Merge branch '0.9.x' into 1.0.x

Conflicts:
	classes/statusnet.ini
	db/statusnet.sql
	lib/jabber.php
	lib/xmppmanager.php

36 files changed, 1232 insertions, 339 deletions

diff --git a/lib/action.php b/lib/action.php
index fa9ddb911..10394c789 100644
--- a/lib/action.php
+++ b/lib/action.php
@@ -420,56 +420,75 @@ class Action extends HTMLOutputter // lawsuit
     function showPrimaryNav()
     {
         $user = common_current_user();
-        $connect = '';
-        if (common_config('xmpp', 'enabled')) {
-            $connect = 'imsettings';
-        } else if (common_config('sms', 'enabled')) {
-            $connect = 'smssettings';
-        } else if (common_config('twitter', 'enabled')) {
-            $connect = 'twittersettings';
-        }
-
         $this->elementStart('dl', array('id' => 'site_nav_global_primary'));
         $this->element('dt', null, _('Primary site navigation'));
         $this->elementStart('dd');
         $this->elementStart('ul', array('class' => 'nav'));
         if (Event::handle('StartPrimaryNav', array($this))) {
             if ($user) {
+                // TRANS: Tooltip for main menu option "Personal"
+                $tooltip = _m('TOOLTIP', 'Personal profile and friends timeline');
+                // TRANS: Main menu option when logged in for access to personal profile and friends timeline
                 $this->menuItem(common_local_url('all', array('nickname' => $user->nickname)),
-                                _('Home'), _('Personal profile and friends timeline'), false, 'nav_home');
+                                _m('MENU', 'Personal'), $tooltip, false, 'nav_home');
+                // TRANS: Tooltip for main menu option "Account"
+                $tooltip = _m('TOOLTIP', 'Change your email, avatar, password, profile');
+                // TRANS: Main menu option when logged in for access to user settings
                 $this->menuItem(common_local_url('profilesettings'),
-                                _('Account'), _('Change your email, avatar, password, profile'), false, 'nav_account');
-                if ($connect) {
-                    $this->menuItem(common_local_url($connect),
-                                    _('Connect'), _('Connect to services'), false, 'nav_connect');
-                }
+                                _('Account'), $tooltip, false, 'nav_account');
+                // TRANS: Tooltip for main menu option "Services"
+                $tooltip = _m('TOOLTIP', 'Connect to services');
+                // TRANS: Main menu option when logged in and connection are possible for access to options to connect to other services
+                $this->menuItem(common_local_url('oauthconnectionssettings'),
+                                _('Connect'), $tooltip, false, 'nav_connect');
                 if ($user->hasRight(Right::CONFIGURESITE)) {
+                    // TRANS: Tooltip for menu option "Admin"
+                    $tooltip = _m('TOOLTIP', 'Change site configuration');
+                    // TRANS: Main menu option when logged in and site admin for access to site configuration
                     $this->menuItem(common_local_url('siteadminpanel'),
-                                    _('Admin'), _('Change site configuration'), false, 'nav_admin');
+                                    _m('MENU', 'Admin'), $tooltip, false, 'nav_admin');
                 }
                 if (common_config('invite', 'enabled')) {
+                    // TRANS: Tooltip for main menu option "Invite"
+                    $tooltip = _m('TOOLTIP', 'Invite friends and colleagues to join you on %s');
+                    // TRANS: Main menu option when logged in and invitations are allowed for inviting new users
                     $this->menuItem(common_local_url('invite'),
-                                    _('Invite'),
-                                    sprintf(_('Invite friends and colleagues to join you on %s'),
+                                    _m('MENU', 'Invite'),
+                                    sprintf($tooltip,
                                             common_config('site', 'name')),
                                     false, 'nav_invitecontact');
                 }
+                // TRANS: Tooltip for main menu option "Logout"
+                $tooltip = _m('TOOLTIP', 'Logout from the site');
+                // TRANS: Main menu option when logged in to log out the current user
                 $this->menuItem(common_local_url('logout'),
-                                _('Logout'), _('Logout from the site'), false, 'nav_logout');
+                                _m('MENU', 'Logout'), $tooltip, false, 'nav_logout');
             }
             else {
                 if (!common_config('site', 'closed')) {
+                    // TRANS: Tooltip for main menu option "Register"
+                    $tooltip = _m('TOOLTIP', 'Create an account');
+                    // TRANS: Main menu option when not logged in to register a new account
                     $this->menuItem(common_local_url('register'),
-                                    _('Register'), _('Create an account'), false, 'nav_register');
+                                    _m('MENU', 'Register'), $tooltip, false, 'nav_register');
                 }
+                // TRANS: Tooltip for main menu option "Login"
+                $tooltip = _m('TOOLTIP', 'Login to the site');
+                // TRANS: Main menu option when not logged in to log in
                 $this->menuItem(common_local_url('login'),
-                                _('Login'), _('Login to the site'), false, 'nav_login');
+                                _m('MENU', 'Login'), $tooltip, false, 'nav_login');
             }
+            // TRANS: Tooltip for main menu option "Help"
+            $tooltip = _m('TOOLTIP', 'Help me!');
+            // TRANS: Main menu option for help on the StatusNet site
             $this->menuItem(common_local_url('doc', array('title' => 'help')),
-                            _('Help'), _('Help me!'), false, 'nav_help');
+                            _m('MENU', 'Help'), $tooltip, false, 'nav_help');
             if ($user || !common_config('site', 'private')) {
+                // TRANS: Tooltip for main menu option "Search"
+                $tooltip = _m('TOOLTIP', 'Search for people or text');
+                // TRANS: Main menu option when logged in or when the StatusNet instance is not private
                 $this->menuItem(common_local_url('peoplesearch'),
-                                _('Search'), _('Search for people or text'), false, 'nav_search');
+                                _m('MENU', 'Search'), $tooltip, false, 'nav_search');
             }
             Event::handle('EndPrimaryNav', array($this));
         }
@@ -490,6 +509,7 @@ class Action extends HTMLOutputter // lawsuit
         if ($text) {
             $this->elementStart('dl', array('id' => 'site_notice',
                                             'class' => 'system_notice'));
+            // TRANS: DT element for site notice. String is hidden in default CSS.
             $this->element('dt', null, _('Site notice'));
             $this->elementStart('dd', null);
             $this->raw($text);
@@ -976,7 +996,7 @@ class Action extends HTMLOutputter // lawsuit
 
         if (is_null($arg)) {
             return $def;
-        } else if (in_array($arg, array('true', 'yes', '1'))) {
+        } else if (in_array($arg, array('true', 'yes', '1', 'on'))) {
             return true;
         } else if (in_array($arg, array('false', 'no', '0'))) {
             return false;
diff --git a/lib/activity.php b/lib/activity.php
index 25727bf2b..2cb80f9e1 100644
--- a/lib/activity.php
+++ b/lib/activity.php
@@ -154,7 +154,15 @@ class PoCo
                 PoCo::NS
             );
 
-            array_push($urls, new PoCoURL($type, $value, $primary));
+            $isPrimary = false;
+
+            if (isset($primary) && $primary == 'true') {
+                $isPrimary = true;
+            }
+
+            // @todo check to make sure a primary hasn't already been added
+
+            array_push($urls, new PoCoURL($type, $value, $isPrimary));
         }
         return $urls;
     }
@@ -215,6 +223,46 @@ class PoCo
         return $poco;
     }
 
+    function fromGroup($group)
+    {
+        if (empty($group)) {
+            return null;
+        }
+
+        $poco = new PoCo();
+
+        $poco->preferredUsername = $group->nickname;
+        $poco->displayName       = $group->getBestName();
+
+        $poco->note = $group->description;
+
+        $paddy = new PoCoAddress();
+        $paddy->formatted = $group->location;
+        $poco->address = $paddy;
+
+        if (!empty($group->homepage)) {
+            array_push(
+                $poco->urls,
+                new PoCoURL(
+                    'homepage',
+                    $group->homepage,
+                    true
+                )
+            );
+        }
+
+        return $poco;
+    }
+
+    function getPrimaryURL()
+    {
+        foreach ($this->urls as $url) {
+            if ($url->primary) {
+                return $url;
+            }
+        }
+    }
+
     function asString()
     {
         $xs = new XMLStringer(true);
@@ -296,22 +344,45 @@ class ActivityUtils
 
     static function getLink(DOMNode $element, $rel, $type=null)
     {
-        $links = $element->getElementsByTagnameNS(self::ATOM, self::LINK);
+        $els = $element->childNodes;
 
-        foreach ($links as $link) {
+        foreach ($els as $link) {
+            if ($link->localName == self::LINK && $link->namespaceURI == self::ATOM) {
 
-            $linkRel = $link->getAttribute(self::REL);
-            $linkType = $link->getAttribute(self::TYPE);
+                $linkRel = $link->getAttribute(self::REL);
+                $linkType = $link->getAttribute(self::TYPE);
 
-            if ($linkRel == $rel &&
-                (is_null($type) || $linkType == $type)) {
-                return $link->getAttribute(self::HREF);
+                if ($linkRel == $rel &&
+                    (is_null($type) || $linkType == $type)) {
+                    return $link->getAttribute(self::HREF);
+                }
             }
         }
 
         return null;
     }
 
+    static function getLinks(DOMNode $element, $rel, $type=null)
+    {
+        $els = $element->childNodes;
+        $out = array();
+
+        foreach ($els as $link) {
+            if ($link->localName == self::LINK && $link->namespaceURI == self::ATOM) {
+
+                $linkRel = $link->getAttribute(self::REL);
+                $linkType = $link->getAttribute(self::TYPE);
+
+                if ($linkRel == $rel &&
+                    (is_null($type) || $linkType == $type)) {
+                    $out[] = $link;
+                }
+            }
+        }
+
+        return $out;
+    }
+
     /**
      * Gets the first child element with the given tag
      *
@@ -417,6 +488,75 @@ class ActivityUtils
     }
 }
 
+// XXX: Arg! This wouldn't be necessary if we used Avatars conistently
+class AvatarLink
+{
+    public $url;
+    public $type;
+    public $size;
+    public $width;
+    public $height;
+
+    function __construct($element=null)
+    {
+        if ($element) {
+            // @fixme use correct namespaces
+            $this->url = $element->getAttribute('href');
+            $this->type = $element->getAttribute('type');
+            $width = $element->getAttribute('media:width');
+            if ($width != null) {
+                $this->width = intval($width);
+            }
+            $height = $element->getAttribute('media:height');
+            if ($height != null) {
+                $this->height = intval($height);
+            }
+        }
+    }
+
+    static function fromAvatar($avatar)
+    {
+        if (empty($avatar)) {
+            return null;
+        }
+        $alink = new AvatarLink();
+        $alink->type   = $avatar->mediatype;
+        $alink->height = $avatar->height;
+        $alink->width  = $avatar->width;
+        $alink->url    = $avatar->displayUrl();
+        return $alink;
+    }
+
+    static function fromFilename($filename, $size)
+    {
+        $alink = new AvatarLink();
+        $alink->url    = $filename;
+        $alink->height = $size;
+        if (!empty($filename)) {
+            $alink->width  = $size;
+            $alink->type   = self::mediatype($filename);
+        } else {
+            $alink->url    = User_group::defaultLogo($size);
+            $alink->type   = 'image/png';
+        }
+        return $alink;
+    }
+
+    // yuck!
+    static function mediatype($filename) {
+        $ext = strtolower(end(explode('.', $filename)));
+        if ($ext == 'jpeg') {
+            $ext = 'jpg';
+        }
+        // hope we don't support any others
+        $types = array('png', 'gif', 'jpg', 'jpeg');
+        if (in_array($ext, $types)) {
+            return 'image/' . $ext;
+        }
+        return null;
+    }
+}
+
 /**
  * A noun-ish thing in the activity universe
  *
@@ -473,7 +613,7 @@ class ActivityObject
     public $content;
     public $link;
     public $source;
-    public $avatar;
+    public $avatarLinks = array();
     public $geopoint;
     public $poco;
     public $displayName;
@@ -496,6 +636,12 @@ class ActivityObject
 
