Merge branch '0.9.x' of git@gitorious.org:statusnet/mainline into 0.9.x

author: Brion Vibber <brion@pobox.com> 2010-03-02 15:16:48 -0800
committer: Brion Vibber <brion@pobox.com> 2010-03-02 15:16:48 -0800
commit: 8e06b932af93b8fbd66610c948bdde4fafd4f300 (patch)
tree: 07b772b280e6f23761c0111d953b3c2f5b8d2120 /lib
parent: 453ad6a9964fe572f0f35821e3f78c6a77c57c49 (diff)
parent: ddf3614c843bcd8d9ecfd0850ac9a8cefae6dbba (diff)
32 files changed, 2115 insertions, 342 deletions
diff --git a/lib/action.php b/lib/action.php
index b85f353a3..a804b8e82 100644
--- a/lib/action.php
+++ b/lib/action.php
@@ -249,7 +249,7 @@ class Action extends HTMLOutputter // lawsuit
                 $this->script('jquery.min.js');
                 $this->script('jquery.form.js');
                 $this->script('jquery.cookie.js');
-                $this->script('json2.js');
+                $this->inlineScript('if (typeof window.JSON !== "object") { $.getScript("'.common_path('js/json2.js').'"); }');
                 $this->script('jquery.joverlay.min.js');
                 Event::handle('EndShowJQueryScripts', array($this));
             }
@@ -259,8 +259,7 @@ class Action extends HTMLOutputter // lawsuit
                 $this->script('util.js');
                 $this->script('geometa.js');
                 // Frame-busting code to avoid clickjacking attacks.
-                $this->element('script', array('type' => 'text/javascript'),
-                               'if (window.top !== window.self) { window.top.location.href = window.self.location.href; }');
+                $this->inlineScript('if (window.top !== window.self) { window.top.location.href = window.self.location.href; }');
                 Event::handle('EndShowStatusNetScripts', array($this));
                 Event::handle('EndShowLaconicaScripts', array($this));
             }
@@ -426,8 +425,6 @@ class Action extends HTMLOutputter // lawsuit
             $connect = 'imsettings';
         } else if (common_config('sms', 'enabled')) {
             $connect = 'smssettings';
-        } else if (common_config('twitter', 'enabled')) {
-            $connect = 'twittersettings';
         }
 
         $this->elementStart('dl', array('id' => 'site_nav_global_primary'));
@@ -436,41 +433,71 @@ class Action extends HTMLOutputter // lawsuit
         $this->elementStart('ul', array('class' => 'nav'));
         if (Event::handle('StartPrimaryNav', array($this))) {
             if ($user) {
+                // TRANS: Tooltip for main menu option "Personal"
+                $tooltip = _m('TOOLTIP', 'Personal profile and friends timeline');
+                // TRANS: Main menu option when logged in for access to personal profile and friends timeline
                 $this->menuItem(common_local_url('all', array('nickname' => $user->nickname)),
-                                _('Home'), _('Personal profile and friends timeline'), false, 'nav_home');
+                                _m('MENU', 'Personal'), $tooltip, false, 'nav_home');
+                // TRANS: Tooltip for main menu option "Account"
+                $tooltip = _m('TOOLTIP', 'Change your email, avatar, password, profile');
+                // TRANS: Main menu option when logged in for access to user settings
                 $this->menuItem(common_local_url('profilesettings'),
-                                _('Account'), _('Change your email, avatar, password, profile'), false, 'nav_account');
+                                _m('MENU', 'Account'), $tooltip, false, 'nav_account');
                 if ($connect) {
+                    // TRANS: Tooltip for main menu option "Services"
+                    $tooltip = _m('TOOLTIP', 'Connect to services');
+                    // TRANS: Main menu option when logged in and connection are possible for access to options to connect to other services
                     $this->menuItem(common_local_url($connect),
-                                    _('Connect'), _('Connect to services'), false, 'nav_connect');
+                                    _m('MENU', 'Connect'), $tooltip, false, 'nav_connect');
                 }
                 if ($user->hasRight(Right::CONFIGURESITE)) {
+                    // TRANS: Tooltip for menu option "Admin"
+                    $tooltip = _m('TOOLTIP', 'Change site configuration');
+                    // TRANS: Main menu option when logged in and site admin for access to site configuration
                     $this->menuItem(common_local_url('siteadminpanel'),
-                                    _('Admin'), _('Change site configuration'), false, 'nav_admin');
+                                    _m('MENU', 'Admin'), $tooltip, false, 'nav_admin');
                 }
                 if (common_config('invite', 'enabled')) {
+                    // TRANS: Tooltip for main menu option "Invite"
+                    $tooltip = _m('TOOLTIP', 'Invite friends and colleagues to join you on %s');
+                    // TRANS: Main menu option when logged in and invitations are allowed for inviting new users
                     $this->menuItem(common_local_url('invite'),
-                                    _('Invite'),
-                                    sprintf(_('Invite friends and colleagues to join you on %s'),
+                                    _m('MENU', 'Invite'),
+                                    sprintf($tooltip,
                                             common_config('site', 'name')),
                                     false, 'nav_invitecontact');
                 }
+                // TRANS: Tooltip for main menu option "Logout"
+                $tooltip = _m('TOOLTIP', 'Logout from the site');
+                // TRANS: Main menu option when logged in to log out the current user
                 $this->menuItem(common_local_url('logout'),
-                                _('Logout'), _('Logout from the site'), false, 'nav_logout');
+                                _m('MENU', 'Logout'), $tooltip, false, 'nav_logout');
             }
             else {
                 if (!common_config('site', 'closed')) {
+                    // TRANS: Tooltip for main menu option "Register"
+                    $tooltip = _m('TOOLTIP', 'Create an account');
+                    // TRANS: Main menu option when not logged in to register a new account
                     $this->menuItem(common_local_url('register'),
-                                    _('Register'), _('Create an account'), false, 'nav_register');
+                                    _m('MENU', 'Register'), $tooltip, false, 'nav_register');
                 }
+                // TRANS: Tooltip for main menu option "Login"
+                $tooltip = _m('TOOLTIP', 'Login to the site');
+                // TRANS: Main menu option when not logged in to log in
                 $this->menuItem(common_local_url('login'),
-                                _('Login'), _('Login to the site'), false, 'nav_login');
+                                _m('MENU', 'Login'), $tooltip, false, 'nav_login');
             }
+            // TRANS: Tooltip for main menu option "Help"
+            $tooltip = _m('TOOLTIP', 'Help me!');
+            // TRANS: Main menu option for help on the StatusNet site
             $this->menuItem(common_local_url('doc', array('title' => 'help')),
-                            _('Help'), _('Help me!'), false, 'nav_help');
+                            _m('MENU', 'Help'), $tooltip, false, 'nav_help');
             if ($user || !common_config('site', 'private')) {
+                // TRANS: Tooltip for main menu option "Search"
+                $tooltip = _m('TOOLTIP', 'Search for people or text');
+                // TRANS: Main menu option when logged in or when the StatusNet instance is not private
                 $this->menuItem(common_local_url('peoplesearch'),
-                                _('Search'), _('Search for people or text'), false, 'nav_search');
+                                _m('MENU', 'Search'), $tooltip, false, 'nav_search');
             }
             Event::handle('EndPrimaryNav', array($this));
         }
@@ -491,6 +518,7 @@ class Action extends HTMLOutputter // lawsuit
         if ($text) {
             $this->elementStart('dl', array('id' => 'site_notice',
                                             'class' => 'system_notice'));
+            // TRANS: DT element for site notice. String is hidden in default CSS.
             $this->element('dt', null, _('Site notice'));
             $this->elementStart('dd', null);
             $this->raw($text);
@@ -977,7 +1005,7 @@ class Action extends HTMLOutputter // lawsuit
 
