diff options
Diffstat (limited to 'lib')
36 files changed, 1232 insertions, 339 deletions
diff --git a/lib/action.php b/lib/action.php index fa9ddb911..10394c789 100644 --- a/lib/action.php +++ b/lib/action.php @@ -420,56 +420,75 @@ class Action extends HTMLOutputter // lawsuit function showPrimaryNav() { $user = common_current_user(); - $connect = ''; - if (common_config('xmpp', 'enabled')) { - $connect = 'imsettings'; - } else if (common_config('sms', 'enabled')) { - $connect = 'smssettings'; - } else if (common_config('twitter', 'enabled')) { - $connect = 'twittersettings'; - } - $this->elementStart('dl', array('id' => 'site_nav_global_primary')); $this->element('dt', null, _('Primary site navigation')); $this->elementStart('dd'); $this->elementStart('ul', array('class' => 'nav')); if (Event::handle('StartPrimaryNav', array($this))) { if ($user) { + // TRANS: Tooltip for main menu option "Personal" + $tooltip = _m('TOOLTIP', 'Personal profile and friends timeline'); + // TRANS: Main menu option when logged in for access to personal profile and friends timeline $this->menuItem(common_local_url('all', array('nickname' => $user->nickname)), - _('Home'), _('Personal profile and friends timeline'), false, 'nav_home'); + _m('MENU', 'Personal'), $tooltip, false, 'nav_home'); + // TRANS: Tooltip for main menu option "Account" + $tooltip = _m('TOOLTIP', 'Change your email, avatar, password, profile'); + // TRANS: Main menu option when logged in for access to user settings $this->menuItem(common_local_url('profilesettings'), - _('Account'), _('Change your email, avatar, password, profile'), false, 'nav_account'); - if ($connect) { - $this->menuItem(common_local_url($connect), - _('Connect'), _('Connect to services'), false, 'nav_connect'); - } + _('Account'), $tooltip, false, 'nav_account'); + // TRANS: Tooltip for main menu option "Services" + $tooltip = _m('TOOLTIP', 'Connect to services'); + // TRANS: Main menu option when logged in and connection are possible for access to options to connect to other services + $this->menuItem(common_local_url('oauthconnectionssettings'), + _('Connect'), $tooltip, false, 'nav_connect'); if ($user->hasRight(Right::CONFIGURESITE)) { + // TRANS: Tooltip for menu option "Admin" + $tooltip = _m('TOOLTIP', 'Change site configuration'); + // TRANS: Main menu option when logged in and site admin for access to site configuration $this->menuItem(common_local_url('siteadminpanel'), - _('Admin'), _('Change site configuration'), false, 'nav_admin'); + _m('MENU', 'Admin'), $tooltip, false, 'nav_admin'); } if (common_config('invite', 'enabled')) { + // TRANS: Tooltip for main menu option "Invite" + $tooltip = _m('TOOLTIP', 'Invite friends and colleagues to join you on %s'); + // TRANS: Main menu option when logged in and invitations are allowed for inviting new users $this->menuItem(common_local_url('invite'), - _('Invite'), - sprintf(_('Invite friends and colleagues to join you on %s'), + _m('MENU', 'Invite'), + sprintf($tooltip, common_config('site', 'name')), false, 'nav_invitecontact'); } + // TRANS: Tooltip for main menu option "Logout" + $tooltip = _m('TOOLTIP', 'Logout from the site'); + // TRANS: Main menu option when logged in to log out the current user $this->menuItem(common_local_url('logout'), - _('Logout'), _('Logout from the site'), false, 'nav_logout'); + _m('MENU', 'Logout'), $tooltip, false, 'nav_logout'); } else { if (!common_config('site', 'closed')) { + // TRANS: Tooltip for main menu option "Register" + $tooltip = _m('TOOLTIP', 'Create an account'); + // TRANS: Main menu option when not logged in to register a new account $this->menuItem(common_local_url('register'), - _('Register'), _('Create an account'), false, 'nav_register'); + _m('MENU', 'Register'), $tooltip, false, 'nav_register'); } + // TRANS: Tooltip for main menu option "Login" + $tooltip = _m('TOOLTIP', 'Login to the site'); + // TRANS: Main menu option when not logged in to log in $this->menuItem(common_local_url('login'), - _('Login'), _('Login to the site'), false, 'nav_login'); + _m('MENU', 'Login'), $tooltip, false, 'nav_login'); } + // TRANS: Tooltip for main menu option "Help" + $tooltip = _m('TOOLTIP', 'Help me!'); + // TRANS: Main menu option for help on the StatusNet site $this->menuItem(common_local_url('doc', array('title' => 'help')), - _('Help'), _('Help me!'), false, 'nav_help'); + _m('MENU', 'Help'), $tooltip, false, 'nav_help'); if ($user || !common_config('site', 'private')) { + // TRANS: Tooltip for main menu option "Search" + $tooltip = _m('TOOLTIP', 'Search for people or text'); + // TRANS: Main menu option when logged in or when the StatusNet instance is not private $this->menuItem(common_local_url('peoplesearch'), - _('Search'), _('Search for people or text'), false, 'nav_search'); + _m('MENU', 'Search'), $tooltip, false, 'nav_search'); } Event::handle('EndPrimaryNav', array($this)); } @@ -490,6 +509,7 @@ class Action extends HTMLOutputter // lawsuit if ($text) { $this->elementStart('dl', array('id' => 'site_notice', 'class' => 'system_notice')); + // TRANS: DT element for site notice. String is hidden in default CSS. $this->element('dt', null, _('Site notice')); $this->elementStart('dd', null); $this->raw($text); @@ -976,7 +996,7 @@ class Action extends HTMLOutputter // lawsuit if (is_null($arg)) { return $def; - } else if (in_array($arg, array('true', 'yes', '1'))) { + } else if (in_array($arg, array('true', 'yes', '1', 'on'))) { return true; } else if (in_array($arg, array('false', 'no', '0'))) { return false; diff --git a/lib/activity.php b/lib/activity.php index 25727bf2b..2cb80f9e1 100644 --- a/lib/activity.php +++ b/lib/activity.php @@ -154,7 +154,15 @@ class PoCo PoCo::NS ); - array_push($urls, new PoCoURL($type, $value, $primary)); + $isPrimary = false; + + if (isset($primary) && $primary == 'true') { + $isPrimary = true; + } + + // @todo check to make sure a primary hasn't already been added + + array_push($urls, new PoCoURL($type, $value, $isPrimary)); } return $urls; } @@ -215,6 +223,46 @@ class PoCo return $poco; } + function fromGroup($group) + { + if (empty($group)) { + return null; + } + + $poco = new PoCo(); + + $poco->preferredUsername = $group->nickname; + $poco->displayName = $group->getBestName(); + + $poco->note = $group->description; + + $paddy = new PoCoAddress(); + $paddy->formatted = $group->location; + $poco->address = $paddy; + + if (!empty($group->homepage)) { + array_push( + $poco->urls, + new PoCoURL( + 'homepage', + $group->homepage, + true + ) + ); + } + + return $poco; + } + + function getPrimaryURL() + { + foreach ($this->urls as $url) { + if ($url->primary) { + return $url; + } + } + } + function asString() { $xs = new XMLStringer(true); @@ -296,22 +344,45 @@ class ActivityUtils static function getLink(DOMNode $element, $rel, $type=null) { - $links = $element->getElementsByTagnameNS(self::ATOM, self::LINK); + $els = $element->childNodes; - foreach ($links as $link) { + foreach ($els as $link) { + if ($link->localName == self::LINK && $link->namespaceURI == self::ATOM) { - $linkRel = $link->getAttribute(self::REL); - $linkType = $link->getAttribute(self::TYPE); + $linkRel = $link->getAttribute(self::REL); + $linkType = $link->getAttribute(self::TYPE); - if ($linkRel == $rel && - (is_null($type) || $linkType == $type)) { - return $link->getAttribute(self::HREF); + if ($linkRel == $rel && + (is_null($type) || $linkType == $type)) { + return $link->getAttribute(self::HREF); + } } } return null; } + static function getLinks(DOMNode $element, $rel, $type=null) + { + $els = $element->childNodes; + $out = array(); + + foreach ($els as $link) { + if ($link->localName == self::LINK && $link->namespaceURI == self::ATOM) { + + $linkRel = $link->getAttribute(self::REL); + $linkType = $link->getAttribute(self::TYPE); + + if ($linkRel == $rel && + (is_null($type) || $linkType == $type)) { + $out[] = $link; + } + } + } + + return $out; + } + /** * Gets the first child element with the given tag * @@ -417,6 +488,75 @@ class ActivityUtils } } +// XXX: Arg! This wouldn't be necessary if we used Avatars conistently +class AvatarLink +{ + public $url; + public $type; + public $size; + public $width; + public $height; + + function __construct($element=null) + { + if ($element) { + // @fixme use correct namespaces + $this->url = $element->getAttribute('href'); + $this->type = $element->getAttribute('type'); + $width = $element->getAttribute('media:width'); + if ($width != null) { + $this->width = intval($width); + } + $height = $element->getAttribute('media:height'); + if ($height != null) { + $this->height = intval($height); + } + } + } + + static function fromAvatar($avatar) + { + if (empty($avatar)) { + return null; + } + $alink = new AvatarLink(); + $alink->type = $avatar->mediatype; + $alink->height = $avatar->height; + $alink->width = $avatar->width; + $alink->url = $avatar->displayUrl(); + return $alink; + } + + static function fromFilename($filename, $size) + { + $alink = new AvatarLink(); + $alink->url = $filename; + $alink->height = $size; + if (!empty($filename)) { + $alink->width = $size; + $alink->type = self::mediatype($filename); + } else { + $alink->url = User_group::defaultLogo($size); + $alink->type = 'image/png'; + } + return $alink; + } + + // yuck! + static function mediatype($filename) { + $ext = strtolower(end(explode('.', $filename))); + if ($ext == 'jpeg') { + $ext = 'jpg'; + } + // hope we don't support any others + $types = array('png', 'gif', 'jpg', 'jpeg'); + if (in_array($ext, $types)) { + return 'image/' . $ext; + } + return null; + } +} + /** * A noun-ish thing in the activity