diff options
Diffstat (limited to 'lib')
40 files changed, 2517 insertions, 1191 deletions
diff --git a/lib/action.php b/lib/action.php index 9884f529c..491d7d481 100644 --- a/lib/action.php +++ b/lib/action.php @@ -426,39 +426,69 @@ class Action extends HTMLOutputter // lawsuit $this->elementStart('ul', array('class' => 'nav')); if (Event::handle('StartPrimaryNav', array($this))) { if ($user) { + // TRANS: Tooltip for main menu option "Personal" + $tooltip = _m('TOOLTIP', 'Personal profile and friends timeline'); + // TRANS: Main menu option when logged in for access to personal profile and friends timeline $this->menuItem(common_local_url('all', array('nickname' => $user->nickname)), - _('Home'), _('Personal profile and friends timeline'), false, 'nav_home'); + _m('MENU', 'Personal'), $tooltip, false, 'nav_home'); + // TRANS: Tooltip for main menu option "Account" + $tooltip = _m('TOOLTIP', 'Change your email, avatar, password, profile'); + // TRANS: Main menu option when logged in for access to user settings $this->menuItem(common_local_url('profilesettings'), - _('Account'), _('Change your email, avatar, password, profile'), false, 'nav_account'); + _('Account'), $tooltip, false, 'nav_account'); + // TRANS: Tooltip for main menu option "Services" + $tooltip = _m('TOOLTIP', 'Connect to services'); + // TRANS: Main menu option when logged in and connection are possible for access to options to connect to other services $this->menuItem(common_local_url('oauthconnectionssettings'), - _('Connect'), _('Connect to services'), false, 'nav_connect'); + _('Connect'), $tooltip, false, 'nav_connect'); if ($user->hasRight(Right::CONFIGURESITE)) { + // TRANS: Tooltip for menu option "Admin" + $tooltip = _m('TOOLTIP', 'Change site configuration'); + // TRANS: Main menu option when logged in and site admin for access to site configuration $this->menuItem(common_local_url('siteadminpanel'), - _('Admin'), _('Change site configuration'), false, 'nav_admin'); + _m('MENU', 'Admin'), $tooltip, false, 'nav_admin'); } if (common_config('invite', 'enabled')) { + // TRANS: Tooltip for main menu option "Invite" + $tooltip = _m('TOOLTIP', 'Invite friends and colleagues to join you on %s'); + // TRANS: Main menu option when logged in and invitations are allowed for inviting new users $this->menuItem(common_local_url('invite'), - _('Invite'), - sprintf(_('Invite friends and colleagues to join you on %s'), + _m('MENU', 'Invite'), + sprintf($tooltip, common_config('site', 'name')), false, 'nav_invitecontact'); } + // TRANS: Tooltip for main menu option "Logout" + $tooltip = _m('TOOLTIP', 'Logout from the site'); + // TRANS: Main menu option when logged in to log out the current user $this->menuItem(common_local_url('logout'), - _('Logout'), _('Logout from the site'), false, 'nav_logout'); + _m('MENU', 'Logout'), $tooltip, false, 'nav_logout'); } else { if (!common_config('site', 'closed')) { + // TRANS: Tooltip for main menu option "Register" + $tooltip = _m('TOOLTIP', 'Create an account'); + // TRANS: Main menu option when not logged in to register a new account $this->menuItem(common_local_url('register'), - _('Register'), _('Create an account'), false, 'nav_register'); + _m('MENU', 'Register'), $tooltip, false, 'nav_register'); } + // TRANS: Tooltip for main menu option "Login" + $tooltip = _m('TOOLTIP', 'Login to the site'); + // TRANS: Main menu option when not logged in to log in $this->menuItem(common_local_url('login'), - _('Login'), _('Login to the site'), false, 'nav_login'); + _m('MENU', 'Login'), $tooltip, false, 'nav_login'); } + // TRANS: Tooltip for main menu option "Help" + $tooltip = _m('TOOLTIP', 'Help me!'); + // TRANS: Main menu option for help on the StatusNet site $this->menuItem(common_local_url('doc', array('title' => 'help')), - _('Help'), _('Help me!'), false, 'nav_help'); + _m('MENU', 'Help'), $tooltip, false, 'nav_help'); if ($user || !common_config('site', 'private')) { + // TRANS: Tooltip for main menu option "Search" + $tooltip = _m('TOOLTIP', 'Search for people or text'); + // TRANS: Main menu option when logged in or when the StatusNet instance is not private $this->menuItem(common_local_url('peoplesearch'), - _('Search'), _('Search for people or text'), false, 'nav_search'); + _m('MENU', 'Search'), $tooltip, false, 'nav_search'); } Event::handle('EndPrimaryNav', array($this)); } @@ -479,6 +509,7 @@ class Action extends HTMLOutputter // lawsuit if ($text) { $this->elementStart('dl', array('id' => 'site_notice', 'class' => 'system_notice')); + // TRANS: DT element for site notice. String is hidden in default CSS. $this->element('dt', null, _('Site notice')); $this->elementStart('dd', null); $this->raw($text); diff --git a/lib/activity.php b/lib/activity.php index 2cb80f9e1..f9192c6b8 100644 --- a/lib/activity.php +++ b/lib/activity.php @@ -32,971 +32,6 @@ if (!defined('STATUSNET')) { exit(1); } -class PoCoURL -{ - const URLS = 'urls'; - const TYPE = 'type'; - const VALUE = 'value'; - const PRIMARY = 'primary'; - - public $type; - public $value; - public $primary; - - function __construct($type, $value, $primary = false) - { - $this->type = $type; - $this->value = $value; - $this->primary = $primary; - } - - function asString() - { - $xs = new XMLStringer(true); - $xs->elementStart('poco:urls'); - $xs->element('poco:type', null, $this->type); - $xs->element('poco:value', null, $this->value); - if (!empty($this->primary)) { - $xs->element('poco:primary', null, 'true'); - } - $xs->elementEnd('poco:urls'); - return $xs->getString(); - } -} - -class PoCoAddress -{ - const ADDRESS = 'address'; - const FORMATTED = 'formatted'; - - public $formatted; - - // @todo Other address fields - - function asString() - { - if (!empty($this->formatted)) { - $xs = new XMLStringer(true); - $xs->elementStart('poco:address'); - $xs->element('poco:formatted', null, $this->formatted); - $xs->elementEnd('poco:address'); - return $xs->getString(); - } - - return null; - } -} - -class PoCo -{ - const NS = 'http://portablecontacts.net/spec/1.0'; - - const USERNAME = 'preferredUsername'; - const DISPLAYNAME = 'displayName'; - const NOTE = 'note'; - - public $preferredUsername; - public $displayName; - public $note; - public $address; - public $urls = array(); - - function __construct($element = null) - { - if (empty($element)) { - return; - } - - $this->preferredUsername = ActivityUtils::childContent( - $element, - self::USERNAME, - self::NS - ); - - $this->displayName = ActivityUtils::childContent( - $element, - self::DISPLAYNAME, - self::NS - ); - - $this->note = ActivityUtils::childContent( - $element, - self::NOTE, - self::NS - ); - - $this->address = $this->_getAddress($element); - $this->urls = $this->_getURLs($element); - } - - private function _getURLs($element) - { - $urlEls = $element->getElementsByTagnameNS(self::NS, PoCoURL::URLS); - $urls = array(); - - foreach ($urlEls as $urlEl) { - - $type = ActivityUtils::childContent( - $urlEl, - PoCoURL::TYPE, - PoCo::NS - ); - - $value = ActivityUtils::childContent( - $urlEl, - PoCoURL::VALUE, - PoCo::NS - ); - - $primary = ActivityUtils::childContent( - $urlEl, - PoCoURL::PRIMARY, - PoCo::NS - ); - - $isPrimary = false; - - if (isset($primary) && $primary == 'true') { - $isPrimary = true; - } - - // @todo check to make sure a primary hasn't already been added - - array_push($urls, new PoCoURL($type, $value, $isPrimary)); - } - return $urls; - } - - private function _getAddress($element) - { - $addressEl = ActivityUtils::child( - $element, - PoCoAddress::ADDRESS, - PoCo::NS - ); - - if (!empty($addressEl)) { - $formatted = ActivityUtils::childContent( - $addressEl, - PoCoAddress::FORMATTED, - self::NS - ); - - if (!empty($formatted)) { - $address = new PoCoAddress(); - $address->formatted = $formatted; - return $address; - } - } - - return null; - } - - function fromProfile($profile) - { - if (empty($profile)) { - return null; - } - - $poco = new PoCo(); - - $poco->preferredUsername = $profile->nickname; - $poco->displayName = $profile->getBestName(); - - $poco->note = $profile->bio; - - $paddy = new PoCoAddress(); - $paddy->formatted = $profile->location; - $poco->address = $paddy; - - if (!empty($profile->homepage)) { - array_push( - $poco->urls, - new PoCoURL( - 'homepage', - $profile->homepage, - true - ) - ); - } - - return $poco; - } - - function fromGroup($group) - { - if (empty($group)) { - return null; - } - - $poco = new PoCo(); - - $poco->preferredUsername = $group->nickname; - $poco->displayName = $group->getBestName(); - - $poco->note = $group->description; - - $paddy = new PoCoAddress(); - $paddy->formatted = $group->location; - $poco->address = $paddy; - - if (!empty($group->homepage)) { - array_push( - $poco->urls, - new PoCoURL( - 'homepage', - $group->homepage, - true - ) - ); - } - - return $poco; - } - - function getPrimaryURL() - { - foreach ($this->urls as $url) { - if ($url->primary) { - return $url; - } - } - } - - function asString() - { - $xs = new XMLStringer(true); - $xs->element( - 'poco:preferredUsername', - null, - $this->preferredUsername - ); - - $xs->element( - 'poco:displayName', - null, - $this->displayName - ); - - if (!empty($this->note)) { - $xs->element('poco:note', null, $this->note); - } - - if (!empty($this->address)) { - $xs->raw($this->address->asString()); - } - - foreach ($this->urls as $url) { - $xs->raw($url->asString()); - } - - return $xs->getString(); - } -} - -/** - * Utilities for turning DOMish things into Activityish things - * - * Some common functions that I didn't have the bandwidth to try to factor - * into some kind of reasonable superclass, so just dumped here. Might - * be useful to have an ActivityObject parent class or something. - * - * @category OStatus - * @package StatusNet - * @author Evan Prodromou <evan@status.net> - * @copyright 2010 StatusNet, Inc. - * @license http://www.fsf.org/licensing/licenses/agpl-3.0.html AGPLv3 - * @link http://status.net/ - */ - -class ActivityUtils -{ - const ATOM = 'http://www.w3.org/2005/Atom'; - - const LINK = 'link'; - const REL = 'rel'; - const TYPE = 'type'; - const HREF = 'href'; - - const CONTENT = 'content'; - const SRC = 'src'; - - /** - * Get the permalink for an Activity object - * - * @param DOMElement $element A DOM element - * - * @return string related link, if any - */ - - static function getPermalink($element) - { - return self::getLink($element, 'alternate', 'text/html'); - } - - /** - * Get the permalink for an Activity object - * - * @param DOMElement $element A DOM element - * - * @return string related link, if any - */ - - static function getLink(DOMNode $element, $rel, $type=null) - { - $els = $element->childNodes; - - foreach ($els as $link) { - if ($link->localName == self::LINK && $link->namespaceURI == self::ATOM) { - - $linkRel = $link->getAttribute(self::REL); - $linkType = $link->getAttribute(self::TYPE); - - if ($linkRel == $rel && - (is_null($type) || $linkType == $type)) { - return $link->getAttribute(self::HREF); - } - } - } - - return null; - } - - static function getLinks(DOMNode $element, $rel, $type=null) - { - $els = $element->childNodes; - $out = array(); - - foreach ($els as $link) { - if ($link->localName == self::LINK && $link->namespaceURI == self::ATOM) { - - $linkRel = $link->getAttribute(self::REL); - $linkType = $link->getAttribute(self::TYPE); - - if ($linkRel == $rel && - (is_null($type) || $linkType == $type)) { - $out[] = $link; - } - } - } - - return $out; - } - - /** - * Gets the first child element with the given tag - * - * @param DOMElement $element element to pick at - * @param string $tag tag to look for - * @param string $namespace Namespace to look under - * - * @return DOMElement found element or null - */ - - static function child(DOMNode $element, $tag, $namespace=self::ATOM) - { - $els = $element->childNodes; - if (empty($els) || $els->length == 0) { - return null; - } else { - for ($i = 0; $i < $els->length; $i++) { - $el = $els->item($i); - if ($el->localName == $tag && $el->namespaceURI == $namespace) { - return $el; - } - } - } - } - - /** - * Grab the text content of a DOM element child of the current element - * - * @param DOMElement $element Element whose children we examine - * @param string $tag Tag to look up - * @param string $namespace Namespace to use, defaults to Atom - * - * @return string content of the child - */ - - static function childContent(DOMNode $element, $tag, $namespace=self::ATOM) - { - $el = self::child($element, $tag, $namespace); - - if (empty($el)) { - return null; - } else { - return $el->textContent; - } - } - - /** - * Get the content of an atom:entry-like object - * - * @param DOMElement $element The element to examine. - * - * @return string unencoded HTML content of the element, like "This -< is <b>HTML</b>." - * - * @todo handle remote content - * @todo handle embedded XML mime types - * @todo handle base64-encoded non-XML and non-text mime types - */ - - static function getContent($element) - { - $contentEl = ActivityUtils::child($element, self::CONTENT); - - if (!empty($contentEl)) { - - $src = $contentEl->getAttribute(self::SRC); - - if (!empty($src)) { - throw new ClientException(_("Can't handle remote content yet.")); - } - - $type = $contentEl->getAttribute(self::TYPE); - - // slavishly following http://atompub.org/rfc4287.html#rfc.section.4.1.3.3 - - if ($type == 'text') { - return $contentEl->textContent; - } else if ($type == 'html') { - $text = $contentEl->textContent; - return htmlspecialchars_decode($text, ENT_QUOTES); - } else if ($type == 'xhtml') { - $divEl = ActivityUtils::child($contentEl, 'div'); - if (empty($divEl)) { - return null; - } - $doc = $divEl->ownerDocument; - $text = ''; - $children = $divEl->childNodes; - - for ($i = 0; $i < $children->length; $i++) { - $child = $children->item($i); - $text .