         if (is_null($arg)) {
             return $def;
-        } else if (in_array($arg, array('true', 'yes', '1'))) {
+        } else if (in_array($arg, array('true', 'yes', '1', 'on'))) {
             return true;
         } else if (in_array($arg, array('false', 'no', '0'))) {
             return false;
diff --git a/lib/activity.php b/lib/activity.php
new file mode 100644
index 000000000..b20153213
--- /dev/null
+++ b/lib/activity.php
@@ -0,0 +1,1267 @@
+<?php
+/**
+ * StatusNet, the distributed open-source microblogging tool
+ *
+ * An activity
+ *
+ * PHP version 5
+ *
+ * LICENCE: This program is free software: you can redistribute it and/or modify
+ * it under the terms of the GNU Affero General Public License as published by
+ * the Free Software Foundation, either version 3 of the License, or
+ * (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU Affero General Public License for more details.
+ *
+ * You should have received a copy of the GNU Affero General Public License
+ * along with this program.  If not, see <http://www.gnu.org/licenses/>.
+ *
+ * @category  Feed
+ * @package   StatusNet
+ * @author    Evan Prodromou <evan@status.net>
+ * @author    Zach Copley <zach@status.net>
+ * @copyright 2010 StatusNet, Inc.
+ * @license   http://www.fsf.org/licensing/licenses/agpl-3.0.html AGPLv3
+ * @link      http://status.net/
+ */
+
+if (!defined('STATUSNET')) {
+    exit(1);
+}
+
+class PoCoURL
+{
+    const URLS      = 'urls';
+    const TYPE      = 'type';
+    const VALUE     = 'value';
+    const PRIMARY   = 'primary';
+
+    public $type;
+    public $value;
+    public $primary;
+
+    function __construct($type, $value, $primary = false)
+    {
+        $this->type    = $type;
+        $this->value   = $value;
+        $this->primary = $primary;
+    }
+
+    function asString()
+    {
+        $xs = new XMLStringer(true);
+        $xs->elementStart('poco:urls');
+        $xs->element('poco:type', null, $this->type);
+        $xs->element('poco:value', null, $this->value);
+        if (!empty($this->primary)) {
+            $xs->element('poco:primary', null, 'true');
+        }
+        $xs->elementEnd('poco:urls');
+        return $xs->getString();
+    }
+}
+
+class PoCoAddress
+{
+    const ADDRESS   = 'address';
+    const FORMATTED = 'formatted';
+
+    public $formatted;
+
+    // @todo Other address fields
+
+    function asString()
+    {
+        if (!empty($this->formatted)) {
+            $xs = new XMLStringer(true);
+            $xs->elementStart('poco:address');
+            $xs->element('poco:formatted', null, $this->formatted);
+            $xs->elementEnd('poco:address');
+            return $xs->getString();
+        }
+
+        return null;
+    }
+}
+
+class PoCo
+{
+    const NS = 'http://portablecontacts.net/spec/1.0';
+
+    const USERNAME     = 'preferredUsername';
+    const DISPLAYNAME  = 'displayName';
+    const NOTE         = 'note';
+
+    public $preferredUsername;
+    public $displayName;
+    public $note;
+    public $address;
+    public $urls = array();
+
+    function __construct($element = null)
+    {
+        if (empty($element)) {
+            return;
+        }
+
+        $this->preferredUsername = ActivityUtils::childContent(
+            $element,
+            self::USERNAME,
+            self::NS
+        );
+
+        $this->displayName = ActivityUtils::childContent(
+            $element,
+            self::DISPLAYNAME,
+            self::NS
+        );
+
+        $this->note = ActivityUtils::childContent(
+            $element,
+            self::NOTE,
+            self::NS
+        );
+
+        $this->address = $this->_getAddress($element);
+        $this->urls = $this->_getURLs($element);
+    }
+
+    private function _getURLs($element)
+    {
+        $urlEls = $element->getElementsByTagnameNS(self::NS, PoCoURL::URLS);
+        $urls = array();
+
+        foreach ($urlEls as $urlEl) {
+
+            $type = ActivityUtils::childContent(
+                $urlEl,
+                PoCoURL::TYPE,
+                PoCo::NS
+            );
+
+            $value = ActivityUtils::childContent(
+                $urlEl,
+                PoCoURL::VALUE,
+                PoCo::NS
+            );
+
+            $primary = ActivityUtils::childContent(
+                $urlEl,
+                PoCoURL::PRIMARY,
+                PoCo::NS
+            );
+
+            $isPrimary = false;
+
+            if (isset($primary) && $primary == 'true') {
+                $isPrimary = true;
+            }
+
+            // @todo check to make sure a primary hasn't already been added
+
+            array_push($urls, new PoCoURL($type, $value, $isPrimary));
+        }
+        return $urls;
+    }
+
+    private function _getAddress($element)
+    {
+        $addressEl = ActivityUtils::child(
+            $element,
+            PoCoAddress::ADDRESS,
+            PoCo::NS
+        );
+
+        if (!empty($addressEl)) {
+            $formatted = ActivityUtils::childContent(
+                $addressEl,
+                PoCoAddress::FORMATTED,
+                self::NS
+            );
+
+            if (!empty($formatted)) {
+                $address = new PoCoAddress();
+                $address->formatted = $formatted;
+                return $address;
+            }
+        }
+
+        return null;
+    }
+
+    function fromProfile($profile)
+    {
+        if (empty($profile)) {
+            return null;
+        }
+
+        $poco = new PoCo();
+
+        $poco->preferredUsername = $profile->nickname;
+        $poco->displayName       = $profile->getBestName();
+
+        $poco->note = $profile->bio;
+
+        $paddy = new PoCoAddress();
+        $paddy->formatted = $profile->location;
+        $poco->address = $paddy;
+
+        if (!empty($profile->homepage)) {
+            array_push(
+                $poco->urls,
+                new PoCoURL(
+                    'homepage',
+                    $profile->homepage,
+                    true
+                )
+            );
+        }
+
+        return $poco;
+    }
+
+    function fromGroup($group)
+    {
+        if (empty($group)) {
+            return null;
+        }
+
+        $poco = new PoCo();
+
+        $poco->preferredUsername = $group->nickname;
+        $poco->displayName       = $group->getBestName();
+
+        $poco->note = $group->description;
+
+        $paddy = new PoCoAddress();
+        $paddy->formatted = $group->location;
+        $poco->address = $paddy;
+
+        if (!empty($group->homepage)) {
+            array_push(
+                $poco->urls,
+                new PoCoURL(
+                    'homepage',
+                    $group->homepage,
+                    true
+                )
+            );
+        }
+
+        return $poco;
+    }
+
+    function getPrimaryURL()
+    {
+        foreach ($this->urls as $url) {
+            if ($url->primary) {
+                return $url;
+            }
+        }
+    }
+
+    function asString()
+    {
+        $xs = new XMLStringer(true);
+        $xs->element(
+            'poco:preferredUsername',
+            null,
+            $this->preferredUsername
+        );
+
+        $xs->element(
+            'poco:displayName',
+            null,
+            $this->displayName
+        );
+
+        if (!empty($this->note)) {
+            $xs->element('poco:note', null, $this->note);
+        }
+
+        if (!empty($this->address)) {
+            $xs->raw($this->address->asString());
+        }
+
+        foreach ($this->urls as $url) {
+            $xs->raw($url->asString());
+        }
+
+        return $xs->getString();
+    }
+}
+
+/**
+ * Utilities for turning DOMish things into Activityish things
+ *
+ * Some common functions that I didn't have the bandwidth to try to factor
+ * into some kind of reasonable superclass, so just dumped here. Might
+ * be useful to have an ActivityObject parent class or something.
+ *
+ * @category  OStatus
+ * @package   StatusNet
+ * @author    Evan Prodromou <evan@status.net>
+ * @copyright 2010 StatusNet, Inc.
+ * @license   http://www.fsf.org/licensing/licenses/agpl-3.0.html AGPLv3
+ * @link      http://status.net/
+ */
+
+class ActivityUtils
+{
+    const ATOM = 'http://www.w3.org/2005/Atom';
+
+    const LINK = 'link';
+    const REL  = 'rel';
+    const TYPE = 'type';
+    const HREF = 'href';
+
+    const CONTENT = 'content';
+    const SRC     = 'src';
+
+    /**
+     * Get the permalink for an Activity object
+     *
+     * @param DOMElement $element A DOM element
+     *
+     * @return string related link, if any
+     */
+
+    static function getPermalink($element)
+    {
+        return self::getLink($element, 'alternate', 'text/html');
+    }
+
+    /**
+     * Get the permalink for an Activity object
+     *
+     * @param DOMElement $element A DOM element
+     *
+     * @return string related link, if any
+     */
+
+    static function getLink(DOMNode $element, $rel, $type=null)
+    {
+        $links = $element->getElementsByTagnameNS(self::ATOM, self::LINK);
+
+        foreach ($links as $link) {
+
+            $linkRel = $link->getAttribute(self::REL);
+            $linkType = $link->getAttribute(self::TYPE);
+
+            if ($linkRel == $rel &&
+                (is_null($type) || $linkType == $type)) {
+                return $link->getAttribute(self::HREF);
+            }
+        }
+
+        return null;
+    }
+
+    static function getLinks(DOMNode $element, $rel, $type=null)
+    {
+        $links = $element->getElementsByTagnameNS(self::ATOM, self::LINK);
+        $out = array();
+
+        foreach ($links as $link) {
+
+            $linkRel = $link->getAttribute(self::REL);
+            $linkType = $link->getAttribute(self::TYPE);
+
+            if ($linkRel == $rel &&
+                (is_null($type) || $linkType == $type)) {
+                $out[] = $link;
+            }
+        }
+
+        return $out;
+    }
+
+    /**
+     * Gets the first child element with the given tag
+     *
+     * @param DOMElement $element   element to pick at
+     * @param string     $tag       tag to look for
+     * @param string     $namespace Namespace to look under
+     *
+     * @return DOMElement found element or null
+     */
+
+    static function child(DOMNode $element, $tag, $namespace=self::ATOM)
+    {
+        $els = $element->childNodes;
+        if (empty($els) || $els->length == 0) {
+            return null;
+        } else {
+            for ($i = 0; $i < $els->length; $i++) {
+                $el = $els->item($i);
+                if ($el->localName == $tag && $el->namespaceURI == $namespace) {
+                    return $el;
+                }
+            }
+        }
+    }
+
+    /**
+     * Grab the text content of a DOM element child of the current element
+     *
+     * @param DOMElement $element   Element whose children we examine
+     * @param string     $tag       Tag to look up
+     * @param string     $namespace Namespace to use, defaults to Atom
+     *
+     * @return string content of the child
+     */
+
+    static function childContent(DOMNode $element, $tag, $namespace=self::ATOM)
+    {
+        $el = self::child($element, $tag, $namespace);
+
+        if (empty($el)) {
+            return null;
+        } else {
+            return $el->textContent;
+        }
+    }
+
+    /**
+     * Get the content of an atom:entry-like object
+     *
+     * @param DOMElement $element The element to examine.
+     *
+     * @return string unencoded HTML content of the element, like "This -&lt; is <b>HTML</b>."
+     *
+     * @todo handle remote content
+     * @todo handle embedded XML mime types
+     * @todo handle base64-encoded non-XML and non-text mime types
+     */
+
+    static function getContent($element)
+    {
+        $contentEl = ActivityUtils::child($element, self::CONTENT);
+
+        if (!empty($contentEl)) {
+
+            $src  = $contentEl->getAttribute(self::SRC);
+
+            if (!empty($src)) {
+                throw new ClientException(_("Can't handle remote content yet."));
+            }
+
+            $type = $contentEl->getAttribute(self::TYPE);
+
+            // slavishly following http://atompub.org/rfc4287.html#rfc.section.4.1.3.3
+
+            if ($type == 'text') {
+                return $contentEl->textContent;
+            } else if ($type == 'html') {
+                $text = $contentEl->textContent;
+                return htmlspecialchars_decode($text, ENT_QUOTES);
+            } else if ($type == 'xhtml') {
+                $divEl = ActivityUtils::child($contentEl, 'div');
+                if (empty($divEl)) {
+                    return null;
+                }
+                $doc = $divEl->ownerDocument;
+                $text = '';
+                $children = $divEl->childNodes;
+
+                for ($i = 0; $i < $children->length; $i++) {
+                    $child = $children->item($i);
+                    $text .= $doc->saveXML($child);
+                }
+                return trim($text);
+            } else if (in_array(array('text/xml', 'application/xml'), $type) ||
+                       preg_match('#(+|/)xml$#', $type)) {
+                throw new ClientException(_("Can't handle embedded XML content yet."));
+            } else if (strncasecmp($type, 'text/', 5)) {
+                return $contentEl->textContent;
+            } else {
+                throw new ClientException(_("Can't handle embedded Base64 content yet."));
+            }
+        }
+    }
+}
+
+// XXX: Arg! This wouldn't be necessary if we used Avatars conistently
+class AvatarLink
+{
+    public $url;
+    public $type;
+    public $size;
+    public $width;
+    public $height;
+
+    function __construct($element=null)
+    {
+        if ($element) {
+            // @fixme use correct namespaces
+            $this->url = $element->getAttribute('href');
+            $this->type = $element->getAttribute('type');
+            $width = $element->getAttribute('media:width');
+            if ($width != null) {
+                $this->width = intval($width);
+            }
+            $height = $element->getAttribute('media:height');
+            if ($height != null) {
+                $this->height = intval($height);
+            }
+        }
+    }
+
+    static function fromAvatar($avatar)
+    {
+        if (empty($avatar)) {
+            return null;
+        }
+        $alink = new AvatarLink();
+        $alink->type   = $avatar->mediatype;
+        $alink->height = $avatar->height;
+        $alink->width  = $avatar->width;
+        $alink->url    = $avatar->displayUrl();
+        return $alink;
+    }
+
+    static function fromFilename($filename, $size)
+    {
+        $alink = new AvatarLink();
+        $alink->url    = $filename;
+        $alink->height = $size;
+        if (!empty($filename)) {
+            $alink->width  = $size;
+            $alink->type   = self::mediatype($filename);
+        } else {
+            $alink->url    = User_group::defaultLogo($size);
+            $alink->type   = 'image/png';
+        }
+        return $alink;
+    }
+
+    // yuck!
+    static function mediatype($filename) {
+        $ext = strtolower(end(explode('.', $filename)));
+        if ($ext == 'jpeg') {
+            $ext = 'jpg';
+        }
+        // hope we don't support any others
+        $types = array('png', 'gif', 'jpg', 'jpeg');
+        if (in_array($ext, $types)) {
+            return 'image/' . $ext;
+        }
+        return null;
+    }
+}
+
+/**
+ * A noun-ish thing in the activity universe
+ *
+ * The activity streams spec talks about activity objects, while also having
+ * a tag activity:object, which is in fact an activity object. Aaaaaah!
+ *
+ * This is just a thing in the activity universe. Can be the subject, object,
+ * or indirect object (target!) of an activity verb. Rotten name, and I'm
+ * propagating it. *sigh*
+ *
+ * @category  OStatus
+ * @package   StatusNet
+ * @author    Evan Prodromou <evan@status.net>
+ * @copyright 2010 StatusNet, Inc.
+ * @license   http://www.fsf.org/licensing/licenses/agpl-3.0.html AGPLv3
+ * @link      http://status.net/
+ */
+
+class ActivityObject
+{
+    const ARTICLE   = 'http://activitystrea.ms/schema/1.0/article';
+    const BLOGENTRY = 'http://activitystrea.ms/schema/1.0/blog-entry';
+    const NOTE      = 'http://activitystrea.ms/schema/1.0/note';
+    const STATUS    = 'http://activitystrea.ms/schema/1.0/status';
+    const FILE      = 'http://activitystrea.ms/schema/1.0/file';
+    const PHOTO     = 'http://activitystrea.ms/schema/1.0/photo';
+    const ALBUM     = 'http://activitystrea.ms/schema/1.0/photo-album';
+    const PLAYLIST  = 'http://activitystrea.ms/schema/1.0/playlist';
+    const VIDEO     = 'http://activitystrea.ms/schema/1.0/video';
+    const AUDIO     = 'http://activitystrea.ms/schema/1.0/audio';
+    const BOOKMARK  = 'http://activitystrea.ms/schema/1.0/bookmark';
+    const PERSON    = 'http://activitystrea.ms/schema/1.0/person';
+    const GROUP     = 'http://activitystrea.ms/schema/1.0/group';
+    const PLACE     = 'http://activitystrea.ms/schema/1.0/place';
+    const COMMENT   = 'http://activitystrea.ms/schema/1.0/comment';
+    // ^^^^^^^^^^ tea!
+
+    // Atom elements we snarf
+
+    const TITLE   = 'title';
+    const SUMMARY = 'summary';
+    const ID      = 'id';
+    const SOURCE  = 'source';
+
+    const NAME  = 'name';
+    const URI   = 'uri';
+    const EMAIL = 'email';
+
+    public $element;
+    public $type;
+    public $id;
+    public $title;
+    public $summary;
+    public $content;
+    public $link;
+    public $source;
+    public $avatarLinks = array();
+    public $geopoint;
+    public $poco;
+    public $displayName;
+
+    /**
+     * Constructor
+     *
+     * This probably needs to be refactored
+     * to generate a local class (ActivityPerson, ActivityFile, ...)
+     * based on the object type.
+     *
+     * @param DOMElement $element DOM thing to turn into an Activity thing
+     */
+
+    function __construct($element = null)
+    {
+        if (empty($element)) {
+            return;
+        }
+
+        $this->element = $element;
+
+        $this->geopoint = $this->_childContent(
+            $element,
+            ActivityContext::POINT,
+            ActivityContext::GEORSS
+        );
+
+        if ($element->tagName == 'author') {
+
+            $this->type  = self::PERSON; // XXX: is this fair?
+            $this->title = $this->_childContent($element, self::NAME);
+            $this->id    = $this->_childContent($element, self::URI);
+
+            if (empty($this->id)) {
+                $email = $this->_childContent($element, self::EMAIL);
+                if (!empty($email)) {
+                    // XXX: acct: ?
+                    $this->id = 'mailto:'.$email;
+                }
+            }
+
+        } else {
+
+            $this->type = $this->_childContent($element, Activity::OBJECTTYPE,
+                                               Activity::SPEC);