universe * @@ -473,7 +613,7 @@ class ActivityObject public $content; public $link; public $source; - public $avatar; + public $avatarLinks = array(); public $geopoint; public $poco; public $displayName; @@ -496,6 +636,12 @@ class ActivityObject $this->element = $element; + $this->geopoint = $this->_childContent( + $element, + ActivityContext::POINT, + ActivityContext::GEORSS + ); + if ($element->tagName == 'author') { $this->type = self::PERSON; // XXX: is this fair? @@ -535,8 +681,10 @@ class ActivityObject if ($this->type == self::PERSON || $this->type == self::GROUP) { $this->displayName = $this->title; - // @fixme we may have multiple avatars with different resolutions specified - $this->avatar = ActivityUtils::getLink($element, 'avatar'); + $avatars = ActivityUtils::getLinks($element, 'avatar'); + foreach ($avatars as $link) { + $this->avatarLinks[] = new AvatarLink($link); + } $this->poco = new PoCo($element); } @@ -587,10 +735,40 @@ class ActivityObject $object->id = $profile->getUri(); $object->title = $profile->getBestName(); $object->link = $profile->profileurl; - $object->avatar = $profile->getAvatar(AVATAR_PROFILE_SIZE); + + $orig = $profile->getOriginalAvatar(); + + if (!empty($orig)) { + $object->avatarLinks[] = AvatarLink::fromAvatar($orig); + } + + $sizes = array( + AVATAR_PROFILE_SIZE, + AVATAR_STREAM_SIZE, + AVATAR_MINI_SIZE + ); + + foreach ($sizes as $size) { + + $alink = null; + $avatar = $profile->getAvatar($size); + + if (!empty($avatar)) { + $alink = AvatarLink::fromAvatar($avatar); + } else { + $alink = new AvatarLink(); + $alink->type = 'image/png'; + $alink->height = $size; + $alink->width = $size; + $alink->url = Avatar::defaultImage($size); + } + + $object->avatarLinks[] = $alink; + } if (isset($profile->lat) && isset($profile->lon)) { - $object->geopoint = (float)$profile->lat . ' ' . (float)$profile->lon; + $object->geopoint = (float)$profile->lat + . ' ' . (float)$profile->lon; } $object->poco = PoCo::fromProfile($profile); @@ -598,6 +776,36 @@ class ActivityObject return $object; } + static function fromGroup($group) + { + $object = new ActivityObject(); + + $object->type = ActivityObject::GROUP; + $object->id = $group->getUri(); + $object->title = $group->getBestName(); + $object->link = $group->getUri(); + + $object->avatarLinks[] = AvatarLink::fromFilename( + $group->homepage_logo, + AVATAR_PROFILE_SIZE + ); + + $object->avatarLinks[] = AvatarLink::fromFilename( + $group->stream_logo, + AVATAR_STREAM_SIZE + ); + + $object->avatarLinks[] = AvatarLink::fromFilename( + $group->mini_logo, + AVATAR_MINI_SIZE + ); + + $object->poco = PoCo::fromGroup($group); + + return $object; + } + + function asString($tag='activity:object') { $xs = new XMLStringer(true); @@ -635,16 +843,19 @@ class ActivityObject if ($this->type == ActivityObject::PERSON || $this->type == ActivityObject::GROUP) { - $xs->element( - 'link', array( - 'type' => empty($this->avatar) ? 'image/png' : $this->avatar->mediatype, - 'rel' => 'avatar', - 'href' => empty($this->avatar) - ? Avatar::defaultImage(AVATAR_PROFILE_SIZE) - : $this->avatar->displayUrl() - ), - null - ); + + foreach ($this->avatarLinks as $avatar) { + $xs->element( + 'link', array( + 'rel' => 'avatar', + 'type' => $avatar->type, + 'media:width' => $avatar->width, + 'media:height' => $avatar->height, + 'href' => $avatar->url + ), + null + ); + } } if (!empty($this->geopoint)) { @@ -761,22 +972,29 @@ class ActivityContext for ($i = 0; $i < $points->length; $i++) { $point = $points->item($i)->textContent; - $point = str_replace(',', ' ', $point); // per spec "treat commas as whitespace" - $point = preg_replace('/\s+/', ' ', $point); - $point = trim($point); - $coords = explode(' ', $point); - if (count($coords) == 2) { - list($lat, $lon) = $coords; - if (is_numeric($lat) && is_numeric($lon)) { - common_log(LOG_INFO, "Looking up location for $lat $lon from georss"); - return Location::fromLatLon($lat, $lon); - } - } - common_log(LOG_ERR, "Ignoring bogus georss:point value $point"); + return self::locationFromPoint($point); } return null; } + + // XXX: Move to ActivityUtils or Location? + static function locationFromPoint($point) + { + $point = str_replace(',', ' ', $point); // per spec "treat commas as whitespace" + $point = preg_replace('/\s+/', ' ', $point); + $point = trim($point); + $coords = explode(' ', $point); + if (count($coords) == 2) { + list($lat, $lon) = $coords; + if (is_numeric($lat) && is_numeric($lon)) { + common_log(LOG_INFO, "Looking up location for $lat $lon from georss point"); + return Location::fromLatLon($lat, $lon); + } + } + common_log(LOG_ERR, "Ignoring bogus georss:point value $point"); + return null; + } } /** @@ -829,6 +1047,8 @@ class Activity public $content; // HTML content of activity public $id; // ID of the activity public $title; // title of the activity + public $categories = array(); // list of AtomCategory objects + public $enclosures = array(); // list of enclosure URL references /** * Turns a regular old Atom <entry> into a magical activity @@ -844,6 +1064,18 @@ class Activity } $this->entry = $entry; + + // @fixme Don't send in a DOMDocument + if ($feed instanceof DOMDocument) { + common_log( + LOG_WARNING, + 'Activity::__construct() - ' + . 'DOMDocument passed in for feed by mistake. ' + . "Expecting a 'feed' DOMElement." + ); + $feed = $feed->getElementsByTagName('feed')->item(0); + } + $this->feed = $feed; $pubEl = $this->_child($entry, self::PUBLISHED, self::ATOM); @@ -917,6 +1149,18 @@ class Activity $this->summary = ActivityUtils::childContent($entry, 'summary'); $this->id = ActivityUtils::childContent($entry, 'id'); $this->content = ActivityUtils::getContent($entry); + + $catEls = $entry->getElementsByTagNameNS(self::ATOM, 'category'); + if ($catEls) { + for ($i = 0; $i < $catEls->length; $i++) { + $catEl = $catEls->item($i); + $this->categories[] = new AtomCategory($catEl); + } + } + + foreach (ActivityUtils::getLinks($entry, 'enclosure') as $link) { + $this->enclosures[] = $link->getAttribute('href'); + } } /** @@ -939,7 +1183,8 @@ class Activity 'xmlns:activity' => 'http://activitystrea.ms/spec/1.0/', 'xmlns:georss' => 'http://www.georss.org/georss', 'xmlns:ostatus' => 'http://ostatus.org/schema/1.0', - 'xmlns:poco' => 'http://portablecontacts.net/spec/1.0'); + 'xmlns:poco' => 'http://portablecontacts.net/spec/1.0', + 'xmlns:media' => 'http://purl.org/syndication/atommedia'); } else { $attrs = array(); } @@ -981,6 +1226,10 @@ class Activity $xs->raw($this->target->asString('activity:target')); } + foreach ($this->categories as $cat) { + $xs->raw($cat->asString()); + } + $xs->elementEnd('entry'); return $xs->getString(); @@ -990,4 +1239,50 @@ class Activity { return ActivityUtils::child($element, $tag, $namespace); } -}
\ No newline at end of file +} + +class AtomCategory +{ + public $term; + public $scheme; + public $label; + + function __construct($element=null) + { + if ($element && $element->attributes) { + $this->term = $this->extract($element, 'term'); + $this->scheme = $this->extract($element, 'scheme'); + $this->label = $this->extract($element, 'label'); + } + } + + protected function extract($element, $attrib) + { + $node = $element->attributes->getNamedItemNS(Activity::ATOM, $attrib); + if ($node) { + return trim($node->textContent); + } + $node = $element->attributes->getNamedItem($attrib); + if ($node) { + return trim($node->textContent); + } + return null; + } + + function asString() + { + $attribs = array(); + if ($this->term !== null) { + $attribs['term'] = $this->term; + } + if ($this->scheme !== null) { + $attribs['scheme'] = $this->scheme; + } + if ($this->label !== null) { + $attribs['label'] = $this->label; + } + $xs = new XMLStringer(); + $xs->element('category', $attribs); + return $xs->asString(); + } +} diff --git a/lib/adminpanelaction.php b/lib/adminpanelaction.php index f05627b31..a927e2333 100644 --- a/lib/adminpanelaction.php +++ b/lib/adminpanelaction.php @@ -69,6 +69,7 @@ class AdminPanelAction extends Action // User must be logged in. if (!common_logged_in()) { + // TRANS: Client error message $this->clientError(_('Not logged in.')); return false; } @@ -93,6 +94,7 @@ class AdminPanelAction extends Action // User must have the right to change admin settings if (!$user->hasRight(Right::CONFIGURESITE)) { + // TRANS: Client error message $this->clientError(_('You cannot make changes to this site.')); return false; } @@ -103,7 +105,8 @@ class AdminPanelAction extends Action $name = mb_substr($name, 0, -10); - if (!in_array($name, common_config('admin', 'panels'))) { + if (!self::canAdmin($name)) { + // TRANS: Client error message $this->clientError(_('Changes to that panel are not allowed.'), 403); return false; } @@ -134,6 +137,7 @@ class AdminPanelAction extends Action Config::loadSettings(); $this->success = true; + // TRANS: Message after successful saving of administrative settings. $this->msg = _('Settings saved.'); } catch (Exception $e) { $this->success = false; @@ -172,6 +176,24 @@ class AdminPanelAction extends Action } /** + * Show content block. Overrided just to add a special class + * to the content div to allow styling. + * + * @return nothing + */ + function showContentBlock() + { + $this->elementStart('div', array('id' => 'content', 'class' => 'admin')); + $this->showPageTitle(); + $this->showPageNoticeBlock(); + $this->elementStart('div', array('id' => 'content_inner')); + // show the actual content (forms, lists, whatever) + $this->showContent(); + $this->elementEnd('div'); + $this->elementEnd('div'); + } + + /** * show human-readable instructions for the page, or * a success/failure on save. * @@ -203,6 +225,7 @@ class AdminPanelAction extends Action function showForm() { + // TRANS: Client error message $this->clientError(_('showForm() not implemented.')); return; } @@ -232,6 +255,7 @@ class AdminPanelAction extends Action function saveSettings() { + // TRANS: Client error message $this->clientError(_('saveSettings() not implemented.')); return; } @@ -255,6 +279,7 @@ class AdminPanelAction extends Action $result = $config->delete(); if (!