= $doc->saveXML($child); - } - return trim($text); - } else if (in_array(array('text/xml', 'application/xml'), $type) || - preg_match('#(+|/)xml$#', $type)) { - throw new ClientException(_("Can't handle embedded XML content yet.")); - } else if (strncasecmp($type, 'text/', 5)) { - return $contentEl->textContent; - } else { - throw new ClientException(_("Can't handle embedded Base64 content yet.")); - } - } - } -} - -// XXX: Arg! This wouldn't be necessary if we used Avatars conistently -class AvatarLink -{ - public $url; - public $type; - public $size; - public $width; - public $height; - - function __construct($element=null) - { - if ($element) { - // @fixme use correct namespaces - $this->url = $element->getAttribute('href'); - $this->type = $element->getAttribute('type'); - $width = $element->getAttribute('media:width'); - if ($width != null) { - $this->width = intval($width); - } - $height = $element->getAttribute('media:height'); - if ($height != null) { - $this->height = intval($height); - } - } - } - - static function fromAvatar($avatar) - { - if (empty($avatar)) { - return null; - } - $alink = new AvatarLink(); - $alink->type = $avatar->mediatype; - $alink->height = $avatar->height; - $alink->width = $avatar->width; - $alink->url = $avatar->displayUrl(); - return $alink; - } - - static function fromFilename($filename, $size) - { - $alink = new AvatarLink(); - $alink->url = $filename; - $alink->height = $size; - if (!empty($filename)) { - $alink->width = $size; - $alink->type = self::mediatype($filename); - } else { - $alink->url = User_group::defaultLogo($size); - $alink->type = 'image/png'; - } - return $alink; - } - - // yuck! - static function mediatype($filename) { - $ext = strtolower(end(explode('.', $filename))); - if ($ext == 'jpeg') { - $ext = 'jpg'; - } - // hope we don't support any others - $types = array('png', 'gif', 'jpg', 'jpeg'); - if (in_array($ext, $types)) { - return 'image/' . $ext; - } - return null; - } -} - -/** - * A noun-ish thing in the activity universe - * - * The activity streams spec talks about activity objects, while also having - * a tag activity:object, which is in fact an activity object. Aaaaaah! - * - * This is just a thing in the activity universe. Can be the subject, object, - * or indirect object (target!) of an activity verb. Rotten name, and I'm - * propagating it. *sigh* - * - * @category OStatus - * @package StatusNet - * @author Evan Prodromou <evan@status.net> - * @copyright 2010 StatusNet, Inc. - * @license http://www.fsf.org/licensing/licenses/agpl-3.0.html AGPLv3 - * @link http://status.net/ - */ - -class ActivityObject -{ - const ARTICLE = 'http://activitystrea.ms/schema/1.0/article'; - const BLOGENTRY = 'http://activitystrea.ms/schema/1.0/blog-entry'; - const NOTE = 'http://activitystrea.ms/schema/1.0/note'; - const STATUS = 'http://activitystrea.ms/schema/1.0/status'; - const FILE = 'http://activitystrea.ms/schema/1.0/file'; - const PHOTO = 'http://activitystrea.ms/schema/1.0/photo'; - const ALBUM = 'http://activitystrea.ms/schema/1.0/photo-album'; - const PLAYLIST = 'http://activitystrea.ms/schema/1.0/playlist'; - const VIDEO = 'http://activitystrea.ms/schema/1.0/video'; - const AUDIO = 'http://activitystrea.ms/schema/1.0/audio'; - const BOOKMARK = 'http://activitystrea.ms/schema/1.0/bookmark'; - const PERSON = 'http://activitystrea.ms/schema/1.0/person'; - const GROUP = 'http://activitystrea.ms/schema/1.0/group'; - const PLACE = 'http://activitystrea.ms/schema/1.0/place'; - const COMMENT = 'http://activitystrea.ms/schema/1.0/comment'; - // ^^^^^^^^^^ tea! - - // Atom elements we snarf - - const TITLE = 'title'; - const SUMMARY = 'summary'; - const ID = 'id'; - const SOURCE = 'source'; - - const NAME = 'name'; - const URI = 'uri'; - const EMAIL = 'email'; - - public $element; - public $type; - public $id; - public $title; - public $summary; - public $content; - public $link; - public $source; - public $avatarLinks = array(); - public $geopoint; - public $poco; - public $displayName; - - /** - * Constructor - * - * This probably needs to be refactored - * to generate a local class (ActivityPerson, ActivityFile, ...) - * based on the object type. - * - * @param DOMElement $element DOM thing to turn into an Activity thing - */ - - function __construct($element = null) - { - if (empty($element)) { - return; - } - - $this->element = $element; - - $this->geopoint = $this->_childContent( - $element, - ActivityContext::POINT, - ActivityContext::GEORSS - ); - - if ($element->tagName == 'author') { - - $this->type = self::PERSON; // XXX: is this fair? - $this->title = $this->_childContent($element, self::NAME); - $this->id = $this->_childContent($element, self::URI); - - if (empty($this->id)) { - $email = $this->_childContent($element, self::EMAIL); - if (!empty($email)) { - // XXX: acct: ? - $this->id = 'mailto:'.$email; - } - } - - } else { - - $this->type = $this->_childContent($element, Activity::OBJECTTYPE, - Activity::SPEC); - - if (empty($this->type)) { - $this->type = ActivityObject::NOTE; - } - - $this->id = $this->_childContent($element, self::ID); - $this->title = $this->_childContent($element, self::TITLE); - $this->summary = $this->_childContent($element, self::SUMMARY); - - $this->source = $this->_getSource($element); - - $this->content = ActivityUtils::getContent($element); - - $this->link = ActivityUtils::getPermalink($element); - - } - - // Some per-type attributes... - if ($this->type == self::PERSON || $this->type == self::GROUP) { - $this->displayName = $this->title; - - $avatars = ActivityUtils::getLinks($element, 'avatar'); - foreach ($avatars as $link) { - $this->avatarLinks[] = new AvatarLink($link); - } - - $this->poco = new PoCo($element); - } - } - - private function _childContent($element, $tag, $namespace=ActivityUtils::ATOM) - { - return ActivityUtils::childContent($element, $tag, $namespace); - } - - // Try to get a unique id for the source feed - - private function _getSource($element) - { - $sourceEl = ActivityUtils::child($element, 'source'); - - if (empty($sourceEl)) { - return null; - } else { - $href = ActivityUtils::getLink($sourceEl, 'self'); - if (!empty($href)) { - return $href; - } else { - return ActivityUtils::childContent($sourceEl, 'id'); - } - } - } - - static function fromNotice($notice) - { - $object = new ActivityObject(); - - $object->type = ActivityObject::NOTE; - - $object->id = $notice->uri; - $object->title = $notice->content; - $object->content = $notice->rendered; - $object->link = $notice->bestUrl(); - - return $object; - } - - static function fromProfile($profile) - { - $object = new ActivityObject(); - - $object->type = ActivityObject::PERSON; - $object->id = $profile->getUri(); - $object->title = $profile->getBestName(); - $object->link = $profile->profileurl; - - $orig = $profile->getOriginalAvatar(); - - if (!empty($orig)) { - $object->avatarLinks[] = AvatarLink::fromAvatar($orig); - } - - $sizes = array( - AVATAR_PROFILE_SIZE, - AVATAR_STREAM_SIZE, - AVATAR_MINI_SIZE - ); - - foreach ($sizes as $size) { - - $alink = null; - $avatar = $profile->getAvatar($size); - - if (!empty($avatar)) { - $alink = AvatarLink::fromAvatar($avatar); - } else { - $alink = new AvatarLink(); - $alink->type = 'image/png'; - $alink->height = $size; - $alink->width = $size; - $alink->url = Avatar::defaultImage($size); - } - - $object->avatarLinks[] = $alink; - } - - if (isset($profile->lat) && isset($profile->lon)) { - $object->geopoint = (float)$profile->lat - . ' ' . (float)$profile->lon; - } - - $object->poco = PoCo::fromProfile($profile); - - return $object; - } - - static function fromGroup($group) - { - $object = new ActivityObject(); - - $object->type = ActivityObject::GROUP; - $object->id = $group->getUri(); - $object->title = $group->getBestName(); - $object->link = $group->getUri(); - - $object->avatarLinks[] = AvatarLink::fromFilename( - $group->homepage_logo, - AVATAR_PROFILE_SIZE - ); - - $object->avatarLinks[] = AvatarLink::fromFilename( - $group->stream_logo, - AVATAR_STREAM_SIZE - ); - - $object->avatarLinks[] = AvatarLink::fromFilename( - $group->mini_logo, - AVATAR_MINI_SIZE - ); - - $object->poco = PoCo::fromGroup($group); - - return $object; - } - - - function asString($tag='activity:object') - { - $xs = new XMLStringer(true); - - $xs->elementStart($tag); - - $xs->element('activity:object-type', null, $this->type); - - $xs->element(self::ID, null, $this->id); - - if (!empty($this->title)) { - $xs->element(self::TITLE, null, $this->title); - } - - if (!empty($this->summary)) { - $xs->element(self::SUMMARY, null, $this->summary); - } - - if (!empty($this->content)) { - // XXX: assuming HTML content here - $xs->element(ActivityUtils::CONTENT, array('type' => 'html'), $this->content); - } - - if (!empty($this->link)) { - $xs->element( - 'link', - array( - 'rel' => 'alternate', - 'type' => 'text/html', - 'href' => $this->link - ), - null - ); - } - - if ($this->type == ActivityObject::PERSON - || $this->type == ActivityObject::GROUP) { - - foreach ($this->avatarLinks as $avatar) { - $xs->element( - 'link', array( - 'rel' => 'avatar', - 'type' => $avatar->type, - 'media:width' => $avatar->width, - 'media:height' => $avatar->height, - 'href' => $avatar->url - ), - null - ); - } - } - - if (!empty($this->geopoint)) { - $xs->element( - 'georss:point', - null, - $this->geopoint - ); - } - - if (!empty($this->poco)) { - $xs->raw($this->poco->asString()); - } - - $xs->elementEnd($tag); - - return $xs->getString(); - } -} - -/** - * Utility class to hold a bunch of constant defining default verb types - * - * @category OStatus - * @package StatusNet - * @author Evan Prodromou <evan@status.net> - * @copyright 2010 StatusNet, Inc. - * @license http://www.fsf.org/licensing/licenses/agpl-3.0.html AGPLv3 - * @link http://status.net/ - */ - -class ActivityVerb -{ - const POST = 'http://activitystrea.ms/schema/1.0/post'; - const SHARE = 'http://activitystrea.ms/schema/1.0/share'; - const SAVE = 'http://activitystrea.ms/schema/1.0/save'; - const FAVORITE = 'http://activitystrea.ms/schema/1.0/favorite'; - const PLAY = 'http://activitystrea.ms/schema/1.0/play'; - const FOLLOW = 'http://activitystrea.ms/schema/1.0/follow'; - const FRIEND = 'http://activitystrea.ms/schema/1.0/make-friend'; - const JOIN = 'http://activitystrea.ms/schema/1.0/join'; - const TAG = 'http://activitystrea.ms/schema/1.0/tag'; - - // Custom OStatus verbs for the flipside until they're standardized - const DELETE = 'http://ostatus.org/schema/1.0/unfollow'; - const UNFAVORITE = 'http://ostatus.org/schema/1.0/unfavorite'; - const UNFOLLOW = 'http://ostatus.org/schema/1.0/unfollow'; - const LEAVE = 'http://ostatus.org/schema/1.0/leave'; - - // For simple profile-update pings; no content to share. - const UPDATE_PROFILE = 'http://ostatus.org/schema/1.0/update-profile'; -} - -class ActivityContext -{ - public $replyToID; - public $replyToUrl; - public $location; - public $attention = array(); - public $conversation; - - const THR = 'http://purl.org/syndication/thread/1.0'; - const GEORSS = 'http://www.georss.org/georss'; - const OSTATUS = 'http://ostatus.org/schema/1.0'; - - const INREPLYTO = 'in-reply-to'; - const REF = 'ref'; - const HREF = 'href'; - - const POINT = 'point'; - - const ATTENTION = 'ostatus:attention'; - const CONVERSATION = 'ostatus:conversation'; - - function __construct($element) - { - $replyToEl = ActivityUtils::child($element, self::INREPLYTO, self::THR); - - if (!empty($replyToEl)) { - $this->replyToID = $replyToEl->getAttribute(self::REF); - $this->replyToUrl = $replyToEl->getAttribute(self::HREF); - } - - $this->location = $this->getLocation($element); - - $this->conversation = ActivityUtils::getLink($element, self::CONVERSATION); - - // Multiple attention links allowed - - $links = $element->getElementsByTagNameNS(ActivityUtils::ATOM, ActivityUtils::LINK); - - for ($i = 0; $i < $links->length; $i++) { - - $link = $links->item($i); - - $linkRel = $link->getAttribute(ActivityUtils::REL); - - if ($linkRel == self::ATTENTION) { - $this->attention[] = $link->getAttribute(self::HREF); - } - } - } - - /** - * Parse location given as a GeoRSS-simple point, if provided. - * http://www.georss.org/simple - * - * @param feed item $entry - * @return mixed Location or false - */ - function getLocation($dom) - { - $points = $dom->getElementsByTagNameNS(self::GEORSS, self::POINT); - - for ($i = 0; $i < $points->length; $i++) { - $point = $points->item($i)->textContent; - return self::locationFromPoint($point); - } - - return null; - } - - // XXX: Move to ActivityUtils or Location? - static function locationFromPoint($point) - { - $point = str_replace(',', ' ', $point); // per spec "treat commas as whitespace" - $point = preg_replace('/\s+/', ' ', $point); - $point = trim($point); - $coords = explode(' ', $point); - if (count($coords) == 2) { - list($lat, $lon) = $coords; - if (is_numeric($lat) && is_numeric($lon)) { - common_log(LOG_INFO, "Looking up location for $lat $lon from georss point"); - return Location::fromLatLon($lat, $lon); - } - } - common_log(LOG_ERR, "Ignoring bogus georss:point value $point"); - return null; - } -} - /** * An activity in the ActivityStrea.ms world * @@ -1018,6 +53,7 @@ class Activity { const SPEC = 'http://activitystrea.ms/spec/1.0/'; const SCHEMA = 'http://activitystrea.ms/schema/1.0/'; + const MEDIA = 'http://purl.org/syndication/atommedia'; const VERB = 'verb'; const OBJECT = 'object'; @@ -1033,9 +69,24 @@ class Activity const PUBLISHED = 'published'; const UPDATED = 'updated'; + const RSS = null; // no namespace! + + const PUBDATE = 'pubDate'; + const DESCRIPTION = 'description'; + const GUID = 'guid'; + const SELF = 'self'; + const IMAGE = 'image'; + const URL = 'url'; + + const DC = 'http://purl.org/dc/elements/1.1/'; + + const CREATOR = 'creator'; + + const CONTENTNS = 'http://purl.org/rss/1.0/modules/content/'; + public $actor; // an ActivityObject public $verb; // a string (the URL) - public $object; // an ActivityObject + public $objects = array(); // an array of ActivityObjects public $target; // an ActivityObject public $context; // an ActivityObject public $time; // Time of the activity @@ -1063,21 +114,29 @@ class Activity return; } - $this->entry = $entry; - - // @fixme Don't send in a DOMDocument + // Insist on a feed's root DOMElement; don't allow a DOMDocument if ($feed instanceof DOMDocument) { - common_log( - LOG_WARNING, - 'Activity::__construct() - ' - . 'DOMDocument passed in for feed by mistake. ' - . "Expecting a 'feed' DOMElement." + throw new ClientException( + _("Expecting a root feed element but got a whole XML document.") ); - $feed = $feed->getElementsByTagName('feed')->item(0); } + $this->entry = $entry; $this->feed = $feed; + if ($entry->namespaceURI == Activity::ATOM && + $entry->localName == 'entry') { + $this->_fromAtomEntry($entry, $feed); + } else if ($entry->namespaceURI == Activity::RSS && + $entry->localName == 'item') { + $this->_fromRssItem($entry, $feed); + } else { + throw new Exception("Unknown DOM element: {$entry->namespaceURI} {$entry->localName}"); + } + } + + function _fromAtomEntry($entry, $feed) + { $pubEl = $this->_child($entry, self::PUBLISHED, self::ATOM); if (!empty($pubEl)) { @@ -1103,12 +162,15 @@ class Activity // XXX: do other implied stuff here } - $objectEl = $this->_child($entry, self::OBJECT); + $objectEls = $entry->getElementsByTagNameNS(self::SPEC, self::OBJECT); - if (!empty($objectEl)) { - $this->object = new ActivityObject($objectEl); + if ($objectEls->length > 0) { + for ($i = 0; $i < $objectEls->length; $i++) { + $objectEl = $objectEls->item($i); + $this->objects[] = new ActivityObject($objectEl); + } } else { - $this->object = new ActivityObject($entry); + $this->objects[] = new ActivityObject($entry); } $actorEl = $this->_child($entry, self::ACTOR); @@ -1163,6 +225,69 @@ class Activity } } + function _fromRssItem($item, $channel) + { + $verbEl = $this->_child($item, self::VERB); + + if (!empty($verbEl)) { + $this->verb = trim($verbEl->textContent); + } else { + $this->verb = ActivityVerb::POST; + // XXX: do other implied stuff here + } + + $pubDateEl = $this->_child($item, self::PUBDATE, self::RSS); + + if (!empty($pubDateEl)) { + $this->time = strtotime($pubDateEl->textContent); + } + + if ($authorEl = $this->_child($item, self::AUTHOR, self::RSS)) { + $this->actor = ActivityObject::fromRssAuthor($authorEl); + } else if ($dcCreatorEl = $this->_child($item, self::CREATOR, self::DC)) { + $this->actor = ActivityObject::fromDcCreator($dcCreatorEl); + } else if ($posterousEl = $this->_child($item, ActivityObject::AUTHOR, ActivityObject::POSTEROUS)) { + // Special case for Posterous.com + $this->actor = ActivityObject::fromPosterousAuthor($posterousEl); + } else if (!empty($channel)) { + $this->actor = ActivityObject::fromRssChannel($channel); + } else { + // No actor! + } + + $this->title = ActivityUtils::childContent($item, ActivityObject::TITLE, self::RSS); + + $contentEl = ActivityUtils::child($item, ActivityUtils::CONTENT, self::CONTENTNS); + + if (!empty($contentEl)) { + $this->content = htmlspecialchars_decode($contentEl->textContent, ENT_QUOTES); + } else { + $descriptionEl = ActivityUtils::child($item, self::DESCRIPTION, self::RSS); + if (!empty($descriptionEl)) { + $this->content = htmlspecialchars_decode($descriptionEl->textContent, ENT_QUOTES); + } + } + + $this->link = ActivityUtils::childContent($item, ActivityUtils::LINK, self::RSS); + + // @fixme enclosures + // @fixme thumbnails... maybe + + $guidEl = ActivityUtils::child($item, self::GUID, self::RSS); + + if (!empty($guidEl)) { + $this->id = $guidEl->textContent; + + if ($guidEl->hasAttribute('isPermaLink') && $guidEl->getAttribute('isPermaLink') != 'false') { + // overwrites <link> + $this->link = $this->id; + } + } + + $this->objects[] = new ActivityObject($item); + $this->context = new ActivityContext($item); + } + /** * Returns an Atom <entry> based on this activity * @@ -1218,8 +343,10 @@ class Activity $xs->element('activity:verb', null, $this->verb); - if ($this->object) { - $xs->raw($this->object->asString()); + if (!empty($this->objects)) { + foreach($this->objects as $object) { + $xs->raw($object->asString()); + } } if ($this->target) { @@ -1241,48 +368,3 @@ class Activity } } -class AtomCategory -{ - public $term; - public $scheme; - public $label; - - function __construct($element=null) - { - if ($element && $element->attributes) { - $this->term = $this->extract($element, 'term'); - $this->scheme = $this->extract($element, 'scheme'); - $this->label = $this->extract($element, 'label'); - } - } - - protected function extract($element, $attrib) - { - $node = $element->attributes->getNamedItemNS(Activity::ATOM, $attrib); - if ($node) { - return trim($node->textContent); - } - $node = $element->attributes->getNamedItem($attrib); - if ($node) { - return trim($node->textContent); - } - return null; - } - - function asString() - { - $attribs = array(); - if ($this->term !