         $this->element = $element;
 
+        $this->geopoint = $this->_childContent(
+            $element,
+            ActivityContext::POINT,
+            ActivityContext::GEORSS
+        );
+
         if ($element->tagName == 'author') {
 
             $this->type  = self::PERSON; // XXX: is this fair?
@@ -535,8 +681,10 @@ class ActivityObject
         if ($this->type == self::PERSON || $this->type == self::GROUP) {
             $this->displayName = $this->title;
 
-            // @fixme we may have multiple avatars with different resolutions specified
-            $this->avatar = ActivityUtils::getLink($element, 'avatar');
+            $avatars = ActivityUtils::getLinks($element, 'avatar');
+            foreach ($avatars as $link) {
+                $this->avatarLinks[] = new AvatarLink($link);
+            }
 
             $this->poco = new PoCo($element);
         }
@@ -587,10 +735,40 @@ class ActivityObject
         $object->id     = $profile->getUri();
         $object->title  = $profile->getBestName();
         $object->link   = $profile->profileurl;
-        $object->avatar = $profile->getAvatar(AVATAR_PROFILE_SIZE);
+
+        $orig = $profile->getOriginalAvatar();
+
+        if (!empty($orig)) {
+            $object->avatarLinks[] = AvatarLink::fromAvatar($orig);
+        }
+
+        $sizes = array(
+            AVATAR_PROFILE_SIZE,
+            AVATAR_STREAM_SIZE,
+            AVATAR_MINI_SIZE
+        );
+
+        foreach ($sizes as $size) {
+
+            $alink  = null;
+            $avatar = $profile->getAvatar($size);
+
+            if (!empty($avatar)) {
+                $alink = AvatarLink::fromAvatar($avatar);
+            } else {
+                $alink = new AvatarLink();
+                $alink->type   = 'image/png';
+                $alink->height = $size;
+                $alink->width  = $size;
+                $alink->url    = Avatar::defaultImage($size);
+            }
+
+            $object->avatarLinks[] = $alink;
+        }
 
         if (isset($profile->lat) && isset($profile->lon)) {
-            $object->geopoint = (float)$profile->lat . ' ' . (float)$profile->lon;
+            $object->geopoint = (float)$profile->lat
+                . ' ' . (float)$profile->lon;
         }
 
         $object->poco = PoCo::fromProfile($profile);
@@ -598,6 +776,36 @@ class ActivityObject
         return $object;
     }
 
+    static function fromGroup($group)
+    {
+        $object = new ActivityObject();
+
+        $object->type   = ActivityObject::GROUP;
+        $object->id     = $group->getUri();
+        $object->title  = $group->getBestName();
+        $object->link   = $group->getUri();
+
+        $object->avatarLinks[] = AvatarLink::fromFilename(
+            $group->homepage_logo,
+            AVATAR_PROFILE_SIZE
+        );
+
+        $object->avatarLinks[] = AvatarLink::fromFilename(
+            $group->stream_logo,
+            AVATAR_STREAM_SIZE
+        );
+
+        $object->avatarLinks[] = AvatarLink::fromFilename(
+            $group->mini_logo,
+            AVATAR_MINI_SIZE
+        );
+
+        $object->poco = PoCo::fromGroup($group);
+
+        return $object;
+    }
+
+
     function asString($tag='activity:object')
     {
         $xs = new XMLStringer(true);
@@ -635,16 +843,19 @@ class ActivityObject
 
         if ($this->type == ActivityObject::PERSON
             || $this->type == ActivityObject::GROUP) {
-            $xs->element(
-                'link', array(
-                    'type' => empty($this->avatar) ? 'image/png' : $this->avatar->mediatype,
-                    'rel'  => 'avatar',
-                    'href' => empty($this->avatar)
-                    ? Avatar::defaultImage(AVATAR_PROFILE_SIZE)
-                    : $this->avatar->displayUrl()
-                ),
-                null
-            );
+
+            foreach ($this->avatarLinks as $avatar) {
+                $xs->element(
+                    'link', array(
+                        'rel'  => 'avatar',
+                        'type'         => $avatar->type,
+                        'media:width'  => $avatar->width,
+                        'media:height' => $avatar->height,
+                        'href' => $avatar->url
+                    ),
+                    null
+                );
+            }
         }
 
         if (!empty($this->geopoint)) {
@@ -761,22 +972,29 @@ class ActivityContext
 
         for ($i = 0; $i < $points->length; $i++) {
             $point = $points->item($i)->textContent;
-            $point = str_replace(',', ' ', $point); // per spec "treat commas as whitespace"
-            $point = preg_replace('/\s+/', ' ', $point);
-            $point = trim($point);
-            $coords = explode(' ', $point);
-            if (count($coords) == 2) {
-                list($lat, $lon) = $coords;
-                if (is_numeric($lat) && is_numeric($lon)) {
-                    common_log(LOG_INFO, "Looking up location for $lat $lon from georss");
-                    return Location::fromLatLon($lat, $lon);
-                }
-            }
-            common_log(LOG_ERR, "Ignoring bogus georss:point value $point");
+            return self::locationFromPoint($point);
         }
 
         return null;
     }
+
+    // XXX: Move to ActivityUtils or Location?
+    static function locationFromPoint($point)
+    {
+        $point = str_replace(',', ' ', $point); // per spec "treat commas as whitespace"
+        $point = preg_replace('/\s+/', ' ', $point);
+        $point = trim($point);
+        $coords = explode(' ', $point);
+        if (count($coords) == 2) {
+            list($lat, $lon) = $coords;
+            if (is_numeric($lat) && is_numeric($lon)) {
+                common_log(LOG_INFO, "Looking up location for $lat $lon from georss point");
+                return Location::fromLatLon($lat, $lon);
+            }
+        }
+        common_log(LOG_ERR, "Ignoring bogus georss:point value $point");
+        return null;
+    }
 }
 
 /**
@@ -829,6 +1047,8 @@ class Activity
     public $content; // HTML content of activity
     public $id;      // ID of the activity
     public $title;   // title of the activity
+    public $categories = array(); // list of AtomCategory objects
+    public $enclosures = array(); // list of enclosure URL references
 
     /**
      * Turns a regular old Atom <entry> into a magical activity
@@ -844,6 +1064,18 @@ class Activity
         }
 
         $this->entry = $entry;
+
+        // @fixme Don't send in a DOMDocument
+        if ($feed instanceof DOMDocument) {
+            common_log(
+                LOG_WARNING,
+                'Activity::__construct() - '
+                . 'DOMDocument passed in for feed by mistake. '
+                . "Expecting a 'feed' DOMElement."
+            );
+            $feed = $feed->getElementsByTagName('feed')->item(0);
+        }
+
         $this->feed  = $feed;
 
         $pubEl = $this->_child($entry, self::PUBLISHED, self::ATOM);
@@ -917,6 +1149,18 @@ class Activity
         $this->summary = ActivityUtils::childContent($entry, 'summary');
         $this->id      = ActivityUtils::childContent($entry, 'id');
         $this->content = ActivityUtils::getContent($entry);
+
+        $catEls = $entry->getElementsByTagNameNS(self::ATOM, 'category');
+        if ($catEls) {
+            for ($i = 0; $i < $catEls->length; $i++) {
+                $catEl = $catEls->item($i);
+                $this->categories[] = new AtomCategory($catEl);
+            }
+        }
+
+        foreach (ActivityUtils::getLinks($entry, 'enclosure') as $link) {
+            $this->enclosures[] = $link->getAttribute('href');
+        }
     }
 
     /**
@@ -939,7 +1183,8 @@ class Activity
                            'xmlns:activity' => 'http://activitystrea.ms/spec/1.0/',
                            'xmlns:georss' => 'http://www.georss.org/georss',
                            'xmlns:ostatus' => 'http://ostatus.org/schema/1.0',
-                           'xmlns:poco' => 'http://portablecontacts.net/spec/1.0');
+                           'xmlns:poco' => 'http://portablecontacts.net/spec/1.0',
+                           'xmlns:media' => 'http://purl.org/syndication/atommedia');
         } else {
             $attrs = array();
         }
@@ -981,6 +1226,10 @@ class Activity
             $xs->raw($this->target->asString('activity:target'));
         }
 
+        foreach ($this->categories as $cat) {
+            $xs->raw($cat->asString());
+        }
+
         $xs->elementEnd('entry');
 
         return $xs->getString();
@@ -990,4 +1239,50 @@ class Activity
     {
         return ActivityUtils::child($element, $tag, $namespace);
     }
-}
\ No newline at end of file
+}
+
+class AtomCategory
+{
+    public $term;
+    public $scheme;
+    public $label;
+
+    function __construct($element=null)
+    {
+        if ($element && $element->attributes) {
+            $this->term = $this->extract($element, 'term');
+            $this->scheme = $this->extract($element, 'scheme');
+            $this->label = $this->extract($element, 'label');
+        }
+    }
+
+    protected function extract($element, $attrib)
+    {
+        $node = $element->attributes->getNamedItemNS(Activity::ATOM, $attrib);
+        if ($node) {
+            return trim($node->textContent);
+        }
+        $node = $element->attributes->getNamedItem($attrib);
+        if ($node) {
+            return trim($node->textContent);
+        }
+        return null;
+    }
+
+    function asString()
+    {
+        $attribs = array();
+        if ($this->term !== null) {
+            $attribs['term'] = $this->term;
+        }
+        if ($this->scheme !== null) {
+            $attribs['scheme'] = $this->scheme;
+        }
+        if ($this->label !== null) {
+            $attribs['label'] = $this->label;
+        }
+        $xs = new XMLStringer();
+        $xs->element('category', $attribs);
+        return $xs->asString();
+    }
+}
diff --git a/lib/adminpanelaction.php b/lib/adminpanelaction.php
index f05627b31..a927e2333 100644
--- a/lib/adminpanelaction.php
+++ b/lib/adminpanelaction.php
@@ -69,6 +69,7 @@ class AdminPanelAction extends Action
         // User must be logged in.
 
         if (!common_logged_in()) {
+            // TRANS: Client error message
             $this->clientError(_('Not logged in.'));
             return false;
         }
@@ -93,6 +94,7 @@ class AdminPanelAction extends Action
         // User must have the right to change admin settings
 
         if (!$user->hasRight(Right::CONFIGURESITE)) {
+            // TRANS: Client error message
             $this->clientError(_('You cannot make changes to this site.'));
             return false;
         }
@@ -103,7 +105,8 @@ class AdminPanelAction extends Action
 
         $name = mb_substr($name, 0, -10);
 
-        if (!in_array($name, common_config('admin', 'panels'))) {
+        if (!self::canAdmin($name)) {
+            // TRANS: Client error message
             $this->clientError(_('Changes to that panel are not allowed.'), 403);
             return false;
         }
@@ -134,6 +137,7 @@ class AdminPanelAction extends Action
                 Config::loadSettings();
 
                 $this->success = true;
+                // TRANS: Message after successful saving of administrative settings.
                 $this->msg     = _('Settings saved.');
             } catch (Exception $e) {
                 $this->success = false;
@@ -172,6 +176,24 @@ class AdminPanelAction extends Action
     }
 
