || WITH_MAILDIR || WITH_SYLPHEED
+- { MN_STOCK_SYSTEM_MAILBOX, NULL, "system" },
++ { MN_STOCK_SYSTEM_MAILBOX, NULL, "applications-system" },
+ #endif
+ #if WITH_EVOLUTION
+ { MN_STOCK_EVOLUTION_MAILBOX, NULL, "evolution" },
+ #endif
+- { MN_STOCK_MAIL_READER, NULL, "stock_mail-handling" },
+- { MN_STOCK_OPEN_MESSAGE, NULL, "stock_mail-open" },
+- { MN_STOCK_CONSIDER_NEW_MAIL_AS_READ, NULL, "stock_mark" }
++ { MN_STOCK_MAIL_READER, NULL, "mail-unread" },
++ { MN_STOCK_OPEN_MESSAGE, NULL, "mail-read" },
++ { MN_STOCK_CONSIDER_NEW_MAIL_AS_READ, NULL, "mail-mark-read" }
+ };
+ GtkIconFactory *factory;
+ GtkIconTheme *icon_theme;
diff --git a/testing/mail-notification/mail-notification-5.4-kde-trayicon.patch b/testing/mail-notification/mail-notification-5.4-kde-trayicon.patch
new file mode 100644
index 000000000..a3bdc8372
--- /dev/null
+++ b/testing/mail-notification/mail-notification-5.4-kde-trayicon.patch
@@ -0,0 +1,72 @@
+diff -Nrbu mail-notification-5.4/build/src/mn-shell.c mail-notification-5.4-OK/build/src/mn-shell.c
+--- mail-notification-5.4/build/src/mn-shell.c 2010-10-11 17:45:23.000000000 +0400
++++ mail-notification-5.4-OK/build/src/mn-shell.c 2010-10-11 17:45:48.000000000 +0400
+@@ -313,6 +313,29 @@
+ #undef __GOB_FUNCTION__
+
+ static void
++mn_shell_init_icon_base (MNShell * self)
++{
++ g_return_if_fail (self != NULL);
++ g_return_if_fail (MN_IS_SHELL (self));
++
++ self->icon = MN_MAIL_ICON(mn_mail_icon_new());
++ mn_add_weak_pointer(&self->icon);
++
++ g_object_connect(self->icon,
++ "signal::activate", self_icon_activate_h, self,
++ "signal::activate-mail-reader", self_icon_activate_mail_reader_h, self,
++ "signal::activate-open-latest-message", self_icon_activate_open_latest_message_h, self,
++ "swapped-signal::activate-consider-new-mail-as-read", self_consider_new_mail_as_read, self,
++ "swapped-signal::activate-update", self_update, self,
++ "signal::activate-properties", self_icon_activate_properties_h, self,
++ "signal::activate-help", self_icon_activate_help_h, self,
++ "signal::activate-about", self_icon_activate_about_h, self,
++ "swapped-signal::activate-remove", self_quit, self,
++ "signal::destroy", self_icon_destroy_h, self,
++ NULL);
++}
++
++static void
+ mn_shell_init (MNShell * o G_GNUC_UNUSED)
+ {
+ #define __GOB_FUNCTION__ "MN:Shell::init"
+@@ -793,22 +816,7 @@
+ {
+ #line 360 "src/mn-shell.gob"
+
+- self->icon = MN_MAIL_ICON(mn_mail_icon_new());
+- mn_add_weak_pointer(&self->icon);
+-
+- g_object_connect(self->icon,
+- "signal::activate", self_icon_activate_h, self,
+- "signal::activate-mail-reader", self_icon_activate_mail_reader_h, self,
+- "signal::activate-open-latest-message", self_icon_activate_open_latest_message_h, self,
+- "swapped-signal::activate-consider-new-mail-as-read", self_consider_new_mail_as_read, self,
+- "swapped-signal::activate-update", self_update, self,