== null) { - $attribs['term'] = $this->term; - } - if ($this->scheme !== null) { - $attribs['scheme'] = $this->scheme; - } - if ($this->label !== null) { - $attribs['label'] = $this->label; - } - $xs = new XMLStringer(); - $xs->element('category', $attribs); - return $xs->asString(); - } -} diff --git a/lib/activitycontext.php b/lib/activitycontext.php new file mode 100644 index 000000000..2df7613f7 --- /dev/null +++ b/lib/activitycontext.php @@ -0,0 +1,121 @@ +<?php +/** + * StatusNet, the distributed open-source microblogging tool + * + * An activity + * + * PHP version 5 + * + * LICENCE: This program is free software: you can redistribute it and/or modify + * it under the terms of the GNU Affero General Public License as published by + * the Free Software Foundation, either version 3 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Affero General Public License for more details. + * + * You should have received a copy of the GNU Affero General Public License + * along with this program. If not, see <http://www.gnu.org/licenses/>. + * + * @category Feed + * @package StatusNet + * @author Evan Prodromou <evan@status.net> + * @author Zach Copley <zach@status.net> + * @copyright 2010 StatusNet, Inc. + * @license http://www.fsf.org/licensing/licenses/agpl-3.0.html AGPLv3 + * @link http://status.net/ + */ + +if (!defined('STATUSNET')) { + exit(1); +} + +class ActivityContext +{ + public $replyToID; + public $replyToUrl; + public $location; + public $attention = array(); + public $conversation; + + const THR = 'http://purl.org/syndication/thread/1.0'; + const GEORSS = 'http://www.georss.org/georss'; + const OSTATUS = 'http://ostatus.org/schema/1.0'; + + const INREPLYTO = 'in-reply-to'; + const REF = 'ref'; + const HREF = 'href'; + + const POINT = 'point'; + + const ATTENTION = 'ostatus:attention'; + const CONVERSATION = 'ostatus:conversation'; + + function __construct($element) + { + $replyToEl = ActivityUtils::child($element, self::INREPLYTO, self::THR); + + if (!empty($replyToEl)) { + $this->replyToID = $replyToEl->getAttribute(self::REF); + $this->replyToUrl = $replyToEl->getAttribute(self::HREF); + } + + $this->location = $this->getLocation($element); + + $this->conversation = ActivityUtils::getLink($element, self::CONVERSATION); + + // Multiple attention links allowed + + $links = $element->getElementsByTagNameNS(ActivityUtils::ATOM, ActivityUtils::LINK); + + for ($i = 0; $i < $links->length; $i++) { + + $link = $links->item($i); + + $linkRel = $link->getAttribute(ActivityUtils::REL); + + if ($linkRel == self::ATTENTION) { + $this->attention[] = $link->getAttribute(self::HREF); + } + } + } + + /** + * Parse location given as a GeoRSS-simple point, if provided. + * http://www.georss.org/simple + * + * @param feed item $entry + * @return mixed Location or false + */ + function getLocation($dom) + { + $points = $dom->getElementsByTagNameNS(self::GEORSS, self::POINT); + + for ($i = 0; $i < $points->length; $i++) { + $point = $points->item($i)->textContent; + return self::locationFromPoint($point); + } + + return null; + } + + // XXX: Move to ActivityUtils or Location? + static function locationFromPoint($point) + { + $point = str_replace(',', ' ', $point); // per spec "treat commas as whitespace" + $point = preg_replace('/\s+/', ' ', $point); + $point = trim($point); + $coords = explode(' ', $point); + if (count($coords) == 2) { + list($lat, $lon) = $coords; + if (is_numeric($lat) && is_numeric($lon)) { + common_log(LOG_INFO, "Looking up location for $lat $lon from georss point"); + return Location::fromLatLon($lat, $lon); + } + } + common_log(LOG_ERR, "Ignoring bogus georss:point value $point"); + return null; + } +} diff --git a/lib/activityobject.php b/lib/activityobject.php new file mode 100644 index 000000000..34d1b9170 --- /dev/null +++ b/lib/activityobject.php @@ -0,0 +1,568 @@ +<?php +/** + * StatusNet, the distributed open-source microblogging tool + * + * An activity + * + * PHP version 5 + * + * LICENCE: This program is free software: you can redistribute it and/or modify + * it under the terms of the GNU Affero General Public License as published by + * the Free Software Foundation, either version 3 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Affero General Public License for more details. + * + * You should have received a copy of the GNU Affero General Public License + * along with this program. If not, see <http://www.gnu.org/licenses/>. + * + * @category Feed + * @package StatusNet + * @author Evan Prodromou <evan@status.net> + * @author Zach Copley <zach@status.net> + * @copyright 2010 StatusNet, Inc. + * @license http://www.fsf.org/licensing/licenses/agpl-3.0.html AGPLv3 + * @link http://status.net/ + */ + +if (!defined('STATUSNET')) { + exit(1); +} + +/** + * A noun-ish thing in the activity universe + * + * The activity streams spec talks about activity objects, while also having + * a tag activity:object, which is in fact an activity object. Aaaaaah! + * + * This is just a thing in the activity universe. Can be the subject, object, + * or indirect object (target!) of an activity verb. Rotten name, and I'm + * propagating it. *sigh* + * + * @category OStatus + * @package StatusNet + * @author Evan Prodromou <evan@status.net> + * @copyright 2010 StatusNet, Inc. + * @license http://www.fsf.org/licensing/licenses/agpl-3.0.html AGPLv3 + * @link http://status.net/ + */ + +class ActivityObject +{ + const ARTICLE = 'http://activitystrea.ms/schema/1.0/article'; + const BLOGENTRY = 'http://activitystrea.ms/schema/1.0/blog-entry'; + const NOTE = 'http://activitystrea.ms/schema/1.0/note'; + const STATUS = 'http://activitystrea.ms/schema/1.0/status'; + const FILE = 'http://activitystrea.ms/schema/1.0/file'; + const PHOTO = 'http://activitystrea.ms/schema/1.0/photo'; + const ALBUM = 'http://activitystrea.ms/schema/1.0/photo-album'; + const PLAYLIST = 'http://activitystrea.ms/schema/1.0/playlist'; + const VIDEO = 'http://activitystrea.ms/schema/1.0/video'; + const AUDIO = 'http://activitystrea.ms/schema/1.0/audio'; + const BOOKMARK = 'http://activitystrea.ms/schema/1.0/bookmark'; + const PERSON = 'http://activitystrea.ms/schema/1.0/person'; + const GROUP = 'http://activitystrea.ms/schema/1.0/group'; + const PLACE = 'http://activitystrea.ms/schema/1.0/place'; + const COMMENT = 'http://activitystrea.ms/schema/1.0/comment'; + // ^^^^^^^^^^ tea! + + // Atom elements we snarf + + const TITLE = 'title'; + const SUMMARY = 'summary'; + const ID = 'id'; + const SOURCE = 'source'; + + const NAME = 'name'; + const URI = 'uri'; + const EMAIL = 'email'; + + const POSTEROUS = 'http://posterous.com/help/rss/1.0'; + const AUTHOR = 'author'; + const USERIMAGE = 'userImage'; + const PROFILEURL = 'profileUrl'; + const NICKNAME = 'nickName'; + const DISPLAYNAME = 'displayName'; + + public $element; + public $type; + public $id; + public $title; + public $summary; + public $content; + public $link; + public $source; + public $avatarLinks = array(); + public $geopoint; + public $poco; + public $displayName; + + // @todo move this stuff to it's own PHOTO activity object + const MEDIA_DESCRIPTION = 'description'; + + public $thumbnail; + public $largerImage; + public $description; + + /** + * Constructor + * + * This probably needs to be refactored + * to generate a local class (ActivityPerson, ActivityFile, ...) + * based on the object type. + * + * @param DOMElement $element DOM thing to turn into an Activity thing + */ + + function __construct($element = null) + { + if (empty($element)) { + return; + } + + $this->element = $element; + + $this->geopoint = $this->_childContent( + $element, + ActivityContext::POINT, + ActivityContext::GEORSS + ); + + if ($element->tagName == 'author') { + $this->_fromAuthor($element); + } else if ($element->tagName == 'item') { + $this->_fromRssItem($element); + } else { + $this->_fromAtomEntry($element); + } + + // Some per-type attributes... + if ($this->type == self::PERSON || $this->type == self::GROUP) { + $this->displayName = $this->title; + + $photos = ActivityUtils::getLinks($element, 'photo'); + if (count($photos)) { + foreach ($photos as $link) { + $this->avatarLinks[] = new AvatarLink($link); + } + } else { + $avatars = ActivityUtils::getLinks($element, 'avatar'); + foreach ($avatars as $link) { + $this->avatarLinks[] = new AvatarLink($link); + } + } + + $this->poco = new PoCo($element); + } + + if ($this->type == self::PHOTO) { + + $this->thumbnail = ActivityUtils::getLink($element, 'preview'); + $this->largerImage = ActivityUtils::getLink($element, 'enclosure'); + + $this->description = ActivityUtils::childContent( + $element, + ActivityObject::MEDIA_DESCRIPTION, + Activity::MEDIA + ); + + } + } + + private function _fromAuthor($element) + { + $this->type = self::PERSON; // XXX: is this fair? + $this->title = $this->_childContent($element, self::NAME); + + $id = $this->_childContent($element, self::URI); + if (ActivityUtils::validateUri($id)) { + $this->id = $id; + } + + if (empty($this->id)) { + $email = $this->_childContent($element, self::EMAIL); + if (!empty($email)) { + // XXX: acct: ? + $this->id = 'mailto:'.$email; + } + } + } + + private function _fromAtomEntry($element) + { + if ($element->localName == 'actor') { + // Old-fashioned <activity:actor>... + // First pull anything from <author>, then we'll add on top. + $author = ActivityUtils::child($element->parentNode, 'author'); + if ($author) { + $this->_fromAuthor($author); + } + } + + $this->type = $this->_childContent($element, Activity::OBJECTTYPE, + Activity::SPEC); + + if (empty($this->type)) { + $this->type = ActivityObject::NOTE; + } + + $id = $this->_childContent($element, self::ID); + if (ActivityUtils::validateUri($id)) { + $this->id = $id; + } + + $this->summary = ActivityUtils::childHtmlContent($element, self::SUMMARY); + $this->content = ActivityUtils::getContent($element); + + // We don't like HTML in our titles, although it's technically allowed + + $title = ActivityUtils::childHtmlContent($element, self::TITLE); + + $this->title = html_entity_decode(strip_tags($title)); + + $this->source = $this->_getSource($element); + + $this->link = ActivityUtils::getPermalink($element); + } + + // @fixme rationalize with Activity::_fromRssItem() + + private function _fromRssItem($item) + { + $this->title = ActivityUtils::childContent($item, ActivityObject::TITLE, Activity::RSS); + + $contentEl = ActivityUtils::child($item, ActivityUtils::CONTENT, Activity::CONTENTNS); + + if (!empty($contentEl)) { + $this->content = htmlspecialchars_decode($contentEl->textContent, ENT_QUOTES); + } else { + $descriptionEl = ActivityUtils::child($item, Activity::DESCRIPTION, Activity::RSS); + if (!empty($descriptionEl)) { + $this->content = htmlspecialchars_decode($descriptionEl->textContent, ENT_QUOTES); + } + } + + $this->link = ActivityUtils::childContent($item, ActivityUtils::LINK, Activity::RSS); + + $guidEl = ActivityUtils::child($item, Activity::GUID, Activity::RSS); + + if (!empty($guidEl)) { + $this->id = $guidEl->textContent; + + if ($guidEl->hasAttribute('isPermaLink')) { + // overwrites <link> + $this->link = $this->id; + } + } + } + + public static function fromRssAuthor($el) + { + $text = $el->textContent; + + if (preg_match('/^(.*?) \((.*)\)$/', $text, $match)) { + $email = $match[1]; + $name = $match[2]; + } else if (preg_match('/^(.*?) <(.*)>$/', $text, $match)) { + $name = $match[1]; + $email = $match[2]; + } else if (preg_match('/.*@.*/', $text)) { + $email = $text; + $name = null; + } else { + $name = $text; + $email = null; + } + + // Not really enough info + + $obj = new ActivityObject(); + + $obj->element = $el; + + $obj->type = ActivityObject::PERSON; + $obj->title = $name; + + if (!empty($email)) { + $obj->id = 'mailto:'.