     /**
+     * Show content block. Overrided just to add a special class
+     * to the content div to allow styling.
+     *
+     * @return nothing
+     */
+    function showContentBlock()
+    {
+        $this->elementStart('div', array('id' => 'content', 'class' => 'admin'));
+        $this->showPageTitle();
+        $this->showPageNoticeBlock();
+        $this->elementStart('div', array('id' => 'content_inner'));
+        // show the actual content (forms, lists, whatever)
+        $this->showContent();
+        $this->elementEnd('div');
+        $this->elementEnd('div');
+    }
+
+    /**
      * show human-readable instructions for the page, or
      * a success/failure on save.
      *
@@ -203,6 +225,7 @@ class AdminPanelAction extends Action
 
     function showForm()
     {
+        // TRANS: Client error message
         $this->clientError(_('showForm() not implemented.'));
         return;
     }
@@ -232,6 +255,7 @@ class AdminPanelAction extends Action
 
     function saveSettings()
     {
+        // TRANS: Client error message
         $this->clientError(_('saveSettings() not implemented.'));
         return;
     }
@@ -255,6 +279,7 @@ class AdminPanelAction extends Action
             $result = $config->delete();
             if (!$result) {
                 common_log_db_error($config, 'DELETE', __FILE__);
+                // TRANS: Client error message
                 $this->clientError(_("Unable to delete design setting."));
                 return null;
             }
@@ -262,6 +287,17 @@ class AdminPanelAction extends Action
 
         return $result;
     }
+
+    function canAdmin($name)
+    {
+        $isOK = false;
+
+        if (Event::handle('AdminPanelCheck', array($name, &$isOK))) {
+            $isOK = in_array($name, common_config('admin', 'panels'));
+        }
+
+        return $isOK;
+    }
 }
 
 /**
@@ -307,34 +343,68 @@ class AdminPanelNav extends Widget
 
         if (Event::handle('StartAdminPanelNav', array($this))) {
 
-            if ($this->canAdmin('site')) {
-                $this->out->menuItem(common_local_url('siteadminpanel'), _('Site'),
-                                     _('Basic site configuration'), $action_name == 'siteadminpanel', 'nav_site_admin_panel');
+            if (AdminPanelAction::canAdmin('site')) {
+                // TRANS: Menu item title/tooltip
+                $menu_title = _('Basic site configuration');
+                // TRANS: Menu item for site administration
+                $this->out->menuItem(common_local_url('siteadminpanel'), _m('MENU', 'Site'),
+                                     $menu_title, $action_name == 'siteadminpanel', 'nav_site_admin_panel');
             }
 
-            if ($this->canAdmin('design')) {
-                $this->out->menuItem(common_local_url('designadminpanel'), _('Design'),
-                                     _('Design configuration'), $action_name == 'designadminpanel', 'nav_design_admin_panel');
+            if (AdminPanelAction::canAdmin('design')) {
+                // TRANS: Menu item title/tooltip
+                $menu_title = _('Design configuration');
+                // TRANS: Menu item for site administration
+                $this->out->menuItem(common_local_url('designadminpanel'), _m('MENU', 'Design'),
+                                     $menu_title, $action_name == 'designadminpanel', 'nav_design_admin_panel');
             }
 
-            if ($this->canAdmin('user')) {
+            if (AdminPanelAction::canAdmin('user')) {
+                // TRANS: Menu item title/tooltip
+                $menu_title = _('User configuration');
+                // TRANS: Menu item for site administration
                 $this->out->menuItem(common_local_url('useradminpanel'), _('User'),
-                                     _('User configuration'), $action_name == 'useradminpanel', 'nav_design_admin_panel');
+                                     $menu_title, $action_name == 'useradminpanel', 'nav_user_admin_panel');
             }
 
-            if ($this->canAdmin('access')) {
+            if (AdminPanelAction::canAdmin('access')) {
+                // TRANS: Menu item title/tooltip
+                $menu_title = _('Access configuration');
+                // TRANS: Menu item for site administration
                 $this->out->menuItem(common_local_url('accessadminpanel'), _('Access'),
-                                     _('Access configuration'), $action_name == 'accessadminpanel', 'nav_design_admin_panel');
+                                     $menu_title, $action_name == 'accessadminpanel', 'nav_access_admin_panel');
             }
 
-            if ($this->canAdmin('paths')) {
+            if (AdminPanelAction::canAdmin('paths')) {
+                // TRANS: Menu item title/tooltip
+                $menu_title = _('Paths configuration');
+                // TRANS: Menu item for site administration
                 $this->out->menuItem(common_local_url('pathsadminpanel'), _('Paths'),
-                                    _('Paths configuration'), $action_name == 'pathsadminpanel', 'nav_design_admin_panel');
+                                    $menu_title, $action_name == 'pathsadminpanel', 'nav_paths_admin_panel');
             }
 
-            if ($this->canAdmin('sessions')) {
+            if (AdminPanelAction::canAdmin('sessions')) {
+                // TRANS: Menu item title/tooltip
+                $menu_title = _('Sessions configuration');
+                // TRANS: Menu item for site administration
                 $this->out->menuItem(common_local_url('sessionsadminpanel'), _('Sessions'),
-                                     _('Sessions configuration'), $action_name == 'sessionsadminpanel', 'nav_design_admin_panel');
+                                     $menu_title, $action_name == 'sessionsadminpanel', 'nav_sessions_admin_panel');
+            }
+
+            if (AdminPanelAction::canAdmin('sitenotice')) {
+                // TRANS: Menu item title/tooltip
+                $menu_title = _('Edit site notice');
+                // TRANS: Menu item for site administration
+                $this->out->menuItem(common_local_url('sitenoticeadminpanel'), _('Site notice'),
+                                     $menu_title, $action_name == 'sitenoticeadminpanel', 'nav_sitenotice_admin_panel');
+            }
+
+            if (AdminPanelAction::canAdmin('snapshot')) {
+                // TRANS: Menu item title/tooltip
+                $menu_title = _('Snapshots configuration');
+                // TRANS: Menu item for site administration
+                $this->out->menuItem(common_local_url('snapshotadminpanel'), _('Snapshots'),
+                                     $menu_title, $action_name == 'snapshotadminpanel', 'nav_snapshot_admin_panel');
             }
 
             Event::handle('EndAdminPanelNav', array($this));
@@ -342,8 +412,4 @@ class AdminPanelNav extends Widget
         $this->action->elementEnd('ul');
     }
 
-    function canAdmin($name)
-    {
-        return in_array($name, common_config('admin', 'panels'));
-    }
 }
diff --git a/lib/api.php b/lib/apiaction.php
index 26977c90f..e4a1df3d1 100644
--- a/lib/api.php
+++ b/lib/apiaction.php
@@ -63,7 +63,6 @@ class ApiAction extends Action
     var $count     = null;
     var $max_id    = null;
     var $since_id  = null;
-    var $since     = null;
 
     var $access    = self::READ_ONLY;  // read (default) or read-write
 
@@ -85,7 +84,10 @@ class ApiAction extends Action
         $this->count    = (int)$this->arg('count', 20);
         $this->max_id   = (int)$this->arg('max_id', 0);
         $this->since_id = (int)$this->arg('since_id', 0);
-        $this->since    = $this->arg('since');
+
+        if ($this->arg('since')) {
+            header('X-StatusNet-Warning: since parameter is disabled; use since_id');
+        }
 
         return true;
     }
@@ -1219,7 +1221,12 @@ class ApiAction extends Action
                 return User_group::staticGet($this->arg('id'));
             } else if ($this->arg('id')) {
                 $nickname = common_canonical_nickname($this->arg('id'));
-                return User_group::staticGet('nickname', $nickname);
+                $local = Local_group::staticGet('nickname', $nickname);
+                if (empty($local)) {
+                    return null;
+                } else {
+                    return User_group::staticGet('id', $local->id);
+                }
             } else if ($this->arg('group_id')) {
                 // This is to ensure that a non-numeric user_id still
                 // overrides screen_name even if it doesn't get used
@@ -1228,14 +1235,24 @@ class ApiAction extends Action
                 }
             } else if ($this->arg('group_name')) {
                 $nickname = common_canonical_nickname($this->arg('group_name'));
-                return User_group::staticGet('nickname', $nickname);
+                $local = Local_group::staticGet('nickname', $nickname);
+                if (empty($local)) {
+                    return null;
+                } else {
+                    return User_group::staticGet('id', $local->id);
+                }
             }
 
         } else if (is_numeric($id)) {
             return User_group::staticGet($id);
         } else {
             $nickname = common_canonical_nickname($id);
-            return User_group::staticGet('nickname', $nickname);
+            $local = Local_group::staticGet('nickname', $nickname);
+            if (empty($local)) {
+                return null;
+            } else {
+                return User_group::staticGet('id', $local->group_id);
+            }
         }
     }
 
@@ -1311,8 +1328,6 @@ class ApiAction extends Action
             case 'max_id':
                 $max_id = (int)$this->args['max_id'];
                 return ($max_id < 1) ? 0 : $max_id;
-            case 'since':
-                return strtotime($this->args['since']);
             default:
                 return parent::arg($key, $def);
             }
diff --git a/lib/apiauth.php b/lib/apiauth.php
index 25e2196cf..5090871cf 100644
--- a/lib/apiauth.php
+++ b/lib/apiauth.php
@@ -38,7 +38,6 @@ if (!defined('STATUSNET')) {
     exit(1);
 }
 
-require_once INSTALLDIR . '/lib/api.php';
 require_once INSTALLDIR . '/lib/apioauth.php';
 
 /**
diff --git a/lib/atom10entry.php b/lib/atom10entry.php
deleted file mode 100644
index f8f16d594..000000000
--- a/lib/atom10entry.php
+++ /dev/null
@@ -1,105 +0,0 @@
-<?php
-/**
- * StatusNet, the distributed open-source microblogging tool
- *
- * Class for building / manipulating an Atom entry in memory
- *
- * PHP version 5
- *
- * LICENCE: This program is free software: you can redistribute it and/or modify
- * it under the terms of the GNU Affero General Public License as published by
- * the Free Software Foundation, either version 3 of the License, or
- * (at your option) any later version.
- *
- * This program is distributed in the hope that it will be useful,
- * but WITHOUT ANY WARRANTY; without even the implied warranty of
- * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
- * GNU Affero General Public License for more details.
- *
- * You should have received a copy of the GNU Affero General Public License
- * along with this program.  If not, see <http://www.gnu.org/licenses/>.
- *
- * @category  Feed
- * @package   StatusNet
- * @author    Zach Copley <zach@status.net>
- * @copyright 2010 StatusNet, Inc.
- * @license   http://www.fsf.org/licensing/licenses/agpl-3.0.html GNU Affero General Public License version 3.0
- * @link      http://status.net/
- */
-
-if (!defined('STATUSNET')) {
-    exit(1);
-}
-
-class Atom10EntryException extends Exception
-{
-}
-
-/**
- * Class for manipulating an Atom entry in memory. Get the entry as an XML
- * string with Atom10Entry::getString().
- *
- * @category Feed
- * @package  StatusNet
- * @author   Zach Copley <zach@status.net>
- * @license  http://www.fsf.org/licensing/licenses/agpl-3.0.html GNU Affero General Public License version 3.0
- * @link     http://status.net/
- */
-class Atom10Entry extends XMLStringer
-{
-    private $namespaces;
-    private $categories;
-    private $content;
-    private $contributors;
-    private $id;
-    private $links;
-    private $published;
-    private $rights;
-    private $source;
-    private $summary;
-    private $title;
-
-    function __construct($indent = true) {
-        parent::__construct($indent);
-        $this->namespaces = array();
-    }
-
-    function addNamespace($namespace, $uri)
-    {
-        $ns = array($namespace => $uri);
-        $this->namespaces = array_merge($this->namespaces, $ns);
-    }
-
-    function initEntry()
-    {
-
-    }
-
-    function endEntry()
-    {
-
-    }
-
-    /**
-     * Check that all required elements have been set, etc.
-     * Throws an Atom10EntryException if something's missing.
-     *
-     * @return void
-     */
-    function validate()
-    {
-
-    }
-
-    function getString()
-    {
-        $this->validate();
-
-        $this->initEntry();
-        $this->renderEntries();
-        $this->endEntry();
-
-        return $this->xw->outputMemory();
-    }
-
-}
\ No newline at end of file
diff --git a/lib/atom10feed.php b/lib/atom10feed.php
index 8842840d5..2d342e785 100644
--- a/lib/atom10feed.php
+++ b/lib/atom10feed.php
@@ -49,6 +49,8 @@ class Atom10FeedException extends Exception
 class Atom10Feed extends XMLStringer
 {
     public  $xw;
+
+    // @fixme most of these should probably be read-only properties
     private $namespaces;
     private $authors;
     private $subject;
@@ -57,10 +59,12 @@ class Atom10Feed extends XMLStringer
     private $generator;
     private $icon;
     private $links;
-    private $logo;
+    private $selfLink;
+    private $selfLinkType;
+    public $logo;
     private $rights;
-    private $subtitle;
-    private $title;
+    public $subtitle;
+    public $title;
     private $published;
     private $updated;
     private $entries;
@@ -172,6 +176,14 @@ class Atom10Feed extends XMLStringer
         }
         $this->elementStart('feed', $commonAttrs);
 