+- "signal::activate-properties", self_icon_activate_properties_h, self,
+- "signal::activate-help", self_icon_activate_help_h, self,
+- "signal::activate-about", self_icon_activate_about_h, self,
+- "swapped-signal::activate-remove", self_quit, self,
+- "signal::destroy", self_icon_destroy_h, self,
+- NULL);
+-
++ mn_shell_init_icon_base(self);
+ self_update_sensitivity(self);
+ self_update_tooltip(self);
+ self_update_icon(self);
+@@ -1094,7 +1102,13 @@
+ }
+ else
+ {
+- gtk_widget_hide(GTK_WIDGET(self->icon));
++ /* Re-create the icon as a regular gtk_widget_hide causes the
++ * icon to remain visible on non-GNOME environments. We can't
++ * use the callback self_icon_destroy_h here as it can cause an
++ * endless recursion */
++ g_signal_handlers_disconnect_by_func(self->icon, self_icon_destroy_h, self);
++ gtk_widget_destroy(GTK_WIDGET(self->icon));
++ mn_shell_init_icon_base(self);
+ mn_mail_icon_set_blinking(self->icon, FALSE);
+ }
+ }}
diff --git a/testing/mail-notification/mail-notification-5.4-libx11.patch b/testing/mail-notification/mail-notification-5.4-libx11.patch
new file mode 100644
index 000000000..bb3574fda
--- /dev/null
+++ b/testing/mail-notification/mail-notification-5.4-libx11.patch
@@ -0,0 +1,13 @@
+Link with libX11 explicitly.
+
+--- mail-notification-5.4.dfsg.1.orig/jbsrc/jb.c
++++ mail-notification-5.4.dfsg.1/jbsrc/jb.c
+@@ -445,6 +445,8 @@
+
+ jb_compile_options_add_libs(object->compile_options, "-lm");
+
++ jb_compile_options_add_libs(object->compile_options, "-lX11");
++
+ jb_compile_options_add_package(object->compile_options, "gettext");
+ jb_compile_options_add_package(object->compile_options, "gnome");
+ jb_compile_options_add_package(object->compile_options, "dbus");
diff --git a/testing/mail-notification/mail-notification-5.4-popup-attach.patch b/testing/mail-notification/mail-notification-5.4-popup-attach.patch
new file mode 100644
index 000000000..b8d5f6a09
--- /dev/null
+++ b/testing/mail-notification/mail-notification-5.4-popup-attach.patch
@@ -0,0 +1,45 @@
+diff -Nrbu mail-notification-5.4/build/src/mn-popup.c mail-notification-5.4-OK/build/src/mn-popup.c
+--- mail-notification-5.4/build/src/mn-popup.c 2008-05-22 19:47:49.000000000 +0400
++++ mail-notification-5.4-OK/build/src/mn-popup.c 2010-10-11 17:42:32.000000000 +0400
+@@ -177,6 +177,29 @@
+ #undef __GOB_FUNCTION__
+
+ static void
++mn_popup_wait_for_icon_to_become_ready (void)
++{
++ int x, y;
++ int count = 0;
++
++ /* When the tray icon is created, it can still take some time before
++ * it has arrived at the correct position. This is especially the case
++ * on KDE environments. To work around this, add a little delay of at
++ * most 2 seconds before showing a popup which is attached to the notification */
++ do {
++ gdk_window_get_origin (gtk_widget_get_window (mn_shell->icon), &x, &y);