$result) { common_log_db_error($config, 'DELETE', __FILE__); + // TRANS: Client error message $this->clientError(_("Unable to delete design setting.")); return null; } @@ -262,6 +287,17 @@ class AdminPanelAction extends Action return $result; } + + function canAdmin($name) + { + $isOK = false; + + if (Event::handle('AdminPanelCheck', array($name, &$isOK))) { + $isOK = in_array($name, common_config('admin', 'panels')); + } + + return $isOK; + } } /** @@ -307,34 +343,68 @@ class AdminPanelNav extends Widget if (Event::handle('StartAdminPanelNav', array($this))) { - if ($this->canAdmin('site')) { - $this->out->menuItem(common_local_url('siteadminpanel'), _('Site'), - _('Basic site configuration'), $action_name == 'siteadminpanel', 'nav_site_admin_panel'); + if (AdminPanelAction::canAdmin('site')) { + // TRANS: Menu item title/tooltip + $menu_title = _('Basic site configuration'); + // TRANS: Menu item for site administration + $this->out->menuItem(common_local_url('siteadminpanel'), _m('MENU', 'Site'), + $menu_title, $action_name == 'siteadminpanel', 'nav_site_admin_panel'); } - if ($this->canAdmin('design')) { - $this->out->menuItem(common_local_url('designadminpanel'), _('Design'), - _('Design configuration'), $action_name == 'designadminpanel', 'nav_design_admin_panel'); + if (AdminPanelAction::canAdmin('design')) { + // TRANS: Menu item title/tooltip + $menu_title = _('Design configuration'); + // TRANS: Menu item for site administration + $this->out->menuItem(common_local_url('designadminpanel'), _m('MENU', 'Design'), + $menu_title, $action_name == 'designadminpanel', 'nav_design_admin_panel'); } - if ($this->canAdmin('user')) { + if (AdminPanelAction::canAdmin('user')) { + // TRANS: Menu item title/tooltip + $menu_title = _('User configuration'); + // TRANS: Menu item for site administration $this->out->menuItem(common_local_url('useradminpanel'), _('User'), - _('User configuration'), $action_name == 'useradminpanel', 'nav_design_admin_panel'); + $menu_title, $action_name == 'useradminpanel', 'nav_user_admin_panel'); } - if ($this->canAdmin('access')) { + if (AdminPanelAction::canAdmin('access')) { + // TRANS: Menu item title/tooltip + $menu_title = _('Access configuration'); + // TRANS: Menu item for site administration $this->out->menuItem(common_local_url('accessadminpanel'), _('Access'), - _('Access configuration'), $action_name == 'accessadminpanel', 'nav_design_admin_panel'); + $menu_title, $action_name == 'accessadminpanel', 'nav_access_admin_panel'); } - if ($this->canAdmin('paths')) { + if (AdminPanelAction::canAdmin('paths')) { + // TRANS: Menu item title/tooltip + $menu_title = _('Paths configuration'); + // TRANS: Menu item for site administration $this->out->menuItem(common_local_url('pathsadminpanel'), _('Paths'), - _('Paths configuration'), $action_name == 'pathsadminpanel', 'nav_design_admin_panel'); + $menu_title, $action_name == 'pathsadminpanel', 'nav_paths_admin_panel'); } - if ($this->canAdmin('sessions')) { + if (AdminPanelAction::canAdmin('sessions')) { + // TRANS: Menu item title/tooltip + $menu_title = _('Sessions configuration'); + // TRANS: Menu item for site administration $this->out->menuItem(common_local_url('sessionsadminpanel'), _('Sessions'), - _('Sessions configuration'), $action_name == 'sessionsadminpanel', 'nav_design_admin_panel'); + $menu_title, $action_name == 'sessionsadminpanel', 'nav_sessions_admin_panel'); + } + + if (AdminPanelAction::canAdmin('sitenotice')) { + // TRANS: Menu item title/tooltip + $menu_title = _('Edit site notice'); + // TRANS: Menu item for site administration + $this->out->menuItem(common_local_url('sitenoticeadminpanel'), _('Site notice'), + $menu_title, $action_name == 'sitenoticeadminpanel', 'nav_sitenotice_admin_panel'); + } + + if (AdminPanelAction::canAdmin('snapshot')) { + // TRANS: Menu item title/tooltip + $menu_title = _('Snapshots configuration'); + // TRANS: Menu item for site administration + $this->out->menuItem(common_local_url('snapshotadminpanel'), _('Snapshots'), + $menu_title, $action_name == 'snapshotadminpanel', 'nav_snapshot_admin_panel'); } Event::handle('EndAdminPanelNav', array($this)); @@ -342,8 +412,4 @@ class AdminPanelNav extends Widget $this->action->elementEnd('ul'); } - function canAdmin($name) - { - return in_array($name, common_config('admin', 'panels')); - } } diff --git a/lib/api.php b/lib/apiaction.php index 26977c90f..e4a1df3d1 100644 --- a/lib/api.php +++ b/lib/apiaction.php @@ -63,7 +63,6 @@ class ApiAction extends Action var $count = null; var $max_id = null; var $since_id = null; - var $since = null; var $access = self::READ_ONLY; // read (default) or read-write @@ -85,7 +84,10 @@ class ApiAction extends Action $this->count = (int)$this->arg('count', 20); $this->max_id = (int)$this->arg('max_id', 0); $this->since_id = (int)$this->arg('since_id', 0); - $this->since = $this->arg('since'); + + if ($this->arg('since')) { + header('X-StatusNet-Warning: since parameter is disabled; use since_id'); + } return true; } @@ -1219,7 +1221,12 @@ class ApiAction extends Action return User_group::staticGet($this->arg('id')); } else if ($this->arg('id')) { $nickname = common_canonical_nickname($this->arg('id')); - return User_group::staticGet('nickname', $nickname); + $local = Local_group::staticGet('nickname', $nickname); + if (empty($local)) { + return null; + } else { + return User_group::staticGet('id', $local->id); + } } else if ($this->arg('group_id')) { // This is to ensure that a non-numeric user_id still // overrides screen_name even if it doesn't get used @@ -1228,14 +1235,24 @@ class ApiAction extends Action } } else if ($this->arg('group_name')) { $nickname = common_canonical_nickname($this->arg('group_name')); - return User_group::staticGet('nickname', $nickname); + $local = Local_group::staticGet('nickname', $nickname); + if (empty($local)) { + return null; + } else { + return User_group::staticGet('id', $local->id); + } } } else if (is_numeric($id)) { return User_group::staticGet($id); } else { $nickname = common_canonical_nickname($id); - return User_group::staticGet('nickname', $nickname); + $local = Local_group::staticGet('nickname', $nickname); + if (empty($local)) { + return null; + } else { + return User_group::staticGet('id', $local->group_id); + } } } @@ -1311,8 +1328,6 @@ class ApiAction extends Action case 'max_id': $max_id = (int)$this->args['max_id']; return ($max_id < 1) ? 0 : $max_id; - case 'since': - return strtotime($this->args['since']); default: return parent::arg($key, $def); } diff --git a/lib/apiauth.php b/lib/apiauth.php index 25e2196cf..5090871cf 100644 --- a/lib/apiauth.php +++ b/lib/apiauth.php @@ -38,7 +38,6 @@ if (!defined('STATUSNET')) { exit(1); } -require_once INSTALLDIR . '/lib/api.php'; require_once INSTALLDIR . '/lib/apioauth.php'; /** diff --git a/lib/atom10entry.php b/lib/atom10entry.php deleted file mode 100644 index f8f16d594..000000000 --- a/lib/atom10entry.php +++ /dev/null @@ -1,105 +0,0 @@ -<?php -/** - * StatusNet, the distributed open-source microblogging tool - * - * Class for building / manipulating an Atom entry in memory - * - * PHP version 5 - * - * LICENCE: This program is free software: you can redistribute it and/or modify - * it under the terms of the GNU Affero General Public License as published by - * the Free Software Foundation, either version 3 of the License, or - * (at your option) any later version. - * - * This program is distributed in the hope that it will be useful, - * but WITHOUT ANY WARRANTY; without even the implied warranty of - * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the - * GNU Affero General Public License for more details. - * - * You should have received a copy of the GNU Affero General Public License - * along with this program. If not, see <http://www.gnu.org/licenses/>. - * - * @category Feed - * @package StatusNet - * @author Zach Copley <zach@status.net> - * @copyright 2010 StatusNet, Inc. - * @license http://www.fsf.org/licensing/licenses/agpl-3.0.html GNU Affero General Public License version 3.0 - * @link http://status.net/ - */ - -if (!defined('STATUSNET')) { - exit(1); -} - -class Atom10EntryException extends Exception -{ -} - -/** - * Class for manipulating an Atom entry in memory. Get the entry as an XML - * string with Atom10Entry::getString(). - * - * @category Feed - * @package StatusNet - * @author Zach Copley <zach@status.net> - * @license http://www.fsf.org/licensing/licenses/agpl-3.0.html GNU Affero General Public License version 3.0 - * @link http://status.net/ - */ -class Atom10Entry extends XMLStringer -{ - private $namespaces; - private $categories; - private $content; - private $contributors; - private $id; - private $links; - private $published; - private $rights; - private $source; - private $summary; - private $title; - - function __construct($indent = true) { - parent::__construct($indent); - $this->namespaces = array(); - } - - function addNamespace($namespace, $uri) - { - $ns = array($namespace => $uri); - $this->namespaces = array_merge($this->namespaces, $ns); - } - - function initEntry() - { - - } - - function endEntry() - { - - } - - /** - * Check that all required elements have been set, etc. - * Throws an Atom10EntryException if something's missing. - * - * @return void - */ - function validate() - { - - } - - function getString() - { - $this->validate(); - - $this->initEntry(); - $this->renderEntries(); - $this->endEntry(); - - return $this->xw->outputMemory(); - } - -}