+        $this->element(
+            'generator', array(
+                'url'     => 'http://status.net',
+                'version' => STATUSNET_VERSION
+            ),
+            'StatusNet'
+        );
+
         $this->element('id', null, $this->id);
         $this->element('title', null, $this->title);
         $this->element('subtitle', null, $this->subtitle);
@@ -184,6 +196,10 @@ class Atom10Feed extends XMLStringer
 
         $this->renderAuthors();
 
+        if ($this->selfLink) {
+            $this->addLink($this->selfLink, array('rel' => 'self',
+                                                  'type' => $this->selfLinkType));
+        }
         $this->renderLinks();
     }
 
@@ -253,6 +269,12 @@ class Atom10Feed extends XMLStringer
         $this->id = $id;
     }
 
+    function setSelfLink($url, $type='application/atom+xml')
+    {
+        $this->selfLink = $url;
+        $this->selfLinkType = $type;
+    }
+
     function setTitle($title)
     {
         $this->title = $title;
diff --git a/lib/atomgroupnoticefeed.php b/lib/atomgroupnoticefeed.php
index 52ee4c7d6..08c1c707c 100644
--- a/lib/atomgroupnoticefeed.php
+++ b/lib/atomgroupnoticefeed.php
@@ -49,14 +49,42 @@ class AtomGroupNoticeFeed extends AtomNoticeFeed
     /**
      * Constructor
      *
-     * @param Group   $group   the group for the feed (optional)
+     * @param Group   $group   the group for the feed
      * @param boolean $indent  flag to turn indenting on or off
      *
      * @return void
      */
-    function __construct($group = null, $indent = true) {
+    function __construct($group, $indent = true) {
         parent::__construct($indent);
         $this->group = $group;
+
+        $title      = sprintf(_("%s timeline"), $group->nickname);
+        $this->setTitle($title);
+
+        $sitename   = common_config('site', 'name');
+        $subtitle   = sprintf(
+            _('Updates from %1$s on %2$s!'),
+            $group->nickname,
+            $sitename
+        );
+        $this->setSubtitle($subtitle);
+
+        $avatar = $group->homepage_logo;
+        $logo = ($avatar) ? $avatar : User_group::defaultLogo(AVATAR_PROFILE_SIZE);
+        $this->setLogo($logo);
+
+        $this->setUpdated('now');
+
+        $self = common_local_url('ApiTimelineGroup',
+                                 array('id' => $group->id,
+                                       'format' => 'atom'));
+        $this->setId($self);
+        $this->setSelfLink($self);
+
+        $this->addAuthorRaw($group->asAtomAuthor());
+        $this->setActivitySubject($group->asActivitySubject());
+
+        $this->addLink($group->homeUrl());
     }
 
     function getGroup()
diff --git a/lib/atomnoticefeed.php b/lib/atomnoticefeed.php
index d2bf2a416..e4df731fe 100644
--- a/lib/atomnoticefeed.php
+++ b/lib/atomnoticefeed.php
@@ -65,6 +65,11 @@ class AtomNoticeFeed extends Atom10Feed
         );
 
         $this->addNamespace(
+            'media',
+            'http://purl.org/syndication/atommedia'
+        );
+
+        $this->addNamespace(
             'poco',
             'http://portablecontacts.net/spec/1.0'
         );
@@ -102,9 +107,19 @@ class AtomNoticeFeed extends Atom10Feed
      */
     function addEntryFromNotice($notice)
     {
-        $this->addEntryRaw($notice->asAtomEntry());
-    }
+        $source = $this->showSource();
+        $author = $this->showAuthor();
 
-}
+        $this->addEntryRaw($notice->asAtomEntry(false, $source, $author));
+    }
 
+    function showSource()
+    {
+        return true;
+    }
 
+    function showAuthor()
+    {
+        return true;
+    }
+}
diff --git a/lib/atomusernoticefeed.php b/lib/atomusernoticefeed.php
index 2ad8de455..428cc2de2 100644
--- a/lib/atomusernoticefeed.php
+++ b/lib/atomusernoticefeed.php
@@ -49,23 +49,71 @@ class AtomUserNoticeFeed extends AtomNoticeFeed
     /**
      * Constructor
      *
-     * @param User    $user    the user for the feed (optional)
+     * @param User    $user    the user for the feed
      * @param boolean $indent  flag to turn indenting on or off
      *
      * @return void
      */
 
-    function __construct($user = null, $indent = true) {
+    function __construct($user, $indent = true) {
         parent::__construct($indent);
         $this->user = $user;
         if (!empty($user)) {
             $profile = $user->getProfile();
             $this->addAuthor($profile->nickname, $user->uri);
+            $this->setActivitySubject($profile->asActivityNoun('subject'));
         }
+
+        $title      = sprintf(_("%s timeline"), $user->nickname);
+        $this->setTitle($title);
+
+        $sitename   = common_config('site', 'name');
+        $subtitle   = sprintf(
+            _('Updates from %1$s on %2$s!'),
+            $user->nickname, $sitename
+        );
+        $this->setSubtitle($subtitle);
+
+        $avatar = $profile->getAvatar(AVATAR_PROFILE_SIZE);
+        $logo = ($avatar) ? $avatar->displayUrl() : Avatar::defaultImage(AVATAR_PROFILE_SIZE);
+        $this->setLogo($logo);
+
+        $this->setUpdated('now');
+
+        $this->addLink(
+            common_local_url(
+                'showstream',
+                array('nickname' => $user->nickname)
+            )
+        );
+        
+        $self = common_local_url('ApiTimelineUser',
+                                 array('id' => $user->id,
+                                       'format' => 'atom'));
+        $this->setId($self);
+        $this->setSelfLink($self);
+
+        $this->addLink(
+            common_local_url('sup', null, null, $user->id),
+            array(
+                'rel' => 'http://api.friendfeed.com/2008/03#sup',
+                'type' => 'application/json'
+            )
+        );
     }
 
     function getUser()
     {
         return $this->user;
     }
+
+    function showSource()
+    {
+        return false;
+    }
+
+    function showAuthor()
+    {
+        return false;
+    }
 }
diff --git a/lib/authenticationplugin.php b/lib/authenticationplugin.php
index 5be3ea5b9..0a3763e2e 100644
--- a/lib/authenticationplugin.php
+++ b/lib/authenticationplugin.php
@@ -79,7 +79,7 @@ abstract class AuthenticationPlugin extends Plugin
             $nickname = $username;
         }
         $registration_data = array();
-        $registration_data['nickname'] = $nickname ;
+        $registration_data['nickname'] = $nickname;
         return User::register($registration_data);
     }
 
@@ -101,12 +101,14 @@ abstract class AuthenticationPlugin extends Plugin
     * Used during autoregistration
     * Useful if your usernames are ugly, and you want to suggest
     * nice looking nicknames when users initially sign on
+    * All nicknames returned by this function should be valid
+    *  implementations may want to use common_nicknamize() to ensure validity
     * @param username
     * @return string nickname
     */
     function suggestNicknameForUsername($username)
     {
-        return $username;
+        return common_nicknamize($username);
     }
 
     //------------Below are the methods that connect StatusNet to the implementing Auth plugin------------\\
@@ -129,7 +131,7 @@ abstract class AuthenticationPlugin extends Plugin
             $test_user = User::staticGet('nickname', $suggested_nickname);
             if($test_user) {
                 //someone already exists with the suggested nickname, so used the passed nickname
-                $suggested_nickname = $nickname;
+                $suggested_nickname = common_nicknamize($nickname);
             }
             $test_user = User::staticGet('nickname', $suggested_nickname);
             if($test_user) {
diff --git a/lib/authorizationplugin.php b/lib/authorizationplugin.php
index 733b0c065..07da9b2d1 100644
--- a/lib/authorizationplugin.php
+++ b/lib/authorizationplugin.php
@@ -85,7 +85,7 @@ abstract class AuthorizationPlugin extends Plugin
     }
 
     function onStartSetApiUser(&$user) {
-        return $this->onStartSetUser(&$user);
+        return $this->onStartSetUser($user);
     }
 
     function onStartHasRole($profile, $name, &$has_role) {
diff --git a/lib/common.php b/lib/common.php
index 68723955e..047dc5a7b 100644
--- a/lib/common.php
+++ b/lib/common.php
@@ -22,7 +22,7 @@ if (!defined('STATUSNET') && !defined('LACONICA')) { exit(1); }
 //exit with 200 response, if this is checking fancy from the installer
 if (isset($_REQUEST['p']) && $_REQUEST['p'] == 'check-fancy') {  exit; }
 
-define('STATUSNET_VERSION', '0.9.0beta5');
+define('STATUSNET_VERSION', '0.9.0');
 define('LACONICA_VERSION', STATUSNET_VERSION); // compatibility
 
 define('STATUSNET_CODENAME', 'Stand');
@@ -71,6 +71,7 @@ if (!function_exists('dl')) {
 # global configuration object
 
 require_once('PEAR.php');
+require_once('PEAR/Exception.php');
 require_once('DB/DataObject.php');
 require_once('DB/DataObject/Cast.php'); # for dates
 
@@ -128,6 +129,17 @@ require_once INSTALLDIR.'/lib/activity.php';
 require_once INSTALLDIR.'/lib/clientexception.php';
 require_once INSTALLDIR.'/lib/serverexception.php';
 
+
+//set PEAR error handling to use regular PHP exceptions
+function PEAR_ErrorToPEAR_Exception($err)
+{
+    if ($err->getCode()) {
+        throw new PEAR_Exception($err->getMessage(), $err->getCode());
+    }
+    throw new PEAR_Exception($err->getMessage());
+}
+PEAR::setErrorHandling(PEAR_ERROR_CALLBACK, 'PEAR_ErrorToPEAR_Exception');
+
 try {
     StatusNet::init(@$server, @$path, @$conffile);
 } catch (NoConfigException $e) {
diff --git a/lib/default.php b/lib/default.php
index 70e00ea75..f22d8b24a 100644
--- a/lib/default.php
+++ b/lib/default.php
@@ -40,7 +40,8 @@ $default =
               'logdebug' => false,
               'fancy' => false,
               'locale_path' => INSTALLDIR.'/locale',
-              'language' => 'en_US',
+              'language' => 'en',
+              'langdetect' => true,
               'languages' => get_all_languages(),
               'email' =>
               array_key_exists('SERVER_ADMIN', $_SERVER) ? $_SERVER['SERVER_ADMIN'] : null,
@@ -53,10 +54,11 @@ $default =
               'ssl' => 'never',
               'sslserver' => null,
               'shorturllength' => 30,
-              'dupelimit' => 60, # default for same person saying the same thing
+              'dupelimit' => 60, // default for same person saying the same thing
               'textlimit' => 140,
               'indent' => true,
-              'use_x_sendfile' => false
+              'use_x_sendfile' => false,
+              'notice' => null // site wide notice text
               ),
         'db' =>
         array('database' => 'YOU HAVE TO SET THIS IN config.php',
@@ -177,8 +179,8 @@ $default =
         array('source' => 'StatusNet', # source attribute for Twitter
               'taguri' => null), # base for tag URIs
         'twitter' =>
-        array('enabled'       => true,
-              'consumer_key'    => null,
+        array('signin' => true,
+              'consumer_key' => null,
               'consumer_secret' => null),
         'cache' =>
         array('base' => null),
@@ -278,13 +280,13 @@ $default =
                                  'TightUrl' => array('shortenerName' => '2tu.us', 'freeService' => true,'serviceUrl'=>'http://2tu.us/?save=y&url=%1$s'),
                                  'Geonames' => null,
                                  'Mapstraction' => null,
-                                 'Linkback' => null,
+                                 'OStatus' => null,
                                  'WikiHashtags' => null,
                                  'RSSCloud' => null,
                                  'OpenID' => null),
               ),
         'admin' =>
-        array('panels' => array('design', 'site', 'user', 'paths', 'access', 'sessions')),
+        array('panels' => array('design', 'site', 'user', 'paths', 'access', 'sessions', 'sitenotice')),
         'singleuser' =>
         array('enabled' => false,
               'nickname' => null),
diff --git a/lib/distribqueuehandler.php b/lib/distribqueuehandler.php
index dc183fb36..d2be7a92c 100644
--- a/lib/distribqueuehandler.php
+++ b/lib/distribqueuehandler.php
@@ -63,24 +63,12 @@ class DistribQueueHandler
         // XXX: do we need to change this for remote users?
 