+
+            if (empty($this->type)) {
+                $this->type = ActivityObject::NOTE;
+            }
+
+            $this->id      = $this->_childContent($element, self::ID);
+            $this->title   = $this->_childContent($element, self::TITLE);
+            $this->summary = $this->_childContent($element, self::SUMMARY);
+
+            $this->source  = $this->_getSource($element);
+
+            $this->content = ActivityUtils::getContent($element);
+
+            $this->link = ActivityUtils::getPermalink($element);
+
+        }
+
+        // Some per-type attributes...
+        if ($this->type == self::PERSON || $this->type == self::GROUP) {
+            $this->displayName = $this->title;
+
+            $avatars = ActivityUtils::getLinks($element, 'avatar');
+            foreach ($avatars as $link) {
+                $this->avatarLinks[] = new AvatarLink($link);
+            }
+
+            $this->poco = new PoCo($element);
+        }
+    }
+
+    private function _childContent($element, $tag, $namespace=ActivityUtils::ATOM)
+    {
+        return ActivityUtils::childContent($element, $tag, $namespace);
+    }
+
+    // Try to get a unique id for the source feed
+
+    private function _getSource($element)
+    {
+        $sourceEl = ActivityUtils::child($element, 'source');
+
+        if (empty($sourceEl)) {
+            return null;
+        } else {
+            $href = ActivityUtils::getLink($sourceEl, 'self');
+            if (!empty($href)) {
+                return $href;
+            } else {
+                return ActivityUtils::childContent($sourceEl, 'id');
+            }
+        }
+    }
+
+    static function fromNotice($notice)
+    {
+        $object = new ActivityObject();
+
+        $object->type    = ActivityObject::NOTE;
+
+        $object->id      = $notice->uri;
+        $object->title   = $notice->content;
+        $object->content = $notice->rendered;
+        $object->link    = $notice->bestUrl();
+
+        return $object;
+    }
+
+    static function fromProfile($profile)
+    {
+        $object = new ActivityObject();
+
+        $object->type   = ActivityObject::PERSON;
+        $object->id     = $profile->getUri();
+        $object->title  = $profile->getBestName();
+        $object->link   = $profile->profileurl;
+
+        $orig = $profile->getOriginalAvatar();
+
+        if (!empty($orig)) {
+            $object->avatarLinks[] = AvatarLink::fromAvatar($orig);
+        }
+
+        $sizes = array(
+            AVATAR_PROFILE_SIZE,
+            AVATAR_STREAM_SIZE,
+            AVATAR_MINI_SIZE
+        );
+
+        foreach ($sizes as $size) {
+
+            $alink  = null;
+            $avatar = $profile->getAvatar($size);
+
+            if (!empty($avatar)) {
+                $alink = AvatarLink::fromAvatar($avatar);
+            } else {
+                $alink = new AvatarLink();
+                $alink->type   = 'image/png';
+                $alink->height = $size;
+                $alink->width  = $size;
+                $alink->url    = Avatar::defaultImage($size);
+            }
+
+            $object->avatarLinks[] = $alink;
+        }
+
+        if (isset($profile->lat) && isset($profile->lon)) {
+            $object->geopoint = (float)$profile->lat
+                . ' ' . (float)$profile->lon;
+        }
+
+        $object->poco = PoCo::fromProfile($profile);
+
+        return $object;
+    }
+
+    static function fromGroup($group)
+    {
+        $object = new ActivityObject();
+
+        $object->type   = ActivityObject::GROUP;
+        $object->id     = $group->getUri();
+        $object->title  = $group->getBestName();
+        $object->link   = $group->getUri();
+
+        $object->avatarLinks[] = AvatarLink::fromFilename(
+            $group->homepage_logo,
+            AVATAR_PROFILE_SIZE
+        );
+
+        $object->avatarLinks[] = AvatarLink::fromFilename(
+            $group->stream_logo,
+            AVATAR_STREAM_SIZE
+        );
+
+        $object->avatarLinks[] = AvatarLink::fromFilename(
+            $group->mini_logo,
+            AVATAR_MINI_SIZE
+        );
+
+        $object->poco = PoCo::fromGroup($group);
+
+        return $object;
+    }
+
+
+    function asString($tag='activity:object')
+    {
+        $xs = new XMLStringer(true);
+
+        $xs->elementStart($tag);
+
+        $xs->element('activity:object-type', null, $this->type);
+
+        $xs->element(self::ID, null, $this->id);
+
+        if (!empty($this->title)) {
+            $xs->element(self::TITLE, null, $this->title);
+        }
+
+        if (!empty($this->summary)) {
+            $xs->element(self::SUMMARY, null, $this->summary);
+        }
+
+        if (!empty($this->content)) {
+            // XXX: assuming HTML content here
+            $xs->element(ActivityUtils::CONTENT, array('type' => 'html'), $this->content);
+        }
+
+        if (!empty($this->link)) {
+            $xs->element(
+                'link',
+                array(
+                    'rel' => 'alternate',
+                    'type' => 'text/html',
+                    'href' => $this->link
+                ),
+                null
+            );
+        }
+
+        if ($this->type == ActivityObject::PERSON
+            || $this->type == ActivityObject::GROUP) {
+
+            foreach ($this->avatarLinks as $avatar) {
+                $xs->element(
+                    'link', array(
+                        'rel'  => 'avatar',
+                        'type'         => $avatar->type,
+                        'media:width'  => $avatar->width,
+                        'media:height' => $avatar->height,
+                        'href' => $avatar->url
+                    ),
+                    null
+                );
+            }
+        }
+
+        if (!empty($this->geopoint)) {
+            $xs->element(
+                'georss:point',
+                null,
+                $this->geopoint
+            );
+        }
+
+        if (!empty($this->poco)) {
+            $xs->raw($this->poco->asString());
+        }
+
+        $xs->elementEnd($tag);
+
+        return $xs->getString();
+    }
+}
+
+/**
+ * Utility class to hold a bunch of constant defining default verb types
+ *
+ * @category  OStatus
+ * @package   StatusNet
+ * @author    Evan Prodromou <evan@status.net>
+ * @copyright 2010 StatusNet, Inc.
+ * @license   http://www.fsf.org/licensing/licenses/agpl-3.0.html AGPLv3
+ * @link      http://status.net/
+ */
+
+class ActivityVerb
+{
+    const POST     = 'http://activitystrea.ms/schema/1.0/post';
+    const SHARE    = 'http://activitystrea.ms/schema/1.0/share';
+    const SAVE     = 'http://activitystrea.ms/schema/1.0/save';
+    const FAVORITE = 'http://activitystrea.ms/schema/1.0/favorite';
+    const PLAY     = 'http://activitystrea.ms/schema/1.0/play';
+    const FOLLOW   = 'http://activitystrea.ms/schema/1.0/follow';
+    const FRIEND   = 'http://activitystrea.ms/schema/1.0/make-friend';
+    const JOIN     = 'http://activitystrea.ms/schema/1.0/join';
+    const TAG      = 'http://activitystrea.ms/schema/1.0/tag';
+
+    // Custom OStatus verbs for the flipside until they're standardized
+    const DELETE     = 'http://ostatus.org/schema/1.0/unfollow';
+    const UNFAVORITE = 'http://ostatus.org/schema/1.0/unfavorite';
+    const UNFOLLOW   = 'http://ostatus.org/schema/1.0/unfollow';
+    const LEAVE      = 'http://ostatus.org/schema/1.0/leave';
+
+    // For simple profile-update pings; no content to share.
+    const UPDATE_PROFILE = 'http://ostatus.org/schema/1.0/update-profile';
+}
+
+class ActivityContext
+{
+    public $replyToID;
+    public $replyToUrl;
+    public $location;
+    public $attention = array();
+    public $conversation;
+
+    const THR     = 'http://purl.org/syndication/thread/1.0';
+    const GEORSS  = 'http://www.georss.org/georss';
+    const OSTATUS = 'http://ostatus.org/schema/1.0';
+
+    const INREPLYTO = 'in-reply-to';
+    const REF       = 'ref';
+    const HREF      = 'href';
+
+    const POINT     = 'point';
+
+    const ATTENTION    = 'ostatus:attention';
+    const CONVERSATION = 'ostatus:conversation';
+
+    function __construct($element)
+    {
+        $replyToEl = ActivityUtils::child($element, self::INREPLYTO, self::THR);
+
+        if (!empty($replyToEl)) {
+            $this->replyToID  = $replyToEl->getAttribute(self::REF);
+            $this->replyToUrl = $replyToEl->getAttribute(self::HREF);
+        }
+
+        $this->location = $this->getLocation($element);
+
+        $this->conversation = ActivityUtils::getLink($element, self::CONVERSATION);
+
+        // Multiple attention links allowed
+
+        $links = $element->getElementsByTagNameNS(ActivityUtils::ATOM, ActivityUtils::LINK);
+
+        for ($i = 0; $i < $links->length; $i++) {
+
+            $link = $links->item($i);
+
+            $linkRel = $link->getAttribute(ActivityUtils::REL);
+
+            if ($linkRel == self::ATTENTION) {
+                $this->attention[] = $link->getAttribute(self::HREF);
+            }
+        }
+    }
+
+    /**
+     * Parse location given as a GeoRSS-simple point, if provided.
+     * http://www.georss.org/simple
+     *
+     * @param feed item $entry
+     * @return mixed Location or false
+     */
+    function getLocation($dom)
+    {
+        $points = $dom->getElementsByTagNameNS(self::GEORSS, self::POINT);
+
+        for ($i = 0; $i < $points->length; $i++) {
+            $point = $points->item($i)->textContent;
+            return self::locationFromPoint($point);
+        }
+
+        return null;
+    }
+
+    // XXX: Move to ActivityUtils or Location?
+    static function locationFromPoint($point)
+    {
+        $point = str_replace(',', ' ', $point); // per spec "treat commas as whitespace"
+        $point = preg_replace('/\s+/', ' ', $point);
+        $point = trim($point);
+        $coords = explode(' ', $point);
+        if (count($coords) == 2) {
+            list($lat, $lon) = $coords;
+            if (is_numeric($lat) && is_numeric($lon)) {
+                common_log(LOG_INFO, "Looking up location for $lat $lon from georss point");
+                return Location::fromLatLon($lat, $lon);
+            }
+        }
+        common_log(LOG_ERR, "Ignoring bogus georss:point value $point");
+        return null;
+    }
+}
+
+/**
+ * An activity in the ActivityStrea.ms world
+ *
+ * An activity is kind of like a sentence: someone did something
+ * to something else.
+ *
+ * 'someone' is the 'actor'; 'did something' is the verb;
+ * 'something else' is the object.
+ *
+ * @category  OStatus
+ * @package   StatusNet
+ * @author    Evan Prodromou <evan@status.net>
+ * @copyright 2010 StatusNet, Inc.
+ * @license   http://www.fsf.org/licensing/licenses/agpl-3.0.html AGPLv3
+ * @link      http://status.net/
+ */
+
+class Activity
+{
+    const SPEC   = 'http://activitystrea.ms/spec/1.0/';
+    const SCHEMA = 'http://activitystrea.ms/schema/1.0/';
+
+    const VERB       = 'verb';
+    const OBJECT     = 'object';
+    const ACTOR      = 'actor';
+    const SUBJECT    = 'subject';
+    const OBJECTTYPE = 'object-type';
+    const CONTEXT    = 'context';
+    const TARGET     = 'target';
+
+    const ATOM = 'http://www.w3.org/2005/Atom';
+
+    const AUTHOR    = 'author';
+    const PUBLISHED = 'published';
+    const UPDATED   = 'updated';
+
+    public $actor;   // an ActivityObject
+    public $verb;    // a string (the URL)
+    public $object;  // an ActivityObject
+    public $target;  // an ActivityObject
+    public $context; // an ActivityObject
+    public $time;    // Time of the activity
+    public $link;    // an ActivityObject
+    public $entry;   // the source entry
+    public $feed;    // the source feed
+
+    public $summary; // summary of activity
+    public $content; // HTML content of activity
+    public $id;      // ID of the activity
+    public $title;   // title of the activity
+    public $categories = array(); // list of AtomCategory objects
+
+    /**
+     * Turns a regular old Atom <entry> into a magical activity
+     *
+     * @param DOMElement $entry Atom entry to poke at
+     * @param DOMElement $feed  Atom feed, for context
+     */
+
+    function __construct($entry = null, $feed = null)
+    {
+        if (is_null($entry)) {
+            return;
+        }
+
+        $this->entry = $entry;
+        $this->feed  = $feed;
+
+        $pubEl = $this->_child($entry, self::PUBLISHED, self::ATOM);
+
+        if (!empty($pubEl)) {
+            $this->time = strtotime($pubEl->textContent);
+        } else {
+            // XXX technically an error; being liberal. Good idea...?
+            $updateEl = $this->_child($entry, self::UPDATED, self::ATOM);
+            if (!empty($updateEl)) {
+                $this->time = strtotime($updateEl->textContent);
+            } else {
+                $this->time = null;
+            }
+        }
+
+        $this->link = ActivityUtils::getPermalink($entry);
+
+        $verbEl = $this->_child($entry, self::VERB);
+
+        if (!empty($verbEl)) {
+            $this->verb = trim($verbEl->textContent);
+        } else {
+            $this->verb = ActivityVerb::POST;
+            // XXX: do other implied stuff here
+        }
+
+        $objectEl = $this->_child($entry, self::OBJECT);
+
+        if (!empty($objectEl)) {
+            $this->object = new ActivityObject($objectEl);
+        } else {
+            $this->object = new ActivityObject($entry);
+        }
+
+        $actorEl = $this->_child($entry, self::ACTOR);
+
+        if (!empty($actorEl)) {
+
+            $this->actor = new ActivityObject($actorEl);
+
+        } else if (!empty($feed) &&
+                   $subjectEl = $this->_child($feed, self::SUBJECT)) {
+
+            $this->actor = new ActivityObject($subjectEl);
+
+        } else if ($authorEl = $this->_child($entry, self::AUTHOR, self::ATOM)) {
+
+            $this->actor = new ActivityObject($authorEl);
+
+        } else if (!empty($feed) && $authorEl = $this->_child($feed, self::AUTHOR,
+                                                              self::ATOM)) {
+
+            $this->actor = new ActivityObject($authorEl);
+        }
+
+        $contextEl = $this->_child($entry, self::CONTEXT);
+
+        if (!empty($contextEl)) {
+            $this->context = new ActivityContext($contextEl);
+        } else {
+            $this->context = new ActivityContext($entry);
+        }
+
+        $targetEl = $this->_child($entry, self::TARGET);
+
+        if (!empty($targetEl)) {
+            $this->target = new ActivityObject($targetEl);
+        }
+
+        $this->summary = ActivityUtils::childContent($entry, 'summary');
+        $this->id      = ActivityUtils::childContent($entry, 'id');
+        $this->content = ActivityUtils::getContent($entry);
+
+        $catEls = $entry->getElementsByTagNameNS(self::ATOM, 'category');
+        if ($catEls) {
+            for ($i = 0; $i < $catEls->length; $i++) {
+                $catEl = $catEls->item($i);
+                $this->categories[] = new AtomCategory($catEl);
+            }
+        }
+    }
+
+    /**
+     * Returns an Atom <entry> based on this activity
+     *
+     * @return DOMElement Atom entry
+     */
+
+    function toAtomEntry()
+    {
+        return null;
+    }
+
+    function asString($namespace=false)
+    {
+        $xs = new XMLStringer(true);
+
+        if ($namespace) {
+            $attrs = array('xmlns' => 'http://www.w3.org/2005/Atom',
+                           'xmlns:activity' => 'http://activitystrea.ms/spec/1.0/',
+                           'xmlns:georss' => 'http://www.georss.org/georss',
+                           'xmlns:ostatus' => 'http://ostatus.org/schema/1.0',
+                           'xmlns:poco' => 'http://portablecontacts.net/spec/1.0',
+                           'xmlns:media' => 'http://purl.org/syndication/atommedia');
+        } else {
+            $attrs = array();
+        }
+
+        $xs->elementStart('entry', $attrs);
+
+        $xs->element('id', null, $this->id);
+        $xs->element('title', null, $this->title);
+        $xs->element('published', null, common_date_iso8601($this->time));
+        $xs->element('content', array('type' => 'html'), $this->content);
+
+        if (!empty($this->summary)) {
+            $xs->element('summary', null, $this->summary);
+        }
+
+        if (!empty($this->link)) {
+            $xs->element('link', array('rel' => 'alternate',
+                                       'type' => 'text/html'),
+                         $this->link);
+        }
+
+        // XXX: add context
+
+        $xs->elementStart('author');
+        $xs->element('uri', array(), $this->actor->id);
+        if ($this->actor->title) {
+            $xs->element('name', array(), $this->actor->title);
+        }
+        $xs->elementEnd('author');
+        $xs->raw($this->actor->asString('activity:actor'));
+
+        $xs->element('activity:verb', null, $this->verb);
+
+        if ($this->object) {
+            $xs->raw($this->object->asString());
+        }
+
+        if ($this->target) {
+            $xs->raw($this->target->asString('activity:target'));
+        }
+
+        foreach ($this->categories as $cat) {
+            $xs->raw($cat->asString());
+        }
+
+        $xs->elementEnd('entry');
+
+        return $xs->getString();
+    }
+
+    private function _child($element, $tag, $namespace=self::SPEC)
+    {
+        return ActivityUtils::child($element, $tag, $namespace);
+    }
+}
+
+class AtomCategory
+{
+    public $term;
+    public $scheme;
+    public $label;
+
+    function __construct($element=null)
+    {
+        if ($element && $element->attributes) {
+            $this->term = $this->extract($element, 'term');
+            $this->scheme = $this->extract($element, 'scheme');
+            $this->label = $this->extract($element, 'label');
+        }
+    }
+
+    protected function extract($element, $attrib)
+    {
+        $node = $element->attributes->getNamedItemNS(Activity::ATOM, $attrib);
+        if ($node) {
+            return trim($node->textContent);
+        }
+        $node = $element->attributes->getNamedItem($attrib);
+        if ($node) {
+            return trim($node->textContent);
+        }
+        return null;
+    }
+
+    function asString()
+    {
+        $attribs = array();
+        if ($this->term !== null) {
+            $attribs['term'] = $this->term;
+        }
+        if ($this->scheme !== null) {
+            $attribs['scheme'] = $this->scheme;
+        }
+        if ($this->label !== null) {
+            $attribs['label'] = $this->label;
+        }
+        $xs = new XMLStringer();
+        $xs->element('category', $attribs);
+        return $xs->asString();
+    }
+}
diff --git a/lib/adminpanelaction.php b/lib/adminpanelaction.php
index f05627b31..a0cdab8a4 100644
--- a/lib/adminpanelaction.php
+++ b/lib/adminpanelaction.php
@@ -69,6 +69,7 @@ class AdminPanelAction extends Action
         // User must be logged in.
 