++
++ if (x != 0 || y != 0) {
++ break;
++ }
++
++ g_usleep(G_USEC_PER_SEC / 10);
++ count++;
++ } while (count < 20);
++}
++
++
++static void
+ mn_popup_init (MNPopup * o G_GNUC_UNUSED)
+ {
+ #define __GOB_FUNCTION__ "MN:Popup::init"
+@@ -299,8 +322,10 @@
+ "icon-name", "stock_mail",
+ NULL);
+
+- if (mn_conf_get_enum_value(MN_TYPE_POPUP_POSITION, MN_CONF_POPUPS_POSITION) == MN_POPUP_POSITION_ATTACHED)
++ if (mn_conf_get_enum_value(MN_TYPE_POPUP_POSITION, MN_CONF_POPUPS_POSITION) == MN_POPUP_POSITION_ATTACHED) {
++ mn_popup_wait_for_icon_to_become_ready();
+ g_object_set(self, "attach-widget", mn_shell->icon, NULL);
++ }
+
+ g_string_free(body, TRUE);
+
diff --git a/testing/mail-notification/mail-notification-5.4-sasl_encode64.patch b/testing/mail-notification/mail-notification-5.4-sasl_encode64.patch
new file mode 100644
index 000000000..80a7304d1
--- /dev/null
+++ b/testing/mail-notification/mail-notification-5.4-sasl_encode64.patch
@@ -0,0 +1,24 @@
+diff -up mail-notification-5.4/build/src/mn-pop3-mailbox.c mail-notification-5.4-OK/build/src/mn-pop3-mailbox.c
+--- mail-notification-5.4/build/src/mn-pop3-mailbox.c 2009-05-19 10:29:58.448201837 +0200
++++ mail-notification-5.4-OK/build/src/mn-pop3-mailbox.c 2009-05-19 10:23:29.356204287 +0200
+@@ -619,7 +619,7 @@ mn_pop3_mailbox_enter_auth_cb (MNClientS
+
+ if (initial_clientoutlen > 0)
+ {
+- char buf64[initial_clientoutlen * 2]; /* Base64 is 33% larger than the data it encodes */
++ char buf64[initial_clientoutlen * 2 + 1]; /* Base64 is 33% larger than the data it encodes */
+ unsigned int outlen;
+ int result;
+ char *str;
+diff -up mail-notification-5.4/src/mn-client-session.c mail-notification-5.4-OK/src/mn-client-session.c
+--- mail-notification-5.4/src/mn-client-session.c 2008-05-22 17:45:35.000000000 +0200
++++ mail-notification-5.4-OK/src/mn-client-session.c 2009-05-19 10:29:09.112211055 +0200
+@@ -1030,7 +1030,7 @@ mn_client_session_write (MNClientSession
+ static int
+ write_base64 (MNClientSession *session, const char *buf, unsigned int len)
+ {
+- char buf64[len * 2]; /* Base64 is 33% larger than the data it encodes */
++ char buf64[len * 2 + 1]; /* Base64 is 33% larger than the data it encodes */
+ unsigned int outlen;
+ int result;
+ char *str;
diff --git a/testing/mail-notification/mail-notification-5.4-weak.patch b/testing/mail-notification/mail-notification-5.4-weak.patch
new file mode 100644
index 000000000..2e2a233aa
--- /dev/null
+++ b/testing/mail-notification/mail-notification-5.4-weak.patch
@@ -0,0 +1,11 @@
+diff -Nrbu mail-notification-5.4/build/src/mn-shell.c mail-notification-5.4-OK/build/src/mn-shell.c
+--- mail-notification-5.4/build/src/mn-shell.c 2008-05-22 19:47:49.000000000 +0400
++++ mail-notification-5.4-OK/build/src/mn-shell.c 2010-05-24 19:39:48.000000000 +0400
+@@ -1008,6 +1008,7 @@
+ Self *self = user_data;