         try {
-            $notice->saveTags();
-        } catch (Exception $e) {
-            $this->logit($notice, $e);
-        }
-
-        try {
             $notice->addToInboxes();
         } catch (Exception $e) {
             $this->logit($notice, $e);
         }
 
         try {
-            $notice->saveUrls();
-        } catch (Exception $e) {
-            $this->logit($notice, $e);
-        }
-
-        try {
             Event::handle('EndNoticeSave', array($notice));
             // Enqueue for other handlers
         } catch (Exception $e) {
diff --git a/lib/grantroleform.php b/lib/grantroleform.php
new file mode 100644
index 000000000..b5f952746
--- /dev/null
+++ b/lib/grantroleform.php
@@ -0,0 +1,93 @@
+<?php
+/**
+ * StatusNet, the distributed open-source microblogging tool
+ *
+ * Form for granting a role
+ *
+ * PHP version 5
+ *
+ * LICENCE: This program is free software: you can redistribute it and/or modify
+ * it under the terms of the GNU Affero General Public License as published by
+ * the Free Software Foundation, either version 3 of the License, or
+ * (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU Affero General Public License for more details.
+ *
+ * You should have received a copy of the GNU Affero General Public License
+ * along with this program.  If not, see <http://www.gnu.org/licenses/>.
+ *
+ * @category  Form
+ * @package   StatusNet
+ * @author    Evan Prodromou <evan@status.net>, Brion Vibber <brion@status.net>
+ * @copyright 2009-2010 StatusNet, Inc.
+ * @license   http://www.fsf.org/licensing/licenses/agpl-3.0.html GNU Affero General Public License version 3.0
+ * @link      http://status.net/
+ */
+
+if (!defined('STATUSNET')) {
+    exit(1);
+}
+
+/**
+ * Form for sandboxing a user
+ *
+ * @category Form
+ * @package  StatusNet
+ * @author   Evan Prodromou <evan@status.net>
+ * @license  http://www.fsf.org/licensing/licenses/agpl-3.0.html GNU Affero General Public License version 3.0
+ * @link     http://status.net/
+ *
+ * @see      UnSandboxForm
+ */
+
+class GrantRoleForm extends ProfileActionForm
+{
+    function __construct($role, $label, $writer, $profile, $r2args)
+    {
+        parent::__construct($writer, $profile, $r2args);
+        $this->role = $role;
+        $this->label = $label;
+    }
+
+    /**
+     * Action this form provides
+     *
+     * @return string Name of the action, lowercased.
+     */
+
+    function target()
+    {
+        return 'grantrole';
+    }
+
+    /**
+     * Title of the form
+     *
+     * @return string Title of the form, internationalized
+     */
+
+    function title()
+    {
+        return $this->label;
+    }
+
+    function formData()
+    {
+        parent::formData();
+        $this->out->hidden('role', $this->role);
+    }
+
+    /**
+     * Description of the form
+     *
+     * @return string description of the form, internationalized
+     */
+
+    function description()
+    {
+        return sprintf(_('Grant this user the "%s" role'), $this->label);
+    }
+}
diff --git a/lib/imagefile.php b/lib/imagefile.php
index 6bc8e599b..7b0479455 100644
--- a/lib/imagefile.php
+++ b/lib/imagefile.php
@@ -99,6 +99,10 @@ class ImageFile
 
         if ($info[2] !== IMAGETYPE_GIF &&
             $info[2] !== IMAGETYPE_JPEG &&
+            $info[2] !== IMAGETYPE_BMP &&
+            $info[2] !== IMAGETYPE_WBMP &&
+            $info[2] !== IMAGETYPE_XBM &&
+            $info[2] !== IMAGETYPE_XPM &&
             $info[2] !== IMAGETYPE_PNG) {
 
             @unlink($_FILES[$param]['tmp_name']);
@@ -146,6 +150,18 @@ class ImageFile
          case IMAGETYPE_PNG:
             $image_src = imagecreatefrompng($this->filepath);
             break;
+         case IMAGETYPE_BMP:
+            $image_src = imagecreatefrombmp($this->filepath);
+            break;
+         case IMAGETYPE_WBMP:
+            $image_src = imagecreatefromwbmp($this->filepath);
+            break;
+         case IMAGETYPE_XBM:
+            $image_src = imagecreatefromxbm($this->filepath);
+            break;
+         case IMAGETYPE_XPM:
+            $image_src = imagecreatefromxpm($this->filepath);
+            break;
          default:
             throw new Exception(_('Unknown file type'));
             return;
@@ -153,7 +169,7 @@ class ImageFile
 
         $image_dest = imagecreatetruecolor($size, $size);
 
-        if ($this->type == IMAGETYPE_GIF || $this->type == IMAGETYPE_PNG) {
+        if ($this->type == IMAGETYPE_GIF || $this->type == IMAGETYPE_PNG || $this->type == IMAGETYPE_BMP) {
 
             $transparent_idx = imagecolortransparent($image_src);
 
@@ -176,6 +192,24 @@ class ImageFile
 
         imagecopyresampled($image_dest, $image_src, 0, 0, $x, $y, $size, $size, $w, $h);
 
+        if($this->type == IMAGETYPE_BMP) {
+            //we don't want to save BMP... it's an inefficient, rare, antiquated format
+            //save png instead
+            $this->type = IMAGETYPE_PNG;
+        } else if($this->type == IMAGETYPE_WBMP) {
+            //we don't want to save WBMP... it's a rare format that we can't guarantee clients will support
+            //save png instead
+            $this->type = IMAGETYPE_PNG;
+        } else if($this->type == IMAGETYPE_XBM) {
+            //we don't want to save XBM... it's a rare format that we can't guarantee clients will support
+            //save png instead
+            $this->type = IMAGETYPE_PNG;
+        } else if($this->type == IMAGETYPE_XPM) {
+            //we don't want to save XPM... it's a rare format that we can't guarantee clients will support
+            //save png instead
+            $this->type = IMAGETYPE_PNG;
+        }
+
         $outname = Avatar::filename($this->id,
                                     image_type_to_extension($this->type),
                                     $size,
@@ -245,4 +279,101 @@ class ImageFile
 
         return $num;
     }
-}
\ No newline at end of file
+}
+
+//PHP doesn't (as of 2/24/2010) have an imagecreatefrombmp so conditionally define one
+if(!function_exists('imagecreatefrombmp')){
+    //taken shamelessly from http://www.php.net/manual/en/function.imagecreatefromwbmp.php#86214
+    function imagecreatefrombmp($p_sFile)
+    {
+        //    Load the image into a string
+        $file    =    fopen($p_sFile,"rb");
+        $read    =    fread($file,10);
+        while(!feof($file)&&($read<>""))
+            $read    .=    fread($file,1024);
+
+        $temp    =    unpack("H*",$read);
+        $hex    =    $temp[1];
+        $header    =    substr($hex,0,108);
+
+        //    Process the header
+        //    Structure: http://www.fastgraph.com/help/bmp_header_format.html
+        if (substr($header,0,4)=="424d")
+        {
+            //    Cut it in parts of 2 bytes
+            $header_parts    =    str_split($header,2);
+
+            //    Get the width        4 bytes
+            $width            =    hexdec($header_parts[19].$header_parts[18]);
+
+            //    Get the height        4 bytes
+            $height            =    hexdec($header_parts[23].$header_parts[22]);
+
+            //    Unset the header params
+            unset($header_parts);
+        }
+
+        //    Define starting X and Y
+        $x                =    0;
+        $y                =    1;
+
+        //    Create newimage
+        $image            =    imagecreatetruecolor($width,$height);
+
+        //    Grab the body from the image
+        $body            =    substr($hex,108);
+
+        //    Calculate if padding at the end-line is needed
+        //    Divided by two to keep overview.
+        //    1 byte = 2 HEX-chars
+        $body_size        =    (strlen($body)/2);
+        $header_size    =    ($width*$height);
+
+        //    Use end-line padding? Only when needed
+        $usePadding        =    ($body_size>($header_size*3)+4);
+
+        //    Using a for-loop with index-calculation instaid of str_split to avoid large memory consumption
+        //    Calculate the next DWORD-position in the body
+        for ($i=0;$i<$body_size;$i+=3)
+        {
+            //    Calculate line-ending and padding
+            if ($x>=$width)
+            {
+                //    If padding needed, ignore image-padding
+                //    Shift i to the ending of the current 32-bit-block
+                if ($usePadding)
+                    $i    +=    $width%4;
+
+                //    Reset horizontal position
+                $x    =    0;
+
+                //    Raise the height-position (bottom-up)
+                $y++;
+
+                //    Reached the image-height? Break the for-loop
+                if ($y>$height)
+                    break;
+            }
+
+            //    Calculation of the RGB-pixel (defined as BGR in image-data)
+            //    Define $i_pos as absolute position in the body
+            $i_pos    =    $i*2;
+            $r        =    hexdec($body[$i_pos+4].$body[$i_pos+5]);
+            $g        =    hexdec($body[$i_pos+2].$body[$i_pos+3]);
+            $b        =    hexdec($body[$i_pos].$body[$i_pos+1]);
+
+            //    Calculate and draw the pixel
+            $color    =    imagecolorallocate($image,$r,$g,$b);
+            imagesetpixel($image,$x,$height-$y,$color);
+
+            //    Raise the horizontal position
+            $x++;
+        }
+
+        //    Unset the body / free the memory
+        unset($body);
+
+        //    Return image-object
+        return $image;
+    }
+}
diff --git a/lib/joinform.php b/lib/joinform.php
index aefb553aa..aa8bc20e2 100644
--- a/lib/joinform.php
+++ b/lib/joinform.php
@@ -100,7 +100,7 @@ class JoinForm extends Form
     function action()
     {
         return common_local_url('joingroup',
-                                array('nickname' => $this->group->nickname));
+                                array('id' => $this->group->id));
     }
 