         if (!common_logged_in()) {
+            // TRANS: Client error message
             $this->clientError(_('Not logged in.'));
             return false;
         }
@@ -93,6 +94,7 @@ class AdminPanelAction extends Action
         // User must have the right to change admin settings
 
         if (!$user->hasRight(Right::CONFIGURESITE)) {
+            // TRANS: Client error message
             $this->clientError(_('You cannot make changes to this site.'));
             return false;
         }
@@ -103,7 +105,8 @@ class AdminPanelAction extends Action
 
         $name = mb_substr($name, 0, -10);
 
-        if (!in_array($name, common_config('admin', 'panels'))) {
+        if (!self::canAdmin($name)) {
+            // TRANS: Client error message
             $this->clientError(_('Changes to that panel are not allowed.'), 403);
             return false;
         }
@@ -134,6 +137,7 @@ class AdminPanelAction extends Action
                 Config::loadSettings();
 
                 $this->success = true;
+                // TRANS: Message after successful saving of administrative settings.
                 $this->msg     = _('Settings saved.');
             } catch (Exception $e) {
                 $this->success = false;
@@ -203,6 +207,7 @@ class AdminPanelAction extends Action
 
     function showForm()
     {
+        // TRANS: Client error message
         $this->clientError(_('showForm() not implemented.'));
         return;
     }
@@ -232,6 +237,7 @@ class AdminPanelAction extends Action
 
     function saveSettings()
     {
+        // TRANS: Client error message
         $this->clientError(_('saveSettings() not implemented.'));
         return;
     }
@@ -255,6 +261,7 @@ class AdminPanelAction extends Action
             $result = $config->delete();
             if (!$result) {
                 common_log_db_error($config, 'DELETE', __FILE__);
+                // TRANS: Client error message
                 $this->clientError(_("Unable to delete design setting."));
                 return null;
             }
@@ -262,6 +269,17 @@ class AdminPanelAction extends Action
 
         return $result;
     }
+
+    function canAdmin($name)
+    {
+        $isOK = false;
+
+        if (Event::handle('AdminPanelCheck', array($name, &$isOK))) {
+            $isOK = in_array($name, common_config('admin', 'panels'));
+        }
+
+        return $isOK;
+    }
 }
 
 /**
@@ -307,34 +325,52 @@ class AdminPanelNav extends Widget
 
         if (Event::handle('StartAdminPanelNav', array($this))) {
 
-            if ($this->canAdmin('site')) {
-                $this->out->menuItem(common_local_url('siteadminpanel'), _('Site'),
-                                     _('Basic site configuration'), $action_name == 'siteadminpanel', 'nav_site_admin_panel');
+            if (AdminPanelAction::canAdmin('site')) {
+                // TRANS: Menu item title/tooltip
+                $menu_title = _('Basic site configuration');
+                // TRANS: Menu item for site administration
+                $this->out->menuItem(common_local_url('siteadminpanel'), _m('MENU', 'Site'),
+                                     $menu_title, $action_name == 'siteadminpanel', 'nav_site_admin_panel');
             }
 
-            if ($this->canAdmin('design')) {
-                $this->out->menuItem(common_local_url('designadminpanel'), _('Design'),
-                                     _('Design configuration'), $action_name == 'designadminpanel', 'nav_design_admin_panel');
+            if (AdminPanelAction::canAdmin('design')) {
+                // TRANS: Menu item title/tooltip
+                $menu_title = _('Design configuration');
+                // TRANS: Menu item for site administration
+                $this->out->menuItem(common_local_url('designadminpanel'), _m('MENU', 'Design'),
+                                     $menu_title, $action_name == 'designadminpanel', 'nav_design_admin_panel');
             }
 
-            if ($this->canAdmin('user')) {
-                $this->out->menuItem(common_local_url('useradminpanel'), _('User'),
-                                     _('User configuration'), $action_name == 'useradminpanel', 'nav_design_admin_panel');
+            if (AdminPanelAction::canAdmin('user')) {
+                // TRANS: Menu item title/tooltip
+                $menu_title = _('User configuration');
+                // TRANS: Menu item for site administration
+                $this->out->menuItem(common_local_url('useradminpanel'), _m('MENU', 'User'),
+                                     $menu_title, $action_name == 'useradminpanel', 'nav_design_admin_panel');
             }
 
-            if ($this->canAdmin('access')) {
-                $this->out->menuItem(common_local_url('accessadminpanel'), _('Access'),
-                                     _('Access configuration'), $action_name == 'accessadminpanel', 'nav_design_admin_panel');
+            if (AdminPanelAction::canAdmin('access')) {
+                // TRANS: Menu item title/tooltip
+                $menu_title = _('Access configuration');
+                // TRANS: Menu item for site administration
+                $this->out->menuItem(common_local_url('accessadminpanel'), _m('MENU', 'Access'),
+                                     $menu_title, $action_name == 'accessadminpanel', 'nav_design_admin_panel');
             }
 
-            if ($this->canAdmin('paths')) {
-                $this->out->menuItem(common_local_url('pathsadminpanel'), _('Paths'),
-                                    _('Paths configuration'), $action_name == 'pathsadminpanel', 'nav_design_admin_panel');
+            if (AdminPanelAction::canAdmin('paths')) {
+                // TRANS: Menu item title/tooltip
+                $menu_title = _('Paths configuration');
+                // TRANS: Menu item for site administration
+                $this->out->menuItem(common_local_url('pathsadminpanel'), _m('MENU', 'Paths'),
+                                    $menu_title, $action_name == 'pathsadminpanel', 'nav_design_admin_panel');
             }
 
-            if ($this->canAdmin('sessions')) {
-                $this->out->menuItem(common_local_url('sessionsadminpanel'), _('Sessions'),
-                                     _('Sessions configuration'), $action_name == 'sessionsadminpanel', 'nav_design_admin_panel');
+            if (AdminPanelAction::canAdmin('sessions')) {
+                // TRANS: Menu item title/tooltip
+                $menu_title = _('Sessions configuration');
+                // TRANS: Menu item for site administration
+                $this->out->menuItem(common_local_url('sessionsadminpanel'), _m('MENU', 'Sessions'),
+                                     $menu_title, $action_name == 'sessionsadminpanel', 'nav_design_admin_panel');
             }
 
             Event::handle('EndAdminPanelNav', array($this));
@@ -342,8 +378,4 @@ class AdminPanelNav extends Widget
         $this->action->elementEnd('ul');
     }
 
-    function canAdmin($name)
-    {
-        return in_array($name, common_config('admin', 'panels'));
-    }
 }
diff --git a/lib/api.php b/lib/apiaction.php
index 9000fb4ba..eef0ba637 100644
--- a/lib/api.php
+++ b/lib/apiaction.php
@@ -63,7 +63,6 @@ class ApiAction extends Action
     var $count     = null;
     var $max_id    = null;
     var $since_id  = null;
-    var $since     = null;
 
     var $access    = self::READ_ONLY;  // read (default) or read-write
 
@@ -85,7 +84,10 @@ class ApiAction extends Action
         $this->count    = (int)$this->arg('count', 20);
         $this->max_id   = (int)$this->arg('max_id', 0);
         $this->since_id = (int)$this->arg('since_id', 0);
-        $this->since    = $this->arg('since');
+
+        if ($this->arg('since')) {
+            $this->clientError(_("since parameter is disabled for performance; use since_id"), 403);
+        }
 
         return true;
     }
@@ -359,7 +361,7 @@ class ApiAction extends Action
         $entry['link'] = common_local_url('shownotice', array('notice' => $notice->id));
         $entry['published'] = common_date_iso8601($notice->created);
 
-        $taguribase = common_config('integration', 'taguri');
+        $taguribase = TagURI::base();
         $entry['id'] = "tag:$taguribase:$entry[link]";
 
         $entry['updated'] = $entry['published'];
@@ -803,7 +805,7 @@ class ApiAction extends Action
         $entry['link'] = common_local_url('showmessage', array('message' => $message->id));
         $entry['published'] = common_date_iso8601($message->created);
 
-        $taguribase = common_config('integration', 'taguri');
+        $taguribase = TagURI::base();
 
         $entry['id'] = "tag:$taguribase:$entry[link]";
         $entry['updated'] = $entry['published'];
@@ -1219,7 +1221,12 @@ class ApiAction extends Action
                 return User_group::staticGet($this->arg('id'));
             } else if ($this->arg('id')) {
                 $nickname = common_canonical_nickname($this->arg('id'));
-                return User_group::staticGet('nickname', $nickname);
+                $local = Local_group::staticGet('nickname', $nickname);
+                if (empty($local)) {
+                    return null;
+                } else {
+                    return User_group::staticGet('id', $local->id);
+                }
             } else if ($this->arg('group_id')) {
                 // This is to ensure that a non-numeric user_id still
                 // overrides screen_name even if it doesn't get used
@@ -1228,14 +1235,24 @@ class ApiAction extends Action
                 }
             } else if ($this->arg('group_name')) {
                 $nickname = common_canonical_nickname($this->arg('group_name'));
-                return User_group::staticGet('nickname', $nickname);
+                $local = Local_group::staticGet('nickname', $nickname);
+                if (empty($local)) {
+                    return null;
+                } else {
+                    return User_group::staticGet('id', $local->id);
+                }
             }
 
         } else if (is_numeric($id)) {
             return User_group::staticGet($id);
         } else {
             $nickname = common_canonical_nickname($id);
-            return User_group::staticGet('nickname', $nickname);
+            $local = Local_group::staticGet('nickname', $nickname);
+            if (empty($local)) {
+                return null;
+            } else {
+                return User_group::staticGet('id', $local->group_id);
+            }
         }
     }
 
@@ -1311,8 +1328,6 @@ class ApiAction extends Action
             case 'max_id':
                 $max_id = (int)$this->args['max_id'];
                 return ($max_id < 1) ? 0 : $max_id;
-            case 'since':
-                return strtotime($this->args['since']);
             default:
                 return parent::arg($key, $def);
             }
diff --git a/lib/apiauth.php b/lib/apiauth.php
index 25e2196cf..5090871cf 100644
--- a/lib/apiauth.php
+++ b/lib/apiauth.php
@@ -38,7 +38,6 @@ if (!defined('STATUSNET')) {
     exit(1);
 }
 
-require_once INSTALLDIR . '/lib/api.php';
 require_once INSTALLDIR . '/lib/apioauth.php';
 
 /**
diff --git a/lib/atom10entry.php b/lib/atom10entry.php
index 5710c80fc..f8f16d594 100644
--- a/lib/atom10entry.php
+++ b/lib/atom10entry.php
@@ -27,8 +27,7 @@
  * @link      http://status.net/
  */
 
-if (!defined('STATUSNET')
-{
+if (!defined('STATUSNET')) {
     exit(1);
 }
 
@@ -87,7 +86,7 @@ class Atom10Entry extends XMLStringer
      *
      * @return void
      */
-    function validate
+    function validate()
     {
 