\ No newline at end of file diff --git a/lib/atom10feed.php b/lib/atom10feed.php index 8842840d5..2d342e785 100644 --- a/lib/atom10feed.php +++ b/lib/atom10feed.php @@ -49,6 +49,8 @@ class Atom10FeedException extends Exception class Atom10Feed extends XMLStringer { public $xw; + + // @fixme most of these should probably be read-only properties private $namespaces; private $authors; private $subject; @@ -57,10 +59,12 @@ class Atom10Feed extends XMLStringer private $generator; private $icon; private $links; - private $logo; + private $selfLink; + private $selfLinkType; + public $logo; private $rights; - private $subtitle; - private $title; + public $subtitle; + public $title; private $published; private $updated; private $entries; @@ -172,6 +176,14 @@ class Atom10Feed extends XMLStringer } $this->elementStart('feed', $commonAttrs); + $this->element( + 'generator', array( + 'url' => 'http://status.net', + 'version' => STATUSNET_VERSION + ), + 'StatusNet' + ); + $this->element('id', null, $this->id); $this->element('title', null, $this->title); $this->element('subtitle', null, $this->subtitle); @@ -184,6 +196,10 @@ class Atom10Feed extends XMLStringer $this->renderAuthors(); + if ($this->selfLink) { + $this->addLink($this->selfLink, array('rel' => 'self', + 'type' => $this->selfLinkType)); + } $this->renderLinks(); } @@ -253,6 +269,12 @@ class Atom10Feed extends XMLStringer $this->id = $id; } + function setSelfLink($url, $type='application/atom+xml') + { + $this->selfLink = $url; + $this->selfLinkType = $type; + } + function setTitle($title) { $this->title = $title; diff --git a/lib/atomgroupnoticefeed.php b/lib/atomgroupnoticefeed.php index 52ee4c7d6..08c1c707c 100644 --- a/lib/atomgroupnoticefeed.php +++ b/lib/atomgroupnoticefeed.php @@ -49,14 +49,42 @@ class AtomGroupNoticeFeed extends AtomNoticeFeed /** * Constructor * - * @param Group $group the group for the feed (optional) + * @param Group $group the group for the feed * @param boolean $indent flag to turn indenting on or off * * @return void */ - function __construct($group = null, $indent = true) { + function __construct($group, $indent = true) { parent::__construct($indent); $this->group = $group; + + $title = sprintf(_("%s timeline"), $group->nickname); + $this->setTitle($title); + + $sitename = common_config('site', 'name'); + $subtitle = sprintf( + _('Updates from %1$s on %2$s!'), + $group->nickname, + $sitename + ); + $this->setSubtitle($subtitle); + + $avatar = $group->homepage_logo; + $logo = ($avatar) ? $avatar : User_group::defaultLogo(AVATAR_PROFILE_SIZE); + $this->setLogo($logo); + + $this->setUpdated('now'); + + $self = common_local_url('ApiTimelineGroup', + array('id' => $group->id, + 'format' => 'atom')); + $this->setId($self); + $this->setSelfLink($self); + + $this->addAuthorRaw($group->asAtomAuthor()); + $this->setActivitySubject($group->asActivitySubject()); + + $this->addLink($group->homeUrl()); } function getGroup() diff --git a/lib/atomnoticefeed.php b/lib/atomnoticefeed.php index d2bf2a416..e4df731fe 100644 --- a/lib/atomnoticefeed.php +++ b/lib/atomnoticefeed.php @@ -65,6 +65,11 @@ class AtomNoticeFeed extends Atom10Feed ); $this->addNamespace( + 'media', + 'http://purl.org/syndication/atommedia' + ); + + $this->addNamespace( 'poco', 'http://portablecontacts.net/spec/1.0' ); @@ -102,9 +107,19 @@ class AtomNoticeFeed extends Atom10Feed */ function addEntryFromNotice($notice) { - $this->addEntryRaw($notice->asAtomEntry()); - } + $source = $this->showSource(); + $author = $this->showAuthor(); -} + $this->addEntryRaw($notice->asAtomEntry(false, $source, $author)); + } + function showSource() + { + return true; + } + function showAuthor() + { + return true; + } +} diff --git a/lib/atomusernoticefeed.php b/lib/atomusernoticefeed.php index 2ad8de455..428cc2de2 100644 --- a/lib/atomusernoticefeed.php +++ b/lib/atomusernoticefeed.php @@ -49,23 +49,71 @@ class AtomUserNoticeFeed extends AtomNoticeFeed /** * Constructor * - * @param User $user the user for the feed (optional) + * @param User $user the user for the feed * @param boolean $indent flag to turn indenting on or off * * @return void */ - function __construct($user = null, $indent = true) { + function __construct($user, $indent = true) { parent::__construct($indent); $this->user = $user; if (!empty($user)) { $profile = $user->getProfile(); $this->addAuthor($profile->nickname, $user->uri); + $this->setActivitySubject($profile->asActivityNoun('subject')); } + + $title = sprintf(_("%s timeline"), $user->nickname); + $this->setTitle($title); + + $sitename = common_config('site', 'name'); + $subtitle = sprintf( + _('Updates from %1$s on %2$s!'), + $user->nickname, $sitename + ); + $this->setSubtitle($subtitle); + + $avatar = $profile->getAvatar(AVATAR_PROFILE_SIZE); + $logo = ($avatar) ? $avatar->displayUrl() : Avatar::defaultImage(AVATAR_PROFILE_SIZE); + $this->setLogo($logo); + + $this->setUpdated('now'); + + $this->addLink( + common_local_url( + 'showstream', + array('nickname' => $user->nickname) + ) + ); + + $self = common_local_url('ApiTimelineUser', + array('id' => $user->id, + 'format' => 'atom')); + $this->setId($self); + $this->setSelfLink($self); + + $this->addLink( + common_local_url('sup', null, null, $user->id), + array( + 'rel' => 'http://api.friendfeed.com/2008/03#sup', + 'type' => 'application/json' + ) + ); } function getUser() { return $this->user; } + + function showSource() + { + return false; + } + + function showAuthor() + { + return false; + } } diff --git a/lib/authenticationplugin.php b/lib/authenticationplugin.php index 5be3ea5b9..0a3763e2e 100644 --- a/lib/authenticationplugin.php +++ b/lib/authenticationplugin.php @@ -79,7 +79,7 @@ abstract class AuthenticationPlugin extends Plugin $nickname = $username; } $registration_data = array(); - $registration_data['nickname'] = $nickname ; + $registration_data['nickname'] = $nickname; return User::register($registration_data); } @@ -101,12 +101,14 @@ abstract class AuthenticationPlugin extends Plugin * Used during autoregistration * Useful if your usernames are ugly, and you want to suggest * nice looking nicknames when users initially sign on + * All nicknames returned by this function should be valid + * implementations may want to use common_nicknamize() to ensure validity * @param username * @return string nickname */ function suggestNicknameForUsername($username) { - return $username; + return common_nicknamize($username); } //------------Below are the methods that connect StatusNet to the implementing Auth plugin------------\\ @@ -129,7 +131,7 @@ abstract class AuthenticationPlugin extends Plugin $test_user = User::staticGet('nickname', $suggested_nickname); if($test_user) { //someone already exists with the suggested nickname, so used the passed nickname - $suggested_nickname = $nickname; + $suggested_nickname = common_nicknamize($nickname); } $test_user = User::staticGet('nickname', $suggested_nickname); if($test_user) { diff --git a/lib/authorizationplugin.php b/lib/authorizationplugin.php index 733b0c065..07da9b2d1 100644 --- a/lib/authorizationplugin.php +++ b/lib/authorizationplugin.php @@ -85,7 +85,7 @@ abstract class AuthorizationPlugin extends Plugin } function onStartSetApiUser(&$user) { - return $this->onStartSetUser(&$user); + return $this->onStartSetUser($user); } function onStartHasRole($profile, $name, &$has_role) { diff --git a/lib/common.php b/lib/common.php index 68723955e..047dc5a7b 100644 --- a/lib/common.php +++ b/lib/common.php @@ -22,7 +22,7 @@ if (!defined('STATUSNET') && !defined('LACONICA')) { exit(1); } //exit with 200 response, if this is checking fancy from the installer if (isset($_REQUEST['p']) && $_REQUEST['p'] == 'check-fancy') { exit; } -define('STATUSNET_VERSION', '0.9.0beta5'); +define('STATUSNET_VERSION', '0.9.0'); define('LACONICA_VERSION', STATUSNET_VERSION); // compatibility define('STATUSNET_CODENAME', 'Stand'); @@ -71,6 +71,7 @@ if (!function_exists('dl')) { # global configuration object require_once('PEAR.php'); +require_once('PEAR/Exception.php'); require_once('DB/DataObject.php'); require_once('DB/DataObject/Cast.php'); # for dates @@ -128,6 +129,17 @@ require_once INSTALLDIR.'/lib/activity.php'; require_once INSTALLDIR.'/lib/clientexception.php'; require_once INSTALLDIR.'/lib/serverexception.php'; + +//set PEAR error handling to use regular PHP exceptions +function PEAR_ErrorToPEAR_Exception($err) +{ + if ($err->getCode()) { + throw new PEAR_Exception($err->getMessage(), $err->getCode()); + } + throw new PEAR_Exception($err->getMessage()); +} +PEAR::setErrorHandling(PEAR_ERROR_CALLBACK, 'PEAR_ErrorToPEAR_Exception'); + try { StatusNet::init(@$server, @$path, @$conffile); } catch (NoConfigException $e) { diff --git a/lib/default.php b/lib/default.php index 70e00ea75..f22d8b24a 100644 --- a/lib/default.php +++ b/lib/default.php @@ -40,7 +40,8 @@ $default = 'logdebug' => false, 'fancy' => false, 'locale_path' => INSTALLDIR.'