+
+ /* The Notification Area applet has been terminated. Recreate the icon. */
++ mn_remove_weak_pointer(&self->icon);
+ self_init_icon(self);
+ }}
+ #line 1014 "mn-shell.c"
diff --git a/testing/mail-notification/mail-notification.install b/testing/mail-notification/mail-notification.install
new file mode 100644
index 000000000..21cd94399
--- /dev/null
+++ b/testing/mail-notification/mail-notification.install
@@ -0,0 +1,24 @@
+pkgname=mail-notification
+
+post_install() {
+ usr/sbin/gconfpkg --install ${pkgname}
+ kill -s HUP `pidof bonobo-activation-server` > /dev/null 2>&1
+ gtk-update-icon-cache -q -t -f usr/share/icons/hicolor
+}
+
+pre_upgrade() {
+ pre_remove $1
+}
+
+post_upgrade() {
+ post_install $1
+}
+
+pre_remove() {
+ usr/sbin/gconfpkg --uninstall ${pkgname}
+}
+
+post_remove() {
+ kill -s HUP `pidof bonobo-activation-server` > /dev/null 2>&1
+ gtk-update-icon-cache -q -t -f usr/share/icons/hicolor
+}
diff --git a/testing/mail-notification/remove-ubuntu-special-case.patch b/testing/mail-notification/remove-ubuntu-special-case.patch
new file mode 100644
index 000000000..4516f32c6
--- /dev/null
+++ b/testing/mail-notification/remove-ubuntu-special-case.patch
@@ -0,0 +1,33 @@
+--- jbsrc/lib/src/core/jb-feature.c.~1~ 2008-04-27 16:47:27.000000000 +0200
++++ jbsrc/lib/src/core/jb-feature.c 2008-07-22 11:40:50.856886210 +0200
+@@ -164,8 +164,6 @@
+ static void
+ gconf_configure (void)
+ {
+- JBVariable *variable;
+-
+ jb_require_program("gconftool-2");
+
+ if (! strcmp(jb_variable_get_string("gconf-config-source"), "autodetect"))
+@@ -178,21 +176,6 @@
+ jb_variable_set_string("gconf-config-source", config_source);
+ g_free(config_source);
+ }
+-
+- /* fix the default schemas dir on Ubuntu */
+- variable = jb_variable_get_variable_or_error("gconf-schemas-dir");
+- if (! variable->user_set)
+- {
+- static const char *ubuntu_dir = "$datadir/gconf/schemas";
+- char *expanded;
+-
+- expanded = jb_variable_expand(ubuntu_dir, NULL);
+-
+- if (g_file_test(expanded, G_FILE_TEST_IS_DIR))
+- jb_variable_set_string("gconf-schemas-dir", ubuntu_dir);
+-
+- g_free(expanded);
+- }
+ }
+
+ static void
diff --git a/testing/systemd/0001-tmpfiles-fix-parsing-of-proc-net-unix-on-32Bit-machi.patch b/testing/systemd/0001-tmpfiles-fix-parsing-of-proc-net-unix-on-32Bit-machi.patch
new file mode 100644
index 000000000..456d679ed
--- /dev/null
+++ b/testing/systemd/0001-tmpfiles-fix-parsing-of-proc-net-unix-on-32Bit-machi.patch
@@ -0,0 +1,87 @@
+From fdcad0c25579a60061b1fda956686e878a80faef Mon Sep 17 00:00:00 2001
+From: Lennart Poettering <lennart@poettering.net>
+Date: Wed, 11 Jan 2012 22:07:35 +0100
+Subject: [PATCH] tmpfiles: fix parsing of /proc/net/unix on 32Bit machines
+
+Tracked down by Michael Meeks
+---
+ src/tmpfiles.c | 30 ++++++++++++++++++++----------
+ 1 files changed, 20 insertions(+), 10 deletions(-)