     /**
diff --git a/lib/language.php b/lib/language.php
index f5ee7fac5..64b59e739 100644
--- a/lib/language.php
+++ b/lib/language.php
@@ -289,6 +289,7 @@ function get_all_languages() {
         'ar'      => array('q' => 0.8, 'lang' => 'ar', 'name' => 'Arabic', 'direction' => 'rtl'),
         'arz'     => array('q' => 0.8, 'lang' => 'arz', 'name' => 'Egyptian Spoken Arabic', 'direction' => 'rtl'),
         'bg'      => array('q' => 0.8, 'lang' => 'bg', 'name' => 'Bulgarian', 'direction' => 'ltr'),
+        'br'      => array('q' => 0.8, 'lang' => 'br', 'name' => 'Breton', 'direction' => 'ltr'),
         'ca'      => array('q' => 0.5, 'lang' => 'ca', 'name' => 'Catalan', 'direction' => 'ltr'),
         'cs'      => array('q' => 0.5, 'lang' => 'cs', 'name' => 'Czech', 'direction' => 'ltr'),
         'de'      => array('q' => 0.8, 'lang' => 'de', 'name' => 'German', 'direction' => 'ltr'),
diff --git a/lib/leaveform.php b/lib/leaveform.php
index e63d96ee8..5469b5704 100644
--- a/lib/leaveform.php
+++ b/lib/leaveform.php
@@ -100,7 +100,7 @@ class LeaveForm extends Form
     function action()
     {
         return common_local_url('leavegroup',
-                                array('nickname' => $this->group->nickname));
+                                array('id' => $this->group->id));
     }
 
     /**
diff --git a/lib/mail.php b/lib/mail.php
index c724764cc..807b6a363 100644
--- a/lib/mail.php
+++ b/lib/mail.php
@@ -133,12 +133,13 @@ function mail_notify_from()
  * @param User   &$user   user to send email to
  * @param string $subject subject of the email
  * @param string $body    body of the email
+ * @param array  $headers optional list of email headers
  * @param string $address optional specification of email address
  *
  * @return boolean success flag
  */
 
-function mail_to_user(&$user, $subject, $body, $address=null)
+function mail_to_user(&$user, $subject, $body, $headers=array(), $address=null)
 {
     if (!$address) {
         $address = $user->email;
@@ -180,7 +181,9 @@ function mail_confirm_address($user, $code, $nickname, $address)
                     $nickname, common_config('site', 'name'),
                     common_local_url('confirmaddress', array('code' => $code)),
                     common_config('site', 'name'));
-    return mail_to_user($user, $subject, $body, $address);
+    $headers = array();
+
+    return mail_to_user($user, $subject, $body, $headers, $address);
 }
 
 /**
@@ -231,6 +234,7 @@ function mail_subscribe_notify_profile($listenee, $other)
 
         $recipients = $listenee->email;
 
+        $headers = _mail_prepare_headers('subscribe', $listenee->nickname, $other->nickname);
         $headers['From']    = mail_notify_from();
         $headers['To']      = $name . ' <' . $listenee->email . '>';
         $headers['Subject'] = sprintf(_('%1$s is now listening to '.
@@ -476,7 +480,10 @@ function mail_notify_nudge($from, $to)
                     common_local_url('all', array('nickname' => $to->nickname)),
                     common_config('site', 'name'));
     common_init_locale();
-    return mail_to_user($to, $subject, $body);
+
+    $headers = _mail_prepare_headers('nudge', $to->nickname, $from->nickname);
+
+    return mail_to_user($to, $subject, $body, $headers);
 }
 
 /**
@@ -526,8 +533,10 @@ function mail_notify_message($message, $from=null, $to=null)
                     common_local_url('newmessage', array('to' => $from->id)),
                     common_config('site', 'name'));
 
+    $headers = _mail_prepare_headers('message', $to->nickname, $from->nickname);
+
     common_init_locale();
-    return mail_to_user($to, $subject, $body);
+    return mail_to_user($to, $subject, $body, $headers);
 }
 
 /**
@@ -578,8 +587,10 @@ function mail_notify_fave($other, $user, $notice)
                     common_config('site', 'name'),
                     $user->nickname);
 
+    $headers = _mail_prepare_headers('fave', $other->nickname, $user->nickname);
+
     common_init_locale();
-    mail_to_user($other, $subject, $body);
+    mail_to_user($other, $subject, $body, $headers);
 }
 
 /**
@@ -611,19 +622,19 @@ function mail_notify_attn($user, $notice)
 
     common_init_locale($user->language);
 
-	if ($notice->conversation != $notice->id) {
-		$conversationEmailText = "The full conversation can be read here:\n\n".
-								 "\t%5\$s\n\n ";
-		$conversationUrl 	   = common_local_url('conversation',
+        if ($notice->conversation != $notice->id) {
+                $conversationEmailText = "The full conversation can be read here:\n\n".
+                                                                 "\t%5\$s\n\n ";
+                $conversationUrl            = common_local_url('conversation',
                                  array('id' => $notice->conversation)).'#notice-'.$notice->id;
-	} else {
-		$conversationEmailText = "%5\$s";
-		$conversationUrl = null;
-	}
+        } else {
+                $conversationEmailText = "%5\$s";
+                $conversationUrl = null;
+        }
 
     $subject = sprintf(_('%s (@%s) sent a notice to your attention'), $bestname, $sender->nickname);
 
-	$body = sprintf(_("%1\$s (@%9\$s) just sent a notice to your attention (an '@-reply') on %2\$s.\n\n".
+        $body = sprintf(_("%1\$s (@%9\$s) just sent a notice to your attention (an '@-reply') on %2\$s.\n\n".
                       "The notice is here:\n\n".
                       "\t%3\$s\n\n" .
                       "It reads:\n\n".
@@ -641,7 +652,7 @@ function mail_notify_attn($user, $notice)
                     common_local_url('shownotice',
                                      array('notice' => $notice->id)),//%3
                     $notice->content,//%4
-					$conversationUrl,//%5
+                                        $conversationUrl,//%5
                     common_local_url('newnotice',
                                      array('replyto' => $sender->nickname, 'inreplyto' => $notice->id)),//%6
                     common_local_url('replies',
@@ -649,6 +660,30 @@ function mail_notify_attn($user, $notice)
                     common_local_url('emailsettings'), //%8
                     $sender->nickname); //%9
 
+    $headers = _mail_prepare_headers('mention', $user->nickname, $sender->nickname);
+
     common_init_locale();
-    mail_to_user($user, $subject, $body);
+    mail_to_user($user, $subject, $body, $headers);
 }
+
+/**
+ * Prepare the common mail headers used in notification emails
+ *
+ * @param string $msg_type type of message being sent to the user
+ * @param string $to       nickname of the receipient
+ * @param string $from     nickname of the user triggering the notification
+ *
+ * @return array list of mail headers to include in the message
+ */
+function _mail_prepare_headers($msg_type, $to, $from)
+{
+    $headers = array(
+        'X-StatusNet-MessageType' => $msg_type,
+        'X-StatusNet-TargetUser'  => $to,
+        'X-StatusNet-SourceUser'  => $from,
+        'X-StatusNet-Domain'      => common_config('site', 'server')
+    );
+
+    return $headers;
+}
+
diff --git a/lib/mediafile.php b/lib/mediafile.php
index e3d5b1dbc..10d90d008 100644
--- a/lib/mediafile.php
+++ b/lib/mediafile.php
@@ -262,7 +262,7 @@ class MediaFile
             $filetype = MIME_Type::autoDetect($stream['uri']);
         }
 
-        if (in_array($filetype, common_config('attachments', 'supported'))) {
+        if (common_config('attachments', 'supported') === true || in_array($filetype, common_config('attachments', 'supported'))) {
             return $filetype;
         }
         $media = MIME_Type::getMedia($filetype);
diff --git a/lib/messageform.php b/lib/messageform.php
index 0c568e1bd..b116964da 100644
--- a/lib/messageform.php
+++ b/lib/messageform.php
@@ -175,6 +175,6 @@ class MessageForm extends Form
                                            'class' => 'submit',
                                            'name' => 'message_send',
                                            'type' => 'submit',
-                                           'value' => _('Send')));
+                                           'value' => _m('Send button for sending notice', 'Send')));
     }
 }
diff --git a/lib/noticeform.php b/lib/noticeform.php
index 62df5c941..7278c41a9 100644
--- a/lib/noticeform.php
+++ b/lib/noticeform.php
@@ -233,6 +233,6 @@ class NoticeForm extends Form
                                            'class' => 'submit',
                                            'name' => 'status_submit',
                                            'type' => 'submit',
-                                           'value' => _('Send')));
+                                           'value' => _m('Send button for sending notice', 'Send')));
     }
 }
diff --git a/lib/noticelist.php b/lib/noticelist.php
index 28a563d87..88a925241 100644
--- a/lib/noticelist.php
+++ b/lib/noticelist.php
@@ -540,22 +540,40 @@ class NoticeListItem extends Widget
     function showContext()
     {
         $hasConversation = false;
-        if( !empty($this->notice->conversation)
-            && $this->notice->conversation != $this->notice->id){
-            $hasConversation = true;
-        }else{
-            $conversation = Notice::conversationStream($this->notice->id, 1, 1);
-            if($conversation->N > 0){
+        if (!empty($this->notice->conversation)) {
+            $conversation = Notice::conversationStream(
+                $this->notice->conversation,
+                1,
+                1
+            );
+            if ($conversation->N > 0) {
                 $hasConversation = true;
             }
         }
-        if ($hasConversation){
-            $this->out->text(' ');
-            $convurl = common_local_url('conversation',
-                                         array('id' => $this->notice->conversation));
-            $this->out->element('a', array('href' => $convurl.'#notice-'.$this->notice->id,
-                                           'class' => 'response'),
-                                _('in context'));
+        if ($hasConversation) {
+            $conv = Conversation::staticGet(
+                'id',
+                $this->notice->conversation
+            );
+            $convurl = $conv->uri;
+            if (!empty($convurl)) {
+                $this->out->text(' ');
+                $this->out->element(
+                    'a',
+                    array(
+                    'href' => $convurl.'#notice-'.$this->notice->id,
+                    'class' => 'response'),
+                    _('in context')
+                );
+            } else {
+                $msg = sprintf(
+                    "Couldn't find Conversation ID %d to make 'in context'"
+                    . "link for Notice ID %d",
+                    $this->notice->conversation,
+                    $this->notice->id
+                );
+                common_log(LOG_WARNING, $msg);
+            }
         }
     }
 
diff --git a/lib/oauthstore.php b/lib/oauthstore.php
index eabe37f9f..a6a6de750 100644
--- a/lib/oauthstore.php
+++ b/lib/oauthstore.php
@@ -390,7 +390,7 @@ class StatusNetOAuthDataStore extends OAuthDataStore
         $sub->subscribed = $user->id;
 
         if (!$sub->find(true)) {
-            return 0;
+            return array();
         }
 
         /* Since we do not use OMB_Service_Provider’s action methods, there
diff --git a/lib/omb.php b/lib/omb.php
index 17132a594..db60fa0ef 100644
--- a/lib/omb.php
+++ b/lib/omb.php
@@ -77,7 +77,7 @@ function omb_broadcast_notice($notice)
     /* Get remote users subscribed to this profile. */
     $rp = new Remote_profile();
 
-    $rp->query('SELECT postnoticeurl, token, secret ' .
+    $rp->query('SELECT remote_profile.*, secret, token ' .
                'FROM subscription JOIN remote_profile ' .
                'ON subscription.subscriber = remote_profile.id ' .
                'WHERE subscription.subscribed = ' . $notice->profile_id . ' ');
@@ -93,7 +93,8 @@ function omb_broadcast_notice($notice)
 
         /* Post notice. */
         $service = new StatusNet_OMB_Service_Consumer(
-                     array(OMB_ENDPOINT_POSTNOTICE => $rp->postnoticeurl));
+                     array(OMB_ENDPOINT_POSTNOTICE => $rp->postnoticeurl),
+                                                      $rp->uri);
         try {
             $service->setToken($rp->token, $rp->secret);
             $service->postNotice($omb_notice);
@@ -125,7 +126,7 @@ function omb_broadcast_profile($profile)
     /* Get remote users subscribed to this profile. */
     $rp = new Remote_profile();
 