     }
diff --git a/lib/atom10feed.php b/lib/atom10feed.php
index 14a3beb83..8842840d5 100644
--- a/lib/atom10feed.php
+++ b/lib/atom10feed.php
@@ -78,7 +78,7 @@ class Atom10Feed extends XMLStringer
         $this->authors    = array();
         $this->links      = array();
         $this->entries    = array();
-        $this->addNamespace('xmlns', 'http://www.w3.org/2005/Atom');
+        $this->addNamespace('', 'http://www.w3.org/2005/Atom');
     }
 
     /**
@@ -109,11 +109,11 @@ class Atom10Feed extends XMLStringer
             );
         }
 
-        if (!is_null($uri)) {
+        if (isset($uri)) {
             $xs->element('uri', null, $uri);
         }
 
-        if (!is_null(email)) {
+        if (isset($email)) {
             $xs->element('email', null, $email);
         }
 
@@ -162,7 +162,14 @@ class Atom10Feed extends XMLStringer
     {
         $this->xw->startDocument('1.0', 'UTF-8');
         $commonAttrs = array('xml:lang' => 'en-US');
-        $commonAttrs = array_merge($commonAttrs, $this->namespaces);
+        foreach ($this->namespaces as $prefix => $uri) {
+            if ($prefix == '') {
+                $attr = 'xmlns';
+            } else {
+                $attr = 'xmlns:' . $prefix;
+            }
+            $commonAttrs[$attr] = $uri;
+        }
         $this->elementStart('feed', $commonAttrs);
 
         $this->element('id', null, $this->id);
diff --git a/lib/atomnoticefeed.php b/lib/atomnoticefeed.php
index b7a60bde6..3c3556cb9 100644
--- a/lib/atomnoticefeed.php
+++ b/lib/atomnoticefeed.php
@@ -50,23 +50,33 @@ class AtomNoticeFeed extends Atom10Feed
         // Feeds containing notice info use these namespaces
 
         $this->addNamespace(
-            'xmlns:thr',
+            'thr',
             'http://purl.org/syndication/thread/1.0'
         );
 
         $this->addNamespace(
-            'xmlns:georss',
+            'georss',
             'http://www.georss.org/georss'
         );
 
         $this->addNamespace(
-            'xmlns:activity',
+            'activity',
             'http://activitystrea.ms/spec/1.0/'
         );
 
+        $this->addNamespace(
+            'media',
+            'http://purl.org/syndication/atommedia'
+        );
+
+        $this->addNamespace(
+            'poco',
+            'http://portablecontacts.net/spec/1.0'
+        );
+
         // XXX: What should the uri be?
         $this->addNamespace(
-            'xmlns:ostatus',
+            'ostatus',
             'http://ostatus.org/schema/1.0'
         );
     }
diff --git a/lib/atomusernoticefeed.php b/lib/atomusernoticefeed.php
index 9f224325c..2ad8de455 100644
--- a/lib/atomusernoticefeed.php
+++ b/lib/atomusernoticefeed.php
@@ -54,9 +54,14 @@ class AtomUserNoticeFeed extends AtomNoticeFeed
      *
      * @return void
      */
+
     function __construct($user = null, $indent = true) {
         parent::__construct($indent);
         $this->user = $user;
+        if (!empty($user)) {
+            $profile = $user->getProfile();
+            $this->addAuthor($profile->nickname, $user->uri);
+        }
     }
 
     function getUser()
diff --git a/lib/authenticationplugin.php b/lib/authenticationplugin.php
index 5be3ea5b9..0a3763e2e 100644
--- a/lib/authenticationplugin.php
+++ b/lib/authenticationplugin.php
@@ -79,7 +79,7 @@ abstract class AuthenticationPlugin extends Plugin
             $nickname = $username;
         }
         $registration_data = array();
-        $registration_data['nickname'] = $nickname ;
+        $registration_data['nickname'] = $nickname;
         return User::register($registration_data);
     }
 
@@ -101,12 +101,14 @@ abstract class AuthenticationPlugin extends Plugin
     * Used during autoregistration
     * Useful if your usernames are ugly, and you want to suggest
     * nice looking nicknames when users initially sign on
+    * All nicknames returned by this function should be valid
+    *  implementations may want to use common_nicknamize() to ensure validity
     * @param username
     * @return string nickname
     */
     function suggestNicknameForUsername($username)
     {
-        return $username;
+        return common_nicknamize($username);
     }
 
     //------------Below are the methods that connect StatusNet to the implementing Auth plugin------------\\
@@ -129,7 +131,7 @@ abstract class AuthenticationPlugin extends Plugin
             $test_user = User::staticGet('nickname', $suggested_nickname);
             if($test_user) {
                 //someone already exists with the suggested nickname, so used the passed nickname
-                $suggested_nickname = $nickname;
+                $suggested_nickname = common_nicknamize($nickname);
             }
             $test_user = User::staticGet('nickname', $suggested_nickname);
             if($test_user) {
diff --git a/lib/authorizationplugin.php b/lib/authorizationplugin.php
index 733b0c065..07da9b2d1 100644
--- a/lib/authorizationplugin.php
+++ b/lib/authorizationplugin.php
@@ -85,7 +85,7 @@ abstract class AuthorizationPlugin extends Plugin
     }
 
     function onStartSetApiUser(&$user) {
-        return $this->onStartSetUser(&$user);
+        return $this->onStartSetUser($user);
     }
 
     function onStartHasRole($profile, $name, &$has_role) {
diff --git a/lib/command.php b/lib/command.php
index 2a51fd687..db8e80030 100644
--- a/lib/command.php
+++ b/lib/command.php
@@ -548,12 +548,19 @@ class SubCommand extends Command
             return;
         }
 
-        $result = subs_subscribe_user($this->user, $this->other);
+        $otherUser = User::staticGet('nickname', $this->other);
 
-        if ($result == 'true') {
+        if (empty($otherUser)) {
+            $channel->error($this->user, _('No such user'));
+            return;
+        }
+
+        try {
+            Subscription::start($this->user->getProfile(),
+                                $otherUser->getProfile());
             $channel->output($this->user, sprintf(_('Subscribed to %s'), $this->other));
-        } else {
-            $channel->error($this->user, $result);
+        } catch (Exception $e) {
+            $channel->error($this->user, $e->getMessage());
         }
     }
 }
@@ -576,12 +583,18 @@ class UnsubCommand extends Command
             return;
         }
 
-        $result=subs_unsubscribe_user($this->user, $this->other);
+        $otherUser = User::staticGet('nickname', $this->other);
 
-        if ($result) {
+        if (empty($otherUser)) {
+            $channel->error($this->user, _('No such user'));
+        }
+
+        try {
+            Subscription::cancel($this->user->getProfile(),
+                                 $otherUser->getProfile());
             $channel->output($this->user, sprintf(_('Unsubscribed from %s'), $this->other));
-        } else {
-            $channel->error($this->user, $result);
+        } catch (Exception $e) {
+            $channel->error($this->user, $e->getMessage());
         }
     }
 }
@@ -655,6 +668,34 @@ class LoginCommand extends Command
     }
 }
 
+class LoseCommand extends Command
+{
+
+    var $other = null;
+
+    function __construct($user, $other)
+    {
+        parent::__construct($user);
+        $this->other = $other;
+    }
+
+    function execute($channel)
+    {
+        if(!$this->other) {
+            $channel->error($this->user, _('Specify the name of the user to unsubscribe from'));
+            return;
+        }
+
+        $result=subs_unsubscribe_from($this->user, $this->other);
+
+        if ($result) {
+            $channel->output($this->user, sprintf(_('Unsubscribed  %s'), $this->other));
+        } else {
+            $channel->error($this->user, $result);
+        }
+    }
+}
+
 class SubscriptionsCommand extends Command
 {
     function execute($channel)
@@ -737,6 +778,7 @@ class HelpCommand extends Command
                            "d <nickname> <text> - direct message to user\n".
                            "get <nickname> - get last notice from user\n".
                            "whois <nickname> - get profile info on user\n".
+                           "lose <nickname> - force user to stop following you\n".
                            "fav <nickname> - add user's last notice as a 'fave'\n".
                            "fav #<notice_id> - add notice with the given id as a 'fave'\n".
                            "repeat #<notice_id> - repeat a notice with a given id\n".
diff --git a/lib/commandinterpreter.php b/lib/commandinterpreter.php
index c2add7299..fbc6174bb 100644
--- a/lib/commandinterpreter.php
+++ b/lib/commandinterpreter.php
@@ -47,6 +47,17 @@ class CommandInterpreter
             } else {
                 return new LoginCommand($user);
             }
+         case 'lose':
+            if ($arg) {
+                list($other, $extra) = $this->split_arg($arg);
+                if ($extra) {
+                    return null;
+                } else {
+                    return new LoseCommand($user, $other);
+                }
+            } else {
+              return null;
+            }
          case 'subscribers':
             if ($arg) {
                 return null;
diff --git a/lib/common.php b/lib/common.php
index b95cd1175..6c01c7db4 100644
--- a/lib/common.php
+++ b/lib/common.php
@@ -22,7 +22,7 @@ if (!defined('STATUSNET') && !defined('LACONICA')) { exit(1); }
 //exit with 200 response, if this is checking fancy from the installer
 if (isset($_REQUEST['p']) && $_REQUEST['p'] == 'check-fancy') {  exit; }
 
-define('STATUSNET_VERSION', '0.9.0beta5');
+define('STATUSNET_VERSION', '0.9.0beta6+bugfix1');
 define('LACONICA_VERSION', STATUSNET_VERSION); // compatibility
 
 define('STATUSNET_CODENAME', 'Stand');
@@ -71,6 +71,7 @@ if (!function_exists('dl')) {
 # global configuration object
 
 require_once('PEAR.php');
+require_once('PEAR/Exception.php');
 require_once('DB/DataObject.php');
 require_once('DB/DataObject/Cast.php'); # for dates
 
@@ -123,10 +124,22 @@ require_once INSTALLDIR.'/lib/util.php';
 require_once INSTALLDIR.'/lib/action.php';
 require_once INSTALLDIR.'/lib/mail.php';
 require_once INSTALLDIR.'/lib/subs.php';
+require_once INSTALLDIR.'/lib/activity.php';
 
 require_once INSTALLDIR.'/lib/clientexception.php';
 require_once INSTALLDIR.'/lib/serverexception.php';
 
+
+//set PEAR error handling to use regular PHP exceptions
+function PEAR_ErrorToPEAR_Exception($err)
+{
+    if ($err->getCode()) {
+        throw new PEAR_Exception($err->getMessage(), $err->getCode());
+    }
+    throw new PEAR_Exception($err->getMessage());
+}
+PEAR::setErrorHandling(PEAR_ERROR_CALLBACK, 'PEAR_ErrorToPEAR_Exception');
+
 try {
     StatusNet::init(@$server, @$path, @$conffile);
 } catch (NoConfigException $e) {
diff --git a/lib/default.php b/lib/default.php
index 37eb6cafa..7b97c7dda 100644
--- a/lib/default.php
+++ b/lib/default.php
@@ -175,10 +175,10 @@ $default =
         array('enabled' => false),
         'integration' =>
         array('source' => 'StatusNet', # source attribute for Twitter
-              'taguri' => $_server.',2009'), # base for tag URIs
+              'taguri' => null), # base for tag URIs
         'twitter' =>
-        array('enabled'       => true,
-              'consumer_key'    => null,
+        array('signin' => true,
+              'consumer_key' => null,
               'consumer_secret' => null),
         'cache' =>
         array('base' => null),
@@ -278,9 +278,7 @@ $default =
                                  'TightUrl' => array('shortenerName' => '2tu.us', 'freeService' => true,'serviceUrl'=>'http://2tu.us/?save=y&url=%1$s'),
                                  'Geonames' => null,
                                  'Mapstraction' => null,
-                                 'Linkback' => null,
                                  'WikiHashtags' => null,
-                                 'PubSubHubBub' => null,
                                  'RSSCloud' => null,
                                  'OpenID' => null),
               ),
diff --git a/lib/distribqueuehandler.php b/lib/distribqueuehandler.php
index 4477468d0..d2be7a92c 100644
--- a/lib/distribqueuehandler.php
+++ b/lib/distribqueuehandler.php
@@ -63,31 +63,7 @@ class DistribQueueHandler
         // XXX: do we need to change this for remote users?
 
         try {
-            $notice->saveTags();
-        } catch (Exception $e) {
-            $this->logit($notice, $e);
-        }
-
-        try {
-            $groups = $notice->saveGroups();
-        } catch (Exception $e) {
-            $this->logit($notice, $e);
-        }
-
-        try {
-            $recipients = $notice->saveReplies();
-        } catch (Exception $e) {
-            $this->logit($notice, $e);
-        }
-
-        try {
-            $notice->addToInboxes($groups, $recipients);
-        } catch (Exception $e) {
-            $this->logit($notice, $e);
-        }
-
-        try {
-            $notice->saveUrls();
+            $notice->addToInboxes();
         } catch (Exception $e) {
             $this->logit($notice, $e);
         }
@@ -107,7 +83,7 @@ class DistribQueueHandler
 
         return true;
     }
-    
+
     protected function logit($notice, $e)
     {
         common_log(LOG_ERR, "Distrib queue exception saving notice $notice->id: " .
diff --git a/lib/imagefile.php b/lib/imagefile.php
index 6bc8e599b..7b0479455 100644
--- a/lib/imagefile.php
+++ b/lib/imagefile.php
@@ -99,6 +99,10 @@ class ImageFile
 
         if ($info[2] !== IMAGETYPE_GIF &&
             $info[2] !== IMAGETYPE_JPEG &&
+            $info[2] !== IMAGETYPE_BMP &&
+            $info[2] !== IMAGETYPE_WBMP &&
+            $info[2] !== IMAGETYPE_XBM &&
+            $info[2] !== IMAGETYPE_XPM &&
             $info[2] !== IMAGETYPE_PNG) {
 