$email; + } + + return $obj; + } + + public static function fromDcCreator($el) + { + // Not really enough info + + $text = $el->textContent; + + $obj = new ActivityObject(); + + $obj->element = $el; + + $obj->title = $text; + $obj->type = ActivityObject::PERSON; + + return $obj; + } + + public static function fromRssChannel($el) + { + $obj = new ActivityObject(); + + $obj->element = $el; + + $obj->type = ActivityObject::PERSON; // @fixme guess better + + $obj->title = ActivityUtils::childContent($el, ActivityObject::TITLE, Activity::RSS); + $obj->link = ActivityUtils::childContent($el, ActivityUtils::LINK, Activity::RSS); + $obj->id = ActivityUtils::getLink($el, Activity::SELF); + + if (empty($obj->id)) { + $obj->id = $obj->link; + } + + $desc = ActivityUtils::childContent($el, Activity::DESCRIPTION, Activity::RSS); + + if (!empty($desc)) { + $obj->content = htmlspecialchars_decode($desc, ENT_QUOTES); + } + + $imageEl = ActivityUtils::child($el, Activity::IMAGE, Activity::RSS); + + if (!empty($imageEl)) { + $url = ActivityUtils::childContent($imageEl, Activity::URL, Activity::RSS); + $al = new AvatarLink(); + $al->url = $url; + $obj->avatarLinks[] = $al; + } + + return $obj; + } + + public static function fromPosterousAuthor($el) + { + $obj = new ActivityObject(); + + $obj->type = ActivityObject::PERSON; // @fixme any others...? + + $userImage = ActivityUtils::childContent($el, self::USERIMAGE, self::POSTEROUS); + + if (!empty($userImage)) { + $al = new AvatarLink(); + $al->url = $userImage; + $obj->avatarLinks[] = $al; + } + + $obj->link = ActivityUtils::childContent($el, self::PROFILEURL, self::POSTEROUS); + $obj->id = $obj->link; + + $obj->poco = new PoCo(); + + $obj->poco->preferredUsername = ActivityUtils::childContent($el, self::NICKNAME, self::POSTEROUS); + $obj->poco->displayName = ActivityUtils::childContent($el, self::DISPLAYNAME, self::POSTEROUS); + + $obj->title = $obj->poco->displayName; + + return $obj; + } + + private function _childContent($element, $tag, $namespace=ActivityUtils::ATOM) + { + return ActivityUtils::childContent($element, $tag, $namespace); + } + + // Try to get a unique id for the source feed + + private function _getSource($element) + { + $sourceEl = ActivityUtils::child($element, 'source'); + + if (empty($sourceEl)) { + return null; + } else { + $href = ActivityUtils::getLink($sourceEl, 'self'); + if (!empty($href)) { + return $href; + } else { + return ActivityUtils::childContent($sourceEl, 'id'); + } + } + } + + static function fromNotice(Notice $notice) + { + $object = new ActivityObject(); + + $object->type = ActivityObject::NOTE; + + $object->id = $notice->uri; + $object->title = $notice->content; + $object->content = $notice->rendered; + $object->link = $notice->bestUrl(); + + return $object; + } + + static function fromProfile(Profile $profile) + { + $object = new ActivityObject(); + + $object->type = ActivityObject::PERSON; + $object->id = $profile->getUri(); + $object->title = $profile->getBestName(); + $object->link = $profile->profileurl; + + $orig = $profile->getOriginalAvatar(); + + if (!empty($orig)) { + $object->avatarLinks[] = AvatarLink::fromAvatar($orig); + } + + $sizes = array( + AVATAR_PROFILE_SIZE, + AVATAR_STREAM_SIZE, + AVATAR_MINI_SIZE + ); + + foreach ($sizes as $size) { + + $alink = null; + $avatar = $profile->getAvatar($size); + + if (!empty($avatar)) { + $alink = AvatarLink::fromAvatar($avatar); + } else { + $alink = new AvatarLink(); + $alink->type = 'image/png'; + $alink->height = $size; + $alink->width = $size; + $alink->url = Avatar::defaultImage($size); + } + + $object->avatarLinks[] = $alink; + } + + if (isset($profile->lat) && isset($profile->lon)) { + $object->geopoint = (float)$profile->lat + . ' ' . (float)$profile->lon; + } + + $object->poco = PoCo::fromProfile($profile); + + return $object; + } + + static function fromGroup($group) + { + $object = new ActivityObject(); + + $object->type = ActivityObject::GROUP; + $object->id = $group->getUri(); + $object->title = $group->getBestName(); + $object->link = $group->getUri(); + + $object->avatarLinks[] = AvatarLink::fromFilename( + $group->homepage_logo, + AVATAR_PROFILE_SIZE + ); + + $object->avatarLinks[] = AvatarLink::fromFilename( + $group->stream_logo, + AVATAR_STREAM_SIZE + ); + + $object->avatarLinks[] = AvatarLink::fromFilename( + $group->mini_logo, + AVATAR_MINI_SIZE + ); + + $object->poco = PoCo::fromGroup($group); + + return $object; + } + + function asString($tag='activity:object') + { + $xs = new XMLStringer(true); + + $xs->elementStart($tag); + + $xs->element('activity:object-type', null, $this->type); + + $xs->element(self::ID, null, $this->id); + + if (!empty($this->title)) { + $xs->element( + self::TITLE, + null, + common_xml_safe_str($this->title) + ); + } + + if (!empty($this->summary)) { + $xs->element( + self::SUMMARY, + null, + common_xml_safe_str($this->summary) + ); + } + + if (!empty($this->content)) { + // XXX: assuming HTML content here + $xs->element( + ActivityUtils::CONTENT, + array('type' => 'html'), + common_xml_safe_str($this->content) + ); + } + + if (!empty($this->link)) { + $xs->element( + 'link', + array( + 'rel' => 'alternate', + 'type' => 'text/html', + 'href' => $this->link + ), + null + ); + } + + if ($this->type == ActivityObject::PERSON + || $this->type == ActivityObject::GROUP) { + + foreach ($this->avatarLinks as $avatar) { + $xs->element( + 'link', array( + 'rel' => 'avatar', + 'type' => $avatar->type, + 'media:width' => $avatar->width, + 'media:height' => $avatar->height, + 'href' => $avatar->url + ), + null + ); + } + } + + if (!empty($this->geopoint)) { + $xs->element( + 'georss:point', + null, + $this->geopoint + ); + } + + if (!empty($this->poco)) { + $xs->raw($this->poco->asString()); + } + + $xs->elementEnd($tag); + + return $xs->getString(); + } +} diff --git a/lib/activityutils.php b/lib/activityutils.php new file mode 100644 index 000000000..a7e99fb11 --- /dev/null +++ b/lib/activityutils.php @@ -0,0 +1,265 @@ +<?php +/** + * StatusNet, the distributed open-source microblogging tool + * + * An activity + * + * PHP version 5 + * + * LICENCE: This program is free software: you can redistribute it and/or modify + * it under the terms of the GNU Affero General Public License as published by + * the Free Software Foundation, either version 3 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Affero General Public License for more details. + * + * You should have received a copy of the GNU Affero General Public License + * along with this program. If not, see <http://www.gnu.org/licenses/>. + * + * @category Feed + * @package StatusNet + * @author Evan Prodromou <evan@status.net> + * @author Zach Copley <zach@status.net> + * @copyright 2010 StatusNet, Inc. + * @license http://www.fsf.org/licensing/licenses/agpl-3.0.html AGPLv3 + * @link http://status.net/ + */ + +if (!defined('STATUSNET')) { + exit(1); +} + +/** + * Utilities for turning DOMish things into Activityish things + * + * Some common functions that I didn't have the bandwidth to try to factor + * into some kind of reasonable superclass, so just dumped here. Might + * be useful to have an ActivityObject parent class or something. + * + * @category OStatus + * @package StatusNet + * @author Evan Prodromou <evan@status.net> + * @copyright 2010 StatusNet, Inc. + * @license http://www.fsf.org/licensing/licenses/agpl-3.0.html AGPLv3 + * @link http://status.net/ + */ + +class ActivityUtils +{ + const ATOM = 'http://www.w3.org/2005/Atom'; + + const LINK = 'link'; + const REL = 'rel'; + const TYPE = 'type'; + const HREF = 'href'; + + const CONTENT = 'content'; + const SRC = 'src'; + + /** + * Get the permalink for an Activity object + * + * @param DOMElement $element A DOM element + * + * @return string related link, if any + */ + + static function getPermalink($element) + { + return self::getLink($element, 'alternate', 'text/html'); + } + + /** + * Get the permalink for an Activity object + * + * @param DOMElement $element A DOM element + * + * @return string related link, if any + */ + + static function getLink(DOMNode $element, $rel, $type=null) + { + $els = $element->childNodes; + + foreach ($els as $link) { + + if (!($link instanceof DOMElement)) { + continue; + } + + if ($link->localName == self::LINK && $link->namespaceURI == self::ATOM) { + + $linkRel = $link->getAttribute(self::REL); + $linkType = $link->getAttribute(self::TYPE); + + if ($linkRel == $rel && + (is_null($type) || $linkType == $type)) { + return $link->getAttribute(self::HREF); + } + } + } + + return null; + } + + static function getLinks(DOMNode $element, $rel, $type=null) + { + $els = $element->childNodes; + $out = array(); + + foreach ($els as $link) { + if ($link->localName == self::LINK && $link->namespaceURI == self::ATOM) { + + $linkRel = $link->getAttribute(self::REL); + $linkType = $link->getAttribute(self::TYPE); + + if ($linkRel == $rel && + (is_null($type) || $linkType == $type)) { + $out[] = $link; + } + } + } + + return $out; + } + + /** + * Gets the first child element with the given tag + * + * @param DOMElement $element element to pick at + * @param string $tag tag to look for + * @param string $namespace Namespace to look under + * + * @return DOMElement found element or null + */ + + static function child(DOMNode $element, $tag, $namespace=self::ATOM) + { + $els = $element->childNodes; + if (empty($els) || $els->length == 0) { + return null; + } else { + for ($i = 0; $i < $els->length; $i++) { + $el = $els->item($i); + if ($el->localName == $tag && $el->namespaceURI == $namespace) { + return $el; + } + } + } + } + + /** + * Grab the text content of a DOM element child of the current element + * + * @param DOMElement $element Element whose children we examine + * @param string $tag Tag to look up + * @param string $namespace Namespace to use, defaults to Atom + * + * @return string content of the child + */ + + static function childContent(DOMNode $element, $tag, $namespace=self::ATOM) + { + $el = self::child($element, $tag, $namespace); + + if (empty($el)) { + return null; + } else { + return $el->textContent; + } + } + + static function childHtmlContent(DOMNode $element, $tag, $namespace=self::ATOM) + { + $el = self::child($element, $tag, $namespace); + + if (empty($el)) { + return null; + } else { + return self::textConstruct($el); + } + } + + /** + * Get the content of an atom:entry-like object + * + * @param DOMElement $element The element to examine. + * + * @return string unencoded HTML content of the element, like "This -< is <b>HTML</b>." + * + * @todo handle remote content + * @todo handle embedded XML mime types + * @todo handle base64-encoded non-XML and non-text mime types + */ + + static function getContent($element) + { + return self::childHtmlContent($element, self::CONTENT, self::ATOM); + } + + static function textConstruct($el) + { + $src = $el->getAttribute(self::SRC); + + if (!empty($src)) { + throw new ClientException(_("Can't handle remote content yet.")); + } + + $type = $el->getAttribute(self::TYPE); + + // slavishly following http://atompub.org/rfc4287.html#rfc.section.4.1.3.3 + + if (empty($type) || $type == 'text') { + return $el->textContent; + } else if ($type == 'html') { + $text = $el->textContent; + return htmlspecialchars_decode($text, ENT_QUOTES); + } else if ($type == 'xhtml') { + $divEl = ActivityUtils::child($el, 'div', 'http://www.w3.org/1999/xhtml'); + if (empty($divEl)) { + return null; + } + $doc = $divEl->ownerDocument; + $text = ''; + $children = $divEl->childNodes; + + for ($i = 0; $i < $children->length; $i++) { + $child = $children->item($i); + $text .= $doc->saveXML($child); + } + return trim($text); + } else if (in_array($type, array('text/xml', 'application/xml')) || + preg_match('#(+|/)xml$#', $type)) { + throw new ClientException(_("Can't handle embedded XML content yet.")); + } else if (strncasecmp($type, 'text/', 5)) { + return $el->textContent; + } else { + throw new ClientException(_("Can't handle embedded Base64 content yet.")); + } + } + + /** + * Is this a valid URI for remote profile/notice identification? + * Does not have to be a resolvable URL. + * @param string $uri + * @return boolean + */ + static function validateUri($uri) + { + if (Validate::uri($uri)) { + return true; + } + + // Possibly an upstream bug; tag: URIs aren't validated properly + // unless you explicitly ask for them. All other schemes are accepted + // for basic URI validation without asking. + if (Validate::uri($uri, array('allowed_scheme' => array('tag')))) { + return true; + } + + return false; + } +} diff --git a/lib/activityverb.php b/lib/activityverb.php new file mode 100644 index 000000000..76f2b84e9 --- /dev/null +++ b/lib/activityverb.php @@ -0,0 +1,66 @@ +<?php +/** + * StatusNet, the distributed open-source microblogging tool + * + * An activity + * + * PHP version 5 + * + * LICENCE: This program is free software: you can redistribute it and/or modify + * it under the terms of the GNU Affero General Public License as published by + * the Free Software Foundation, either version 3 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Affero General Public License for more details. + * + * You should have received a copy of the GNU Affero General Public License + * along with this program. If not, see <http://www.gnu.org/licenses/>. + * + * @category Feed + * @package StatusNet + * @author Evan Prodromou <evan@status.net> + * @author Zach Copley <zach@status.net> + * @copyright 2010 StatusNet, Inc. + * @license http://www.fsf.org/licensing/licenses/agpl-3.0.html AGPLv3 + * @link http://status.net/ + */ + +if (!defined('STATUSNET')) { + exit(1); +} + +/** + * Utility class to hold a bunch of constant defining default verb types + * + * @category OStatus + * @package StatusNet + * @author Evan Prodromou <evan@status.net> + * @copyright 2010 StatusNet, Inc. + * @license http://www.fsf.org/licensing/licenses/agpl-3.0.html AGPLv3 + * @link http://status.net/ + */ + +class ActivityVerb +{ + const POST = 'http://activitystrea.ms/schema/1.0/post'; + const SHARE = 'http://activitystrea.ms/schema/1.0/share'; + const SAVE = 'http://activitystrea.ms/schema/1.0/save'; + const FAVORITE = 'http://activitystrea.ms/schema/1.0/favorite'; + const PLAY = 'http://activitystrea.ms/schema/1.0/play'; + const FOLLOW = 'http://activitystrea.ms/schema/1.0/follow'; + const FRIEND = 'http://activitystrea.ms/schema/1.0/make-friend'; + const JOIN = 'http://activitystrea.ms/schema/1.0/join'; + const TAG = 'http://activitystrea.ms/schema/1.0/tag'; + + // Custom OStatus verbs for the flipside until they're standardized + const DELETE = 'http://ostatus.org/schema/1.0/unfollow'; + const UNFAVORITE = 'http://ostatus.org/schema/1.0/unfavorite'; + const UNFOLLOW = 'http://ostatus.org/schema/1.0/unfollow'; + const LEAVE = 'http://ostatus.org/schema/1.0/leave'; + + // For simple profile-update pings; no content to share. + const UPDATE_PROFILE = 'http://ostatus.org/schema/1.0/update-profile'; +} diff --git a/lib/adminpanelaction.php b/lib/adminpanelaction.php index d43ea7698..a927e2333 100644 --- a/lib/adminpanelaction.php +++ b/lib/adminpanelaction.php @@ -69,6 +69,7 @@ class AdminPanelAction extends Action // User must be logged in. if (!common_logged_in()) { + // TRANS: Client error message $this->clientError(_('Not logged in.')); return false; } @@ -93,6 +94,7 @@ class AdminPanelAction extends Action // User must have the right to change admin settings if (!$user->hasRight(Right::CONFIGURESITE)) { + // TRANS: Client error message $this->clientError(_('You cannot make changes to this site.')); return false; } @@ -104,6 +106,7 @@ class AdminPanelAction extends Action $name = mb_substr($name, 0, -10); if (!self::canAdmin($name)) { + // TRANS: Client error message $this->clientError(_('Changes to that panel are not allowed.'), 403); return false; } @@ -134,6 +137,7 @@ class AdminPanelAction extends Action Config::loadSettings(); $this->success = true; + // TRANS: Message after successful saving of administrative settings. $this->msg = _('Settings saved.'); } catch (Exception $e) { $this->success = false; @@ -221,6 +225,7 @@ class AdminPanelAction extends Action function showForm() { + // TRANS: Client error message $this->clientError(_('showForm() not implemented.')); return; } @@ -250,6 +255,7 @@ class AdminPanelAction extends Action function saveSettings() { + // TRANS: Client error message $this->clientError(_('saveSettings() not implemented.')); return; } @@ -273,6 +279,7 @@ class AdminPanelAction extends Action $result = $config->delete(); if (!