+
+diff --git a/src/tmpfiles.c b/src/tmpfiles.c
+index 19a7c08..44e5c9d 100644
+--- a/src/tmpfiles.c
++++ b/src/tmpfiles.c
+@@ -117,41 +117,50 @@ static void load_unix_sockets(void) {
+ /* We maintain a cache of the sockets we found in
+ * /proc/net/unix to speed things up a little. */
+
+- if (!(unix_sockets = set_new(string_hash_func, string_compare_func)))
++ unix_sockets = set_new(string_hash_func, string_compare_func);
++ if (!unix_sockets)
+ return;
+
+- if (!(f = fopen("/proc/net/unix", "re")))
++ f = fopen("/proc/net/unix", "re");
++ if (!f)
+ return;
+
+- if (!(fgets(line, sizeof(line), f)))
++ /* Skip header */
++ if (!fgets(line, sizeof(line), f))
+ goto fail;
+
+ for (;;) {
+ char *p, *s;
+ int k;
+
+- if (!(fgets(line, sizeof(line), f)))
++ if (!fgets(line, sizeof(line), f))
+ break;
+
+ truncate_nl(line);
+
+- if (strlen(line) < 53)
++ p = strchr(line, ':');
++ if (!p)
++ continue;
++
++ if (strlen(p) < 37)
+ continue;
+
+- p = line + 53;
++ p += 37;
+ p += strspn(p, WHITESPACE);
+- p += strcspn(p, WHITESPACE);
++ p += strcspn(p, WHITESPACE); /* skip one more word */
+ p += strspn(p, WHITESPACE);
+
+ if (*p != '/')
+ continue;
+
+- if (!(s = strdup(p)))
++ s = strdup(p);
++ if (!s)
+ goto fail;
+
+ path_kill_slashes(s);
+
+- if ((k = set_put(unix_sockets, s)) < 0) {
++ k = set_put(unix_sockets, s);
++ if (k < 0) {
+ free(s);
+
+ if (k != -EEXIST)
+@@ -1059,7 +1068,8 @@ int main(int argc, char *argv[]) {
+ Item *i;
+ Iterator iterator;
+
+- if ((r = parse_argv(argc, argv)) <= 0)
++ r = parse_argv(argc, argv);
++ if (r <= 0)
+ return r < 0 ? EXIT_FAILURE : EXIT_SUCCESS;
+
+ log_set_target(LOG_TARGET_AUTO);
+--
+1.7.8.3
+
diff --git a/testing/systemd/0001-units-make-sure-syslog-socket-goes-away-early-during.patch b/testing/systemd/0001-units-make-sure-syslog-socket-goes-away-early-during.patch
new file mode 100644
index 000000000..49248a6a4
--- /dev/null
+++ b/testing/systemd/0001-units-make-sure-syslog-socket-goes-away-early-during.patch
@@ -0,0 +1,26 @@
+From ead51eb4ed55981f290e40a871ffbca6480c4cd3 Mon Sep 17 00:00:00 2001
+From: Lennart Poettering <lennart@poettering.net>
+Date: Thu, 12 Jan 2012 04:34:50 +0100
+Subject: [PATCH] units: make sure syslog socket goes away early during
+ shutdown
+
+---
+ units/syslog.socket | 2 ++
+ 1 files changed, 2 insertions(+), 0 deletions(-)
+
+diff --git a/units/syslog.socket b/units/syslog.socket
+index 323fa86..657e791 100644
+--- a/units/syslog.socket
++++ b/units/syslog.socket
+@@ -11,6 +11,8 @@
+ Description=Syslog Socket
+ DefaultDependencies=no
+ Before=sockets.target syslog.target
++Conflicts=shutdown.target
++Before=shutdown.target
+
+ # Pull in syslog.target to tell people that /dev/log is now accessible
+ Wants=syslog.target
+--
+1.7.8.3
+
diff --git a/testing/systemd/PKGBUILD b/testing/systemd/PKGBUILD
index da1a936ae..1dea4b12a 100644