             @unlink($_FILES[$param]['tmp_name']);
@@ -146,6 +150,18 @@ class ImageFile
          case IMAGETYPE_PNG:
             $image_src = imagecreatefrompng($this->filepath);
             break;
+         case IMAGETYPE_BMP:
+            $image_src = imagecreatefrombmp($this->filepath);
+            break;
+         case IMAGETYPE_WBMP:
+            $image_src = imagecreatefromwbmp($this->filepath);
+            break;
+         case IMAGETYPE_XBM:
+            $image_src = imagecreatefromxbm($this->filepath);
+            break;
+         case IMAGETYPE_XPM:
+            $image_src = imagecreatefromxpm($this->filepath);
+            break;
          default:
             throw new Exception(_('Unknown file type'));
             return;
@@ -153,7 +169,7 @@ class ImageFile
 
         $image_dest = imagecreatetruecolor($size, $size);
 
-        if ($this->type == IMAGETYPE_GIF || $this->type == IMAGETYPE_PNG) {
+        if ($this->type == IMAGETYPE_GIF || $this->type == IMAGETYPE_PNG || $this->type == IMAGETYPE_BMP) {
 
             $transparent_idx = imagecolortransparent($image_src);
 
@@ -176,6 +192,24 @@ class ImageFile
 
         imagecopyresampled($image_dest, $image_src, 0, 0, $x, $y, $size, $size, $w, $h);
 
+        if($this->type == IMAGETYPE_BMP) {
+            //we don't want to save BMP... it's an inefficient, rare, antiquated format
+            //save png instead
+            $this->type = IMAGETYPE_PNG;
+        } else if($this->type == IMAGETYPE_WBMP) {
+            //we don't want to save WBMP... it's a rare format that we can't guarantee clients will support
+            //save png instead
+            $this->type = IMAGETYPE_PNG;
+        } else if($this->type == IMAGETYPE_XBM) {
+            //we don't want to save XBM... it's a rare format that we can't guarantee clients will support
+            //save png instead
+            $this->type = IMAGETYPE_PNG;
+        } else if($this->type == IMAGETYPE_XPM) {
+            //we don't want to save XPM... it's a rare format that we can't guarantee clients will support
+            //save png instead
+            $this->type = IMAGETYPE_PNG;
+        }
+
         $outname = Avatar::filename($this->id,
                                     image_type_to_extension($this->type),
                                     $size,
@@ -245,4 +279,101 @@ class ImageFile
 
         return $num;
     }
-}
-\ No newline at end of file
+}
+
+//PHP doesn't (as of 2/24/2010) have an imagecreatefrombmp so conditionally define one
+if(!function_exists('imagecreatefrombmp')){
+    //taken shamelessly from http://www.php.net/manual/en/function.imagecreatefromwbmp.php#86214
+    function imagecreatefrombmp($p_sFile)
+    {
+        //    Load the image into a string
+        $file    =    fopen($p_sFile,"rb");
+        $read    =    fread($file,10);
+        while(!feof($file)&&($read<>""))
+            $read    .=    fread($file,1024);
+
+        $temp    =    unpack("H*",$read);
+        $hex    =    $temp[1];
+        $header    =    substr($hex,0,108);
+
+        //    Process the header
+        //    Structure: http://www.fastgraph.com/help/bmp_header_format.html
+        if (substr($header,0,4)=="424d")
+        {
+            //    Cut it in parts of 2 bytes
+            $header_parts    =    str_split($header,2);
+
+            //    Get the width        4 bytes
+            $width            =    hexdec($header_parts[19].$header_parts[18]);
+
+            //    Get the height        4 bytes
+            $height            =    hexdec($header_parts[23].$header_parts[22]);
+
+            //    Unset the header params
+            unset($header_parts);
+        }
+
+        //    Define starting X and Y
+        $x                =    0;
+        $y                =    1;
+
+        //    Create newimage
+        $image            =    imagecreatetruecolor($width,$height);
+
+        //    Grab the body from the image
+        $body            =    substr($hex,108);
+
+        //    Calculate if padding at the end-line is needed
+        //    Divided by two to keep overview.
+        //    1 byte = 2 HEX-chars
+        $body_size        =    (strlen($body)/2);
+        $header_size    =    ($width*$height);
+
+        //    Use end-line padding? Only when needed
+        $usePadding        =    ($body_size>($header_size*3)+4);
+
+        //    Using a for-loop with index-calculation instaid of str_split to avoid large memory consumption
+        //    Calculate the next DWORD-position in the body
+        for ($i=0;$i<$body_size;$i+=3)
+        {
+            //    Calculate line-ending and padding
+            if ($x>=$width)
+            {
+                //    If padding needed, ignore image-padding
+                //    Shift i to the ending of the current 32-bit-block
+                if ($usePadding)
+                    $i    +=    $width%4;
+
+                //    Reset horizontal position
+                $x    =    0;
+
+                //    Raise the height-position (bottom-up)
+                $y++;
+
+                //    Reached the image-height? Break the for-loop
+                if ($y>$height)
+                    break;
+            }
+
+            //    Calculation of the RGB-pixel (defined as BGR in image-data)
+            //    Define $i_pos as absolute position in the body
+            $i_pos    =    $i*2;
+            $r        =    hexdec($body[$i_pos+4].$body[$i_pos+5]);
+            $g        =    hexdec($body[$i_pos+2].$body[$i_pos+3]);
+            $b        =    hexdec($body[$i_pos].$body[$i_pos+1]);
+
+            //    Calculate and draw the pixel
+            $color    =    imagecolorallocate($image,$r,$g,$b);
+            imagesetpixel($image,$x,$height-$y,$color);
+
+            //    Raise the horizontal position
+            $x++;
+        }
+
+        //    Unset the body / free the memory
+        unset($body);
+
+        //    Return image-object
+        return $image;
+    }
+}
diff --git a/lib/joinform.php b/lib/joinform.php
index aefb553aa..aa8bc20e2 100644
--- a/lib/joinform.php
+++ b/lib/joinform.php
@@ -100,7 +100,7 @@ class JoinForm extends Form
     function action()
     {
         return common_local_url('joingroup',
-                                array('nickname' => $this->group->nickname));
+                                array('id' => $this->group->id));
     }
 
     /**
diff --git a/lib/leaveform.php b/lib/leaveform.php
index e63d96ee8..5469b5704 100644
--- a/lib/leaveform.php
+++ b/lib/leaveform.php
@@ -100,7 +100,7 @@ class LeaveForm extends Form
     function action()
     {
         return common_local_url('leavegroup',
-                                array('nickname' => $this->group->nickname));
+                                array('id' => $this->group->id));
     }
 
     /**
diff --git a/lib/mediafile.php b/lib/mediafile.php
index e3d5b1dbc..10d90d008 100644
--- a/lib/mediafile.php
+++ b/lib/mediafile.php
@@ -262,7 +262,7 @@ class MediaFile
             $filetype = MIME_Type::autoDetect($stream['uri']);
         }
 
-        if (in_array($filetype, common_config('attachments', 'supported'))) {
+        if (common_config('attachments', 'supported') === true || in_array($filetype, common_config('attachments', 'supported'))) {
             return $filetype;
         }
         $media = MIME_Type::getMedia($filetype);
diff --git a/lib/messageform.php b/lib/messageform.php
index 0c568e1bd..b116964da 100644
--- a/lib/messageform.php
+++ b/lib/messageform.php
@@ -175,6 +175,6 @@ class MessageForm extends Form
                                            'class' => 'submit',
                                            'name' => 'message_send',
                                            'type' => 'submit',
-                                           'value' => _('Send')));
+                                           'value' => _m('Send button for sending notice', 'Send')));
     }
 }
diff --git a/lib/noticeform.php b/lib/noticeform.php
index 62df5c941..7278c41a9 100644
--- a/lib/noticeform.php
+++ b/lib/noticeform.php
@@ -233,6 +233,6 @@ class NoticeForm extends Form
                                            'class' => 'submit',
                                            'name' => 'status_submit',
                                            'type' => 'submit',
-                                           'value' => _('Send')));
+                                           'value' => _m('Send button for sending notice', 'Send')));
     }
 }
diff --git a/lib/noticelist.php b/lib/noticelist.php
index 837cb90fa..88a925241 100644
--- a/lib/noticelist.php
+++ b/lib/noticelist.php
@@ -380,12 +380,12 @@ class NoticeListItem extends Widget
 
     function showNoticeLink()
     {
-        if($this->notice->is_local == Notice::LOCAL_PUBLIC || $this->notice->is_local == Notice::LOCAL_NONPUBLIC){
-            $noticeurl = common_local_url('shownotice',
-                                      array('notice' => $this->notice->id));
-        }else{
-            $noticeurl = $this->notice->uri;
-        }
+        $noticeurl = $this->notice->bestUrl();
+
+        // above should always return an URL
+
+        assert(!empty($noticeurl));
+
         $this->out->elementStart('a', array('rel' => 'bookmark',
                                             'class' => 'timestamp',
                                             'href' => $noticeurl));
@@ -438,14 +438,15 @@ class NoticeListItem extends Widget
         $this->out->text(_('at'));
         $this->out->text(' ');
         if (empty($url)) {
-            $this->out->element('span', array('class' => 'geo',
+            $this->out->element('abbr', array('class' => 'geo',
                                               'title' => $latlon),
                                 $name);
         } else {
-            $this->out->element('a', array('class' => 'geo',
-                                           'title' => $latlon,
-                                           'href' => $url),
+            $this->out->elementStart('a', array('href' => $url));
+            $this->out->element('abbr', array('class' => 'geo',
+                                              'title' => $latlon),
                                 $name);
+            $this->out->elementEnd('a');
         }
         $this->out->elementEnd('span');
     }
@@ -539,22 +540,40 @@ class NoticeListItem extends Widget
     function showContext()
     {
         $hasConversation = false;
-        if( !empty($this->notice->conversation)
-            && $this->notice->conversation != $this->notice->id){
-            $hasConversation = true;
-        }else{
-            $conversation = Notice::conversationStream($this->notice->id, 1, 1);
-            if($conversation->N > 0){
+        if (!empty($this->notice->conversation)) {
+            $conversation = Notice::conversationStream(
+                $this->notice->conversation,
+                1,
+                1
+            );
+            if ($conversation->N > 0) {
                 $hasConversation = true;
             }
         }
-        if ($hasConversation){
-            $this->out->text(' ');
-            $convurl = common_local_url('conversation',
-                                         array('id' => $this->notice->conversation));
-            $this->out->element('a', array('href' => $convurl.'#notice-'.$this->notice->id,
-                                           'class' => 'response'),
-                                _('in context'));
+        if ($hasConversation) {
+            $conv = Conversation::staticGet(
+                'id',
+                $this->notice->conversation
+            );
+            $convurl = $conv->uri;
+            if (!empty($convurl)) {
+                $this->out->text(' ');
+                $this->out->element(
+                    'a',
+                    array(
+                    'href' => $convurl.'#notice-'.$this->notice->id,
+                    'class' => 'response'),
+                    _('in context')
+                );
+            } else {
+                $msg = sprintf(
+                    "Couldn't find Conversation ID %d to make 'in context'"
+                    . "link for Notice ID %d",
+                    $this->notice->conversation,
+                    $this->notice->id
+                );
+                common_log(LOG_WARNING, $msg);
+            }
         }
     }
 
diff --git a/lib/oauthstore.php b/lib/oauthstore.php
index eabe37f9f..a6a6de750 100644
--- a/lib/oauthstore.php
+++ b/lib/oauthstore.php
@@ -390,7 +390,7 @@ class StatusNetOAuthDataStore extends OAuthDataStore
         $sub->subscribed = $user->id;
 
         if (!$sub->find(true)) {
-            return 0;
+            return array();
         }
 
         /* Since we do not use OMB_Service_Provider’s action methods, there
diff --git a/lib/omb.php b/lib/omb.php
index 0f38a4936..db60fa0ef 100644
--- a/lib/omb.php
+++ b/lib/omb.php
@@ -29,11 +29,9 @@ require_once 'Auth/Yadis/Yadis.php';
 
 function omb_oauth_consumer()
 {
-    static $con = null;
-    if (is_null($con)) {
-        $con = new OAuthConsumer(common_root_url(), '');
-    }
-    return $con;
+    // Don't try to make this static. Leads to issues in
+    // multi-site setups - Z
+    return new OAuthConsumer(common_root_url(), '');
 }
 
 function omb_oauth_server()
@@ -79,7 +77,7 @@ function omb_broadcast_notice($notice)
     /* Get remote users subscribed to this profile. */
     $rp = new Remote_profile();
 
-    $rp->query('SELECT postnoticeurl, token, secret ' .
+    $rp->query('SELECT remote_profile.*, secret, token ' .
                'FROM subscription JOIN remote_profile ' .
                'ON subscription.subscriber = remote_profile.id ' .
                'WHERE subscription.subscribed = ' . $notice->profile_id . ' ');
@@ -95,7 +93,8 @@ function omb_broadcast_notice($notice)
 
         /* Post notice. */
         $service = new StatusNet_OMB_Service_Consumer(
-                     array(OMB_ENDPOINT_POSTNOTICE => $rp->postnoticeurl));
+                     array(OMB_ENDPOINT_POSTNOTICE => $rp->postnoticeurl),
+                                                      $rp->uri);
         try {
             $service->setToken($rp->token, $rp->secret);
             $service->postNotice($omb_notice);
@@ -127,7 +126,7 @@ function omb_broadcast_profile($profile)
     /* Get remote users subscribed to this profile. */
     $rp = new Remote_profile();
 
-    $rp->query('SELECT updateprofileurl, token, secret ' .
+    $rp->query('SELECT remote_profile.*, secret, token ' .
                'FROM subscription JOIN remote_profile ' .
                'ON subscription.subscriber = remote_profile.id ' .
                'WHERE subscription.subscribed = ' . $profile->id . ' ');
@@ -143,7 +142,8 @@ function omb_broadcast_profile($profile)
 