$result) { common_log_db_error($config, 'DELETE', __FILE__); + // TRANS: Client error message $this->clientError(_("Unable to delete design setting.")); return null; } @@ -337,43 +344,67 @@ class AdminPanelNav extends Widget if (Event::handle('StartAdminPanelNav', array($this))) { if (AdminPanelAction::canAdmin('site')) { - $this->out->menuItem(common_local_url('siteadminpanel'), _('Site'), - _('Basic site configuration'), $action_name == 'siteadminpanel', 'nav_site_admin_panel'); + // TRANS: Menu item title/tooltip + $menu_title = _('Basic site configuration'); + // TRANS: Menu item for site administration + $this->out->menuItem(common_local_url('siteadminpanel'), _m('MENU', 'Site'), + $menu_title, $action_name == 'siteadminpanel', 'nav_site_admin_panel'); } if (AdminPanelAction::canAdmin('design')) { - $this->out->menuItem(common_local_url('designadminpanel'), _('Design'), - _('Design configuration'), $action_name == 'designadminpanel', 'nav_design_admin_panel'); + // TRANS: Menu item title/tooltip + $menu_title = _('Design configuration'); + // TRANS: Menu item for site administration + $this->out->menuItem(common_local_url('designadminpanel'), _m('MENU', 'Design'), + $menu_title, $action_name == 'designadminpanel', 'nav_design_admin_panel'); } if (AdminPanelAction::canAdmin('user')) { + // TRANS: Menu item title/tooltip + $menu_title = _('User configuration'); + // TRANS: Menu item for site administration $this->out->menuItem(common_local_url('useradminpanel'), _('User'), - _('User configuration'), $action_name == 'useradminpanel', 'nav_user_admin_panel'); + $menu_title, $action_name == 'useradminpanel', 'nav_user_admin_panel'); } if (AdminPanelAction::canAdmin('access')) { + // TRANS: Menu item title/tooltip + $menu_title = _('Access configuration'); + // TRANS: Menu item for site administration $this->out->menuItem(common_local_url('accessadminpanel'), _('Access'), - _('Access configuration'), $action_name == 'accessadminpanel', 'nav_access_admin_panel'); + $menu_title, $action_name == 'accessadminpanel', 'nav_access_admin_panel'); } if (AdminPanelAction::canAdmin('paths')) { + // TRANS: Menu item title/tooltip + $menu_title = _('Paths configuration'); + // TRANS: Menu item for site administration $this->out->menuItem(common_local_url('pathsadminpanel'), _('Paths'), - _('Paths configuration'), $action_name == 'pathsadminpanel', 'nav_paths_admin_panel'); + $menu_title, $action_name == 'pathsadminpanel', 'nav_paths_admin_panel'); } if (AdminPanelAction::canAdmin('sessions')) { + // TRANS: Menu item title/tooltip + $menu_title = _('Sessions configuration'); + // TRANS: Menu item for site administration $this->out->menuItem(common_local_url('sessionsadminpanel'), _('Sessions'), - _('Sessions configuration'), $action_name == 'sessionsadminpanel', 'nav_sessions_admin_panel'); + $menu_title, $action_name == 'sessionsadminpanel', 'nav_sessions_admin_panel'); } if (AdminPanelAction::canAdmin('sitenotice')) { + // TRANS: Menu item title/tooltip + $menu_title = _('Edit site notice'); + // TRANS: Menu item for site administration $this->out->menuItem(common_local_url('sitenoticeadminpanel'), _('Site notice'), - _('Edit site notice'), $action_name == 'sitenoticeadminpanel', 'nav_sitenotice_admin_panel'); + $menu_title, $action_name == 'sitenoticeadminpanel', 'nav_sitenotice_admin_panel'); } if (AdminPanelAction::canAdmin('snapshot')) { + // TRANS: Menu item title/tooltip + $menu_title = _('Snapshots configuration'); + // TRANS: Menu item for site administration $this->out->menuItem(common_local_url('snapshotadminpanel'), _('Snapshots'), - _('Snapshots configuration'), $action_name == 'snapshotadminpanel', 'nav_snapshot_admin_panel'); + $menu_title, $action_name == 'snapshotadminpanel', 'nav_snapshot_admin_panel'); } Event::handle('EndAdminPanelNav', array($this)); diff --git a/lib/apiaction.php b/lib/apiaction.php index e4a1df3d1..e6aaf9316 100644 --- a/lib/apiaction.php +++ b/lib/apiaction.php @@ -491,7 +491,7 @@ class ApiAction extends Action $this->showXmlAttachments($twitter_status['attachments']); break; case 'geo': - $this->showGeoRSS($value); + $this->showGeoXML($value); break; case 'retweeted_status': $this->showTwitterXmlStatus($value, 'retweeted_status'); @@ -539,7 +539,7 @@ class ApiAction extends Action } } - function showGeoRSS($geo) + function showGeoXML($geo) { if (empty($geo)) { // empty geo element @@ -551,6 +551,17 @@ class ApiAction extends Action } } + function showGeoRSS($geo) + { + if (!empty($geo)) { + $this->element( + 'georss:point', + null, + $geo['coordinates'][0] . ' ' . $geo['coordinates'][1] + ); + } + } + function showTwitterRssItem($entry) { $this->elementStart('item'); @@ -619,13 +630,25 @@ class ApiAction extends Action $this->endDocument('xml'); } - function showRssTimeline($notice, $title, $link, $subtitle, $suplink=null, $logo=null) + function showRssTimeline($notice, $title, $link, $subtitle, $suplink = null, $logo = null, $self = null) { $this->initDocument('rss'); $this->element('title', null, $title); $this->element('link', null, $link); + + if (!is_null($self)) { + $this->element( + 'atom:link', + array( + 'type' => 'application/rss+xml', + 'href' => $self, + 'rel' => 'self' + ) + ); + } + if (!is_null($suplink)) { // For FriendFeed's SUP protocol $this->element('link', array('xmlns' => 'http://www.w3.org/2005/Atom', @@ -732,8 +755,12 @@ class ApiAction extends Action function showTwitterAtomEntry($entry) { $this->elementStart('entry'); - $this->element('title', null, $entry['title']); - $this->element('content', array('type' => 'html'), $entry['content']); + $this->element('title', null, common_xml_safe_str($entry['title'])); + $this->element( + 'content', + array('type' => 'html'), + common_xml_safe_str($entry['content']) + ); $this->element('id', null, $entry['id']); $this->element('published', null, $entry['published']); $this->element('updated', null, $entry['updated']); @@ -848,7 +875,7 @@ class ApiAction extends Action $this->initDocument('atom'); - $this->element('title', null, $title); + $this->element('title', null, common_xml_safe_str($title)); $this->element('id', null, $id); $this->element('link', array('href' => $link, 'rel' => 'alternate', 'type' => 'text/html'), null); @@ -858,7 +885,7 @@ class ApiAction extends Action } $this->element('updated', null, common_date_iso8601('now')); - $this->element('subtitle', null, $subtitle); + $this->element('subtitle', null, common_xml_safe_str($subtitle)); if (is_array($group)) { foreach ($group as $g) { @@ -1138,7 +1165,14 @@ class ApiAction extends Action function initTwitterRss() { $this->startXML(); - $this->elementStart('rss', array('version' => '2.0', 'xmlns:atom'=>'http://www.w3.org/2005/Atom')); + $this->elementStart( + 'rss', + array( + 'version' => '2.0', + 'xmlns:atom' => 'http://www.w3.org/2005/Atom', + 'xmlns:georss' => 'http://www.georss.org/georss' + ) + ); $this->elementStart('channel'); Event::handle('StartApiRss', array($this)); } @@ -1336,8 +1370,27 @@ class ApiAction extends Action } } - function getSelfUri($action, $aargs) + /** + * Calculate the complete URI that called up this action. Used for + * Atom rel="self" links. Warning: this is funky. + * + * @return string URL a URL suitable for rel="self" Atom links + */ + function getSelfUri() { + $action = mb_substr(get_class($this), 0, -6); // remove 'Action' + + $id = $this->arg('id'); + $aargs = array('format' => $this->format); + if (!empty($id)) { + $aargs['id'] = $id; + } + + $tag = $this->arg('tag'); + if (!empty($tag)) { + $aargs['tag'] = $tag; + } + parse_str($_SERVER['QUERY_STRING'], $params); $pstring = ''; if (!empty($params)) { diff --git a/lib/apiauth.php b/lib/apiauth.php index 32502399f..17f803a1c 100644 --- a/lib/apiauth.php +++ b/lib/apiauth.php @@ -294,11 +294,15 @@ class ApiAuthAction extends ApiAction function basicAuthProcessHeader() { - if (isset($_SERVER['AUTHORIZATION']) - || isset($_SERVER['HTTP_AUTHORIZATION']) - ) { - $authorization_header = isset($_SERVER['HTTP_AUTHORIZATION']) - ? $_SERVER['HTTP_AUTHORIZATION'] : $_SERVER['AUTHORIZATION']; + $authHeaders = array('AUTHORIZATION', + 'HTTP_AUTHORIZATION', + 'REDIRECT_HTTP_AUTHORIZATION'); // rewrite for CGI + $authorization_header = null; + foreach ($authHeaders as $header) { + if (isset($_SERVER[$header])) { + $authorization_header = $_SERVER[$header]; + break; + } } if (isset($_SERVER['PHP_AUTH_USER'])) { diff --git a/lib/atom10feed.php b/lib/atom10feed.php index 2d342e785..a46d49f35 100644 --- a/lib/atom10feed.php +++ b/lib/atom10feed.php @@ -178,7 +178,7 @@ class Atom10Feed extends XMLStringer $this->element( 'generator', array( - 'url' => 'http://status.net', + 'uri' => 'http://status.net', 'version' => STATUSNET_VERSION ), 'StatusNet' diff --git a/lib/atomcategory.php b/lib/atomcategory.php new file mode 100644 index 000000000..4cc3b4f4d --- /dev/null +++ b/lib/atomcategory.php @@ -0,0 +1,77 @@ +<?php +/** + * StatusNet, the distributed open-source microblogging tool + * + * PHP version 5 + * + * LICENCE: This program is free software: you can redistribute it and/or modify + * it under the terms of the GNU Affero General Public License as published by + * the Free Software Foundation, either version 3 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Affero General Public License for more details. + * + * You should have received a copy of the GNU Affero General Public License + * along with this program. If not, see <http://www.gnu.org/licenses/>. + * + * @category Feed + * @package StatusNet + * @author Evan Prodromou <evan@status.net> + * @author Zach Copley <zach@status.net> + * @copyright 2010 StatusNet, Inc. + * @license http://www.fsf.org/licensing/licenses/agpl-3.0.html AGPLv3 + * @link http://status.net/ + */ + +if (!defined('STATUSNET')) { + exit(1); +} + +class AtomCategory +{ + public $term; + public $scheme; + public $label; + + function __construct($element=null) + { + if ($element && $element->attributes) { + $this->term = $this->extract($element, 'term'); + $this->scheme = $this->extract($element, 'scheme'); + $this->label = $this->extract($element, 'label'); + } + } + + protected function extract($element, $attrib) + { + $node = $element->attributes->getNamedItemNS(Activity::ATOM, $attrib); + if ($node) { + return trim($node->textContent); + } + $node = $element->attributes->getNamedItem($attrib); + if ($node) { + return trim($node->textContent); + } + return null; + } + + function asString() + { + $attribs = array(); + if ($this->term !== null) { + $attribs['term'] = $this->term; + } + if ($this->scheme !== null) { + $attribs['scheme'] = $this->scheme; + } + if ($this->label !== null) { + $attribs['label'] = $this->label; + } + $xs = new XMLStringer(); + $xs->element('category', $attribs); + return $xs->asString(); + } +} diff --git a/lib/authenticationplugin.php b/lib/authenticationplugin.php index de479a576..0a3763e2e 100644 --- a/lib/authenticationplugin.php +++ b/lib/authenticationplugin.php @@ -69,13 +69,17 @@ abstract class AuthenticationPlugin extends Plugin /** * Automatically register a user when they attempt to login with valid credentials. * User::register($data) is a very useful method for this implementation - * @param username + * @param username username (that is used to login and find the user in the authentication provider) of the user to be registered + * @param nickname nickname of the user in the SN system. If nickname is null, then set nickname = username * @return mixed instance of User, or false (if user couldn't be created) */ - function autoRegister($username) + function autoRegister($username, $nickname = null) { + if(is_null($nickname)){ + $nickname = $username; + } $registration_data = array(); - $registration_data['nickname'] = $username ; + $registration_data['nickname'] = $nickname; return User::register($registration_data); } @@ -92,6 +96,21 @@ abstract class AuthenticationPlugin extends Plugin return false; } + /** + * Given a username, suggest what the nickname should be + * Used during autoregistration + * Useful if your usernames are ugly, and you want to suggest + * nice looking nicknames when users initially sign on + * All nicknames returned by this function should be valid + * implementations may want to use common_nicknamize() to ensure validity + * @param username + * @return string nickname + */ + function suggestNicknameForUsername($username) + { + return common_nicknamize($username); + } + //------------Below are the methods that connect StatusNet to the implementing Auth plugin------------\\ function onInitializePlugin(){ if(!isset($this->provider_name)){ @@ -108,10 +127,22 @@ abstract class AuthenticationPlugin extends Plugin function onAutoRegister($nickname, $provider_name, &$user) { if($provider_name == $this->provider_name && $this->autoregistration){ - $user = $this->autoregister($nickname); - if($user){ - User_username::register($user,$nickname,$this->provider_name); - return false; + $suggested_nickname = $this->suggestNicknameForUsername($nickname); + $test_user = User::staticGet('nickname', $suggested_nickname); + if($test_user) { + //someone already exists with the suggested nickname, so used the passed nickname + $suggested_nickname = common_nicknamize($nickname); + } + $test_user = User::staticGet('nickname', $suggested_nickname); + if($test_user) { + //someone already exists with the suggested nickname + //not much else we can do + }else{ + $user = $this->autoRegister($nickname, $suggested_nickname); + if($user){ + User_username::register($user,$nickname,$this->provider_name); + return false; + } } } } @@ -122,23 +153,30 @@ abstract class AuthenticationPlugin extends Plugin $user_username->username=$nickname; $user_username->provider_name=$this->provider_name; if($user_username->find() && $user_username->fetch()){ - $username = $user_username->username; - $authenticated = $this->checkPassword($username, $password); + $authenticated = $this->checkPassword($user_username->username, $password); if($authenticated){ $authenticatedUser = User::staticGet('id', $user_username->user_id); return false; } }else{ - $user = User::staticGet('nickname', $nickname); + //$nickname is the username used to login + //$suggested_nickname is the nickname the auth provider suggests for that username + $suggested_nickname = $this->suggestNicknameForUsername($nickname); + $user = User::staticGet('nickname', $suggested_nickname); if($user){ - //make sure a different provider isn't handling this nickname + //make sure this user isn't claimed $user_username = new User_username(); - $user_username->username=$nickname; - if(!