/locale', - 'language' => 'en_US', + 'language' => 'en', + 'langdetect' => true, 'languages' => get_all_languages(), 'email' => array_key_exists('SERVER_ADMIN', $_SERVER) ? $_SERVER['SERVER_ADMIN'] : null, @@ -53,10 +54,11 @@ $default = 'ssl' => 'never', 'sslserver' => null, 'shorturllength' => 30, - 'dupelimit' => 60, # default for same person saying the same thing + 'dupelimit' => 60, // default for same person saying the same thing 'textlimit' => 140, 'indent' => true, - 'use_x_sendfile' => false + 'use_x_sendfile' => false, + 'notice' => null // site wide notice text ), 'db' => array('database' => 'YOU HAVE TO SET THIS IN config.php', @@ -177,8 +179,8 @@ $default = array('source' => 'StatusNet', # source attribute for Twitter 'taguri' => null), # base for tag URIs 'twitter' => - array('enabled' => true, - 'consumer_key' => null, + array('signin' => true, + 'consumer_key' => null, 'consumer_secret' => null), 'cache' => array('base' => null), @@ -278,13 +280,13 @@ $default = 'TightUrl' => array('shortenerName' => '2tu.us', 'freeService' => true,'serviceUrl'=>'http://2tu.us/?save=y&url=%1$s'), 'Geonames' => null, 'Mapstraction' => null, - 'Linkback' => null, + 'OStatus' => null, 'WikiHashtags' => null, 'RSSCloud' => null, 'OpenID' => null), ), 'admin' => - array('panels' => array('design', 'site', 'user', 'paths', 'access', 'sessions')), + array('panels' => array('design', 'site', 'user', 'paths', 'access', 'sessions', 'sitenotice')), 'singleuser' => array('enabled' => false, 'nickname' => null), diff --git a/lib/distribqueuehandler.php b/lib/distribqueuehandler.php index dc183fb36..d2be7a92c 100644 --- a/lib/distribqueuehandler.php +++ b/lib/distribqueuehandler.php @@ -63,24 +63,12 @@ class DistribQueueHandler // XXX: do we need to change this for remote users? try { - $notice->saveTags(); - } catch (Exception $e) { - $this->logit($notice, $e); - } - - try { $notice->addToInboxes(); } catch (Exception $e) { $this->logit($notice, $e); } try { - $notice->saveUrls(); - } catch (Exception $e) { - $this->logit($notice, $e); - } - - try { Event::handle('EndNoticeSave', array($notice)); // Enqueue for other handlers } catch (Exception $e) { diff --git a/lib/grantroleform.php b/lib/grantroleform.php new file mode 100644 index 000000000..b5f952746 --- /dev/null +++ b/lib/grantroleform.php @@ -0,0 +1,93 @@ +<?php +/** + * StatusNet, the distributed open-source microblogging tool + * + * Form for granting a role + * + * PHP version 5 + * + * LICENCE: This program is free software: you can redistribute it and/or modify + * it under the terms of the GNU Affero General Public License as published by + * the Free Software Foundation, either version 3 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Affero General Public License for more details. + * + * You should have received a copy of the GNU Affero General Public License + * along with this program. If not, see <http://www.gnu.org/licenses/>. + * + * @category Form + * @package StatusNet + * @author Evan Prodromou <evan@status.net>, Brion Vibber <brion@status.net> + * @copyright 2009-2010 StatusNet, Inc. + * @license http://www.fsf.org/licensing/licenses/agpl-3.0.html GNU Affero General Public License version 3.0 + * @link http://status.net/ + */ + +if (!defined('STATUSNET')) { + exit(1); +} + +/** + * Form for sandboxing a user + * + * @category Form + * @package StatusNet + * @author Evan Prodromou <evan@status.net> + * @license http://www.fsf.org/licensing/licenses/agpl-3.0.html GNU Affero General Public License version 3.0 + * @link http://status.net/ + * + * @see UnSandboxForm + */ + +class GrantRoleForm extends ProfileActionForm +{ + function __construct($role, $label, $writer, $profile, $r2args) + { + parent::__construct($writer, $profile, $r2args); + $this->role = $role; + $this->label = $label; + } + + /** + * Action this form provides + * + * @return string Name of the action, lowercased. + */ + + function target() + { + return 'grantrole'; + } + + /** + * Title of the form + * + * @return string Title of the form, internationalized + */ + + function title() + { + return $this->label; + } + + function formData() + { + parent::formData(); + $this->out->hidden('role', $this->role); + } + + /** + * Description of the form + * + * @return string description of the form, internationalized + */ + + function description() + { + return sprintf(_('Grant this user the "%s" role'), $this->label); + } +} diff --git a/lib/imagefile.php b/lib/imagefile.php index 6bc8e599b..7b0479455 100644 --- a/lib/imagefile.php +++ b/lib/imagefile.php @@ -99,6 +99,10 @@ class ImageFile if ($info[2] !== IMAGETYPE_GIF && $info[2] !== IMAGETYPE_JPEG && + $info[2] !== IMAGETYPE_BMP && + $info[2] !== IMAGETYPE_WBMP && + $info[2] !== IMAGETYPE_XBM && + $info[2] !== IMAGETYPE_XPM && $info[2] !== IMAGETYPE_PNG) { @unlink($_FILES[$param]['tmp_name']); @@ -146,6 +150,18 @@ class ImageFile case IMAGETYPE_PNG: $image_src = imagecreatefrompng($this->filepath); break; + case IMAGETYPE_BMP: + $image_src = imagecreatefrombmp($this->filepath); + break; + case IMAGETYPE_WBMP: + $image_src = imagecreatefromwbmp($this->filepath); + break; + case IMAGETYPE_XBM: + $image_src = imagecreatefromxbm($this->filepath); + break; + case IMAGETYPE_XPM: + $image_src = imagecreatefromxpm($this->filepath); + break; default: throw new Exception(_('Unknown file type')); return; @@ -153,7 +169,7 @@ class ImageFile $image_dest = imagecreatetruecolor($size, $size); - if ($this->type == IMAGETYPE_GIF || $this->type == IMAGETYPE_PNG) { + if ($this->type == IMAGETYPE_GIF || $this->type == IMAGETYPE_PNG || $this->type == IMAGETYPE_BMP) { $transparent_idx = imagecolortransparent($image_src); @@ -176,6 +192,24 @@ class ImageFile imagecopyresampled($image_dest, $image_src, 0, 0, $x, $y, $size, $size, $w, $h); + if($this->type == IMAGETYPE_BMP) { + //we don't want to save BMP... it's an inefficient, rare, antiquated format + //save png instead + $this->type = IMAGETYPE_PNG; + } else if($this->type == IMAGETYPE_WBMP) { + //we don't want to save WBMP... it's a rare format that we can't guarantee clients will support + //save png instead + $this->type = IMAGETYPE_PNG; + } else if($this->type == IMAGETYPE_XBM) { + //we don't want to save XBM... it's a rare format that we can't guarantee clients will support + //save png instead + $this->type = IMAGETYPE_PNG; + } else if($this->type == IMAGETYPE_XPM) { + //we don't want to save XPM... it's a rare format that we can't guarantee clients will support + //save png instead + $this->type = IMAGETYPE_PNG; + } + $outname = Avatar::filename($this->id, image_type_to_extension($this->type), $size, @@ -245,4 +279,101 @@ class ImageFile return $num; } -}
\ No newline at end of file +} + +//PHP doesn't (as of 2/24/2010) have an imagecreatefrombmp so conditionally define one +if(!function_exists('imagecreatefrombmp')){ + //taken shamelessly from http://www.php.net/manual/en/function.imagecreatefromwbmp.php#86214 + function imagecreatefrombmp($p_sFile) + { + // Load the image into a string + $file = fopen($p_sFile,"rb"); + $read = fread($file,10); + while(!feof($file)&&($read<>"")) + $read .= fread($file,1024); + + $temp = unpack("H*",$read); + $hex = $temp[1]; + $header = substr($hex,0,108); + + // Process the header + // Structure: http://www.fastgraph.com/help/bmp_header_format.html + if (substr($header,0,4)=="424d") + { + // Cut it in parts of 2 bytes + $header_parts = str_split($header,2); + + // Get the width 4 bytes + $width = hexdec($header_parts[19].$header_parts[18]); + + // Get the height 4 bytes + $height = hexdec($header_parts[23].$header_parts[22]); + + // Unset the header params + unset($header_parts); + } + + // Define starting X and Y + $x = 0; + $y = 1; + + // Create newimage + $image = imagecreatetruecolor($width,$height); + + // Grab the body from the image + $body = substr($hex,108); + + // Calculate if padding at the end-line is needed + // Divided by two to keep overview. + // 1 byte = 2 HEX-chars + $body_size = (strlen($body)/2); + $header_size = ($width*$height); + + // Use end-line padding? Only when needed + $usePadding = ($body_size>($header_size*3)+4); + + // Using a for-loop with index-calculation instaid of str_split to avoid large memory consumption + // Calculate the next DWORD-position in the body + for ($i=0;$i<$body_size;$i+=3) + { + // Calculate line-ending and padding + if ($x>=$width) + { + // If padding needed, ignore image-padding + // Shift i to the ending of the current 32-bit-block + if ($usePadding) + $i += $width%4; + + // Reset horizontal position + $x = 0; + + // Raise the height-position (bottom-up) + $y++; + + // Reached the image-height? Break the for-loop + if ($y>$height) + break; + } + + // Calculation of the RGB-pixel (defined as BGR in image-data) + // Define $i_pos as absolute position in the body + $i_pos = $i*2; + $r = hexdec($body[$i_pos+4].$body[$i_pos+5]); + $g = hexdec($body[$i_pos+2].$body[$i_pos+3]); + $b = hexdec($body[$i_pos].