         /* Update profile. */
         $service = new StatusNet_OMB_Service_Consumer(
-                     array(OMB_ENDPOINT_UPDATEPROFILE => $rp->updateprofileurl));
+                     array(OMB_ENDPOINT_UPDATEPROFILE => $rp->updateprofileurl),
+                                                      $rp->uri);
         try {
             $service->setToken($rp->token, $rp->secret);
             $service->updateProfile($omb_profile);
@@ -161,13 +161,14 @@ function omb_broadcast_profile($profile)
 }
 
 class StatusNet_OMB_Service_Consumer extends OMB_Service_Consumer {
-    public function __construct($urls)
+    public function __construct($urls, $listener_uri=null)
     {
         $this->services       = $urls;
         $this->datastore      = omb_oauth_datastore();
         $this->oauth_consumer = omb_oauth_consumer();
         $this->fetcher        = Auth_Yadis_Yadis::getHTTPFetcher();
         $this->fetcher->timeout = intval(common_config('omb', 'timeout'));
+        $this->listener_uri   = $listener_uri;
     }
 
 }
diff --git a/lib/profilelist.php b/lib/profilelist.php
index 693cd6449..4f1e84a6a 100644
--- a/lib/profilelist.php
+++ b/lib/profilelist.php
@@ -273,13 +273,18 @@ class ProfileListItem extends Widget
                 $usf = new UnsubscribeForm($this->out, $this->profile);
                 $usf->show();
             } else {
-                // Is it a local user? can't remote sub from a list
-                // XXX: make that possible!
                 $other = User::staticGet('id', $this->profile->id);
                 if (!empty($other)) {
                     $sf = new SubscribeForm($this->out, $this->profile);
                     $sf->show();
                 }
+                else {
+                    $url = common_local_url('remotesubscribe',
+                                            array('nickname' => $this->profile->nickname));
+                    $this->out->element('a', array('href' => $url,
+                                              'class' => 'entity_remote_subscribe'),
+                                   _('Subscribe'));
+                }
             }
             $this->out->elementEnd('li');
         }
diff --git a/lib/profilequeuehandler.php b/lib/profilequeuehandler.php
new file mode 100644
index 000000000..6ce93229b
--- /dev/null
+++ b/lib/profilequeuehandler.php
@@ -0,0 +1,52 @@
+<?php
+/*
+ * StatusNet - the distributed open-source microblogging tool
+ * Copyright (C) 2010, StatusNet, Inc.
+ *
+ * This program is free software: you can redistribute it and/or modify
+ * it under the terms of the GNU Affero General Public License as published by
+ * the Free Software Foundation, either version 3 of the License, or
+ * (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU Affero General Public License for more details.
+ *
+ * You should have received a copy of the GNU Affero General Public License
+ * along with this program.  If not, see <http://www.gnu.org/licenses/>.
+ */
+
+/**
+ * @package QueueHandler
+ * @maintainer Brion Vibber <brion@status.net>
+ */
+
+class ProfileQueueHandler extends QueueHandler
+{
+
+    function transport()
+    {
+        return 'profile';
+    }
+
+    function handle($profile)
+    {
+        if (!($profile instanceof Profile)) {
+            common_log(LOG_ERR, "Got a bogus profile, not broadcasting");
+            return true;
+        }
+
+        if (Event::handle('StartBroadcastProfile', array($profile))) {
+            require_once(INSTALLDIR.'/lib/omb.php');
+            try {
+                omb_broadcast_profile($profile);
+            } catch (Exception $e) {
+                common_log(LOG_ERR, "Failed sending OMB profiles: " . $e->getMessage());
+            }
+        }
+        Event::handle('EndBroadcastProfile', array($profile));
+        return true;
+    }
+
+}
diff --git a/lib/queuemanager.php b/lib/queuemanager.php
index 710829e49..87bd356aa 100644
--- a/lib/queuemanager.php
+++ b/lib/queuemanager.php
@@ -264,6 +264,9 @@ abstract class QueueManager extends IoManager
                 $this->connect('sms', 'SmsQueueHandler');
             }
 
+            // Broadcasting profile updates to OMB remote subscribers
+            $this->connect('profile', 'ProfileQueueHandler');
+
             // XMPP output handlers...
             if (common_config('xmpp', 'enabled')) {
                 // Delivery prep, read by queuedaemon.php:
diff --git a/lib/router.php b/lib/router.php
index 987d0152e..abbce041d 100644
--- a/lib/router.php
+++ b/lib/router.php
@@ -247,6 +247,9 @@ class Router
                 $m->connect('group/:nickname/'.$v,
                             array('action' => $v.'group'),
                             array('nickname' => '[a-zA-Z0-9]+'));
+                $m->connect('group/:id/id/'.$v,
+                            array('action' => $v.'group'),
+                            array('id' => '[0-9]+'));
             }
 
             foreach (array('members', 'logo', 'rss', 'designsettings') as $n) {
@@ -668,7 +671,7 @@ class Router
 
                 foreach (array('subscriptions', 'subscribers',
                                'all', 'foaf', 'xrds',
-                               'replies', 'microsummary') as $a) {
+                               'replies', 'microsummary', 'hcard') as $a) {
                     $m->connect($a,
                                 array('action' => $a,
                                       'nickname' => $nickname));
@@ -734,7 +737,7 @@ class Router
 
                 foreach (array('subscriptions', 'subscribers',
                                'nudge', 'all', 'foaf', 'xrds',
-                               'replies', 'inbox', 'outbox', 'microsummary') as $a) {
+                               'replies', 'inbox', 'outbox', 'microsummary', 'hcard') as $a) {
                     $m->connect(':nickname/'.$a,
                                 array('action' => $a),
                                 array('nickname' => '[a-zA-Z0-9]{1,64}'));
diff --git a/lib/subs.php b/lib/subs.php
index 5ac1a75a5..e2ce0667e 100644
--- a/lib/subs.php
+++ b/lib/subs.php
@@ -19,24 +19,6 @@
 
 if (!defined('STATUSNET') && !defined('LACONICA')) { exit(1); }
 
-require_once('XMPPHP/XMPP.php');
-
-/* Subscribe $user to nickname $other_nickname
-  Returns true or an error message.
-*/
-
-function subs_subscribe_user($user, $other_nickname)
-{
-
-    $other = User::staticGet('nickname', $other_nickname);
-
-    if (!$other) {
-        return _('No such user.');
-    }
-
-    return subs_subscribe_to($user, $other);
-}
-
 /* Subscribe user $user to other user $other.
  * Note: $other must be a local user, not a remote profile.
  * Because the other way is quite a bit more complicated.
@@ -44,111 +26,40 @@ function subs_subscribe_user($user, $other_nickname)
 
 function subs_subscribe_to($user, $other)
 {
-    if (!$user->hasRight(Right::SUBSCRIBE)) {
-        return _('You have been banned from subscribing.');
-    }
-
-    if ($user->isSubscribed($other)) {
-        return _('Already subscribed!');
-    }
-
-    if ($other->hasBlocked($user)) {
-        return _('User has blocked you.');
-    }
-
     try {
-        if (Event::handle('StartSubscribe', array($user, $other))) {
-
-            if (!$user->subscribeTo($other)) {
-                return _('Could not subscribe.');
-                return;
-            }
-
-            subs_notify($other, $user);
-
-            $cache = common_memcache();
-
-            if ($cache) {
-                $cache->delete(common_cache_key('user:notices_with_friends:' . $user->id));
-            }
-
-            $profile = $user->getProfile();
-
-            $profile->blowSubscriptionsCount();
-            $other->blowSubscribersCount();
-
-            if ($other->autosubscribe && !$other->isSubscribed($user) && !$user->hasBlocked($other)) {
-                if (!$other->subscribeTo($user)) {
-                    return _('Could not subscribe other to you.');
-                }
-                $cache = common_memcache();
-
-                if ($cache) {
-                    $cache->delete(common_cache_key('user:notices_with_friends:' . $other->id));
-                }
-
-                subs_notify($user, $other);
-            }
-
-            Event::handle('EndSubscribe', array($user, $other));
-        }
+        Subscription::start($user->getProfile(), $other);
+        return true;
     } catch (Exception $e) {
         return $e->getMessage();
     }
-
-    return true;
-}
-
-function subs_notify($listenee, $listener)
-{
-    # XXX: add other notifications (Jabber, SMS) here
-    # XXX: queue this and handle it offline
-    # XXX: Whatever happens, do it in Twitter-like API, too
-    subs_notify_email($listenee, $listener);
 }
 
-function subs_notify_email($listenee, $listener)
-{
-    mail_subscribe_notify($listenee, $listener);
-}
-
-/* Unsubscribe $user from nickname $other_nickname
-  Returns true or an error message.
-*/
-
-function subs_unsubscribe_user($user, $other_nickname)
-{
-
-    $other = User::staticGet('nickname', $other_nickname);
-
-    if (!$other) {
-        return _('No such user.');
-    }
-
-    return subs_unsubscribe_to($user, $other->getProfile());
-}
-
-/* Unsubscribe user $user from profile $other
- * NB: other can be a remote user. */
-
 function subs_unsubscribe_to($user, $other)
 {
-    if (!$user->isSubscribed($other))
-        return _('Not subscribed!');
-
-    // Don't allow deleting self subs
-
-    if ($user->id == $other->id) {
-        return _('Couldn\'t delete self-subscription.');
+    try {
+        Subscription::cancel($user->getProfile(), $other);
+        return true;
+    } catch (Exception $e) {
+        return $e->getMessage();
     }
+}
 
+function subs_unsubscribe_from($user, $other){
+   $local = User::staticGet("nickname",$other);
+   if($local){
+     return subs_unsubscribe_to($local,$user);
+   } else {
     try {
-        if (Event::handle('StartUnsubscribe', array($user, $other))) {
+        $remote = Profile::staticGet("nickname",$other);
+        if(is_string($remote)){
+          return $remote;
+        }
+        if (Event::handle('StartUnsubscribe', array($remote,$user))) {
 
             $sub = DB_DataObject::factory('subscription');
 
-            $sub->subscriber = $user->id;
-            $sub->subscribed = $other->id;
+            $sub->subscriber = $remote->id;
+            $sub->subscribed = $user->id;
 
             $sub->find(true);
 
@@ -160,20 +71,18 @@ function subs_unsubscribe_to($user, $other)
             $cache = common_memcache();
 
             if ($cache) {
-                $cache->delete(common_cache_key('user:notices_with_friends:' . $user->id));
+                $cache->delete(common_cache_key('user:notices_with_friends:' . $remote->id));
             }
 
-            $profile = $user->getProfile();
 
-            $profile->blowSubscriptionsCount();
-            $other->blowSubscribersCount();
+            $user->blowSubscribersCount();
+            $remote->blowSubscribersCount();
 
-            Event::handle('EndUnsubscribe', array($user, $other));
+            Event::handle('EndUnsubscribe', array($remote, $user));
         }
     } catch (Exception $e) {
         return $e->getMessage();
     }
-
-    return true;
+   }
 }
 
diff --git a/lib/taguri.php b/lib/taguri.php
new file mode 100644
index 000000000..d8398eded
--- /dev/null
+++ b/lib/taguri.php
@@ -0,0 +1,96 @@
+<?php
+/**
+ * StatusNet, the distributed open-source microblogging tool
+ *
+ * Utility for creating new tag: URIs
+ *
+ * PHP version 5
+ *
+ * LICENCE: This program is free software: you can redistribute it and/or modify
+ * it under the terms of the GNU Affero General Public License as published by
+ * the Free Software Foundation, either version 3 of the License, or
+ * (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU Affero General Public License for more details.
+ *
+ * You should have received a copy of the GNU Affero General Public License
+ * along with this program.  If not, see <http://www.gnu.org/licenses/>.
+ *
+ * @category  URI
+ * @package   StatusNet
+ * @author    Evan Prodromou <evan@status.net>
+ * @copyright 2010 StatusNet, Inc.
+ * @license   http://www.fsf.org/licensing/licenses/agpl-3.0.html AGPLv3
+ * @link      http://status.net/
+ */
+
+if (!defined('STATUSNET')) {
+    exit(1);
+}
+
+/**
+ * Mint tag: URIs
+ *
+ * tag: URIs are unique identifiers according to http://tools.ietf.org/html/rfc4151.
+ *
+ * We use them for creating URIs for things that can't be HTTP retrieved.
+ *
+ * @category URI
+ * @package  StatusNet
+ * @author   Evan Prodromou <evan@status.net>
+ * @license  http://www.fsf.org/licensing/licenses/agpl-3.0.html AGPLv3
+ * @link     http://status.net/
+ */
+
+class TagURI
+{
+    /**
+     * Return the base part of a tag URI
+     *
+     * Note: use mint() instead.
+     *
+     * @return string Tag URI base to use
+     */
+
+    static function base()
+    {
+        $base = common_config('integration', 'taguri');
+
+        if (empty($base)) {
+
+            $base = common_config('site', 'server').','.date('Y-m-d');
+
+            $pathPart = trim(common_config('site', 'path'), '/');
+
+            if (!empty($pathPart)) {
+                $base .= ':'.str_replace('/', ':', $pathPart);
+            }
+        }
+
+        return $base;
+    }
+
+    /**
+     * Make a new tag URI
+     *
+     * Builds the proper base and creates all the parts
+     *
+     * @return string minted URI
+     */
+
+    static function mint()
+    {
+        $base = self::base();
+
+        $args = func_get_args();
+
+        $format = array_shift($args);
+
+        $extra = vsprintf($format, $args);
+
+        return 'tag:'.$base.':'.$extra;
+    }
+}
diff --git a/lib/util.php b/lib/util.php
index ef7852953..add1b0ae6 100644
--- a/lib/util.php
+++ b/lib/util.php
@@ -134,7 +134,7 @@ function common_check_user($nickname, $password)
     $authenticatedUser = false;
 
     if (Event::handle('StartCheckPassword', array($nickname, $password, &$authenticatedUser))) {
-        $user = User::staticGet('nickname', $nickname);
+        $user = User::staticGet('nickname', common_canonical_nickname($nickname));
         if (!empty($user)) {
             if (!empty($password)) { // never allow login with blank password
                 if (0 == strcmp(common_munge_password($password, $user->id),
@@ -426,13 +426,187 @@ function common_render_content($text, $notice)
 {
     $r = common_render_text($text);
     $id = $notice->profile_id;
-    $r = preg_replace('/(^|\s+)@(['.NICKNAME_FMT.']{1,64})/e', "'\\1@'.common_at_link($id, '\\2')", $r);
-    $r = preg_replace('/^T ([A-Z0-9]{1,64}) /e', "'T '.common_at_link($id, '\\1').' '", $r);
-    $r = preg_replace('/(^|[\s\.\,\:\;]+)@#([A-Za-z0-9]{1,64})/e', "'\\1@#'.common_at_hash_link($id, '\\2')", $r);
+    $r = common_linkify_mentions($r, $notice);
     $r = preg_replace('/(^|[\s\.\,\:\;]+)!([A-Za-z0-9]{1,64})/e', "'\\1!'.common_group_link($id, '\\2')", $r);
     return $r;
 }
 