$user_username->find()){ - //no other provider claims this username, so it's safe for us to handle it + $user_username->user_id=$user->id; + $we_can_handle = false; + if($user_username->find()){ + //either this provider, or another one, has already claimed this user + //so we cannot. Let another plugin try. + return; + }else{ + //no other provider claims this user, so it's safe for us to handle it $authenticated = $this->checkPassword($nickname, $password); if($authenticated){ - $authenticatedUser = User::staticGet('nickname', $nickname); + $authenticatedUser = $user; User_username::register($authenticatedUser,$nickname,$this->provider_name); return false; } diff --git a/lib/authorizationplugin.php b/lib/authorizationplugin.php index 733b0c065..07da9b2d1 100644 --- a/lib/authorizationplugin.php +++ b/lib/authorizationplugin.php @@ -85,7 +85,7 @@ abstract class AuthorizationPlugin extends Plugin } function onStartSetApiUser(&$user) { - return $this->onStartSetUser(&$user); + return $this->onStartSetUser($user); } function onStartHasRole($profile, $name, &$has_role) { diff --git a/lib/avatarlink.php b/lib/avatarlink.php new file mode 100644 index 000000000..e67799e2e --- /dev/null +++ b/lib/avatarlink.php @@ -0,0 +1,102 @@ +<?php +/** + * StatusNet, the distributed open-source microblogging tool + * + * An activity + * + * PHP version 5 + * + * LICENCE: This program is free software: you can redistribute it and/or modify + * it under the terms of the GNU Affero General Public License as published by + * the Free Software Foundation, either version 3 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Affero General Public License for more details. + * + * You should have received a copy of the GNU Affero General Public License + * along with this program. If not, see <http://www.gnu.org/licenses/>. + * + * @category Feed + * @package StatusNet + * @author Evan Prodromou <evan@status.net> + * @author Zach Copley <zach@status.net> + * @copyright 2010 StatusNet, Inc. + * @license http://www.fsf.org/licensing/licenses/agpl-3.0.html AGPLv3 + * @link http://status.net/ + */ + +if (!defined('STATUSNET')) { + exit(1); +} + +// XXX: Arg! This wouldn't be necessary if we used Avatars conistently +class AvatarLink +{ + public $url; + public $type; + public $size; + public $width; + public $height; + + function __construct($element=null) + { + if ($element) { + // @fixme use correct namespaces + $this->url = $element->getAttribute('href'); + $this->type = $element->getAttribute('type'); + $width = $element->getAttribute('media:width'); + if ($width != null) { + $this->width = intval($width); + } + $height = $element->getAttribute('media:height'); + if ($height != null) { + $this->height = intval($height); + } + } + } + + static function fromAvatar($avatar) + { + if (empty($avatar)) { + return null; + } + $alink = new AvatarLink(); + $alink->type = $avatar->mediatype; + $alink->height = $avatar->height; + $alink->width = $avatar->width; + $alink->url = $avatar->displayUrl(); + return $alink; + } + + static function fromFilename($filename, $size) + { + $alink = new AvatarLink(); + $alink->url = $filename; + $alink->height = $size; + if (!empty($filename)) { + $alink->width = $size; + $alink->type = self::mediatype($filename); + } else { + $alink->url = User_group::defaultLogo($size); + $alink->type = 'image/png'; + } + return $alink; + } + + // yuck! + static function mediatype($filename) { + $ext = strtolower(end(explode('.', $filename))); + if ($ext == 'jpeg') { + $ext = 'jpg'; + } + // hope we don't support any others + $types = array('png', 'gif', 'jpg', 'jpeg'); + if (in_array($ext, $types)) { + return 'image/' . $ext; + } + return null; + } +} diff --git a/lib/command.php b/lib/command.php index 8080fb8bc..216f9e649 100644 --- a/lib/command.php +++ b/lib/command.php @@ -711,6 +711,34 @@ class LoginCommand extends Command } } +class LoseCommand extends Command +{ + + var $other = null; + + function __construct($user, $other) + { + parent::__construct($user); + $this->other = $other; + } + + function execute($channel) + { + if(!$this->other) { + $channel->error($this->user, _('Specify the name of the user to unsubscribe from')); + return; + } + + $result = Subscription::cancel($this->getProfile($this->other), $this->user->getProfile()); + + if ($result) { + $channel->output($this->user, sprintf(_('Unsubscribed %s'), $this->other)); + } else { + $channel->error($this->user, $result); + } + } +} + class SubscriptionsCommand extends Command { function handle($channel) @@ -793,6 +821,7 @@ class HelpCommand extends Command "d <nickname> <text> - direct message to user\n". "get <nickname> - get last notice from user\n". "whois <nickname> - get profile info on user\n". + "lose <nickname> - force user to stop following you\n". "fav <nickname> - add user's last notice as a 'fave'\n". "fav #<notice_id> - add notice with the given id as a 'fave'\n". "repeat #<notice_id> - repeat a notice with a given id\n". diff --git a/lib/commandinterpreter.php b/lib/commandinterpreter.php index c2add7299..fbc6174bb 100644 --- a/lib/commandinterpreter.php +++ b/lib/commandinterpreter.php @@ -47,6 +47,17 @@ class CommandInterpreter } else { return new LoginCommand($user); } + case 'lose': + if ($arg) { + list($other, $extra) = $this->split_arg($arg); + if ($extra) { + return null; + } else { + return new LoseCommand($user, $other); + } + } else { + return null; + } case 'subscribers': if ($arg) { return null; diff --git a/lib/common.php b/lib/common.php index 5d53270e3..334a88ffd 100644 --- a/lib/common.php +++ b/lib/common.php @@ -123,7 +123,6 @@ require_once INSTALLDIR.'/lib/util.php'; require_once INSTALLDIR.'/lib/action.php'; require_once INSTALLDIR.'/lib/mail.php'; require_once INSTALLDIR.'/lib/subs.php'; -require_once INSTALLDIR.'/lib/activity.php'; require_once INSTALLDIR.'/lib/clientexception.php'; require_once INSTALLDIR.'/lib/serverexception.php'; diff --git a/lib/default.php b/lib/default.php index 46d3d4774..10f3f1a97 100644 --- a/lib/default.php +++ b/lib/default.php @@ -282,6 +282,7 @@ $default = 'Mapstraction' => null, 'OStatus' => null, 'WikiHashtags' => null, + 'RSSCloud' => null, 'OpenID' => null), ), 'admin' => diff --git a/lib/deluserqueuehandler.php b/lib/deluserqueuehandler.php new file mode 100644 index 000000000..4a1233a5e --- /dev/null +++ b/lib/deluserqueuehandler.php @@ -0,0 +1,95 @@ +<?php +/* + * StatusNet - the distributed open-source microblogging tool + * Copyright (C) 2010, StatusNet, Inc. + * + * This program is free software: you can redistribute it and/or modify + * it under the terms of the GNU Affero General Public License as published by + * the Free Software Foundation, either version 3 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Affero General Public License for more details. + * + * You should have received a copy of the GNU Affero General Public License + * along with this program. If not, see <http://www.gnu.org/licenses/>. + */ + +/** + * Background job to delete prolific users without disrupting front-end too much. + * + * Up to 50 messages are deleted on each run through; when all messages are gone, + * the actual account is deleted. + * + * @package QueueHandler + * @maintainer Brion Vibber <brion@status.net> + */ + +class DelUserQueueHandler extends QueueHandler +{ + const DELETION_WINDOW = 50; + + public function transport() + { + return 'deluser'; + } + + public function handle($user) + { + if (!($user instanceof User)) { + common_log(LOG_ERR, "Got a bogus user, not deleting"); + return true; + } + + $user = User::staticGet('id', $user->id); + if (!$user) { + common_log(LOG_INFO, "User {$user->nickname} was deleted before we got here."); + return true; + } + + if (!$user->hasRole(Profile_role::DELETED)) { + common_log(LOG_INFO, "User {$user->nickname} is not pending deletion; aborting."); + return true; + } + + $notice = $this->getNextBatch($user); + if ($notice->N) { + common_log(LOG_INFO, "Deleting next {$notice->N} notices by {$user->nickname}"); + while ($notice->fetch()) { + $del = clone($notice); + $del->delete(); + } + + // @todo improve reliability in case we died during the above deletions + // with a fatal error. If the job is lost, we should perform some kind + // of garbage collection later. + + // Queue up the next batch. + $qm = QueueManager::get(); + $qm->enqueue($user, 'deluser'); + } else { + // Out of notices? Let's finish deleting this guy! + $user->delete(); + common_log(LOG_INFO, "User $user->id $user->nickname deleted."); + return true; + } + + return true; + } + + /** + * Fetch the next self::DELETION_WINDOW messages for this user. + * @return Notice + */ + protected function getNextBatch(User $user) + { + $notice = new Notice(); + $notice->profile_id = $user->id; + $notice->limit(self::DELETION_WINDOW); + $notice->find(); + return $notice; + } + +} diff --git a/lib/htmloutputter.php b/lib/htmloutputter.php index 7315fe2ad..7786b5941 100644 --- a/lib/htmloutputter.php +++ b/lib/htmloutputter.php @@ -356,40 +356,47 @@ class HTMLOutputter extends XMLOutputter if( empty($url['scheme']) && empty($url['host']) && empty($url['query']) && empty($url['fragment'])) { - $path = common_config('javascript', 'path'); + if (strpos($src, 'plugins/') === 0 || strpos($src, 'local/') === 0) { - if (empty($path)) { - $path = common_config('site', 'path') . '/js/'; - } + $src = common_path($src) . '?version=' . STATUSNET_VERSION; - if ($path[strlen($path)-1] != '/') { - $path .= '/'; - } + }else{ - if ($path[0] != '/') { - $path = '/'.$path; - } + $path = common_config('javascript', 'path'); - $server = common_config('javascript', 'server'); + if (empty($path)) { + $path = common_config('site', 'path') . '/js/'; + } - if (empty($server)) { - $server = common_config('site', 'server'); - } + if ($path[strlen($path)-1] != '/') { + $path .= '/'; + } - $ssl = common_config('javascript', 'ssl'); + if ($path[0] != '/') { + $path = '/'.$path; + } + + $server = common_config('javascript', 'server'); - if (is_null($ssl)) { // null -> guess - if (common_config('site', 'ssl') == 'always' && - !common_config('javascript', 'server')) { - $ssl = true; - } else { - $ssl = false; + if (empty($server)) { + $server = common_config('site', 'server'); } - } - $protocol = ($ssl) ? 'https' : 'http'; + $ssl = common_config('javascript', 'ssl'); - $src = $protocol.'://'.$server.$path.$src . '?version=' . STATUSNET_VERSION; + if (is_null($ssl)) { // null -> guess + if (common_config('site', 'ssl') == 'always' && + !common_config('javascript', 'server')) { + $ssl = true; + } else { + $ssl = false; + } + } + + $protocol = ($ssl) ? 'https' : 'http'; + + $src = $protocol.'://'.$server.$path.$src . '?version=' . STATUSNET_VERSION; + } } $this->element('script', array('type' => $type, diff --git a/lib/imagefile.php b/lib/imagefile.php index 6bc8e599b..e47287741 100644 --- a/lib/imagefile.php +++ b/lib/imagefile.php @@ -60,6 +60,19 @@ class ImageFile $this->filepath = $filepath; $info = @getimagesize($this->filepath); + + if (!( + ($info[2] == IMAGETYPE_GIF && function_exists('imagecreatefromgif')) || + ($info[2] == IMAGETYPE_JPEG && function_exists('imagecreatefromjpeg')) || + $info[2] == IMAGETYPE_BMP || + ($info[2] == IMAGETYPE_WBMP && function_exists('imagecreatefromwbmp')) || + ($info[2] == IMAGETYPE_XBM && function_exists('imagecreatefromxbm')) || + ($info[2] == IMAGETYPE_PNG && function_exists('imagecreatefrompng')))) { + + throw new Exception(_('Unsupported image file format.')); + return; + } + $this->type = ($info) ? $info[2]:$type; $this->width = ($info) ? $info[0]:$width; $this->height = ($info) ? $info[1]:$height; @@ -97,15 +110,6 @@ class ImageFile return; } - if ($info[2] !== IMAGETYPE_GIF && - $info[2] !== IMAGETYPE_JPEG && - $info[2] !== IMAGETYPE_PNG) { - - @unlink($_FILES[$param]['tmp_name']); - throw new Exception(_('Unsupported image file format.')); - return; - } - return new ImageFile(null, $_FILES[$param]['tmp_name']); } @@ -146,6 +150,15 @@ class ImageFile case IMAGETYPE_PNG: $image_src = imagecreatefrompng($this->filepath); break; + case IMAGETYPE_BMP: + $image_src = imagecreatefrombmp($this->filepath); + break; + case IMAGETYPE_WBMP: + $image_src = imagecreatefromwbmp($this->filepath); + break; + case IMAGETYPE_XBM: + $image_src = imagecreatefromxbm($this->filepath); + break; default: throw new Exception(_('Unknown file type')); return; @@ -153,7 +166,7 @@ class ImageFile $image_dest = imagecreatetruecolor($size, $size); - if ($this->type == IMAGETYPE_GIF || $this->type == IMAGETYPE_PNG) { + if ($this->type == IMAGETYPE_GIF || $this->type == IMAGETYPE_PNG || $this->type == IMAGETYPE_BMP) { $transparent_idx = imagecolortransparent($image_src); @@ -176,6 +189,20 @@ class ImageFile imagecopyresampled($image_dest, $image_src, 0, 0, $x, $y, $size, $size, $w, $h); + if($this->type == IMAGETYPE_BMP) { + //we don't want to save BMP... it's an inefficient, rare, antiquated format + //save png instead + $this->type = IMAGETYPE_PNG; + } else if($this->type == IMAGETYPE_WBMP) { + //we don't want to save WBMP... it's a rare format that we can't guarantee clients will support + //save png instead + $this->type = IMAGETYPE_PNG; + } else if($this->type == IMAGETYPE_XBM) { + //we don't want to save XBM... it's a rare format that we can't guarantee clients will support + //save png instead + $this->type = IMAGETYPE_PNG; + } + $outname = Avatar::filename($this->id, image_type_to_extension($this->type), $size, @@ -245,4 +272,101 @@ class ImageFile return $num; } -}
\ No newline at end of file +} + +//PHP doesn't (as of 2/24/2010) have an imagecreatefrombmp so conditionally define one +if(!function_exists('imagecreatefrombmp')){ + //taken shamelessly from http://www.php.net/manual/en/function.imagecreatefromwbmp.php#86214 + function imagecreatefrombmp($p_sFile) + { + // Load the image into a string + $file = fopen($p_sFile,"rb"); + $read = fread($file,10); + while(!feof($file)&&($read<>"")) + $read .= fread($file,1024); + + $temp = unpack("H*",$read); + $hex = $temp[1]; + $header = substr($hex,0,108); + + // Process the header + // Structure: http://www.fastgraph.com/help/bmp_header_format.html + if (substr($header,0,4)=="424d") + { + // Cut it in parts of 2 bytes + $header_parts = str_split($header,2); + + // Get the width 4 bytes + $width = hexdec($header_parts[19].$header_parts[18]); + + // Get the height 4 bytes + $height = hexdec($header_parts[23].$header_parts[22]); + + // Unset the header params + unset($header_parts); + } + + // Define starting X and Y + $x = 0; + $y = 1; + + // Create newimage + $image = imagecreatetruecolor($width,$height); + + // Grab the body from the image + $body = substr($hex,108); + + // Calculate if padding at the end-line is needed + // Divided by two to keep overview. + // 1 byte = 2 HEX-chars + $body_size = (strlen($body)/2); + $header_size = ($width*$height); + + // Use end-line padding? Only when needed + $usePadding = ($body_size>($header_size*3)+4); + + // Using a for-loop with index-calculation instaid of str_split to avoid large memory consumption + // Calculate the next DWORD-position in the body + for ($i=0;$i<$body_size;$i+=3) + { + // Calculate line-ending and padding + if ($x>=$width) + { + // If padding needed, ignore image-padding + // Shift i to the ending of the current 32-bit-block + if ($usePadding) + $i += $width%4; + + // Reset horizontal position + $x = 0; + + // Raise the height-position (bottom-up) + $y++; + + // Reached the image-height? Break the for-loop + if ($y>$height) + break; + } + + // Calculation of the RGB-pixel (defined as BGR in image-data) + // Define $i_pos as absolute position in the body + $i_pos = $i*2; + $r = hexdec($body[$i_pos+4].$body[$i_pos+5]); + $g = hexdec($body[$i_pos+2].$body[$i_pos+3]); + $b = hexdec($body[$i_pos].