$body[$i_pos+1]); + + // Calculate and draw the pixel + $color = imagecolorallocate($image,$r,$g,$b); + imagesetpixel($image,$x,$height-$y,$color); + + // Raise the horizontal position + $x++; + } + + // Unset the body / free the memory + unset($body); + + // Return image-object + return $image; + } +} diff --git a/lib/joinform.php b/lib/joinform.php index aefb553aa..aa8bc20e2 100644 --- a/lib/joinform.php +++ b/lib/joinform.php @@ -100,7 +100,7 @@ class JoinForm extends Form function action() { return common_local_url('joingroup', - array('nickname' => $this->group->nickname)); + array('id' => $this->group->id)); } /** diff --git a/lib/language.php b/lib/language.php index f5ee7fac5..64b59e739 100644 --- a/lib/language.php +++ b/lib/language.php @@ -289,6 +289,7 @@ function get_all_languages() { 'ar' => array('q' => 0.8, 'lang' => 'ar', 'name' => 'Arabic', 'direction' => 'rtl'), 'arz' => array('q' => 0.8, 'lang' => 'arz', 'name' => 'Egyptian Spoken Arabic', 'direction' => 'rtl'), 'bg' => array('q' => 0.8, 'lang' => 'bg', 'name' => 'Bulgarian', 'direction' => 'ltr'), + 'br' => array('q' => 0.8, 'lang' => 'br', 'name' => 'Breton', 'direction' => 'ltr'), 'ca' => array('q' => 0.5, 'lang' => 'ca', 'name' => 'Catalan', 'direction' => 'ltr'), 'cs' => array('q' => 0.5, 'lang' => 'cs', 'name' => 'Czech', 'direction' => 'ltr'), 'de' => array('q' => 0.8, 'lang' => 'de', 'name' => 'German', 'direction' => 'ltr'), diff --git a/lib/leaveform.php b/lib/leaveform.php index e63d96ee8..5469b5704 100644 --- a/lib/leaveform.php +++ b/lib/leaveform.php @@ -100,7 +100,7 @@ class LeaveForm extends Form function action() { return common_local_url('leavegroup', - array('nickname' => $this->group->nickname)); + array('id' => $this->group->id)); } /** diff --git a/lib/mail.php b/lib/mail.php index c724764cc..807b6a363 100644 --- a/lib/mail.php +++ b/lib/mail.php @@ -133,12 +133,13 @@ function mail_notify_from() * @param User &$user user to send email to * @param string $subject subject of the email * @param string $body body of the email + * @param array $headers optional list of email headers * @param string $address optional specification of email address * * @return boolean success flag */ -function mail_to_user(&$user, $subject, $body, $address=null) +function mail_to_user(&$user, $subject, $body, $headers=array(), $address=null) { if (!$address) { $address = $user->email; @@ -180,7 +181,9 @@ function mail_confirm_address($user, $code, $nickname, $address) $nickname, common_config('site', 'name'), common_local_url('confirmaddress', array('code' => $code)), common_config('site', 'name')); - return mail_to_user($user, $subject, $body, $address); + $headers = array(); + + return mail_to_user($user, $subject, $body, $headers, $address); } /** @@ -231,6 +234,7 @@ function mail_subscribe_notify_profile($listenee, $other) $recipients = $listenee->email; + $headers = _mail_prepare_headers('subscribe', $listenee->nickname, $other->nickname); $headers['From'] = mail_notify_from(); $headers['To'] = $name . ' <' . $listenee->email . '>'; $headers['Subject'] = sprintf(_('%1$s is now listening to '. @@ -476,7 +480,10 @@ function mail_notify_nudge($from, $to) common_local_url('all', array('nickname' => $to->nickname)), common_config('site', 'name')); common_init_locale(); - return mail_to_user($to, $subject, $body); + + $headers = _mail_prepare_headers('nudge', $to->nickname, $from->nickname); + + return mail_to_user($to, $subject, $body, $headers); } /** @@ -526,8 +533,10 @@ function mail_notify_message($message, $from=null, $to=null) common_local_url('newmessage', array('to' => $from->id)), common_config('site', 'name')); + $headers = _mail_prepare_headers('message', $to->nickname, $from->nickname); + common_init_locale(); - return mail_to_user($to, $subject, $body); + return mail_to_user($to, $subject, $body, $headers); } /** @@ -578,8 +587,10 @@ function mail_notify_fave($other, $user, $notice) common_config('site', 'name'), $user->nickname); + $headers = _mail_prepare_headers('fave', $other->nickname, $user->nickname); + common_init_locale(); - mail_to_user($other, $subject, $body); + mail_to_user($other, $subject, $body, $headers); } /** @@ -611,19 +622,19 @@ function mail_notify_attn($user, $notice) common_init_locale($user->language); - if ($notice->conversation != $notice->id) { - $conversationEmailText = "The full conversation can be read here:\n\n". - "\t%5\$s\n\n "; - $conversationUrl = common_local_url('conversation', + if ($notice->conversation != $notice->id) { + $conversationEmailText = "The full conversation can be read here:\n\n". + "\t%5\$s\n\n "; + $conversationUrl = common_local_url('conversation', array('id' => $notice->conversation)).'#notice-'.$notice->id; - } else { - $conversationEmailText = "%5\$s"; - $conversationUrl = null; - } + } else { + $conversationEmailText = "%5\$s"; + $conversationUrl = null; + } $subject = sprintf(_('%s (@%s) sent a notice to your attention'), $bestname, $sender->nickname); - $body = sprintf(_("%1\$s (@%9\$s) just sent a notice to your attention (an '@-reply') on %2\$s.\n\n". + $body = sprintf(_("%1\$s (@%9\$s) just sent a notice to your attention (an '@-reply') on %2\$s.\n\n". "The notice is here:\n\n". "\t%3\$s\n\n" . "It reads:\n\n". @@ -641,7 +652,7 @@ function mail_notify_attn($user, $notice) common_local_url('shownotice', array('notice' => $notice->id)),//%3 $notice->content,//%4 - $conversationUrl,//%5 + $conversationUrl,//%5 common_local_url('newnotice', array('replyto' => $sender->nickname, 'inreplyto' => $notice->id)),//%6 common_local_url('replies', @@ -649,6 +660,30 @@ function mail_notify_attn($user, $notice) common_local_url('emailsettings'), //%8 $sender->nickname); //%9 + $headers = _mail_prepare_headers('mention', $user->nickname, $sender->nickname); + common_init_locale(); - mail_to_user($user, $subject, $body); + mail_to_user($user, $subject, $body, $headers); } + +/** + * Prepare the common mail headers used in notification emails + * + * @param string $msg_type type of message being sent to the user + * @param string $to nickname of the receipient + * @param string $from nickname of the user triggering the notification + * + * @return array list of mail headers to include in the message + */ +function _mail_prepare_headers($msg_type, $to, $from) +{ + $headers = array( + 'X-StatusNet-MessageType' => $msg_type, + 'X-StatusNet-TargetUser' => $to, + 'X-StatusNet-SourceUser' => $from, + 'X-StatusNet-Domain' => common_config('site', 'server') + ); + + return $headers; +} + diff --git a/lib/mediafile.php b/lib/mediafile.php index e3d5b1dbc..10d90d008 100644 --- a/lib/mediafile.php +++ b/lib/mediafile.php @@ -262,7 +262,7 @@ class MediaFile $filetype = MIME_Type::autoDetect($stream['uri']); } - if (in_array($filetype, common_config('attachments', 'supported'))) { + if (common_config('attachments', 'supported') === true || in_array($filetype, common_config('attachments', 'supported'))) { return $filetype; } $media = MIME_Type::getMedia($filetype); diff --git a/lib/messageform.php b/lib/messageform.php index 0c568e1bd..b116964da 100644 --- a/lib/messageform.php +++ b/lib/messageform.php @@ -175,6 +175,6 @@ class MessageForm extends Form 'class' => 'submit', 'name' => 'message_send', 'type' => 'submit', - 'value' => _('Send'))); + 'value' => _m('Send button for sending notice', 'Send'))); } } diff --git a/lib/noticeform.php b/lib/noticeform.php index 62df5c941..7278c41a9 100644 --- a/lib/noticeform.php +++ b/lib/noticeform.php @@ -233,6 +233,6 @@ class NoticeForm extends Form 'class' => 'submit', 'name' => 'status_submit', 'type' => 'submit', - 'value' => _('Send'))); + 'value' => _m('Send button for sending notice', 'Send'))); } } diff --git a/lib/noticelist.php b/lib/noticelist.php index 28a563d87..88a925241 100644 --- a/lib/noticelist.php +++ b/lib/noticelist.php @@ -540,22 +540,40 @@ class NoticeListItem extends Widget function showContext() { $hasConversation = false; - if( !empty($this->notice->conversation) - && $this->notice->conversation != $this->notice->id){ - $hasConversation = true; - }else{ - $conversation = Notice::conversationStream($this->notice->id, 1, 1); - if($conversation->N > 0){ + if (!empty($this->notice->conversation)) { + $conversation = Notice::conversationStream( + $this->notice->conversation, + 1, + 1 + ); + if ($conversation->N > 0) { $hasConversation = true; } } - if ($hasConversation){ - $this->out->text(' '); - $convurl = common_local_url('conversation', - array('id' => $this->notice->conversation)); - $this->out->element('a', array('href' => $convurl.'#notice-'.$this->notice->id, - 'class' => 'response'), - _('in context')); + if ($hasConversation) { + $conv = Conversation::staticGet( + 'id', + $this->notice->conversation + ); + $convurl = $conv->uri; + if (!empty($convurl)) { + $this->out->text(' '); + $this->out->element( + 'a', + array( + 'href' => $convurl.'#notice-'.$this->notice->id, + 'class' => 'response'), + _('in context') + ); + } else { + $msg = sprintf( + "Couldn't find Conversation ID %d to make 'in context'" + . "link for Notice ID %d", + $this->notice->conversation, + $this->notice->id + ); + common_log(LOG_WARNING, $msg); + } } } diff --git a/lib/oauthstore.php b/lib/oauthstore.php index eabe37f9f..a6a6de750 100644 --- a/lib/oauthstore.php +++ b/lib/oauthstore.php @@ -390,7 +390,7 @@ class StatusNetOAuthDataStore extends OAuthDataStore $sub->subscribed = $user->id; if (!$sub->find(true)) { - return 0; + return array(); } /* Since we do not use OMB_Service_Provider’s action methods, there diff --git a/lib/omb.php b/lib/omb.php index 17132a594..db60fa0ef 100644 --- a/lib/omb.php +++ b/lib/omb.php @@ -77,7 +77,7 @@ function omb_broadcast_notice($notice) /* Get remote users subscribed to this profile. */ $rp = new Remote_profile(); - $rp->query('SELECT postnoticeurl, token, secret ' . + $rp->query('SELECT remote_profile.*, secret, token ' . 'FROM subscription JOIN remote_profile ' . 'ON subscription.subscriber = remote_profile.id ' . 'WHERE subscription.subscribed = ' . $notice->profile_id . ' '); @@ -93,7 +93,8 @@ function omb_broadcast_notice($notice) /* Post notice. */ $service = new StatusNet_OMB_Service_Consumer( - array(OMB_ENDPOINT_POSTNOTICE => $rp->postnoticeurl)); + array(OMB_ENDPOINT_POSTNOTICE => $rp->postnoticeurl), + $rp->uri); try { $service->setToken($rp->token, $rp->secret); $service->postNotice($omb_notice); @@ -125,7 +126,7 @@ function omb_broadcast_profile($profile) /* Get remote users subscribed to this profile. */ $rp = new Remote_profile(); - $rp->query('SELECT updateprofileurl, token, secret ' . + $rp->query('SELECT remote_profile.*, secret, token ' . 