-    $rp->query('SELECT updateprofileurl, token, secret ' .
+    $rp->query('SELECT remote_profile.*, secret, token ' .
                'FROM subscription JOIN remote_profile ' .
                'ON subscription.subscriber = remote_profile.id ' .
                'WHERE subscription.subscribed = ' . $profile->id . ' ');
@@ -141,7 +142,8 @@ function omb_broadcast_profile($profile)
 
         /* Update profile. */
         $service = new StatusNet_OMB_Service_Consumer(
-                     array(OMB_ENDPOINT_UPDATEPROFILE => $rp->updateprofileurl));
+                     array(OMB_ENDPOINT_UPDATEPROFILE => $rp->updateprofileurl),
+                                                      $rp->uri);
         try {
             $service->setToken($rp->token, $rp->secret);
             $service->updateProfile($omb_profile);
@@ -159,13 +161,14 @@ function omb_broadcast_profile($profile)
 }
 
 class StatusNet_OMB_Service_Consumer extends OMB_Service_Consumer {
-    public function __construct($urls)
+    public function __construct($urls, $listener_uri=null)
     {
         $this->services       = $urls;
         $this->datastore      = omb_oauth_datastore();
         $this->oauth_consumer = omb_oauth_consumer();
         $this->fetcher        = Auth_Yadis_Yadis::getHTTPFetcher();
         $this->fetcher->timeout = intval(common_config('omb', 'timeout'));
+        $this->listener_uri   = $listener_uri;
     }
 
 }
diff --git a/lib/profileaction.php b/lib/profileaction.php
index 2d4d23265..029c21845 100644
--- a/lib/profileaction.php
+++ b/lib/profileaction.php
@@ -105,28 +105,30 @@ class ProfileAction extends OwnerDesignAction
 
         $this->elementStart('div', array('id' => 'entity_subscriptions',
                                          'class' => 'section'));
+        if (Event::handle('StartShowSubscriptionsMiniList', array($this))) {
+            $this->element('h2', null, _('Subscriptions'));
 
-        $this->element('h2', null, _('Subscriptions'));
+            $cnt = 0;
 
-        $cnt = 0;
+            if (!empty($profile)) {
+                $pml = new ProfileMiniList($profile, $this);
+                $cnt = $pml->show();
+                if ($cnt == 0) {
+                    $this->element('p', null, _('(None)'));
+                }
+            }
 
-        if (!empty($profile)) {
-            $pml = new ProfileMiniList($profile, $this);
-            $cnt = $pml->show();
-            if ($cnt == 0) {
-                $this->element('p', null, _('(None)'));
+            if ($cnt > PROFILES_PER_MINILIST) {
+                $this->elementStart('p');
+                $this->element('a', array('href' => common_local_url('subscriptions',
+                                                                     array('nickname' => $this->profile->nickname)),
+                                          'class' => 'more'),
+                               _('All subscriptions'));
+                $this->elementEnd('p');
             }
-        }
 
-        if ($cnt > PROFILES_PER_MINILIST) {
-            $this->elementStart('p');
-            $this->element('a', array('href' => common_local_url('subscriptions',
-                                                                 array('nickname' => $this->profile->nickname)),
-                                      'class' => 'more'),
-                           _('All subscriptions'));
-            $this->elementEnd('p');
+            Event::handle('EndShowSubscriptionsMiniList', array($this));
         }
-
         $this->elementEnd('div');
     }
 
@@ -226,27 +228,29 @@ class ProfileAction extends OwnerDesignAction
 
         $this->elementStart('div', array('id' => 'entity_groups',
                                          'class' => 'section'));
+        if (Event::handle('StartShowGroupsMiniList', array($this))) {
+            $this->element('h2', null, _('Groups'));
+
+            if ($groups) {
+                $gml = new GroupMiniList($groups, $this->user, $this);
+                $cnt = $gml->show();
+                if ($cnt == 0) {
+                    $this->element('p', null, _('(None)'));
+                }
+            }
 
-        $this->element('h2', null, _('Groups'));
-
-        if ($groups) {
-            $gml = new GroupMiniList($groups, $this->user, $this);
-            $cnt = $gml->show();
-            if ($cnt == 0) {
-                $this->element('p', null, _('(None)'));
+            if ($cnt > GROUPS_PER_MINILIST) {
+                $this->elementStart('p');
+                $this->element('a', array('href' => common_local_url('usergroups',
+                                                                     array('nickname' => $this->profile->nickname)),
+                                          'class' => 'more'),
+                               _('All groups'));
+                $this->elementEnd('p');
             }
-        }
 
-        if ($cnt > GROUPS_PER_MINILIST) {
-            $this->elementStart('p');
-            $this->element('a', array('href' => common_local_url('usergroups',
-                                                                 array('nickname' => $this->profile->nickname)),
-                                      'class' => 'more'),
-                           _('All groups'));
-            $this->elementEnd('p');
+            Event::handle('EndShowGroupsMiniList', array($this));
         }
-
-        $this->elementEnd('div');
+            $this->elementEnd('div');
     }
 }
 
diff --git a/lib/profilelist.php b/lib/profilelist.php
index 693cd6449..d970e605a 100644
--- a/lib/profilelist.php
+++ b/lib/profilelist.php
@@ -273,10 +273,9 @@ class ProfileListItem extends Widget
                 $usf = new UnsubscribeForm($this->out, $this->profile);
                 $usf->show();
             } else {
-                // Is it a local user? can't remote sub from a list
-                // XXX: make that possible!
-                $other = User::staticGet('id', $this->profile->id);
-                if (!empty($other)) {
+                // We can't initiate sub for a remote OMB profile.
+                $remote = Remote_profile::staticGet('id', $this->profile->id);
+                if (empty($remote)) {
                     $sf = new SubscribeForm($this->out, $this->profile);
                     $sf->show();
                 }
diff --git a/lib/profilequeuehandler.php b/lib/profilequeuehandler.php
index e8a00aef3..6ce93229b 100644
--- a/lib/profilequeuehandler.php
+++ b/lib/profilequeuehandler.php
@@ -39,7 +39,11 @@ class ProfileQueueHandler extends QueueHandler
 
         if (Event::handle('StartBroadcastProfile', array($profile))) {
             require_once(INSTALLDIR.'/lib/omb.php');
-            omb_broadcast_profile($profile);
+            try {
+                omb_broadcast_profile($profile);
+            } catch (Exception $e) {
+                common_log(LOG_ERR, "Failed sending OMB profiles: " . $e->getMessage());
+            }
         }
         Event::handle('EndBroadcastProfile', array($profile));
         return true;
diff --git a/lib/revokeroleform.php b/lib/revokeroleform.php
new file mode 100644
index 000000000..ec24b9910
--- /dev/null
+++ b/lib/revokeroleform.php
@@ -0,0 +1,93 @@
+<?php
+/**
+ * StatusNet, the distributed open-source microblogging tool
+ *
+ * Form for revoking a role
+ *
+ * PHP version 5
+ *
+ * LICENCE: This program is free software: you can redistribute it and/or modify
+ * it under the terms of the GNU Affero General Public License as published by
+ * the Free Software Foundation, either version 3 of the License, or
+ * (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU Affero General Public License for more details.
+ *
+ * You should have received a copy of the GNU Affero General Public License
+ * along with this program.  If not, see <http://www.gnu.org/licenses/>.
+ *
+ * @category  Form
+ * @package   StatusNet
+ * @author    Evan Prodromou <evan@status.net>, Brion Vibber <brion@status.net>
+ * @copyright 2009-2010 StatusNet, Inc.
+ * @license   http://www.fsf.org/licensing/licenses/agpl-3.0.html GNU Affero General Public License version 3.0
+ * @link      http://status.net/
+ */
+
+if (!defined('STATUSNET')) {
+    exit(1);
+}
+
+/**
+ * Form for sandboxing a user
+ *
+ * @category Form
+ * @package  StatusNet
+ * @author   Evan Prodromou <evan@status.net>
+ * @license  http://www.fsf.org/licensing/licenses/agpl-3.0.html GNU Affero General Public License version 3.0
+ * @link     http://status.net/
+ *
+ * @see      UnSandboxForm
+ */
+
+class RevokeRoleForm extends ProfileActionForm
+{
+    function __construct($role, $label, $writer, $profile, $r2args)
+    {
+        parent::__construct($writer, $profile, $r2args);
+        $this->role = $role;
+        $this->label = $label;
+    }
+
+    /**
+     * Action this form provides
+     *
+     * @return string Name of the action, lowercased.
+     */
+
+    function target()
+    {
+        return 'revokerole';
+    }
+
+    /**
+     * Title of the form
+     *
+     * @return string Title of the form, internationalized
+     */
+
+    function title()
+    {
+        return $this->label;
+    }
+
+    function formData()
+    {
+        parent::formData();
+        $this->out->hidden('role', $this->role);
+    }
+
+    /**
+     * Description of the form
+     *
+     * @return string description of the form, internationalized
+     */
+
+    function description()
+    {
+        return sprintf(_('Revoke the "%s" role from this user'), $this->label);
+    }
+}
diff --git a/lib/right.php b/lib/right.php
index 4e9c5a918..deb451fde 100644
--- a/lib/right.php
+++ b/lib/right.php
@@ -58,5 +58,7 @@ class Right
     const EMAILONSUBSCRIBE   = 'emailonsubscribe';
     const EMAILONFAVE        = 'emailonfave';
     const MAKEGROUPADMIN     = 'makegroupadmin';
+    const GRANTROLE          = 'grantrole';
+    const REVOKEROLE         = 'revokerole';
 }
 
diff --git a/lib/router.php b/lib/router.php
index 987d0152e..706120e0b 100644
--- a/lib/router.php
+++ b/lib/router.php
@@ -98,6 +98,7 @@ class Router
                           'groupblock', 'groupunblock',
                           'sandbox', 'unsandbox',
                           'silence', 'unsilence',
+                          'grantrole', 'revokerole',
                           'repeat',
                           'deleteuser',
                           'geocode',
@@ -247,6 +248,9 @@ class Router
                 $m->connect('group/:nickname/'.$v,
                             array('action' => $v.'group'),
                             array('nickname' => '[a-zA-Z0-9]+'));
+                $m->connect('group/:id/id/'.$v,
+                            array('action' => $v.'group'),
+                            array('id' => '[0-9]+'));
             }
 
             foreach (array('members', 'logo', 'rss', 'designsettings') as $n) {
@@ -646,6 +650,8 @@ class Router
 	        $m->connect('admin/access', array('action' => 'accessadminpanel'));
             $m->connect('admin/paths', array('action' => 'pathsadminpanel'));
             $m->connect('admin/sessions', array('action' => 'sessionsadminpanel'));
+            $m->connect('admin/sitenotice', array('action' => 'sitenoticeadminpanel'));
+            $m->connect('admin/snapshot', array('action' => 'snapshotadminpanel'));
 
             $m->connect('getfile/:filename',
                         array('action' => 'getfile'),
@@ -668,7 +674,7 @@ class Router
 
                 foreach (array('subscriptions', 'subscribers',
                                'all', 'foaf', 'xrds',
-                               'replies', 'microsummary') as $a) {
+                               'replies', 'microsummary', 'hcard') as $a) {
                     $m->connect($a,
                                 array('action' => $a,
                                       'nickname' => $nickname));
@@ -734,7 +740,7 @@ class Router
 
                 foreach (array('subscriptions', 'subscribers',
                                'nudge', 'all', 'foaf', 'xrds',
-                               'replies', 'inbox', 'outbox', 'microsummary') as $a) {
+                               'replies', 'inbox', 'outbox', 'microsummary', 'hcard') as $a) {
                     $m->connect(':nickname/'.$a,
                                 array('action' => $a),
                                 array('nickname' => '[a-zA-Z0-9]{1,64}'));
diff --git a/lib/statusnet.php b/lib/statusnet.php
index 3f9a48e6a..afb8f5af0 100644
--- a/lib/statusnet.php
+++ b/lib/statusnet.php
@@ -341,7 +341,11 @@ class StatusNet
         // Backwards compatibility
         if (array_key_exists('memcached', $config)) {
             if ($config['memcached']['enabled']) {
-                addPlugin('Memcache', array('servers' => $config['memcached']['server']));
+                if(class_exists('Memcached')) {
+                    addPlugin('Memcached', array('servers' => $config['memcached']['server']));
+                } else {
+                    addPlugin('Memcache', array('servers' => $config['memcached']['server']));
+                }
             }
 
             if (!empty($config['memcached']['base'])) {
@@ -368,10 +372,10 @@ class StatusNet
 
 class NoConfigException extends Exception
 {
-    public $config_files;
+    public $configFiles;
 