$body[$i_pos+1]); + + // Calculate and draw the pixel + $color = imagecolorallocate($image,$r,$g,$b); + imagesetpixel($image,$x,$height-$y,$color); + + // Raise the horizontal position + $x++; + } + + // Unset the body / free the memory + unset($body); + + // Return image-object + return $image; + } +} diff --git a/lib/iomaster.php b/lib/iomaster.php index d20837ba5..7cfb2c9a0 100644 --- a/lib/iomaster.php +++ b/lib/iomaster.php @@ -330,7 +330,7 @@ abstract class IoMaster * for per-queue and per-site records. * * @param string $key counter name - * @param array $owners list of owner keys like 'queue:jabber' or 'site:stat01' + * @param array $owners list of owner keys like 'queue:xmpp' or 'site:stat01' */ public function stats($key, $owners=array()) { diff --git a/lib/language.php b/lib/language.php index f5ee7fac5..64b59e739 100644 --- a/lib/language.php +++ b/lib/language.php @@ -289,6 +289,7 @@ function get_all_languages() { 'ar' => array('q' => 0.8, 'lang' => 'ar', 'name' => 'Arabic', 'direction' => 'rtl'), 'arz' => array('q' => 0.8, 'lang' => 'arz', 'name' => 'Egyptian Spoken Arabic', 'direction' => 'rtl'), 'bg' => array('q' => 0.8, 'lang' => 'bg', 'name' => 'Bulgarian', 'direction' => 'ltr'), + 'br' => array('q' => 0.8, 'lang' => 'br', 'name' => 'Breton', 'direction' => 'ltr'), 'ca' => array('q' => 0.5, 'lang' => 'ca', 'name' => 'Catalan', 'direction' => 'ltr'), 'cs' => array('q' => 0.5, 'lang' => 'cs', 'name' => 'Czech', 'direction' => 'ltr'), 'de' => array('q' => 0.8, 'lang' => 'de', 'name' => 'German', 'direction' => 'ltr'), diff --git a/lib/mail.php b/lib/mail.php index c724764cc..807b6a363 100644 --- a/lib/mail.php +++ b/lib/mail.php @@ -133,12 +133,13 @@ function mail_notify_from() * @param User &$user user to send email to * @param string $subject subject of the email * @param string $body body of the email + * @param array $headers optional list of email headers * @param string $address optional specification of email address * * @return boolean success flag */ -function mail_to_user(&$user, $subject, $body, $address=null) +function mail_to_user(&$user, $subject, $body, $headers=array(), $address=null) { if (!$address) { $address = $user->email; @@ -180,7 +181,9 @@ function mail_confirm_address($user, $code, $nickname, $address) $nickname, common_config('site', 'name'), common_local_url('confirmaddress', array('code' => $code)), common_config('site', 'name')); - return mail_to_user($user, $subject, $body, $address); + $headers = array(); + + return mail_to_user($user, $subject, $body, $headers, $address); } /** @@ -231,6 +234,7 @@ function mail_subscribe_notify_profile($listenee, $other) $recipients = $listenee->email; + $headers = _mail_prepare_headers('subscribe', $listenee->nickname, $other->nickname); $headers['From'] = mail_notify_from(); $headers['To'] = $name . ' <' . $listenee->email . '>'; $headers['Subject'] = sprintf(_('%1$s is now listening to '. @@ -476,7 +480,10 @@ function mail_notify_nudge($from, $to) common_local_url('all', array('nickname' => $to->nickname)), common_config('site', 'name')); common_init_locale(); - return mail_to_user($to, $subject, $body); + + $headers = _mail_prepare_headers('nudge', $to->nickname, $from->nickname); + + return mail_to_user($to, $subject, $body, $headers); } /** @@ -526,8 +533,10 @@ function mail_notify_message($message, $from=null, $to=null) common_local_url('newmessage', array('to' => $from->id)), common_config('site', 'name')); + $headers = _mail_prepare_headers('message', $to->nickname, $from->nickname); + common_init_locale(); - return mail_to_user($to, $subject, $body); + return mail_to_user($to, $subject, $body, $headers); } /** @@ -578,8 +587,10 @@ function mail_notify_fave($other, $user, $notice) common_config('site', 'name'), $user->nickname); + $headers = _mail_prepare_headers('fave', $other->nickname, $user->nickname); + common_init_locale(); - mail_to_user($other, $subject, $body); + mail_to_user($other, $subject, $body, $headers); } /** @@ -611,19 +622,19 @@ function mail_notify_attn($user, $notice) common_init_locale($user->language); - if ($notice->conversation != $notice->id) { - $conversationEmailText = "The full conversation can be read here:\n\n". - "\t%5\$s\n\n "; - $conversationUrl = common_local_url('conversation', + if ($notice->conversation != $notice->id) { + $conversationEmailText = "The full conversation can be read here:\n\n". + "\t%5\$s\n\n "; + $conversationUrl = common_local_url('conversation', array('id' => $notice->conversation)).'#notice-'.$notice->id; - } else { - $conversationEmailText = "%5\$s"; - $conversationUrl = null; - } + } else { + $conversationEmailText = "%5\$s"; + $conversationUrl = null; + } $subject = sprintf(_('%s (@%s) sent a notice to your attention'), $bestname, $sender->nickname); - $body = sprintf(_("%1\$s (@%9\$s) just sent a notice to your attention (an '@-reply') on %2\$s.\n\n". + $body = sprintf(_("%1\$s (@%9\$s) just sent a notice to your attention (an '@-reply') on %2\$s.\n\n". "The notice is here:\n\n". "\t%3\$s\n\n" . "It reads:\n\n". @@ -641,7 +652,7 @@ function mail_notify_attn($user, $notice) common_local_url('shownotice', array('notice' => $notice->id)),//%3 $notice->content,//%4 - $conversationUrl,//%5 + $conversationUrl,//%5 common_local_url('newnotice', array('replyto' => $sender->nickname, 'inreplyto' => $notice->id)),//%6 common_local_url('replies', @@ -649,6 +660,30 @@ function mail_notify_attn($user, $notice) common_local_url('emailsettings'), //%8 $sender->nickname); //%9 + $headers = _mail_prepare_headers('mention', $user->nickname, $sender->nickname); + common_init_locale(); - mail_to_user($user, $subject, $body); + mail_to_user($user, $subject, $body, $headers); } + +/** + * Prepare the common mail headers used in notification emails + * + * @param string $msg_type type of message being sent to the user + * @param string $to nickname of the receipient + * @param string $from nickname of the user triggering the notification + * + * @return array list of mail headers to include in the message + */ +function _mail_prepare_headers($msg_type, $to, $from) +{ + $headers = array( + 'X-StatusNet-MessageType' => $msg_type, + 'X-StatusNet-TargetUser' => $to, + 'X-StatusNet-SourceUser' => $from, + 'X-StatusNet-Domain' => common_config('site', 'server') + ); + + return $headers; +} + diff --git a/lib/mediafile.php b/lib/mediafile.php index e3d5b1dbc..10d90d008 100644 --- a/lib/mediafile.php +++ b/lib/mediafile.php @@ -262,7 +262,7 @@ class MediaFile $filetype = MIME_Type::autoDetect($stream['uri']); } - if (in_array($filetype, common_config('attachments', 'supported'))) { + if (common_config('attachments', 'supported') === true || in_array($filetype, common_config('attachments', 'supported'))) { return $filetype; } $media = MIME_Type::getMedia($filetype); diff --git a/lib/messageform.php b/lib/messageform.php index 0c568e1bd..b116964da 100644 --- a/lib/messageform.php +++ b/lib/messageform.php @@ -175,6 +175,6 @@ class MessageForm extends Form 'class' => 'submit', 'name' => 'message_send', 'type' => 'submit', - 'value' => _('Send'))); + 'value' => _m('Send button for sending notice', 'Send'))); } } diff --git a/lib/mysqlschema.php b/lib/mysqlschema.php index 485096ac4..455695366 100644 --- a/lib/mysqlschema.php +++ b/lib/mysqlschema.php @@ -90,15 +90,24 @@ class MysqlSchema extends Schema * @param string $name Name of the table to get * * @return TableDef tabledef for that table. + * @throws SchemaTableMissingException */ public function getTableDef($name) { - $res = $this->conn->query('DESCRIBE ' . $name); + $query = "SELECT * FROM INFORMATION_SCHEMA.COLUMNS " . + "WHERE TABLE_SCHEMA='%s' AND TABLE_NAME='%s'"; + $schema = $this->conn->dsn['database']; + $sql = sprintf($query, $schema, $name); + $res = $this->conn->query($sql); if (PEAR::isError($res)) { throw new Exception($res->getMessage()); } + if ($res->numRows() == 0) { + $res->free(); + throw new SchemaTableMissingException("No such table: $name"); + } $td = new TableDef(); @@ -111,9 +120,9 @@ class MysqlSchema extends Schema $cd = new ColumnDef(); - $cd->name = $row['Field']; + $cd->name = $row['COLUMN_NAME']; - $packed = $row['Type']; + $packed = $row['COLUMN_TYPE']; if (preg_match('/^(\w+)\((\d+)\)$/', $packed, $match)) { $cd->type = $match[1]; @@ -122,18 +131,58 @@ class MysqlSchema extends Schema $cd->type = $packed; } - $cd->nullable = ($row['Null'] == 'YES') ? true : false; - $cd->key = $row['Key']; - $cd->default = $row['Default']; - $cd->extra = $row['Extra']; + $cd->nullable = ($row['IS_NULLABLE'] == 'YES') ? true : false; + $cd->key = $row['COLUMN_KEY']; + $cd->default = $row['COLUMN_DEFAULT']; + $cd->extra = $row['EXTRA']; + + // Autoincrement is stuck into the extra column. + // Pull it out so we don't accidentally mod it every time... + $extra = preg_replace('/(^|\s)auto_increment(\s|$)/i', '$1$2', $cd->extra); + if ($extra != $cd->extra) { + $cd->extra = trim($extra); + $cd->auto_increment = true; + } + + // mysql extensions -- not (yet) used by base class + $cd->charset = $row['CHARACTER_SET_NAME']; + $cd->collate = $row['COLLATION_NAME']; $td->columns[] = $cd; } + $res->free(); return $td; } /** + * Pull the given table properties from INFORMATION_SCHEMA. + * Most of the good stuff is MySQL extensions. + * + * @return array + * @throws Exception if table info can't be looked up + */ + + function getTableProperties($table, $props) + { + $query = "SELECT %s FROM INFORMATION_SCHEMA.TABLES " . + "WHERE TABLE_SCHEMA='%s' AND TABLE_NAME='%s'"; + $schema = $this->conn->dsn['database']; + $sql = sprintf($query, implode(',', $props), $schema, $table); + $res = $this->conn->query($sql); + + $row = array(); + $ok = $res->fetchInto($row, DB_FETCHMODE_ASSOC); + $res->free(); + + if ($ok) { + return $row; + } else { + throw new SchemaTableMissingException("No such table: $table"); + } + } + + /** * Gets a ColumnDef object for a single column. * * Throws an exception if the table is not found. @@ -185,35 +234,26 @@ class MysqlSchema extends Schema } $sql .= $this->_columnSql($cd); - - switch ($cd->key) { - case 'UNI': - $uniques[] = $cd->name; - break; - case 'PRI': - $primary[] = $cd->name; - break; - case 'MUL': - $indices[] = $cd->name; - break; - } } - if (count($primary) > 0) { // it really should be... - $sql .= ",\nconstraint primary key (" . implode(',', $primary) . ")"; + $idx = $this->_indexList($columns); + + if ($idx['primary']) { + $sql .= ",\nconstraint primary key (" . implode(',', $idx['primary']) . ")"; } - foreach ($uniques as $u) { - $sql .= ",\nunique index {$name}_{$u}_idx ($u)"; + foreach ($idx['uniques'] as $u) { + $key = $this->_uniqueKey($name, $u); + $sql .= ",\nunique index $key ($u)"; } - foreach ($indices as $i) { - $sql .= ",\nindex {$name}_{$i}_idx ($i)"; + foreach ($idx['indices'] as $i) { + $key = $this->_key($name, $i); + $sql .= ",\nindex $key ($i)"; } - $sql .= "); "; + $sql .= ") ENGINE=InnoDB CHARACTER SET utf8 COLLATE utf8_bin; "; - common_log(LOG_INFO, $sql); $res = $this->conn->query($sql); if (PEAR::isError($res)) { @@ -224,6 +264,47 @@ class MysqlSchema extends Schema } /** + * Look over a list of column definitions and list up which + * indices will be present + */ + private function _indexList(array $columns) + { + $list = array('uniques' => array(), + 'primary' => array(), + 'indices' => array()); + foreach ($columns as $cd) { + switch ($cd->key) { + case 'UNI': + $list['uniques'][] = $cd->name; + break; + case 'PRI': + $list['primary'][] = $cd->name; + break; + case 'MUL': + $list['indices'][] = $cd->name; + break; + } + } + return $list; + } + + /** + * Get the unique index key name for a given column on this table + */ + function _uniqueKey($tableName, $columnName) + { + return $this->_key($tableName, $columnName); + } + + /** + * Get the index key name for a given column on this table + */ + function _key($tableName, $columnName) + { + return "{$tableName}_{$columnName}_idx"; + } + + /** * Drops a table from the schema * * Throws an exception if the table is not found. @@ -394,21 +475,20 @@ class MysqlSchema extends Schema try { $td = $this->getTableDef($tableName); - } catch (Exception $e) { - if (preg_match('/no such table/', $e->getMessage())) { - return $this->createTable($tableName, $columns); - } else { - throw $e; - } + } catch (SchemaTableMissingException $e) { + return $this->createTable($tableName, $columns); } $cur = $this->_names($td->columns); $new = $this->_names($columns); - $toadd = array_diff($new, $cur); - $todrop = array_diff($cur, $new); - $same = array_intersect($new, $cur); - $tomod = array(); + $dropIndex = array(); + $toadd = array_diff($new, $cur); + $todrop = array_diff($cur, $new); + $same = array_intersect($new, $cur); + $tomod = array(); + $addIndex = array(); + $tableProps = array(); foreach ($same as $m) { $curCol = $this->_byName($td->columns, $m); @@ -416,10 +496,64 @@ class MysqlSchema extends Schema if (!$newCol->equals($curCol)) { $tomod[] = $newCol->name; + continue; + } + + // Earlier versions may have accidentally left tables at default + // charsets which might be latin1 or other freakish things. + if ($this->_isString($curCol)) { + if ($curCol->charset != 'utf8') { + $tomod[] = $newCol->name; + continue; + } + } + } + + // Find any indices we have to change... + $curIdx = $this->_indexList($td->columns); + $newIdx = $this->_indexList($columns); + + if ($curIdx['primary'] != $newIdx['primary']) { + if ($curIdx['primary']) { + $dropIndex[] = 'drop primary key'; + } + if ($newIdx['primary']) { + $keys = implode(',', $newIdx['primary']); + $addIndex[] = "add constraint primary key ($keys)"; } } - if (count($toadd) + count($todrop) + count($tomod) == 0) { + $dropUnique = array_diff($curIdx['uniques'], $newIdx['uniques']); + $addUnique = array_diff($newIdx['uniques'], $curIdx['uniques']); + foreach ($dropUnique as $columnName) { + $dropIndex[] = 'drop key ' . $this->_uniqueKey($tableName, $columnName); + } + foreach ($addUnique as $columnName) { + $addIndex[] = 'add constraint unique key ' . $this->_uniqueKey($tableName, $columnName) . " ($columnName)";; + } + + $dropMultiple = array_diff($curIdx['indices'], $newIdx['indices']); + $addMultiple = array_diff($newIdx['indices'], $curIdx['indices']); + foreach ($dropMultiple as $columnName) { + $dropIndex[] = 'drop key ' . $this->_key($tableName, $columnName); + } + foreach ($addMultiple as $columnName) { + $addIndex[] = 'add key ' . $this->_key($tableName, $columnName) . " ($columnName)"; + } + + // Check for table properties: make sure we're using a sane + // engine type and charset/collation. + // @fixme make the default engine configurable? + $oldProps = $this->getTableProperties($tableName, array('ENGINE', 'TABLE_COLLATION')); + if (strtolower($oldProps['ENGINE']) != 'innodb') { + $tableProps['ENGINE'] = 'InnoDB'; + } + if (strtolower($oldProps['TABLE_COLLATION']) != 'utf8_bin') { + $tableProps['DEFAULT CHARSET'] = 'utf8'; + $tableProps['COLLATE'] = 'utf8_bin'; + } + + if (count($dropIndex) + count($toadd) + count($todrop) + count($tomod) + count($addIndex) + count($tableProps) == 0) { // nothing to do return true; } @@ -429,6 +563,10 @@ class MysqlSchema extends Schema $phrase = array(); + foreach ($dropIndex as $indexSql) { + $phrase[] = $indexSql; + } + foreach ($toadd as $columnName) { $cd = $this->_byName($columns, $columnName); @@ -445,8 +583,17 @@ class MysqlSchema extends Schema $phrase[] = 'MODIFY COLUMN ' . $this->_columnSql($cd); } + foreach ($addIndex as $indexSql) { + $phrase[] = $indexSql; + } + + foreach ($tableProps as $key => $val) { + $phrase[] = "$key=$val"; + } + $sql = 'ALTER TABLE ' . $tableName . ' ' . implode(', ', $phrase); + common_log(LOG_DEBUG, __METHOD__ . ': ' . $sql); $res = $this->conn->query($sql); if (PEAR::isError($res)) { @@ -519,6 +666,10 @@ class MysqlSchema extends Schema $sql .= "{$cd->type} "; } + if ($this->_isString($cd)) { + $sql .= " CHARACTER SET utf8 "; + } + if (!empty($cd->default)) { $sql .