'FROM subscription JOIN remote_profile ' . 'ON subscription.subscriber = remote_profile.id ' . 'WHERE subscription.subscribed = ' . $profile->id . ' '); @@ -141,7 +142,8 @@ function omb_broadcast_profile($profile) /* Update profile. */ $service = new StatusNet_OMB_Service_Consumer( - array(OMB_ENDPOINT_UPDATEPROFILE => $rp->updateprofileurl)); + array(OMB_ENDPOINT_UPDATEPROFILE => $rp->updateprofileurl), + $rp->uri); try { $service->setToken($rp->token, $rp->secret); $service->updateProfile($omb_profile); @@ -159,13 +161,14 @@ function omb_broadcast_profile($profile) } class StatusNet_OMB_Service_Consumer extends OMB_Service_Consumer { - public function __construct($urls) + public function __construct($urls, $listener_uri=null) { $this->services = $urls; $this->datastore = omb_oauth_datastore(); $this->oauth_consumer = omb_oauth_consumer(); $this->fetcher = Auth_Yadis_Yadis::getHTTPFetcher(); $this->fetcher->timeout = intval(common_config('omb', 'timeout')); + $this->listener_uri = $listener_uri; } } diff --git a/lib/profileaction.php b/lib/profileaction.php index 2d4d23265..029c21845 100644 --- a/lib/profileaction.php +++ b/lib/profileaction.php @@ -105,28 +105,30 @@ class ProfileAction extends OwnerDesignAction $this->elementStart('div', array('id' => 'entity_subscriptions', 'class' => 'section')); + if (Event::handle('StartShowSubscriptionsMiniList', array($this))) { + $this->element('h2', null, _('Subscriptions')); - $this->element('h2', null, _('Subscriptions')); + $cnt = 0; - $cnt = 0; + if (!empty($profile)) { + $pml = new ProfileMiniList($profile, $this); + $cnt = $pml->show(); + if ($cnt == 0) { + $this->element('p', null, _('(None)')); + } + } - if (!empty($profile)) { - $pml = new ProfileMiniList($profile, $this); - $cnt = $pml->show(); - if ($cnt == 0) { - $this->element('p', null, _('(None)')); + if ($cnt > PROFILES_PER_MINILIST) { + $this->elementStart('p'); + $this->element('a', array('href' => common_local_url('subscriptions', + array('nickname' => $this->profile->nickname)), + 'class' => 'more'), + _('All subscriptions')); + $this->elementEnd('p'); } - } - if ($cnt > PROFILES_PER_MINILIST) { - $this->elementStart('p'); - $this->element('a', array('href' => common_local_url('subscriptions', - array('nickname' => $this->profile->nickname)), - 'class' => 'more'), - _('All subscriptions')); - $this->elementEnd('p'); + Event::handle('EndShowSubscriptionsMiniList', array($this)); } - $this->elementEnd('div'); } @@ -226,27 +228,29 @@ class ProfileAction extends OwnerDesignAction $this->elementStart('div', array('id' => 'entity_groups', 'class' => 'section')); + if (Event::handle('StartShowGroupsMiniList', array($this))) { + $this->element('h2', null, _('Groups')); + + if ($groups) { + $gml = new GroupMiniList($groups, $this->user, $this); + $cnt = $gml->show(); + if ($cnt == 0) { + $this->element('p', null, _('(None)')); + } + } - $this->element('h2', null, _('Groups')); - - if ($groups) { - $gml = new GroupMiniList($groups, $this->user, $this); - $cnt = $gml->show(); - if ($cnt == 0) { - $this->element('p', null, _('(None)')); + if ($cnt > GROUPS_PER_MINILIST) { + $this->elementStart('p'); + $this->element('a', array('href' => common_local_url('usergroups', + array('nickname' => $this->profile->nickname)), + 'class' => 'more'), + _('All groups')); + $this->elementEnd('p'); } - } - if ($cnt > GROUPS_PER_MINILIST) { - $this->elementStart('p'); - $this->element('a', array('href' => common_local_url('usergroups', - array('nickname' => $this->profile->nickname)), - 'class' => 'more'), - _('All groups')); - $this->elementEnd('p'); + Event::handle('EndShowGroupsMiniList', array($this)); } - - $this->elementEnd('div'); + $this->elementEnd('div'); } } diff --git a/lib/profilelist.php b/lib/profilelist.php index 693cd6449..d970e605a 100644 --- a/lib/profilelist.php +++ b/lib/profilelist.php @@ -273,10 +273,9 @@ class ProfileListItem extends Widget $usf = new UnsubscribeForm($this->out, $this->profile); $usf->show(); } else { - // Is it a local user? can't remote sub from a list - // XXX: make that possible! - $other = User::staticGet('id', $this->profile->id); - if (!empty($other)) { + // We can't initiate sub for a remote OMB profile. + $remote = Remote_profile::staticGet('id', $this->profile->id); + if (empty($remote)) { $sf = new SubscribeForm($this->out, $this->profile); $sf->show(); } diff --git a/lib/profilequeuehandler.php b/lib/profilequeuehandler.php index e8a00aef3..6ce93229b 100644 --- a/lib/profilequeuehandler.php +++ b/lib/profilequeuehandler.php @@ -39,7 +39,11 @@ class ProfileQueueHandler extends QueueHandler if (Event::handle('StartBroadcastProfile', array($profile))) { require_once(INSTALLDIR.'/lib/omb.php'); - omb_broadcast_profile($profile); + try { + omb_broadcast_profile($profile); + } catch (Exception $e) { + common_log(LOG_ERR, "Failed sending OMB profiles: " . $e->getMessage()); + } } Event::handle('EndBroadcastProfile', array($profile)); return true; diff --git a/lib/revokeroleform.php b/lib/revokeroleform.php new file mode 100644 index 000000000..ec24b9910 --- /dev/null +++ b/lib/revokeroleform.php @@ -0,0 +1,93 @@ +<?php +/** + * StatusNet, the distributed open-source microblogging tool + * + * Form for revoking a role + * + * PHP version 5 + * + * LICENCE: This program is free software: you can redistribute it and/or modify + * it under the terms of the GNU Affero General Public License as published by + * the Free Software Foundation, either version 3 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Affero General Public License for more details. + * + * You should have received a copy of the GNU Affero General Public License + * along with this program. If not, see <http://www.gnu.org/licenses/>. + * + * @category Form + * @package StatusNet + * @author Evan Prodromou <evan@status.net>, Brion Vibber <brion@status.net> + * @copyright 2009-2010 StatusNet, Inc. + * @license http://www.fsf.org/licensing/licenses/agpl-3.0.html GNU Affero General Public License version 3.0 + * @link http://status.net/ + */ + +if (!defined('STATUSNET')) { + exit(1); +} + +/** + * Form for sandboxing a user + * + * @category Form + * @package StatusNet + * @author Evan Prodromou <evan@status.net> + * @license http://www.fsf.org/licensing/licenses/agpl-3.0.html GNU Affero General Public License version 3.0 + * @link http://status.net/ + * + * @see UnSandboxForm + */ + +class RevokeRoleForm extends ProfileActionForm +{ + function __construct($role, $label, $writer, $profile, $r2args) + { + parent::__construct($writer, $profile, $r2args); + $this->role = $role; + $this->label = $label; + } + + /** + * Action this form provides + * + * @return string Name of the action, lowercased. + */ + + function target() + { + return 'revokerole'; + } + + /** + * Title of the form + * + * @return string Title of the form, internationalized + */ + + function title() + { + return $this->label; + } + + function formData() + { + parent::formData(); + $this->out->hidden('role', $this->role); + } + + /** + * Description of the form + * + * @return string description of the form, internationalized + */ + + function description() + { + return sprintf(_('Revoke the "%s" role from this user'), $this->label); + } +} diff --git a/lib/right.php b/lib/right.php index 4e9c5a918..deb451fde 100644 --- a/lib/right.php +++ b/lib/right.php @@ -58,5 +58,7 @@ class Right const EMAILONSUBSCRIBE = 'emailonsubscribe'; const EMAILONFAVE = 'emailonfave'; const MAKEGROUPADMIN = 'makegroupadmin'; + const GRANTROLE = 'grantrole'; + const REVOKEROLE = 'revokerole'; } diff --git a/lib/router.php b/lib/router.php index 987d0152e..706120e0b 100644 --- a/lib/router.php +++ b/lib/router.php @@ -98,6 +98,7 @@ class Router 'groupblock', 'groupunblock', 'sandbox', 'unsandbox', 'silence', 'unsilence', + 'grantrole', 'revokerole', 'repeat', 'deleteuser', 'geocode', @@ -247,6 +248,9 @@ class Router $m->connect('group/:nickname/'.$v, array('action' => $v.'group'), array('nickname' => '[a-zA-Z0-9]+')); + $m->connect('group/:id/id/'.$v, + array('action' => $v.'group'), + array('id' => '[0-9]+')); } foreach (array('members', 'logo', 'rss', 'designsettings') as $n) { @@ -646,6 +650,8 @@ class Router $m->connect('admin/access', array('action' => 'accessadminpanel')); $m->connect('admin/paths', array('action' => 'pathsadminpanel')); $m->connect('admin/sessions', array('action' => 'sessionsadminpanel')); + $m->connect('admin/sitenotice', array('action' => 'sitenoticeadminpanel')); + $m->connect('admin/snapshot', array('action' => 'snapshotadminpanel')); $m->connect('getfile/:filename', array('action' => 'getfile'), @@ -668,7 +674,7 @@ class Router foreach (array('subscriptions', 'subscribers', 'all', 'foaf', 'xrds', - 'replies', 'microsummary') as $a) { + 'replies', 'microsummary', 'hcard') as $a) { $m->connect($a, array('action' => $a, 'nickname' => $nickname)); @@ -734,7 +740,7 @@ class Router foreach (array('subscriptions', 'subscribers', 'nudge', 'all', 'foaf', 'xrds', - 'replies', 'inbox', 'outbox', 'microsummary') as $a) { + 'replies', 'inbox', 'outbox', 'microsummary', 'hcard') as $a) { $m->connect(':nickname/'.