+function common_linkify_mentions($text, $notice)
+{
+    $mentions = common_find_mentions($text, $notice);
+
+    // We need to go through in reverse order by position,
+    // so our positions stay valid despite our fudging with the
+    // string!
+
+    $points = array();
+
+    foreach ($mentions as $mention)
+    {
+        $points[$mention['position']] = $mention;
+    }
+
+    krsort($points);
+
+    foreach ($points as $position => $mention) {
+
+        $linkText = common_linkify_mention($mention);
+
+        $text = substr_replace($text, $linkText, $position, mb_strlen($mention['text']));
+    }
+
+    return $text;
+}
+
+function common_linkify_mention($mention)
+{
+    $output = null;
+
+    if (Event::handle('StartLinkifyMention', array($mention, &$output))) {
+
+        $xs = new XMLStringer(false);
+
+        $attrs = array('href' => $mention['url'],
+                       'class' => 'url');
+
+        if (!empty($mention['title'])) {
+            $attrs['title'] = $mention['title'];
+        }
+
+        $xs->elementStart('span', 'vcard');
+        $xs->elementStart('a', $attrs);
+        $xs->element('span', 'fn nickname', $mention['text']);
+        $xs->elementEnd('a');
+        $xs->elementEnd('span');
+
+        $output = $xs->getString();
+
+        Event::handle('EndLinkifyMention', array($mention, &$output));
+    }
+
+    return $output;
+}
+
+function common_find_mentions($text, $notice)
+{
+    $mentions = array();
+
+    $sender = Profile::staticGet('id', $notice->profile_id);
+
+    if (empty($sender)) {
+        return $mentions;
+    }
+
+    if (Event::handle('StartFindMentions', array($sender, $text, &$mentions))) {
+
+        // Get the context of the original notice, if any
+
+        $originalAuthor   = null;
+        $originalNotice   = null;
+        $originalMentions = array();
+
+        // Is it a reply?
+
+        if (!empty($notice) && !empty($notice->reply_to)) {
+            $originalNotice = Notice::staticGet('id', $notice->reply_to);
+            if (!empty($originalNotice)) {
+                $originalAuthor = Profile::staticGet('id', $originalNotice->profile_id);
+
+                $ids = $originalNotice->getReplies();
+
+                foreach ($ids as $id) {
+                    $repliedTo = Profile::staticGet('id', $id);
+                    if (!empty($repliedTo)) {
+                        $originalMentions[$repliedTo->nickname] = $repliedTo;
+                    }
+                }
+            }
+        }
+
+        preg_match_all('/^T ([A-Z0-9]{1,64}) /',
+                       $text,
+                       $tmatches,
+                       PREG_OFFSET_CAPTURE);
+
+        preg_match_all('/(?:^|\s+)@(['.NICKNAME_FMT.']{1,64})/',
+                       $text,
+                       $atmatches,
+                       PREG_OFFSET_CAPTURE);
+
+        $matches = array_merge($tmatches[1], $atmatches[1]);
+
+        foreach ($matches as $match) {
+
+            $nickname = common_canonical_nickname($match[0]);
+
+            // Try to get a profile for this nickname.
+            // Start with conversation context, then go to
+            // sender context.
+
+            if (!empty($originalAuthor) && $originalAuthor->nickname == $nickname) {
+
+                $mentioned = $originalAuthor;
+
+            } else if (!empty($originalMentions) &&
+                       array_key_exists($nickname, $originalMentions)) {
+
+                $mentioned = $originalMentions[$nickname];
+            } else {
+                $mentioned = common_relative_profile($sender, $nickname);
+            }
+
+            if (!empty($mentioned)) {
+
+                $user = User::staticGet('id', $mentioned->id);
+
+                if ($user) {
+                    $url = common_local_url('userbyid', array('id' => $user->id));
+                } else {
+                    $url = $mentioned->profileurl;
+                }
+
+                $mention = array('mentioned' => array($mentioned),
+                                 'text' => $match[0],
+                                 'position' => $match[1],
+                                 'url' => $url);
+
+                if (!empty($mentioned->fullname)) {
+                    $mention['title'] = $mentioned->fullname;
+                }
+
+                $mentions[] = $mention;
+            }
+        }
+
+        // @#tag => mention of all subscriptions tagged 'tag'
+
+        preg_match_all('/(?:^|[\s\.\,\:\;]+)@#([\pL\pN_\-\.]{1,64})/',
+                       $text,
+                       $hmatches,
+                       PREG_OFFSET_CAPTURE);
+
+        foreach ($hmatches[1] as $hmatch) {
+
+            $tag = common_canonical_tag($hmatch[0]);
+
+            $tagged = Profile_tag::getTagged($sender->id, $tag);
+
+            $url = common_local_url('subscriptions',
+                                    array('nickname' => $sender->nickname,
+                                          'tag' => $tag));
+
+            $mentions[] = array('mentioned' => $tagged,
+                                'text' => $hmatch[0],
+                                'position' => $hmatch[1],
+                                'url' => $url);
+        }
+
+        Event::handle('EndFindMentions', array($sender, $text, &$mentions));
+    }
+
+    return $mentions;
+}
+
 function common_render_text($text)
 {
     $r = htmlspecialchars($text);
@@ -628,8 +802,28 @@ function common_shorten_links($text)
 
 function common_xml_safe_str($str)
 {
-    // Neutralize control codes and surrogates
-	return preg_replace('/[\p{Cc}\p{Cs}]/u', '*', $str);
+    // Replace common eol and extra whitespace input chars
+    $unWelcome = array(
+        "\t",  // tab
+        "\n",  // newline
+        "\r",  // cr
+        "\0",  // null byte eos
+        "\x0B" // vertical tab
+    );
+
+    $replacement = array(
+        ' ', // single space
+        ' ',
+        '',  // nothing
+        '',
+        ' '
+    );
+
+    $str = str_replace($unWelcome, $replacement, $str);
+
+    // Neutralize any additional control codes and UTF-16 surrogates
+    // (Twitter uses '*')
+    return preg_replace('/[\p{Cc}\p{Cs}]/u', '*', $str);
 }
 
 function common_tag_link($tag)
@@ -656,37 +850,6 @@ function common_valid_profile_tag($str)
     return preg_match('/^[A-Za-z0-9_\-\.]{1,64}$/', $str);
 }
 
-function common_at_link($sender_id, $nickname)
-{
-    $sender = Profile::staticGet($sender_id);
-    if (!$sender) {
-        return $nickname;
-    }
-    $recipient = common_relative_profile($sender, common_canonical_nickname($nickname));
-    if ($recipient) {
-        $user = User::staticGet('id', $recipient->id);
-        if ($user) {
-            $url = common_local_url('userbyid', array('id' => $user->id));
-        } else {
-            $url = $recipient->profileurl;
-        }
-        $xs = new XMLStringer(false);
-        $attrs = array('href' => $url,
-                       'class' => 'url');
-        if (!empty($recipient->fullname)) {
-            $attrs['title'] = $recipient->fullname . ' (' . $recipient->nickname . ')';
-        }
-        $xs->elementStart('span', 'vcard');
-        $xs->elementStart('a', $attrs);
-        $xs->element('span', 'fn nickname', $nickname);
-        $xs->elementEnd('a');
-        $xs->elementEnd('span');
-        return $xs->getString();
-    } else {
-        return $nickname;
-    }
-}
-
 function common_group_link($sender_id, $nickname)
 {
     $sender = Profile::staticGet($sender_id);
@@ -709,29 +872,6 @@ function common_group_link($sender_id, $nickname)
     }
 }
 
-function common_at_hash_link($sender_id, $tag)
-{
-    $user = User::staticGet($sender_id);
-    if (!$user) {
-        return $tag;
-    }
-    $tagged = Profile_tag::getTagged($user->id, common_canonical_tag($tag));
-    if ($tagged) {
-        $url = common_local_url('subscriptions',
-                                array('nickname' => $user->nickname,
-                                      'tag' => $tag));
-        $xs = new XMLStringer();
-        $xs->elementStart('span', 'tag');
-        $xs->element('a', array('href' => $url,
-                                'rel' => $tag),
-                     $tag);
-        $xs->elementEnd('span');
-        return $xs->getString();
-    } else {
-        return $tag;
-    }
-}
-
 function common_relative_profile($sender, $nickname, $dt=null)
 {
     // Try to find profiles this profile is subscribed to that have this nickname
@@ -768,7 +908,7 @@ function common_relative_profile($sender, $nickname, $dt=null)
     return null;
 }
 
-function common_local_url($action, $args=null, $params=null, $fragment=null)
+function common_local_url($action, $args=null, $params=null, $fragment=null, $addSession=true)
 {
     $r = Router::get();
     $path = $r->build($action, $args, $params, $fragment);
@@ -776,12 +916,12 @@ function common_local_url($action, $args=null, $params=null, $fragment=null)
     $ssl = common_is_sensitive($action);
 
     if (common_config('site','fancy')) {
-        $url = common_path(mb_substr($path, 1), $ssl);
+        $url = common_path(mb_substr($path, 1), $ssl, $addSession);
     } else {
         if (mb_strpos($path, '/index.php') === 0) {
-            $url = common_path(mb_substr($path, 1), $ssl);
+            $url = common_path(mb_substr($path, 1), $ssl, $addSession);
         } else {
-            $url = common_path('index.php'.$path, $ssl);
+            $url = common_path('index.php'.$path, $ssl, $addSession);
         }
     }
     return $url;
@@ -800,7 +940,7 @@ function common_is_sensitive($action)
     return $ssl;
 }
 
-function common_path($relative, $ssl=false)
+function common_path($relative, $ssl=false, $addSession=true)
 {
     $pathpart = (common_config('site', 'path')) ? common_config('site', 'path')."/" : '';
 
@@ -824,7 +964,9 @@ function common_path($relative, $ssl=false)
         }
     }
 
-    $relative = common_inject_session($relative, $serverpart);
+    if ($addSession) {
+        $relative = common_inject_session($relative, $serverpart);
+    }
 
     return $proto.'://'.$serverpart.'/'.$pathpart.$relative;
 }
@@ -1031,25 +1173,30 @@ function common_enqueue_notice($notice)
     return true;
 }
 
-function common_broadcast_profile($profile)
+/**
+ * Broadcast profile updates to OMB and other remote subscribers.
+ *
+ * Since this may be slow with a lot of subscribers or bad remote sites,
+ * this is run through the background queues if possible.
+ */
+function common_broadcast_profile(Profile $profile)
 {
-    // XXX: optionally use a queue system like http://code.google.com/p/microapps/wiki/NQDQ
-    require_once(INSTALLDIR.'/lib/omb.php');
-    omb_broadcast_profile($profile);
-    // XXX: Other broadcasts...?
+    $qm = QueueManager::get();
+    $qm->enqueue($profile, "profile");
     return true;
 }
 
 function common_profile_url($nickname)
 {
-    return common_local_url('showstream', array('nickname' => $nickname));
+    return common_local_url('showstream', array('nickname' => $nickname),
+                            null, null, false);
 }
 
 // Should make up a reasonable root URL
 
 function common_root_url($ssl=false)
 {
-    $url = common_path('', $ssl);
+    $url = common_path('', $ssl, false);
     $i = strpos($url, '?');
     if ($i !== false) {
         $url = substr($url, 0, $i);
@@ -1334,7 +1481,8 @@ function common_remove_magic_from_request()
 
 function common_user_uri(&$user)
 {
-    return common_local_url('userbyid', array('id' => $user->id));
+    return common_local_url('userbyid', array('id' => $user->id),
+                            null, null, false);
 }
 
 function common_notice_uri(&$notice)
@@ -1514,6 +1662,7 @@ function common_database_tablename($tablename)
  */
 function common_shorten_url($long_url)
 {
+    $long_url = trim($long_url);
     $user = common_current_user();
     if (empty($user)) {
         // common current user does not find a user when called from the XMPP daemon
@@ -1528,7 +1677,7 @@ function common_shorten_url($long_url)
         return $long_url;
     }else{
         //URL was shortened, so return the result
-        return $shortenedUrl;
+        return trim($shortenedUrl);
     }
 }
 
@@ -1605,7 +1754,8 @@ function common_url_to_nickname($url)
             # Strip starting, ending slashes
             $path = preg_replace('@/$@', '', $parts['path']);
             $path = preg_replace('@^/@', '', $path);
-            if (strpos($path, '/') === false) {
+            $path = basename($path);
+            if ($path) {
                 return common_nicknamize($path);
             }
         }
author	Brion Vibber <brion@pobox.com>	2010-03-02 15:16:48 -0800
committer	Brion Vibber <brion@pobox.com>	2010-03-02 15:16:48 -0800
commit	8e06b932af93b8fbd66610c948bdde4fafd4f300 (patch)
tree	07b772b280e6f23761c0111d953b3c2f5b8d2120 /lib
parent	453ad6a9964fe572f0f35821e3f78c6a77c57c49 (diff)
parent	ddf3614c843bcd8d9ecfd0850ac9a8cefae6dbba (diff)