--- a/testing/systemd/PKGBUILD
+++ b/testing/systemd/PKGBUILD
@@ -1,15 +1,15 @@
-# $Id: PKGBUILD 146498 2012-01-12 03:32:19Z dreisner $
+# $Id: PKGBUILD 146631 2012-01-14 21:33:48Z dreisner $
# Maintainer: Dave Reisner <dreisner@archlinux.org>
pkgname=systemd
pkgver=38
-pkgrel=1
+pkgrel=2
pkgdesc="Session and Startup manager"
arch=('i686' 'x86_64')
url="http://www.freedesktop.org/wiki/Software/systemd"
license=('GPL2')
-depends=('dbus-core' 'kbd' 'libcap' 'util-linux>=2.19' 'udev>=172' 'xz')
-makedepends=('acl' 'gperf' 'cryptsetup' 'intltool' 'linux-api-headers')
+depends=('acl' 'dbus-core' 'kbd' 'libcap' 'util-linux>=2.19' 'udev>=172' 'xz')
+makedepends=('gperf' 'cryptsetup' 'intltool' 'linux-api-headers')
optdepends=('cryptsetup: required for encrypted block devices'
'dbus-python: systemd-analyze'
'initscripts: legacy support for hostname and vconsole setup'
@@ -28,9 +28,13 @@ backup=(etc/dbus-1/system.d/org.freedesktop.systemd1.conf
etc/systemd/systemd-logind.conf)
install=systemd.install
source=("http://www.freedesktop.org/software/$pkgname/$pkgname-$pkgver.tar.xz"
- "os-release")
+ "os-release"
+ '0001-tmpfiles-fix-parsing-of-proc-net-unix-on-32Bit-machi.patch'
+ '0001-units-make-sure-syslog-socket-goes-away-early-during.patch')
md5sums=('68c66dce5a28c0efd7c210af5d11efed'
- '752636def0db3c03f121f8b4f44a63cd')
+ '752636def0db3c03f121f8b4f44a63cd'
+ '07437e70be65ef14fd4f13c5ec5bd1fe'
+ 'c567ce597f68c07b9bc5b7e835f80f7d')
build() {
cd "$pkgname-$pkgver"
@@ -40,13 +44,14 @@ build() {
sed -i -e '/^Environ.*LANG/s/^/#/' \
-e '/^ExecStart/s/agetty/& -8/' units/getty@.service.m4
+ patch -Np1 < "$srcdir/0001-tmpfiles-fix-parsing-of-proc-net-unix-on-32Bit-machi.patch"
+ patch -Np1 < "$srcdir/0001-units-make-sure-syslog-socket-goes-away-early-during.patch"
./configure --sysconfdir=/etc \
--libexecdir=/usr/lib \
--libdir=/usr/lib \
--localstatedir=/var \
- --with-rootprefix= \
- --with-rootlibdir=/lib
+ --with-rootprefix=
make
diff --git a/testing/totem-plparser/PKGBUILD b/testing/totem-plparser/PKGBUILD
index feac870e6..f63b5c140 100644
--- a/testing/totem-plparser/PKGBUILD
+++ b/testing/totem-plparser/PKGBUILD
@@ -1,15 +1,15 @@
-# $Id: PKGBUILD 146042 2012-01-04 16:37:02Z ibiru $
+# $Id: PKGBUILD 146624 2012-01-14 12:24:19Z ibiru $
# Maintainer: Jan de Groot <jgc@archlinux.org>
pkgname=totem-plparser
pkgver=2.32.6
-pkgrel=2
+pkgrel=3
url="http://www.hadess.net/totem.php3"
pkgdesc="Totem playlist parser library"
license=('LGPL')
arch=(i686 x86_64)
depends=('gmime' 'libsoup-gnome' 'libarchive')
-makedepends=('intltool' 'pkgconfig' 'gobject-introspection')
+makedepends=('intltool' 'gobject-introspection')
options=('!libtool')
source=(http://ftp.gnome.org/pub/gnome/sources/totem-pl-parser/2.32/totem-pl-parser-$pkgver.tar.xz)
sha256sums=('8e6ccef547f1ad311474a975032d2482e621550ee3d4d22c725cdc6b496e4874')