-    function __construct($msg, $config_files) {
+    function __construct($msg, $configFiles) {
         parent::__construct($msg);
-        $this->config_files = $config_files;
+        $this->configFiles = $configFiles;
     }
 }
diff --git a/lib/userprofile.php b/lib/userprofile.php
index 43dfd05be..8464c2446 100644
--- a/lib/userprofile.php
+++ b/lib/userprofile.php
@@ -346,6 +346,16 @@ class UserProfile extends Widget
                             $this->out->elementEnd('ul');
                             $this->out->elementEnd('li');
                         }
+                        
+                        if ($cur->hasRight(Right::GRANTROLE)) {
+                            $this->out->elementStart('li', 'entity_role');
+                            $this->out->element('p', null, _('User role'));
+                            $this->out->elementStart('ul');
+                            $this->roleButton('administrator', _m('role', 'Administrator'));
+                            $this->roleButton('moderator', _m('role', 'Moderator'));
+                            $this->out->elementEnd('ul');
+                            $this->out->elementEnd('li');
+                        }
                     }
                 }
 
@@ -359,6 +369,22 @@ class UserProfile extends Widget
         }
     }
 
+    function roleButton($role, $label)
+    {
+        list($action, $r2args) = $this->out->returnToArgs();
+        $r2args['action'] = $action;
+
+        $this->out->elementStart('li', "entity_role_$role");
+        if ($this->user->hasRole($role)) {
+            $rf = new RevokeRoleForm($role, $label, $this->out, $this->profile, $r2args);
+            $rf->show();
+        } else {
+            $rf = new GrantRoleForm($role, $label, $this->out, $this->profile, $r2args);
+            $rf->show();
+        }
+        $this->out->elementEnd('li');
+    }
+
     function showRemoteSubscribeLink()
     {
         $url = common_local_url('remotesubscribe',
diff --git a/lib/util.php b/lib/util.php
index 82dec0f0c..6a8494275 100644
--- a/lib/util.php
+++ b/lib/util.php
@@ -105,11 +105,13 @@ function common_language()
 
     // Otherwise, find the best match for the languages requested by the
     // user's browser...
-    $httplang = isset($_SERVER['HTTP_ACCEPT_LANGUAGE']) ? $_SERVER['HTTP_ACCEPT_LANGUAGE'] : null;
-    if (!empty($httplang)) {
-        $language = client_prefered_language($httplang);
-        if ($language)
-          return $language;
+    if (common_config('site', 'langdetect')) {
+        $httplang = isset($_SERVER['HTTP_ACCEPT_LANGUAGE']) ? $_SERVER['HTTP_ACCEPT_LANGUAGE'] : null;
+        if (!empty($httplang)) {
+            $language = client_prefered_language($httplang);
+            if ($language)
+              return $language;
+        }
     }
 
     // Finally, if none of the above worked, use the site's default...
@@ -134,7 +136,7 @@ function common_check_user($nickname, $password)
     $authenticatedUser = false;
 
     if (Event::handle('StartCheckPassword', array($nickname, $password, &$authenticatedUser))) {
-        $user = User::staticGet('nickname', $nickname);
+        $user = User::staticGet('nickname', common_canonical_nickname($nickname));
         if (!empty($user)) {
             if (!empty($password)) { // never allow login with blank password
                 if (0 == strcmp(common_munge_password($password, $user->id),
@@ -426,14 +428,14 @@ function common_render_content($text, $notice)
 {
     $r = common_render_text($text);
     $id = $notice->profile_id;
-    $r = common_linkify_mentions($id, $r);
+    $r = common_linkify_mentions($r, $notice);
     $r = preg_replace('/(^|[\s\.\,\:\;]+)!([A-Za-z0-9]{1,64})/e', "'\\1!'.common_group_link($id, '\\2')", $r);
     return $r;
 }
 
-function common_linkify_mentions($profile_id, $text)
+function common_linkify_mentions($text, $notice)
 {
-    $mentions = common_find_mentions($profile_id, $text);
+    $mentions = common_find_mentions($text, $notice);
 
     // We need to go through in reverse order by position,
     // so our positions stay valid despite our fudging with the
@@ -487,11 +489,11 @@ function common_linkify_mention($mention)
     return $output;
 }
 
-function common_find_mentions($profile_id, $text)
+function common_find_mentions($text, $notice)
 {
     $mentions = array();
 
-    $sender = Profile::staticGet('id', $profile_id);
+    $sender = Profile::staticGet('id', $notice->profile_id);
 
     if (empty($sender)) {
         return $mentions;
@@ -499,6 +501,30 @@ function common_find_mentions($profile_id, $text)
 
     if (Event::handle('StartFindMentions', array($sender, $text, &$mentions))) {
 
+        // Get the context of the original notice, if any
+
+        $originalAuthor   = null;
+        $originalNotice   = null;
+        $originalMentions = array();
+
+        // Is it a reply?
+
+        if (!empty($notice) && !empty($notice->reply_to)) {
+            $originalNotice = Notice::staticGet('id', $notice->reply_to);
+            if (!empty($originalNotice)) {
+                $originalAuthor = Profile::staticGet('id', $originalNotice->profile_id);
+
+                $ids = $originalNotice->getReplies();
+
+                foreach ($ids as $id) {
+                    $repliedTo = Profile::staticGet('id', $id);
+                    if (!empty($repliedTo)) {
+                        $originalMentions[$repliedTo->nickname] = $repliedTo;
+                    }
+                }
+            }
+        }
+
         preg_match_all('/^T ([A-Z0-9]{1,64}) /',
                        $text,
                        $tmatches,
@@ -514,7 +540,22 @@ function common_find_mentions($profile_id, $text)
         foreach ($matches as $match) {
 
             $nickname = common_canonical_nickname($match[0]);
-            $mentioned = common_relative_profile($sender, $nickname);
+
+            // Try to get a profile for this nickname.
+            // Start with conversation context, then go to
+            // sender context.
+
+            if (!empty($originalAuthor) && $originalAuthor->nickname == $nickname) {
+
+                $mentioned = $originalAuthor;
+
+            } else if (!empty($originalMentions) &&
+                       array_key_exists($nickname, $originalMentions)) {
+
+                $mentioned = $originalMentions[$nickname];
+            } else {
+                $mentioned = common_relative_profile($sender, $nickname);
+            }
 
             if (!empty($mentioned)) {
 
@@ -763,8 +804,28 @@ function common_shorten_links($text)
 
 function common_xml_safe_str($str)
 {
-    // Neutralize control codes and surrogates
-	return preg_replace('/[\p{Cc}\p{Cs}]/u', '*', $str);
+    // Replace common eol and extra whitespace input chars
+    $unWelcome = array(
+        "\t",  // tab
+        "\n",  // newline
+        "\r",  // cr
+        "\0",  // null byte eos
+        "\x0B" // vertical tab
+    );
+
+    $replacement = array(
+        ' ', // single space
+        ' ',
+        '',  // nothing
+        '',
+        ' '
+    );
+
+    $str = str_replace($unWelcome, $replacement, $str);
+
+    // Neutralize any additional control codes and UTF-16 surrogates
+    // (Twitter uses '*')
+    return preg_replace('/[\p{Cc}\p{Cs}]/u', '*', $str);
 }
 
 function common_tag_link($tag)
@@ -794,7 +855,7 @@ function common_valid_profile_tag($str)
 function common_group_link($sender_id, $nickname)
 {
     $sender = Profile::staticGet($sender_id);
-    $group = User_group::getForNickname($nickname);
+    $group = User_group::getForNickname($nickname, $sender);
     if ($sender && $group && $sender->isMember($group)) {
         $attrs = array('href' => $group->permalink(),
                        'class' => 'url');
@@ -849,7 +910,7 @@ function common_relative_profile($sender, $nickname, $dt=null)
     return null;
 }
 
-function common_local_url($action, $args=null, $params=null, $fragment=null)
+function common_local_url($action, $args=null, $params=null, $fragment=null, $addSession=true)
 {
     $r = Router::get();
     $path = $r->build($action, $args, $params, $fragment);
@@ -857,12 +918,12 @@ function common_local_url($action, $args=null, $params=null, $fragment=null)
     $ssl = common_is_sensitive($action);
 
     if (common_config('site','fancy')) {
-        $url = common_path(mb_substr($path, 1), $ssl);
+        $url = common_path(mb_substr($path, 1), $ssl, $addSession);
     } else {
         if (mb_strpos($path, '/index.php') === 0) {
-            $url = common_path(mb_substr($path, 1), $ssl);
+            $url = common_path(mb_substr($path, 1), $ssl, $addSession);
         } else {
-            $url = common_path('index.php'.$path, $ssl);
+            $url = common_path('index.php'.$path, $ssl, $addSession);
         }
     }
     return $url;
@@ -881,7 +942,7 @@ function common_is_sensitive($action)
     return $ssl;
 }
 
-function common_path($relative, $ssl=false)
+function common_path($relative, $ssl=false, $addSession=true)
 {
     $pathpart = (common_config('site', 'path')) ? common_config('site', 'path')."/" : '';
 
@@ -905,7 +966,9 @@ function common_path($relative, $ssl=false)
         }
     }
 
-    $relative = common_inject_session($relative, $serverpart);
+    if ($addSession) {
+        $relative = common_inject_session($relative, $serverpart);
+    }
 
     return $proto.'://'.$serverpart.'/'.$pathpart.$relative;
 }
@@ -1118,14 +1181,15 @@ function common_broadcast_profile(Profile $profile)
 
 function common_profile_url($nickname)
 {
-    return common_local_url('showstream', array('nickname' => $nickname));
+    return common_local_url('showstream', array('nickname' => $nickname),
+                            null, null, false);
 }
 
 // Should make up a reasonable root URL
 
 function common_root_url($ssl=false)
 {
-    $url = common_path('', $ssl);
+    $url = common_path('', $ssl, false);
     $i = strpos($url, '?');
     if ($i !== false) {
         $url = substr($url, 0, $i);
@@ -1410,7 +1474,8 @@ function common_remove_magic_from_request()
 
 function common_user_uri(&$user)
 {
-    return common_local_url('userbyid', array('id' => $user->id));
+    return common_local_url('userbyid', array('id' => $user->id),
+                            null, null, false);
 }
 
 function common_notice_uri(&$notice)
@@ -1590,6 +1655,7 @@ function common_database_tablename($tablename)
  */
 function common_shorten_url($long_url)
 {
+    $long_url = trim($long_url);
     $user = common_current_user();
     if (empty($user)) {
         // common current user does not find a user when called from the XMPP daemon
@@ -1604,7 +1670,7 @@ function common_shorten_url($long_url)
         return $long_url;
     }else{
         //URL was shortened, so return the result
-        return $shortenedUrl;
+        return trim($shortenedUrl);
     }
 }
 
@@ -1681,7 +1747,8 @@ function common_url_to_nickname($url)
             # Strip starting, ending slashes
             $path = preg_replace('@/$@', '', $parts['path']);
             $path = preg_replace('@^/@', '', $path);
-            if (strpos($path, '/') === false) {
+            $path = basename($path);
+            if ($path) {
                 return common_nicknamize($path);
             }
         }