$a, array('action' => $a), array('nickname' => '[a-zA-Z0-9]{1,64}')); diff --git a/lib/statusnet.php b/lib/statusnet.php index 3f9a48e6a..afb8f5af0 100644 --- a/lib/statusnet.php +++ b/lib/statusnet.php @@ -341,7 +341,11 @@ class StatusNet // Backwards compatibility if (array_key_exists('memcached', $config)) { if ($config['memcached']['enabled']) { - addPlugin('Memcache', array('servers' => $config['memcached']['server'])); + if(class_exists('Memcached')) { + addPlugin('Memcached', array('servers' => $config['memcached']['server'])); + } else { + addPlugin('Memcache', array('servers' => $config['memcached']['server'])); + } } if (!empty($config['memcached']['base'])) { @@ -368,10 +372,10 @@ class StatusNet class NoConfigException extends Exception { - public $config_files; + public $configFiles; - function __construct($msg, $config_files) { + function __construct($msg, $configFiles) { parent::__construct($msg); - $this->config_files = $config_files; + $this->configFiles = $configFiles; } } diff --git a/lib/userprofile.php b/lib/userprofile.php index 43dfd05be..8464c2446 100644 --- a/lib/userprofile.php +++ b/lib/userprofile.php @@ -346,6 +346,16 @@ class UserProfile extends Widget $this->out->elementEnd('ul'); $this->out->elementEnd('li'); } + + if ($cur->hasRight(Right::GRANTROLE)) { + $this->out->elementStart('li', 'entity_role'); + $this->out->element('p', null, _('User role')); + $this->out->elementStart('ul'); + $this->roleButton('administrator', _m('role', 'Administrator')); + $this->roleButton('moderator', _m('role', 'Moderator')); + $this->out->elementEnd('ul'); + $this->out->elementEnd('li'); + } } } @@ -359,6 +369,22 @@ class UserProfile extends Widget } } + function roleButton($role, $label) + { + list($action, $r2args) = $this->out->returnToArgs(); + $r2args['action'] = $action; + + $this->out->elementStart('li', "entity_role_$role"); + if ($this->user->hasRole($role)) { + $rf = new RevokeRoleForm($role, $label, $this->out, $this->profile, $r2args); + $rf->show(); + } else { + $rf = new GrantRoleForm($role, $label, $this->out, $this->profile, $r2args); + $rf->show(); + } + $this->out->elementEnd('li'); + } + function showRemoteSubscribeLink() { $url = common_local_url('remotesubscribe', diff --git a/lib/util.php b/lib/util.php index 82dec0f0c..6a8494275 100644 --- a/lib/util.php +++ b/lib/util.php @@ -105,11 +105,13 @@ function common_language() // Otherwise, find the best match for the languages requested by the // user's browser... - $httplang = isset($_SERVER['HTTP_ACCEPT_LANGUAGE']) ? $_SERVER['HTTP_ACCEPT_LANGUAGE'] : null; - if (!empty($httplang)) { - $language = client_prefered_language($httplang); - if ($language) - return $language; + if (common_config('site', 'langdetect')) { + $httplang = isset($_SERVER['HTTP_ACCEPT_LANGUAGE']) ? $_SERVER['HTTP_ACCEPT_LANGUAGE'] : null; + if (!empty($httplang)) { + $language = client_prefered_language($httplang); + if ($language) + return $language; + } } // Finally, if none of the above worked, use the site's default... @@ -134,7 +136,7 @@ function common_check_user($nickname, $password) $authenticatedUser = false; if (Event::handle('StartCheckPassword', array($nickname, $password, &$authenticatedUser))) { - $user = User::staticGet('nickname', $nickname); + $user = User::staticGet('nickname', common_canonical_nickname($nickname)); if (!empty($user)) { if (!empty($password)) { // never allow login with blank password if (0 == strcmp(common_munge_password($password, $user->id), @@ -426,14 +428,14 @@ function common_render_content($text, $notice) { $r = common_render_text($text); $id = $notice->profile_id; - $r = common_linkify_mentions($id, $r); + $r = common_linkify_mentions($r, $notice); $r = preg_replace('/(^|[\s\.\,\:\;]+)!([A-Za-z0-9]{1,64})/e', "'\\1!'.common_group_link($id, '\\2')", $r); return $r; } -function common_linkify_mentions($profile_id, $text) +function common_linkify_mentions($text, $notice) { - $mentions = common_find_mentions($profile_id, $text); + $mentions = common_find_mentions($text, $notice); // We need to go through in reverse order by position, // so our positions stay valid despite our fudging with the @@ -487,11 +489,11 @@ function common_linkify_mention($mention) return $output; } -function common_find_mentions($profile_id, $text) +function common_find_mentions($text, $notice) { $mentions = array(); - $sender = Profile::staticGet('id', $profile_id); + $sender = Profile::staticGet('id', $notice->profile_id); if (empty($sender)) { return $mentions; @@ -499,6 +501,30 @@ function common_find_mentions($profile_id, $text) if (Event::handle('StartFindMentions', array($sender, $text, &$mentions))) { + // Get the context of the original notice, if any + + $originalAuthor = null; + $originalNotice = null; + $originalMentions = array(); + + // Is it a reply? + + if (!empty($notice) && !empty($notice->reply_to)) { + $originalNotice = Notice::staticGet('id', $notice->reply_to); + if (!empty($originalNotice)) { + $originalAuthor = Profile::staticGet('id', $originalNotice->profile_id); + + $ids = $originalNotice->getReplies(); + + foreach ($ids as $id) { + $repliedTo = Profile::staticGet('id', $id); + if (!empty($repliedTo)) { + $originalMentions[$repliedTo->nickname] = $repliedTo; + } + } + } + } + preg_match_all('/^T ([A-Z0-9]{1,64}) /', $text, $tmatches, @@ -514,7 +540,22 @@ function common_find_mentions($profile_id, $text) foreach ($matches as $match) { $nickname = common_canonical_nickname($match[0]); - $mentioned = common_relative_profile($sender, $nickname); + + // Try to get a profile for this nickname. + // Start with conversation context, then go to + // sender context. + + if (!empty($originalAuthor) && $originalAuthor->nickname == $nickname) { + + $mentioned = $originalAuthor; + + } else if (!empty($originalMentions) && + array_key_exists($nickname, $originalMentions)) { + + $mentioned = $originalMentions[$nickname]; + } else { + $mentioned = common_relative_profile($sender, $nickname); + } if (!empty($mentioned)) { @@ -763,8 +804,28 @@ function common_shorten_links($text) function common_xml_safe_str($str) { - // Neutralize control codes and surrogates - return preg_replace('/[\p{Cc}\p{Cs}]/u', '*', $str); + // Replace common eol and extra whitespace input chars + $unWelcome = array( + "\t", // tab + "\n", // newline + "\r", // cr + "\0", // null byte eos + "\x0B" // vertical tab + ); + + $replacement = array( + ' ', // single space + ' ', + '', // nothing + '', + ' ' + ); + + $str = str_replace($unWelcome, $replacement, $str); + + // Neutralize any additional control codes and UTF-16 surrogates + // (Twitter uses '*') + return preg_replace('/[\p{Cc}\p{Cs}]/u', '*', $str); } function common_tag_link($tag) @@ -794,7 +855,7 @@ function common_valid_profile_tag($str) function common_group_link($sender_id, $nickname) { $sender = Profile::staticGet($sender_id); - $group = User_group::getForNickname($nickname); + $group = User_group::getForNickname($nickname, $sender); if ($sender && $group && $sender->isMember($group)) { $attrs = array('href' => $group->permalink(), 'class' => 'url'); @@ -849,7 +910,7 @@ function common_relative_profile($sender, $nickname, $dt=null) return null; } -function common_local_url($action, $args=null, $params=null, $fragment=null) +function common_local_url($action, $args=null, $params=null, $fragment=null, $addSession=true) { $r = Router::get(); $path = $r->build($action, $args, $params, $fragment); @@ -857,12 +918,12 @@ function common_local_url($action, $args=null, $params=null, $fragment=null) $ssl = common_is_sensitive($action); if (common_config('site','fancy')) { - $url = common_path(mb_substr($path, 1), $ssl); + $url = common_path(mb_substr($path, 1), $ssl, $addSession); } else { if (mb_strpos($path, '/index.php') === 0) { - $url = common_path(mb_substr($path, 1), $ssl); + $url = common_path(mb_substr($path, 1), $ssl, $addSession); } else { - $url = common_path('index.php'.$path, $ssl); + $url = common_path('index.php'.$path, $ssl, $addSession); } } return $url; @@ -881,7 +942,7 @@ function common_is_sensitive($action) return $ssl; } -function common_path($relative, $ssl=false) +function common_path($relative, $ssl=false, $addSession=true) { $pathpart = (common_config('site', 'path')) ? common_config('site', 'path')."/" : ''; @@ -905,7 +966,9 @@ function common_path($relative, $ssl=false) } } - $relative = common_inject_session($relative, $serverpart); + if ($addSession) { + $relative = common_inject_session($relative, $serverpart); + } return $proto.'://'.$serverpart.'/'.$pathpart.$relative; } @@ -1118,14 +1181,15 @@ function common_broadcast_profile(Profile $profile) function common_profile_url($nickname) { - return common_local_url('showstream', array('nickname' => $nickname)); + return common_local_url('showstream', array('nickname' => $nickname), + null, null, false); } // Should make up a reasonable root URL function common_root_url($ssl=false) { - $url = common_path('', $ssl); + $url = common_path('', $ssl, false); $i = strpos($url, '?'); if ($i !== false) { $url = substr($url, 0, $i); @@ -1410,7 +1474,8 @@ function common_remove_magic_from_request() function common_user_uri(&$user) { - return common_local_url('userbyid', array('id' => $user->id)); + return common_local_url('userbyid', array('id' => $user->id), + null, null, false); } function common_notice_uri(&$notice) @@ -1590,6 +1655,7 @@ function common_database_tablename($tablename) */ function common_shorten_url($long_url) { + $long_url = trim($long_url); $user = common_current_user(); if (empty($user)) { // common current user does not find a user when called from the XMPP daemon @@ -1604,7 +1670,7 @@ function common_shorten_url($long_url) return $long_url; }else{ //URL was shortened, so return the result - return $shortenedUrl; + return trim($shortenedUrl); } } @@ -1681,7 +1747,8 @@ function common_url_to_nickname($url) # Strip starting, ending slashes $path = preg_replace('@/$@', '', $parts['path']); $path = preg_replace('@^/@', '', $path); - if (strpos($path, '/') === false) { + $path = basename($path); + if ($path) { return common_nicknamize($path); } } |