= "default {$cd->default} "; } else { @@ -535,4 +686,13 @@ class MysqlSchema extends Schema return $sql; } + + /** + * Is this column a string type? + */ + private function _isString(ColumnDef $cd) + { + $strings = array('char', 'varchar', 'text'); + return in_array(strtolower($cd->type), $strings); + } } diff --git a/lib/noticeform.php b/lib/noticeform.php index 62df5c941..7278c41a9 100644 --- a/lib/noticeform.php +++ b/lib/noticeform.php @@ -233,6 +233,6 @@ class NoticeForm extends Form 'class' => 'submit', 'name' => 'status_submit', 'type' => 'submit', - 'value' => _('Send'))); + 'value' => _m('Send button for sending notice', 'Send'))); } } diff --git a/lib/noticelist.php b/lib/noticelist.php index 88a925241..811b7e4f1 100644 --- a/lib/noticelist.php +++ b/lib/noticelist.php @@ -442,11 +442,13 @@ class NoticeListItem extends Widget 'title' => $latlon), $name); } else { - $this->out->elementStart('a', array('href' => $url)); - $this->out->element('abbr', array('class' => 'geo', - 'title' => $latlon), - $name); - $this->out->elementEnd('a'); + $xstr = new XMLStringer(false); + $xstr->elementStart('a', array('href' => $url)); + $xstr->element('abbr', array('class' => 'geo', + 'title' => $latlon), + $name); + $xstr->elementEnd('a'); + $this->out->raw($xstr->getString()); } $this->out->elementEnd('span'); } diff --git a/lib/pgsqlschema.php b/lib/pgsqlschema.php index 91bc09667..715065d77 100644 --- a/lib/pgsqlschema.php +++ b/lib/pgsqlschema.php @@ -61,7 +61,8 @@ class PgsqlSchema extends Schema public function getTableDef($name) { - $res = $this->conn->query("select *, column_default as default, is_nullable as Null, udt_name as Type, column_name AS Field from INFORMATION_SCHEMA.COLUMNS where table_name = '$name'"); + $res = $this->conn->query("SELECT *, column_default as default, is_nullable as Null, + udt_name as Type, column_name AS Field from INFORMATION_SCHEMA.COLUMNS where table_name = '$name'"); if (PEAR::isError($res)) { throw new Exception($res->getMessage()); @@ -72,6 +73,9 @@ class PgsqlSchema extends Schema $td->name = $name; $td->columns = array(); + if ($res->numRows() == 0 ) { + throw new Exception('no such table'); //pretend to be the msyql error. yeah, this sucks. + } $row = array(); while ($res->fetchInto($row, DB_FETCHMODE_ASSOC)) { @@ -166,12 +170,10 @@ class PgsqlSchema extends Schema } if (count($primary) > 0) { // it really should be... - $sql .= ",\nconstraint primary key (" . implode(',', $primary) . ")"; + $sql .= ",\n primary key (" . implode(',', $primary) . ")"; } - foreach ($uniques as $u) { - $sql .= ",\nunique index {$name}_{$u}_idx ($u)"; - } + foreach ($indices as $i) { $sql .= ",\nindex {$name}_{$i}_idx ($i)"; @@ -179,6 +181,10 @@ class PgsqlSchema extends Schema $sql .= "); "; + + foreach ($uniques as $u) { + $sql .= "\n CREATE index {$name}_{$u}_idx ON {$name} ($u); "; + } $res = $this->conn->query($sql); if (PEAR::isError($res)) { @@ -210,6 +216,22 @@ class PgsqlSchema extends Schema } /** + * Translate the (mostly) mysql-ish column types into somethings more standard + * @param string column type + * + * @return string postgres happy column type + */ + private function _columnTypeTranslation($type) { + $map = array( + 'datetime' => 'timestamp' + ); + if(!empty($map[$type])) { + return $map[$type]; + } + return $type; + } + + /** * Adds an index to a table. * * If no name is provided, a name will be made up based @@ -359,6 +381,7 @@ class PgsqlSchema extends Schema try { $td = $this->getTableDef($tableName); + } catch (Exception $e) { if (preg_match('/no such table/', $e->getMessage())) { return $this->createTable($tableName, $columns); @@ -477,11 +500,12 @@ class PgsqlSchema extends Schema private function _columnSql($cd) { $sql = "{$cd->name} "; + $type = $this->_columnTypeTranslation($cd->type); if (!empty($cd->size)) { - $sql .= "{$cd->type}({$cd->size}) "; + $sql .= "{$type}({$cd->size}) "; } else { - $sql .= "{$cd->type} "; + $sql .= "{$type} "; } if (!empty($cd->default)) { diff --git a/lib/poco.php b/lib/poco.php new file mode 100644 index 000000000..2157062b3 --- /dev/null +++ b/lib/poco.php @@ -0,0 +1,240 @@ +<?php +/** + * StatusNet, the distributed open-source microblogging tool + * + * An activity + * + * PHP version 5 + * + * LICENCE: This program is free software: you can redistribute it and/or modify + * it under the terms of the GNU Affero General Public License as published by + * the Free Software Foundation, either version 3 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Affero General Public License for more details. + * + * You should have received a copy of the GNU Affero General Public License + * along with this program. If not, see <http://www.gnu.org/licenses/>. + * + * @category Feed + * @package StatusNet + * @author Evan Prodromou <evan@status.net> + * @author Zach Copley <zach@status.net> + * @copyright 2010 StatusNet, Inc. + * @license http://www.fsf.org/licensing/licenses/agpl-3.0.html AGPLv3 + * @link http://status.net/ + */ + +if (!defined('STATUSNET')) { + exit(1); +} + +class PoCo +{ + const NS = 'http://portablecontacts.net/spec/1.0'; + + const USERNAME = 'preferredUsername'; + const DISPLAYNAME = 'displayName'; + const NOTE = 'note'; + + public $preferredUsername; + public $displayName; + public $note; + public $address; + public $urls = array(); + + function __construct($element = null) + { + if (empty($element)) { + return; + } + + $this->preferredUsername = ActivityUtils::childContent( + $element, + self::USERNAME, + self::NS + ); + + $this->displayName = ActivityUtils::childContent( + $element, + self::DISPLAYNAME, + self::NS + ); + + $this->note = ActivityUtils::childContent( + $element, + self::NOTE, + self::NS + ); + + $this->address = $this->_getAddress($element); + $this->urls = $this->_getURLs($element); + } + + private function _getURLs($element) + { + $urlEls = $element->getElementsByTagnameNS(self::NS, PoCoURL::URLS); + $urls = array(); + + foreach ($urlEls as $urlEl) { + + $type = ActivityUtils::childContent( + $urlEl, + PoCoURL::TYPE, + PoCo::NS + ); + + $value = ActivityUtils::childContent( + $urlEl, + PoCoURL::VALUE, + PoCo::NS + ); + + $primary = ActivityUtils::childContent( + $urlEl, + PoCoURL::PRIMARY, + PoCo::NS + ); + + $isPrimary = false; + + if (isset($primary) && $primary == 'true') { + $isPrimary = true; + } + + // @todo check to make sure a primary hasn't already been added + + array_push($urls, new PoCoURL($type, $value, $isPrimary)); + } + return $urls; + } + + private function _getAddress($element) + { + $addressEl = ActivityUtils::child( + $element, + PoCoAddress::ADDRESS, + PoCo::NS + ); + + if (!empty($addressEl)) { + $formatted = ActivityUtils::childContent( + $addressEl, + PoCoAddress::FORMATTED, + self::NS + ); + + if (!empty($formatted)) { + $address = new PoCoAddress(); + $address->formatted = $formatted; + return $address; + } + } + + return null; + } + + function fromProfile($profile) + { + if (empty($profile)) { + return null; + } + + $poco = new PoCo(); + + $poco->preferredUsername = $profile->nickname; + $poco->displayName = $profile->getBestName(); + + $poco->note = $profile->bio; + + $paddy = new PoCoAddress(); + $paddy->formatted = $profile->location; + $poco->address = $paddy; + + if (!empty($profile->homepage)) { + array_push( + $poco->urls, + new PoCoURL( + 'homepage', + $profile->homepage, + true + ) + ); + } + + return $poco; + } + + function fromGroup($group) + { + if (empty($group)) { + return null; + } + + $poco = new PoCo(); + + $poco->preferredUsername = $group->nickname; + $poco->displayName = $group->getBestName(); + + $poco->note = $group->description; + + $paddy = new PoCoAddress(); + $paddy->formatted = $group->location; + $poco->address = $paddy; + + if (!empty($group->homepage)) { + array_push( + $poco->urls, + new PoCoURL( + 'homepage', + $group->homepage, + true + ) + ); + } + + return $poco; + } + + function getPrimaryURL() + { + foreach ($this->urls as $url) { + if ($url->primary) { + return $url; + } + } + } + + function asString() + { + $xs = new XMLStringer(true); + $xs->element( + 'poco:preferredUsername', + null, + $this->preferredUsername + ); + + $xs->element( + 'poco:displayName', + null, + $this->displayName + ); + + if (!empty($this->note)) { + $xs->element('poco:note', null, common_xml_safe_str($this->note)); + } + + if (!empty($this->address)) { + $xs->raw($this->address->asString()); + } + + foreach ($this->urls as $url) { + $xs->raw($url->asString()); + } + + return $xs->getString(); + } +} diff --git a/lib/pocoaddress.php b/lib/pocoaddress.php new file mode 100644 index 000000000..60873bdc4 --- /dev/null +++ b/lib/pocoaddress.php @@ -0,0 +1,56 @@ +<?php +/** + * StatusNet, the distributed open-source microblogging tool + * + * An activity + * + * PHP version 5 + * + * LICENCE: This program is free software: you can redistribute it and/or modify + * it under the terms of the GNU Affero General Public License as published by + * the Free Software Foundation, either version 3 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Affero General Public License for more details. + * + * You should have received a copy of the GNU Affero General Public License + * along with this program. If not, see <http://www.gnu.org/licenses/>. + * + * @category Feed + * @package StatusNet + * @author Evan Prodromou <evan@status.net> + * @author Zach Copley <zach@status.net> + * @copyright 2010 StatusNet, Inc. + * @license http://www.fsf.org/licensing/licenses/agpl-3.0.html AGPLv3 + * @link http://status.net/ + */ + +if (!defined('STATUSNET')) { + exit(1); +} + +class PoCoAddress +{ + const ADDRESS = 'address'; + const FORMATTED = 'formatted'; + + public $formatted; + + // @todo Other address fields + + function asString() + { + if (!empty($this->formatted)) { + $xs = new XMLStringer(true); + $xs->elementStart('poco:address'); + $xs->element('poco:formatted', null, common_xml_safe_str($this->formatted)); + $xs->elementEnd('poco:address'); + return $xs->getString(); + } + + return null; + } +} diff --git a/lib/pocourl.php b/lib/pocourl.php new file mode 100644 index 000000000..803484d76 --- /dev/null +++ b/lib/pocourl.php @@ -0,0 +1,65 @@ +<?php +/** + * StatusNet, the distributed open-source microblogging tool + * + * An activity + * + * PHP version 5 + * + * LICENCE: This program is free software: you can redistribute it and/or modify + * it under the terms of the GNU Affero General Public License as published by + * the Free Software Foundation, either version 3 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Affero General Public License for more details. + * + * You should have received a copy of the GNU Affero General Public License + * along with this program. If not, see <http://www.gnu.org/licenses/>. + * + * @category Feed + * @package StatusNet + * @author Evan Prodromou <evan@status.net> + * @author Zach Copley <zach@status.net> + * @copyright 2010 StatusNet, Inc. + * @license http://www.fsf.org/licensing/licenses/agpl-3.0.html AGPLv3 + * @link http://status.net/ + */ + +if (!defined('STATUSNET')) { + exit(1); +} + +class PoCoURL +{ + const URLS = 'urls'; + const TYPE = 'type'; + const VALUE = 'value'; + const PRIMARY = 'primary'; + + public $type; + public $value; + public $primary; + + function __construct($type, $value, $primary = false) + { + $this->type = $type; + $this->value = $value; + $this->primary = $primary; + } + + function asString() + { + $xs = new XMLStringer(true); + $xs->elementStart('poco:urls'); + $xs->element('poco:type', null, $this->type); + $xs->element('poco:value', null, $this->value); + if (!empty($this->primary)) { + $xs->element('poco:primary', null, 'true'); + } + $xs->elementEnd('poco:urls'); + return $xs->getString(); + } +} diff --git a/lib/queuemanager.php b/lib/queuemanager.php index 9fdc80110..0829c8a8b 100644 --- a/lib/queuemanager.php +++ b/lib/queuemanager.php @@ -213,7 +213,9 @@ abstract class QueueManager extends IoManager { if (isset($this->handlers[$queue])) { $class = $this->handlers[$queue]; - if (class_exists($class)) { + if(is_object($class)) { + return $class; + } else if (class_exists($class)) { return new $class(); } else { $this->_log(LOG_ERR, "Nonexistent handler class '$class' for queue '$queue'"); @@ -262,6 +264,9 @@ abstract class QueueManager extends IoManager $this->connect('sms', 'SmsQueueHandler'); } + // Background user management tasks... + $this->connect('deluser', 'DelUserQueueHandler'); + // Broadcasting profile updates to OMB remote subscribers $this->connect('profile', 'ProfileQueueHandler'); @@ -286,7 +291,7 @@ abstract class QueueManager extends IoManager * Only registered transports will be reliably picked up! * * @param string $transport - * @param string $class + * @param string $class class name or object instance * @param string $group */ public function connect($transport, $class, $group='main') diff --git a/lib/router.php b/lib/router.php index 706120e0b..a48ee875e 100644 --- a/lib/router.php +++ b/lib/router.php @@ -628,6 +628,12 @@ class Router array('action' => 'ApiTimelineTag', 'format' => '(xmljson|rss|atom)')); + // media related + $m->connect( + 'api/statusnet/media/upload', + array('action' => 'ApiMediaUpload') + ); + // search $m->connect('api/search.atom', array('action' => 'twitapisearchatom')); $m->connect('api/search.json', array('action' => 'twitapisearchjson')); diff --git a/lib/schema.php b/lib/schema.php index 137b814e0..1503c96d4 100644 --- a/lib/schema.php +++ b/lib/schema.php @@ -485,3 +485,9 @@ class Schema return $sql; } } + +class SchemaTableMissingException extends Exception +{ + // no-op +} + diff --git a/lib/servererroraction.php b/lib/servererroraction.php index 0993a63bc..9b5a553dc 100644 --- a/lib/servererroraction.php +++ b/lib/servererroraction.php @@ -62,15 +62,18 @@ class ServerErrorAction extends ErrorAction 504 => 'Gateway Timeout', 505 => 'HTTP Version Not Supported'); - function __construct($message='Error', $code=500) + function __construct($message='Error', $code=500, $ex=null) { parent::__construct($message, $code); $this->default = 500; // Server errors must be logged. - - common_log(LOG_ERR, "ServerErrorAction: $code $message"); + $log = "ServerErrorAction: $code $message"; + if ($ex) { + $log .= "\n" . $ex->getTraceAsString(); + } + common_log(LOG_ERR, $log); } // XXX: Should these error actions even be invokable via URI? diff --git a/lib/subs.php b/lib/subs.php index 1c240c475..165bbaa8f 100644 --- a/lib/subs.php +++ b/lib/subs.php @@ -42,4 +42,4 @@ function subs_unsubscribe_to($user, $other) } catch (Exception $e) { return $e->getMessage(); } -}
\ No newline at end of file +} diff --git a/lib/userprofile.php b/lib/userprofile.php index 8464c2446..2c3b1ea45 100644 --- a/lib/userprofile.php +++ b/lib/userprofile.php @@ -228,6 +228,17 @@ class UserProfile extends Widget function showEntityActions() { + if ($this->profile->hasRole(Profile_role::DELETED)) { + $this->out->elementStart('div', 'entity_actions'); + $this->out->element('h2', null, _('User actions')); + $this->out->elementStart('ul'); + $this->out->elementStart('p', array('class' => 'profile_deleted')); + $this->out->text(_('User deletion in progress...')); + $this->out->elementEnd('p'); + $this->out->elementEnd('ul'); + $this->out->elementEnd('div'); + return; + } if (Event::handle('StartProfilePageActionsSection', array(&$this->out, $this->profile))) { $cur = common_current_user(); diff --git a/lib/util.php b/lib/util.php index 3d4ed087f..795997868 100644 --- a/lib/util.php +++ b/lib/util.php @@ -1493,7 +1493,15 @@ function common_copy_args($from) $to = array(); $strip = get_magic_quotes_gpc(); foreach ($from as $k => $v) { - $to[$k] = ($strip) ? stripslashes($v) : $v; + if($strip) { + if(is_array($v)) { + $to[$k] = common_copy_args($v); + } else { + $to[$k] = stripslashes($v); + } + } else { + $to[$k] = $v; + } } return $to; } |